Answer:
i think its C
Explanation:
heating curve iron
at what temperature does the substance begins to boil
at what temperature does a substance begin to melt
at what temperature is a substance for a liquid and a gas
at what temperature is the substance both a solid and a liquid
The substance begins to boil at 2750⁰C, the substance begins to melt at 1500⁰C, the temperature at which the substance is both a liquid and a gas at 2750⁰C, temperature is the substance both a solid and a liquid at 1500⁰C.
Heating curves are the graphical correlations between heat added to a substance. When viewed from a cooling perspective, ie. loss of heat, it is the cooling curve.
The gradient of the cooling curve is related to the heat capacity, the thermal conductivity of the substance, and the external temperature. The more heat is required to change the temperature of the substance, the slower it cools, so the smaller the gradient of the curve. The higher the thermal conductivity, the faster heat is transferred, so the faster the substance cools.
Learn more about Heating curve, here:
https://brainly.com/question/29592874
#SPJ1
When a solution of sodium hydroxide is mixed with iron (II) chloride, a green precipitate is formed. What is the balanced equation for that reaction?
The balanced chemical equation for the reaction is:
2NaOH(aq) + FeCl₂(aq) --> 2NaCl(aq) + Fe(OH)₂(s)
What is a chemical equation?Chemical equations are representations of chemical reactions using symbols and formula of the reactants and products.
The reactants are located on the left side while the products are located on the right side.
Reactants —> Products
The balancing of chemical equations follows the law of conservation of matter which states that matter can neither be created nor destroyed during a chemical reaction but can be transferred from one form to another.
How to write the balanced equationSodium hydroxide => NaOH
Iron (II) chloride => FeCl₂
2NaOH(aq) + FeCl₂(aq) --> 2NaCl(aq) + Fe(OH)₂(s)
Learn more about chemical equation:
https://brainly.com/question/7181548
#SPJ1
Write the empirical formula for c2h6o2
Answer:c1h3o1
Explanation:
Ahahah I’m getting points nah jp here
C1h3o1
What is the central idea illustrated in the 4 sets of pictures above
You can also answer the 4 pics 1 word if you'd like.
Answer:
Battery
Explanation:
Because it has a negative and positive sign
3. Red light has a frequency of 401 THz. What is the wavelength?
A light wave in a medium has a wavelength of 5107 m and a frequency of 41014 Hz.
What wavelength is red light at 740 nm?Its frequencies range from 4 to 8 hertz (Hz), or cycles per second, and its wavelengths range from 380 nanometers (nm), or 1.5 nm, to 740 nm, or 2.9 to 105 inches.
Which seven electromagnetic waves are there, from smallest to largest?The parts of the electromagnetic spectrum are designated as follows, from highest to lowest energy: gamma rays, X-rays, ultraviolet radiation, visible light, infrared radiation, and radio waves. The radio wave region of the electromagnetic spectrum includes microwaves (such as those found in microwave ovens).
To know more about red light frequency visit:-
https://brainly.com/question/13104367
#SPJ4
Please answer this question according to the image below
for the molecule shown below, please answer the following questions.
1. how many carbon atoms are there?
2. how many p-orbitals are involved in π bonds in this molecule?
3. how many Ione pairs of electrons must be added?
4. how many formal positive charges must be added?
When we show the structure of a molecule, we see the arrangement of atoms in the molecule.
Structure of moleculesThe structure of a molecule shows the arrangement of atoms in the molecule.
1) There are 24 carbon atoms in the molecule.
2) There are 30 p- orbitals that are involved in pi bonds in the molecule.
3) We need to add 22 lone pairs of electrons
4) We do not need to add any formal positive charge to the molecule.
Learn more about molecules: https://brainly.com/question/19922822
What is the process of a gas changing back into a liquid called
PLEASEEEEEE HELP MEEEEEEE
Answer:
condensation
Explanation:
Answer:
Condensation
Explanation:
The process of a gas changing back into a liquid is called condensation.
What is the difference between a homogenous and a heterogeneous?
Answer:
Explanation:
A homogeneous mixture consists of one single phase while a heterogeneous mixture consists of two or more phases.
A decrease in entropy is associated with which of the following types of reaction?
A) dehydration B) catabolic C) depolymerization D) hydrolysis
Dehydration of the process is linked to a decrease in entropy. correct option is (A).
Entropy is a measurement of a system's disorganization. It is an extended attribute of a thermodynamic system, which means that the amount of matter in the system affects its value. Entropy is frequently represented in equations by the letter S and is measured in joules per kelvin.
By combining several molecules into one, a dehydration reaction lowers the system's entropy. On the other hand, entropy is raised by catabolic, depolymerizing, and hydrolytic activities that break down molecules into smaller parts.
To know more about Entropy click here:
https://brainly.com/question/13448613
#SPJ4
The molar mass of water (H₂O) is 18.02 g/mol. Yun has 0.025 mol of H₂O for a laboratory experiment.
How many grams of water does she have?
The amount of water Yun has for experiment is 0.45 gram.
One mole of any substance is equal to the Avogadro number. we can obtain number of moles of any element If it's given mass and molar mass are known.number of moles = given mass / molar massThe proportionality factor that connects the quantity of substance in a sample to the number of constituent particles in that sample is called the Avogadro constant. ( 6.023 × 10²³)Given,
molar mass of water (H₂O) is 18.02 g/mol.
Yun has 0.025 mol of H₂O
we have to find out amount of water she has for her experiment
number of moles of water = given mass of water / molar mass of water
mass of water = number of moles of water × molar mass of water
= 0.025 × 18.02
= 0.45 gram
Therefore, Yun has 0.45 gram of water for experiment.
Learn more about Avagadro number here:
https://brainly.com/question/859564
#SPJ9
Arrange the objects from smallest to largest.
According to the problem Arrange the objects from smallest to largest is Pencil, Pillow, Basketball, House.
What is smallest?The smallest unit of measurement is the atom, which is the smallest particle of an element that still retains its chemical identity. Atoms are composed of even smaller particles, including protons, neutrons, and electrons. The size of an atom can vary depending on the element, but they typically measure between 0.1 and 0.5 nanometers in diameter.The smallest unit of measurement is the Planck Length, which is 1.616229 x 10-35 meters. This is the smallest measurement of length that is possible in the universe. It is also the smallest unit of measurement that has a meaning in physics.
To learn more about smallest
https://brainly.com/question/26842818
#SPJ1
What is the molarity of a solution which has a total volume of 0.310 L with 0.05 g of KCl dissolved in it?
The molarity of the solution containing 0.05 g of KCl in a total volume of 0.310 L is approximately 0.0022 M.
To determine the molarity of a solution, we need to know the moles of solute and the volume of the solution. First, we need to convert the mass of KCl to moles using its molar mass. The molar mass of KCl is approximately 74.55 g/mol (39.10 g/mol for potassium + 35.45 g/mol for chlorine).
Using the formula:
moles = mass / molar mass
moles = 0.05 g / 74.55 g/mol = 0.00067 mol
Next, we convert the total volume of the solution to liters:
0.310 L
Finally, we calculate the molarity (M) using the formula:
Molarity = moles of solute / volume of solution (in liters)
Molarity = 0.00067 mol / 0.310 L ≈ 0.0022 M
For more such questions on molarity
https://brainly.com/question/30404105
#SPJ8
Avoiding an accident when driving can depend on reaction time. That time, measured in seconds from the moment the driver see danger until they step on the brake pedal, can be described by the Normal model �(1.5, 0.18). (15 pts) a) What percent of drivers have a reaction time less than 1.35 seconds? b) What percent of drivers have a reaction time greater than 1.9 seconds? c) What percent of drivers have a reaction time between 1.45 and 1.75 seconds? d) Describe the reaction time of the slowest 10% of all drivers? (hint: the slower a person reacts, the higher their reaction time) e) In what interval reaction times do the middle 60% of all drivers fall
Answer:
The answer is below
Explanation:
A normal model is represented as (μ, σ). Therefore for (1.5, 0.18), the mean (μ) = 1.5 and the standard deviation (σ) = 0.18
The z score shows by how many standard deviations the raw score is above or below the mean. It is given as:
\(z=\frac{x-\mu}{\sigma}\)
a) For x < 1.35 s
\(z=\frac{x-\mu}{\sigma}\\\\z=\frac{1.35-1.5}{0.18}=-0.83\)
From the normal distribution table, the percent of drivers have a reaction time less than 1.35 seconds = P(x < 1.35) = P(z < -0.83) = 0.2033 = 20.33%
b) For x > 1.9 s
\(z=\frac{x-\mu}{\sigma}\\\\z=\frac{1.9-1.5}{0.18}=2.22\)
From the normal distribution table, the percent of drivers have a reaction time greater than 1.9 seconds = P(x > 1.9) = P(z > 2.22) = 1 - P(z<2.22) = 1 - 0.9868 = 0.0132 = 1.32%
c) For x = 1.45
\(z=\frac{x-\mu}{\sigma}\\\\z=\frac{1.45-1.5}{0.18}=-0.28\)
For x = 1.75
\(z=\frac{x-\mu}{\sigma}\\\\z=\frac{1.75-1.5}{0.18}=1.39\)
From the normal distribution table, P(1.45 < x < 1.75) = P(-0.28 < z < 1.39) = P(z < 1.39) - P(z< - 0.28) = 0.9177 - 0.3897 = 0.528 = 52.8%
d) A percentage of 10% corresponds to a z score of -1.28
\(z=\frac{x-\mu}{\sigma}\\\\-1.28=\frac{x-1.5}{0.18}\\\\x-1.5=-0.2034\\\\x=1.27\)
e) P(z < z1) - P(z< -z1) = 60%
P(z < z1) - P(z< -z1) = 0.6
P(z < -z1) = 1 - P(z < z1)
P(z<z1) - (1 - P(z < z1)) = 0.6
2P(z<z1) - 1= 0.6
2P(z<z1) = 1.6
P(z<z1) = 0.8
From the z table, z1 = 0.85
\(0.85=\frac{x-1.5}{0.18}and-0.85=\frac{x -1.5}{0.18} \\\\x=1.65 \ and\ x=1.35\)
The reaction time between 1.35 and 1.65 seconds
1s² 2s²2p6 is the electron configuration of
The electron configuration 1s² 2s²2p6 is the element Neon.
Which four different electron configurations are there?One orbital may house a maximum of two electrons, and there are four different types of orbitals (s, p, d, and f). More electrons can be held in the p, d, and f orbitals since they contain various sublevels. As was said, each element's location on the periodic table determines the specific electron configuration of that element.
The octet rule states that an atom's outermost shell may hold no more than 8 electrons (except K shell which can accommodate maximum 2 electrons). Hence, potassium's electrical structure.
The quantity of valance electrons, which take part in the creation of a chemical bond, is found in an atom's outermost shell. The outermost shell of the atom's electrical structure contains 4 valance electrons.
To know more about Electron configuration visit:
https://brainly.com/question/13497372
#SPJ13
Draw a Lewis structure for each covalent molecule. a. CH3F b. N2H4
Answer:
See attached picture.
Explanation:
Hello,
In this case, given the compounds we notice:
a. Since carbon has four valence electrons (group IVA), it has three hydrogen atoms around it as well as a fluorine atom which has seven valence electrons (group VIIA). Moreover, we notice both carbon and fluorine attaining the octet.
b. In this case, two nitrogen atoms which have five valence electrons each (groupVA) are bonded via a single bond and two hydrogen atoms are bonded to each nitrogen atom in order to attain the octet for nitrogen only.
Thus, structures are given on the attached picture.
Regards.
Lewis structure for each covalent molecule CH₃F and N₂H₄ are attached to the image below.
a. CH₃F:
Carbon (C) has 4 valence electrons, Hydrogen (H) has 1 valence electron, and Fluorine (F) has 7 valence electrons.
The total number of valence electrons in CH3F can be calculated as follows:
1 carbon atom (C) × 4 valence electrons = 4 valence electrons
3 hydrogen atoms (H) × 1 valence electron = 3 valence electrons
1 fluorine atom (F) × 7 valence electrons = 7 valence electrons
Total valence electrons = 4 + 3 + 7 = 14
b. N₂H₄:
Nitrogen (N) has 5 valence electrons, and Hydrogen (H) has 1 valence electron.
The total number of valence electrons in N2H4 can be calculated as follows:
2 nitrogen atoms (N) × 5 valence electrons = 10 valence electrons
4 hydrogen atoms (H) × 1 valence electron = 4 valence electrons
Total valence electrons = 10 + 4 = 14
To learn more about the Lewis structure, follow the link:
https://brainly.com/question/29603042
#SPJ6
a) Select from the list below at least 3 solvents suitable for solvent extraction in combination with water. This list below includes solvents that are not suitable for extraction, then review the information carefully before choosing. Solvent hewane toluene water 2-butan acetone chloroform 1 propanol Density/ml) Molecular Mass 0.695 86 178 0.867 92.141 1.000 18.02 O. BOS 72.11 0.7845 58.079 1492 119.37 0.803 60.10 BPC Solubility (wt 25 /100 6RS Salin water: 0.0014 111 Solin water: 0.05 100 79.54 Sol in water 256 (mice 56.05 Sol in water miscible 61.15 Sal in water: 0.795 97 Sol in water miscible b) Using the supporting data provided, indicate for the 3 solvents chosen if the organic phase would be the upper (top) or lower (bottom) layer when each one of these solvents is used for extraction in combination with water. Solvent 1 is... and organic layer is the... (upper or lower) Solvent 2 is... and organic layer is the... (upper or lower) Solvent 3 is... and organic layer is the... (upper or lower) hexane (upper) heyane (lower) Solvent 1 is... and organic layer is the... (upper or lower) Solvent 2 is... and organic layer is the... (upper or lower) Solvent 3 is... and organic layer is the... (upper or lower) hexane (upper) hexane (lower) toluene (upper) toluene (lower) 2-butanone (upper) 2-butanone (lower) acetone (upper) acetone (lower) chloroform (upper) chloroform (lower) 1-propanol (upper) 1-propanol (lower)
a) The three solvents suitable for solvent extraction in combination with water are 2-butanone, acetone, and 1-propanol. These solvents are suitable because they are all miscible with water, meaning they can dissolve in water to form a homogeneous solution.
b) Solvent 1 is 2-butanone and the organic layer is the upper layer because the density of 2-butanone (0.805 g/mL) is lower than the density of water (1.000 g/mL).
Solvent 2 is acetone and the organic layer is the upper layer because the density of acetone (0.7845 g/mL) is lower than the density of water (1.000 g/mL).
Solvent 3 is 1-propanol and the organic layer is the upper layer because the density of 1-propanol (0.803 g/mL) is lower than the density of water (1.000 g/mL).
In solvent extraction, the organic layer will be on top if the density of the solvent is lower than the density of water, and the organic layer will be on the bottom if the density of the solvent is higher than the density of water.
To know more about solvent extraction, refer here:
https://brainly.com/question/12910778#
#SPJ11
Hydrogen gas is collected over water at 23°C, 767 torr. At this temperature the vapor pressure of water is 21.0 torr. What is the partial pressure of hydrogen in the collected gas?
The partial pressure of hydrogen gas in the collected gas is 746 torr.
To determine the partial pressure of hydrogen gas in the collected gas, we need to consider the difference between the total pressure of the collected gas and the vapor pressure of water at the given temperature. The partial pressure of hydrogen gas is the pressure exerted by hydrogen alone.
Given information:
Total pressure of the collected gas (Ptotal) = 767 torr
Vapor pressure of water (Pwater) = 21.0 torr
The partial pressure of hydrogen gas (Phydrogen) can be calculated using Dalton's law of partial pressures, which states that the total pressure of a mixture of gases is equal to the sum of the partial pressures of each individual gas.
Phydrogen = Ptotal - Pwater
Plugging in the given values:
Phydrogen = 767 torr - 21.0 torr
Phydrogen = 746 torr
Therefore, the partial pressure of hydrogen gas in the collected gas is 746 torr.
It's important to note that in this calculation, we assume that the water vapor does not react with or dissolve in the hydrogen gas and that the gases behave ideally. Additionally, it's assumed that the collected gas is dry, meaning all the water vapor has been removed or does not significantly contribute to the total pressure.
Fo rmore such questions on partial pressure visit:
https://brainly.com/question/19813237
#SPJ8
What volume would 0.435 moles of hydrogen gas, Hz, occupy at STP?
Answer:
will be 9.7 Liters
Explanation:
Predict: How do you think you could use the Gizmo to make the color gray? _____________
_________________________________________________________________________
Observe: Change the Red, Green, and Blue values to 90. What color does this produce?
_________________________________________________________________________
The simplest way to make the color gray is by mixing white and black colors, but it can also be created by mixing colors such as red and green.
What is the grey color?This is considered a neutral and cool color that can be naturally found in elements such as rocks.
How can you make this color by mixing other colors?Neutral gray: The eeasiest way to create this color is by mixing black and white. This would give you a very neutral gray.Other shades: It is also possible to make this color by mixing colors that are opposite in the colors scale such as:Yellow and purples.Red and green.This would not be a neutral gray as it will resemble a little bit the original colors.
Learn more about colors in: https://brainly.com/question/19580247
under what circumstances do you think credit cards should NOT be used ?
It's never a good idea to use your credit card when experiencing strong emotions, especially if you tend to steer toward 'retail therapy.
A piece of metal is heated to 250 degrees then placed in a bucket of water with an initial temperature of 15 degrees. After 10 minutes, the system reaches a point of thermal equilibrium. The water is now 22 degrees. Which of the following is the most likely temperature of the piece of metal?
Answer: 22 degrees
Explanation:
Most of the information in this question is put there to throw you off- the only important piece of information here is the final temperature of the water.
In a system of say 2, like in this example, whichever object has more energy in the form of heat will transfer that heat to the object with lesser heat if there is an available path to transfer heat between them. Once the two objects are at the same temperature, however, heat can not be transferred from one to another since neither object has more heat than the other to transfer- this is thermal equilibrium.
This question tells us that the system is at thermal equilibrium- when both objects are at the same temperature. Given the temperature of one object, the water, we then know the other object, the metal is the same temperature.
Adding energy to solid water will turn it into ?
Answer:
Energy added to solid water will turn it into liquid water; add energy into liquid water and it will be turned into water vapor.
Explanation:
Adding energy is basically adding heat; the more heat, the more excited the molecules of H2O gets. In solid water, the molecules aren't really moving because they don't have a lot of energy, so it is solid. In liquid water (which is water in room temperature), it has a medium amount of energy; the molecules aren't stuck together but it isn't completely dispersed, so it is in liquid form. However, in water vapor, the energy becomes very high and the molecules are excited. The hydrogen bonds holding the molecules together break and the water is released as a vapor.
What is the ΔG (kJ/mol) for a reaction at 25 Celsius that is:
Mg3(PO4)2 (s) ⇄ 3 Mg2+ (aq) + 2 PO43− (aq) ΔG0 = 137.0 kJ/mol
If there is initially 0.65 M Mg2+(aq) and 0.43 M PO43− (aq) in solution?
Answer:
115.6 kJ/mol
Explanation:
The ΔG of a reaction can be calculated using the following equation:
ΔG = ΔG° + RT ln(Q)
where:
ΔG° is the standard free energy change, which is given as 137.0 kJ/mol in this case
R is the gas constant, which is 8.314 J/(mol·K)
T is the temperature in Kelvin, which is 25°C + 273.15 = 298.15 K
Q is the reaction quotient, which is the ratio of the concentrations of the products to the concentrations of the reactants, each raised to their stoichiometric coefficients.
From the chemical equation given, the stoichiometric coefficients of Mg2+ and PO43- are 3 and 2 respectively. Therefore, the reaction quotient can be expressed as:
Q = [Mg2+]^3 [PO43-]^2
Substituting the given initial concentrations of Mg2+ and PO43- into the reaction quotient expression, we get:
Q = (0.65 M)^3 (0.43 M)^2 = 0.011 M^5
Now we can calculate the ΔG of the reaction:
ΔG = ΔG° + RT ln(Q)
ΔG = (137.0 kJ/mol) + (8.314 J/(mol·K) × 298.15 K) × ln(0.011 M^5)
ΔG = 137.0 kJ/mol - 21.38 kJ/mol
ΔG = 115.6 kJ/mol
Therefore, the ΔG for the reaction at 25°C and the given initial concentrations of Mg2+ and PO43- is 115.6 kJ/mol.
A drop of water with a mass of 0.48 g is vaporized at 100 ∘C and condenses on the surface of a 55- g block of aluminum that is initially at 25 ∘C . If the heat released during condensation goes only toward heating the metal, what is the final temperature in Celsius of the metal block? (The specific heat capacity of aluminum is 0.903 J/(g⋅∘C ).)
Express the temperature in Celsius to two significant figures.
The final temperature in Celsius of the metal block is 49°C.
How to find the number of moles ?Moles water = \(\frac{\text{Given mass}}{\text{Molar Mass}}\)
= \(\frac{0.48\ g}{18\ \text{g/mol}}\)
= 0.0266 moles
Heat lost by water = 0.0266 mol x 44.0 kJ/mol
= 1.17 kJ
= 1170 J [1 kJ = 1000 J]
Heat lost = Heat gained
Heat gained by aluminum = 1170 J
1170 = 55 x 0.903 (T - 25) = 49.7 T - 1242
1170 + 1242 = 49.7 T
T = 48.5°C (49°C at two significant figures)
Thus from the above conclusion we can say that The final temperature in Celsius of the metal block is 49°C.
Learn more about the Moles here: https://brainly.com/question/15356425
#SPJ1
Write the equation for the equilibrium constant (K) of the reaction studied in this exercise.
2C04 2- (ag) + 2Ht (ag) = CI20, 2- (ag) + H20(1)
The equation for the equilibrium constant (K) of the reaction studied in this exercise can be written as follows: K = ([\(CI_20\), 2-] * [\(H_20\)(1)]) / ([\(C0_4^ 2\)-] * [Ht])
In this equation, the concentrations of the species involved in the reaction are represented by the square brackets [ ]. The subscripts indicate the stoichiometric coefficients of each species in the balanced chemical equation.
The reaction being studied involves the following species:
\(C0_4^ 2\)- (ag) + 2Ht (ag) = \(CI_20\), 2- (ag) + \(H_20\)(1)
In the equilibrium constant expression, the concentration of \(CI_20\), 2- is multiplied by the concentration of \(H_20\)(1) and divided by the product of the concentrations of \(C0_4^ 2\)- and Ht. The stoichiometric coefficients in the balanced equation are used as exponents for the concentrations of the respective species.
It is important to note that the concentrations used in the equilibrium constant expression should be in molar units (mol/L) or expressed as partial pressures for gases.
Additionally, the equilibrium constant is specific to a given temperature, and its value provides information about the relative amounts of reactants and products at equilibrium.
For more such question on equilibrium constant visit:
https://brainly.com/question/3159758
#SPJ8
Calculate the Molar Mass of CuSO4
The molar mass of a molecule corresponds to the sum of the atomic weights of each element multiplied by the number of atoms of the respective element. The atomic weights can be found in the periodic table. For each element the atomic weight is:
Cu=63.546u
S= 32.065 u
O4= 15.999u
The molar mass of the molecule will be:
\(MolarMassCuSO_4=1\times63.546u+1\times32.065u+4\times15.999u\)\(MolarMassCuSO_4=63.546u+32.065u+63.996u\)\(MolarMassCuSO_4=159.607g/mol\)Answer: The molar mass of CuSO4 is 159.607g/mol
Write the molecular equations for the following chemical reactions, REMEMBER that in reaction equations, organic substances are written with their abbreviated structural formulas:
a. butanoic acid + sodium;
b. formic acid + aluminum hydroxide;
c. acetic acid + potassium oxide;
d. propanoic acid + lithium hydroxide;
e. ethanoic acid + butanol;
f. methanoic acid + potassium carbonate.
Molecular equations for the following chemical reactions using shortened structures:
A. Butanoic acid + sodium:
C3H7COOH + Na → C3H7COONa + H2
B. Formic Acid + Aluminum Hydroxide:
HCOOH + Al(OH)3 → Al(HCOO)3 + 3H2O
C. Acetic Acid + Potassium Oxide:
CH3COOH + K2O → 2CH3COOK + H2O
D. Propanoic Acid + Lithium Hydroxide:
C2H5COOH + LiOH → C2H5COOLi + H2O
e. Acetic acid + butanol:
CH3COOH + C4H9OH → CH3COOC4H9 + H2O
F. Methanoic Acid + Potassium Carbonate:
HCOOH + K2CO3 → 2HCOOK + H2O + CO2
For each reaction, an informal structural formula of the organic substance and the product formed in the reaction is given.
For more such question on molecular
https://brainly.com/question/20442936
#SPJ11
how does a buffer work?
A. it prevents added acids or bases from dissociating
B. it neutralizes acids or bases by precipitating a salt
C. it forms new conjugate pairs with the added ions
D. it bonds with the added H+ or OH- in solution
Answer:
It bonds with the added H+ or OH in solution.
Explanation:
A beaker can hold 200 cm3 of water. When it's empty, how
many liters are needed to refill it?
L
Answer:
\(V=0.200L\)
Explanation:
Hello,
In this case, since the volumetric capacity of the beaker is 200 cm³, by considering that 1000 cm³ equals 1 L, the liters are then computed via the following unit conversion:
\(V=200cm^3*\frac{1L}{1000cm^3}\\ \\V=0.200L\)
Best regards.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.