Which part of an atom has a neutral or no charge?

The current passing through the electrolytic cell is approximately 2.02 x 10^4 Amperes.

To calculate the current in amperes, we need to use Faraday's laws of electrolysis and the stoichiometry of the reaction.

Faraday's laws state that the amount of substance produced or consumed during electrolysis is directly proportional to the quantity of electricity passed through the cell. The relationship is given by:

Q = nF

Where Q is the electric charge in coulombs (C), n is the number of moles of substance involved in the reaction, and F is Faraday's constant, which is equal to 96,485 C/mol.

In this case, the substance being produced is Cl2, and we know the mass of Cl2 produced, which is 4.8 x 10^5 g.

First, we need to calculate the number of moles of Cl2 produced:

Molar mass of Cl2 = 35.45 g/mol

Moles of Cl2 = mass / molar mass = (4.8 x 10^5 g) / (35.45 g/mol) ≈ 1.354 x 10^4 mol

Now we can calculate the quantity of electricity passed through the cell using Faraday's laws:

Q = nF

Q = (\(1.354 x 10^4\)mol) * (96,485 C/mol)

Q ≈ 1.308 x 10^9 C

The quantity of electricity is given in coulombs. To find the current, we need to divide this value by the time in seconds.

Given that the time is 18 hours, we convert it to seconds:

Time = 18 hours * 60 minutes/hour * 60 seconds/minute

Time = 6.48 x 10^4 seconds

Finally, we can calculate the current:

Current (I) = Q / Time

I = (1.308 x 10^9 C) / (6.48 x 10^4 s)

I ≈ 2.02 x 10^4 Amperes

Therefore, the current passing through the electrolytic cell is approximately 2.02 x 10^4 Amperes.

for more such question on electrolytic visit

https://brainly.com/question/17089766

#SPJ8

The empirical formula of the compound is C₂H₁₆S₂N₃O.

The moles of each element is as follows::

For CO₂:

Carbon (C) has a molar mass of 12.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of C in CO₂ = 2.08 g / 12.01 g/mol = 0.173 moles

Moles of O in CO₂ = 2.08 g / 16.00 g/mol = 0.130 moles

For H₂O:

Hydrogen (H) has a molar mass of 1.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of H in H₂O = 1.28 g / 1.01 g/mol = 1.27 moles

Moles of O in H₂O = 1.28 g / 16.00 g/mol = 0.080 moles

For SO₃:

Sulfur (S) has a molar mass of 32.06 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of S in SO₃ = 4.77 g / 32.06 g/mol = 0.149 moles

Moles of O in SO₃ = 4.77 g / 16.00 g/mol = 0.298 moles

For HNO₃:

Hydrogen (H) has a molar mass of 1.01 g/mol.

Nitrogen (N) has a molar mass of 14.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of H in HNO₃ = 3.48 g / 1.01 g/mol = 3.45 moles

Moles of N in HNO₃ = 3.48 g / 14.01 g/mol = 0.248 moles

Moles of O in HNO₃ = 3.48 g / 16.00 g/mol = 0.217 moles

The simplest whole-number ratio of the elements will be:

Carbon: 0.173 moles / 0.080 moles ≈ 2.16

Hydrogen: 1.27 moles / 0.080 moles ≈ 15.88

Sulfur: 0.149 moles / 0.080 moles ≈ 1.86

Nitrogen: 0.248 moles / 0.080 moles ≈ 3.10

Oxygen: 0.080 moles / 0.080 moles = 1

Therefore, the empirical formula is C₂H₁₆S₂N₃O.

Learn more about empirical formulas at: https://brainly.com/question/1603500

#SPJ1

We can see that an atom with 14 protons, 14 neutrons, and 16 electrons is unstable, and has a -2 charge.

So the correct option is the third one.

An atom with 14 protons, 14 neutrons, and 16 electrons is not stable. The number of protons in an atom, also known as its atomic number, determines its element and its chemical properties. In this case, the atom has 14 protons, which corresponds to the element silicon (Si) on the periodic table.

For an atom to be stable, it should have a balanced number of protons and electrons. Electrons are negatively charged particles that orbit the nucleus of an atom in energy levels or electron shells. The number of electrons in a stable atom should be equal to the number of protons, resulting in a neutral charge overall.

In this case, the atom has 14 protons and 16 electrons, which means it has two more electrons than protons, resulting in a net charge of -2. This is an example of an ion.

Learn more about atoms.

https://brainly.com/question/17425565

#SPJ1

Answer:

.4 moles

Explanation:

this is if it's 35 grams

The first liquid (milk) that comes out of a woman's breast after delivery is called \(\sf\purple{colostrum}\).

\(\large\mathfrak{{\pmb{\underline{\orange{Happy\:learning }}{\orange{!}}}}}\)

Answer:

Meets the current and future basic resource needs of its people in a just and equitable manner without compromising the ability of future generations.

Explanation:

Answer:

The density of the nugget is  19.3g/cm³  

It is gold because all samples of gold will have the same density value

You should buy it.

Explanation:

Given parameters:

Density of gold  = 19.3g/cm³

Length on all sides  = 5cm

Mass in kg  = 2.413kg

Unknown:

Density = ?

Is it gold = ?

Should you buy it = ?

Solution:

To solve this problem, we need to find the density of the nugget first.

   Density  = \(\frac{mass}{volume}\)  

  Mass  = 2.413kg

         We need to convert to g:

                 1kg  = 1000g

              2.413kg  = 2413g

 Volume  = L³ = 5³   = 125cm³  

Therefore;

      Density  = \(\frac{2413}{125}\)   = 19.3g/cm³  

The density of the nugget is  19.3g/cm³  

It is gold because all samples of gold will have the same density value

You should buy it.

The balanced redox reaction in the chemical reaction is given below:

40H2S + 48H+ + 16MnO4¯ ---> 5S8 + 16Mn2+ + 64H2O

Balancing the redox reaction:

Solution:

1) Half-reactions:

H2S ---> S8

MnO4¯ ---> Mn2+

2) Balance:

8H2S ---> S8 + 16H+ + 16e¯

5e¯ + 8H+ + MnO4¯ ---> Mn2+ + 4H2O

3) Make the number of electrons equal (note that there are no common factors between 5 and 16 except 1):

40H2S ---> 5S8 + 80H+ + 80e¯ <--- factor of 5

80e¯ + 128H+ + 16MnO4¯ ---> 16Mn2+ + 64H2O <---

factor of 16

4) Thus, the final answer is given below;

40H2S + 48H+ + 16MnO4¯ ---> 5S8 + 16Mn2+ + 64H2O

Oxidation-reduction can simply be defined as a special type of chemical reaction in which the oxidation states of the substrate change.

So therefore, the balanced redox reaction in the chemical reaction is given below:

40H2S + 48H+ + 16MnO4¯ ---> 5S8 + 16Mn2+ + 64H2O

Complete question:

Balance the following redox reaction:

MnO4¯ + H2S ---> Mn2+ + S8

Learn more about oxidation-reduction:

https://brainly.com/question/21851295

#SPJ1

A thermochemical equation can be written by expressing the heat evolved or absorbed in terms of the enthalpy change ΔH. Here ΔH for the following reaction +88.2 kJ. The correct option is A.

A chemical equation which indicates the heat change occuring during the reaction is defined as the thermochemical equation. In thermochemical equations, physical states of the reactants and products should be specified.

Here the given reaction 4 AlCl₃ (s) + 3 O₂ (g) ⇒ 2 Al₂O₃ (s) + 6 Cl₂ (g) is reversed as 1 /3 Al₂O₃ (s) + Cl₂ (g) ⇒ 2/3 AlCl₃ (s) + 1/2 O₂ (g) and multiplied by 1/6.

So the new enthalpy is +88.16 ≈ 88.2 kJ

Thus the correct option is A.

To know more about thermochemical equation, visit;

https://brainly.com/question/2874342

#SPJ1

Answer:

This is not a viable question.

Explanation:

Mass, moles and the use by firefighters are not sufficient to determine the identity of a substance. To identify a substance, more information such as chemical and physical properties, chemical reactions, and spectral data are typically required.

To learn more  about mass and mole refer:

brainly.com/question/24191825

#SPJ1

The molarity of the solution is 0.023 M and the molality of the solution is  17.9 m.

The concentration of a solution is defined as the amount of substance in a solution. Now we are told that we have a solution of  2.64 L aqueous solution of KOH. The solution has a density of 1.29 g/mL.

Density of the solution = 1.29 g/mL

Volume of the solution =  2.64 L

mass of the solution = 1.29 g/mL * 2.64 L = 3.4 g

Number of moles of the solute =  3.4 g/56 g/mol = 0.061 moles

Molarity =  0.061 moles/2.64 L = 0.023 M

Molality of the solution = 0.061 moles/3.4 * 10^-3 Kg = 17.9 m

Learn more about concentration:https://brainly.com/question/10725862

#SPJ1

Answer:

Explanation:

1.08kg/50.5 cm^3(1000g/kg)=21.386 g/cm^3

Answer:

\(\boxed {\boxed {\sf 21.4 \ g/cm^3}}\)

Explanation:

We are asked to find the density of an object.

The density of a substance is its mass per unit volume. It is calculated by dividing the mass by the volume.

\(\rho= \frac{m}{v}\)

The mass of the object is 1.08 kilograms. The object displaced 50.50 cubic centimeters of water, so this value is its volume.

We are asked to give the density in grams per cubic centimeter, so we must convert the mass. There are 1000 grams in 1 kilogram. Set up a conversion factor.

\(\frac {1000 \ g}{1 \ kg}\)

Multiply by the given mass: 1.08 kg

\(1.08\ kg *\frac{1000 \ g }{ 1\ kg}\)

The units of kilograms cancel.

\(1.08*\frac{1000 \ g }{1}\)

\(1.08*{1000 \ g } = 1080 \ g\)

Now we know the mass in grams and the volume:

Substitute the values into the density formula.

\(\rho= \frac{1080 \ g }{50.50 \ cm^3}\)

Divide.

\(\rho= 21.3861386 \ g/cm^3\)

The original measurements of mass and density have 3 and 4 significant figures. Our answer must have the least number of significant figures, or 3.

For the number we found, that is the tenths place. The 8 in the hundredth place tells us to round the 3 in the tenths place up to a 4.

\(\rho \approx 21.4 \ g/cm^3\)

The density of the object is approximately 21.4 grams per cubic centimeter.

Answer:

The modern table is a list of elements based on the number of protons in the nucleus.

Explanation:

That’s the positive charge of the nucleus. Then it is organised into rows and columns based on repeating patterns of chemical similarity within that series, other words “periodicity”. That is why it is called the periodic table.

Answer:

A: They bring cool air.

Explanation:

Took the test and got it correct. :)

Jet streams are fast flowing meandering air currents. Polar jet streams bring cool air through the atmosphere. Polar jets meet subtropical jets at some regions.

The polar jet stream, which travels through the lower layers of the atmosphere in the Northern Hemisphere, is a swiftly moving band of westerly winds.

The confluence of warm air ascending from the tropics and cold air masses descending from the arctic produces the jet. The denser cold air lowers and deflects the warmer air areas north, creating deep troughs and steep ridges that give the jet stream its wavy appearance.

As pockets of cold air intermittently sneak down from the Arctic, this pattern spreads across the mid-latitudes of North America, Europe, and Asia, producing opposing waves and flows that speed eastward due to the earth's rotation.

Find more on jet streams:

https://brainly.com/question/885071

#SPJ2

Answer:

1000 K

Explanation:

Given data

We can find the temperature of carbon dioxide using the ideal gas equation.

\(P \times V = n \times R \times T\\T = \frac{P \times V}{n \times R} = \frac{0.8210atm \times 50L}{0.5mol \times \frac{0.08206atm.L}{mol.K} }=1000 K\)

The temperature of the gas is 1000 K.

Answer:

lt serves as a home where crews of astronauts and cosmonauts live. The space station is also a unique science laboratory. Several nations worked together to build and use the space station. The space station is made of parts that were assembled in space by astronauts.

Explanation:

Answer:

I am pretty sure it is C.

Explanation:

Because the wave frequency's tell us the number of waves there are on that diagram.

Answer:

C. the number of vibrations per second an object is making

Explanation:

Hope this helps. Sorry if it doesn't. T^T

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The claim that can be supported is that the channels in mars are made by the flow of lave and not by water. Thus, claim  2 is supportive.

According to the new studies of the surface features of mars there are some channels found through the plates of mars. At least one of the meandering channels on the surface of Mars can possibly be explained by the fact that flowing lava can create or carve patterns that resemble the riverbeds and canyons cut by water.

NASA delivered this talk on these findings on March 4, 2010, at the 41st Lunar and Planetary Science Conference at NASA's Goddard Space Flight Center in Greenbelt, Maryland.

The possibility of discovering life on Mars is supposed to be affected by the question of whether the channels on Mars were produced by lava or by water.

To find more mars, refer here:

https://brainly.com/question/29186894

#SPJ1

Gold's atomic construction is bigger than tin because of the existence of more protons and neutrons.

The disposting of atoms in gold follows what's called a "​face-centered cubic" (fcc) structure. Put directly, the atoms in gold form cubes, with an atom at each of the districts, and another atom in the center of each of the faces (you can see what this looks like in the image below). Gold is an element.

An atom of gold carries 79 protons, 79 electrons, and (most commonly) 118 neutrons, making it among the dense of naturally happen. Gold is a chemical element with 79 protons in each atomic nucleus. Every atom carrying 79 protons is a gold atom and all gold atoms.

So we can conclude that gold has the chemical formula Au. Gold atoms join together in a giant metallic structure. Atomic Structure.

Learn more about Gold's here: https://brainly.com/question/24639749

#SPJ1

7.4 torr for PI2. Due to its direct proportionality to the initial pressure of HIHI, PI2 7.4 torrs.

The forward and reverse reactions happen simultaneously when the system is in equilibrium. Each reactant and product are present in equal amounts once equilibrium has been attained. The relationship between the concentrations of the reactants and the products is mathematically represented by the equilibrium constant equation.

The equilibrium state is the state of a system whose attributes are constant under constant external conditions. Even after equilibrium has been reached, reactants and products continue to change, making chemical equilibria dynamic in nature. However, the reaction time for moving forward and backward is the same. Balance examples include Placed on the table was a book. a vehicle that travels at a fixed speed. a chemical process where the rates of the forward and reverse reactions are equivalent.

Learn more about equilibrium here:

brainly.com/question/517289

#SPJ4

The volume of 0.240 M KOH that is needed to react completely with 11.4 mL of 0.110 M H₂SO₄ is 10.45mL.

The volume required by a solution to react with a substance can be calculated using the following formula:

CaVa/CbVb = Na/Nb

Where;

According to this question, a neutralization reaction occurs between aqueous H₂SO₄ and aqueous KOH as follows:

H₂SO₄(aq) +2KOH(aq) → 2H₂O(l) + K₂SO₄(aq)

If 0.240M KOH is needed to react completely with 11.4mL of 0.110M H₂SO₄, the volume of KOH needed can be calculated as follows:

11.4 × 0.110/0.240 × Vb = 1/2

1.254/0.240Vb = 1/2

1.254 × 2 = 0.240Vb

Vb = 2.508 ÷ 0.240

Vb = 10.45mL

Therefore, 10.45mL is the volume of the base needed to neutralise the acid.

Learn more about volume at: https://brainly.com/question/29525295

#SPJ1

Answer:

AG rxn=+394.4 kJ

Explanation:

Answer: The crust and the upper layer of the mantle together make up a zone of rigid, brittle rock called the Lithosphere . The layer below the rigid lithosphere is a zone of asphalt-like consistancy called the Asthenosphere . The asthenosphere is the part of the mantle that flows and moves the plates of the Earth.

Explanation:

Answer:

2K + 2H2O → 2KOH + H2

So Hydrogen is more reactive than pottasium .

Answer:

A

Explanation:

Hydrogen is more reactive than potassium.

The density of metal block in grams per cubic centimeter is 10.70 g/cm³.

Given,

Mass of metal block = 5.16 lb  

1 lb = 453.592 g

5.26 lb = 2340.536 g

The volume of metal block = 14 in 3

1 in = 2.5 cm

1 in 3 = 15.625 cm³

14 in 3 = 218.75 cm³

Density is defined as the mass per unit volume of a substance. Or, it is the ratio of mass to the volume of the substance.

As we know,

Density = mass/volume

Or, density = 2340.536 / 218.75

Or, density = 10.70 g/cm³

Therefore, the density of the metal block is 10.70 g/cm³.

To learn more about the density, visit: https://brainly.com/question/15164682

#SPJ9

There are 2 grams remain

Given

t1/2 = 30 years

t = 170 years

No = 100 g

Required

Remaining sample

Solution

General formulas used in decay:  

\(\large{\boxed{\bold{N_t=N_0(\dfrac{1}{2})^{t/t\frac{1}{2} }}}\)

Input the value :

\(\tt Nt=100.\dfrac{1}{2}^{170/30}\\\\Nt=1.969\approx 2~grams\)