The stable element of neon is depicted by the Bohr model.
There are ten total electrons in the Bohr model of neon. There are two electrons in the first energy level, which is closest to the nucleus, and eight electrons in the second energy level. The most electrons that can fit into this energy level are found in neon, which has a full outer energy level (valence shell) with 8 of them. Neon has thus reached a stable electron configuration, which makes it less likely to readily conduct chemical reactions.Bohr model The Bohr model is a condensed illustration of atom structure. Niels Bohr of Denmark made the hypothesis in 1913 in order to explain the emission and absorption spectra of hydrogen atoms. Protons and neutrons make form the model's core nucleus, which is surrounded by electrons orbiting at various energy levels or shells.Quantization, which states that electrons can only exist at specific discrete energy levels and can transition between levels by absorbing or emitting energy, is a notion that is included in the Bohr model. The energy of an electron at a given energy level depends on how far it is from the nucleus; the more energy an electron has, the further it is from the nucleus.learn more about Bohr model here
https://brainly.com/question/1402660
#SPJ1
Calculate the heat change in kilojoules for condensation of 195 g of steam at 100 ° C
Answer:
Q = 81.59kJ
Explanation:
Hello,
The heat of condensation is the energy required to to convert the steam into water.
Mass = 195g
Specific heat capacity of water = 4.184J/g°C
Initial temperature(T1) = 100°C
Final temperature(T2) = 0°C
Heat energy (Q) = ?
Heat energy (Q) = mc∇T
M = mass of the substance
C = specific heat capacity of the substance
∇T = T2 - T1 = change in temperature of the substance
Q = 195 × 4.184 × (0 - 100)
Q = -81588J
Q = -81.588kJ
The heat required for the condensation of 195g of steam is 81.59kJ
Find the pH value after adding 0.05 M of sulfuric acid to a solution consisting of 0.1 M of weak acid and its salt. Note that the value of the weak acid dissociation constant is 4.47
The pH value after adding 0.05 M of sulfuric acid to a solution consisting of 0.1 M of weak acid and its salt is o.91.
What is pH ?The pH scale determines how acidic or basic water is. The range is 0 to 14, with 7 representing neutrality. Acidity is indicated by pH values below 7, whereas baseness is shown by pH values above 7. In reality, pH is a measurement of the proportion of free hydrogen and hydroxyl ions in water.
Ka = [ H⁺ ] [ B⁻ ] / [ HB ]
HB = H⁺ + B⁻
Ka = 4.47
C= 0.1
x = ( - 4.47 + (4.47 )² + 4 ( 0.1 ) ( 4.47 )²/2
= 15.51 + 0.844 / 2
= 16.354/ 2
=8.177
pH = - log [ H⁺ ]
= - log ( x )
= -log ( 8.177 )
pH = 0.91
Thus, The pH value after adding 0.05 M of sulfuric acid to a solution consisting of 0.1 M of weak acid and its salt is o.91.
To learn more about pH follow the link;
https://brainly.com/question/15289741
#SPJ1
PLEASE HELP ! :D
WILL GIVE BRAINLIEST
calculate the percentage of sodium and carbon and oxygen in sodium carbonate
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
For each question, determine the type of reaction, then balance the reaction.
Problems 1-4: 2 points each
1.
Al +
H, Te →
Al, Tez +
H
a. Type:
2.
_C12H26 +
O2 →
H2O +
CO2
a. Type:
3.
Au +
CuSO4 →
Cu +
AuSO4
a. Type:
4.
H₂O →
H2 +
a. Type:
Answer:
i know the answer but i dont have time bro
hold 24.5 L of gas convert 2 oz into gallons
Step 1 - Converting L to ml
1 L corresponds to 1000 ml. Since the volume of the gas sample is 425 L, we can convert it to ml by multiplying by 1000:
\(V=425\times1000=425000\text{ ml}\)Step 2 - Converting L to gallons
1 L corresponds to 0.26 gallon. Since the volume of the gas sample is 425 L, we can convert it to gallon by multiplying by 0.26:
\(V=425\times0.26=110.5\text{ gallon}\)Step 3 - Writing the results in scientific notation
To express a number in scientific notation, the number must be between 1 and 10. The first result, 425000 ml, can be expressed as:
\(425000ml=4.25\times10^5ml\)The second result, 110.5 gallons, can be expressed in scientific notation as:
\(110.5\text{ gallons=1.105}\times10^2\text{ gallons}\)Pick the compound with the highest boiling point in each pair. Match the words in the left column to the appropriate blanks in the sentences on the right. Make certain each sentence is complete before submitting your answer.1. For the pair of compounds CO2 or NO2 the one with the highest boiling point is __________ . 2. For the pair of compounds NH3 or CH4 the one with the highest boiling point is _________ 3. For the pair of compounds CS2 or CO2 the one with the highest boiling point is _________
Answer:
1) NO2
2) NH3
3) CS2
Explanation:
CO2 is a nonpolar molecule owing to the fact that the two opposing dipoles in the molecule cancels out. Hence its primary intermolecular forces are the weak dispersion forces. How ever NO2 is polar and its molecules are held together by dipole-dipole interaction this makes the boiling point of NO2 greater than that of CO2
NH3 exhibits hydrogen bonding since nitrogen is far more electronegative than hydrogen. However, CH4 is nonpolar and the only intermolecular forces present are weak dispersion forces. This accounts for the fact that NH3 has a greater boiling point than CH4.
The boiling point of a compound also depends on its molecular mass. CS2 has a greater boiling point than CO2 due to the fact that CS2 has a larger molecular mass. The both compounds- CO2 and CS2 has exactly the same kind of intermolecular forces present between their molecules- the weak dispersion forces.
i. ii. iii. questions on the basis of it. Name 'B' and 'E'? ody. B What happens in 'A'? What type of blood (oxygenated or deoxygenated) flows in 'E' and 'F'? iv. What is the name of the blood circulation that occurs in between the heart and 'A'? The table shows recipients and donors of following questions on the basis of it.
It involves the transport of oxygenated blood from the heart to the rest of the body, and the return of deoxygenated blood from the body to the heart.
The given table shows the blood types of recipients and donors. A person's blood type is determined by the presence or absence of specific antigens on the surface of their red blood cells. In humans, there are four main blood groups: A, B, AB, and O.
Blood group B: The individuals having blood group B have B antigens present on the surface of their red blood cells.
Blood vessel E: The blood vessel E is pulmonary artery.
The chamber 'A' is the right atrium of the heart. The right atrium receives deoxygenated blood from the body and pumps it into the right ventricle.
Blood vessel E is pulmonary artery that carries deoxygenated blood from the right ventricle of the heart to the lungs.
Blood vessel F is pulmonary vein that carries oxygenated blood from the lungs to the left atrium of the heart.
The blood circulation that occurs in between the heart and the chamber 'A' (right atrium) is systemic circulation.
for such more questions on oxygenated
https://brainly.com/question/15290050
#SPJ8
Find the grams in 6.25 moles of HC2H302.
use this formula m=n×M
Your n would be 6.25mols
Your Molar mass would be the number you get after adding the molar mass of your equation: HC2H302. Find your periodic table and look there.
And you plug in the molar number in the formula and you multiply n×M
I would help but I don't have the periodic table with me right now
Potassium Phosphide reacts with reacts with aluminum in a single replacement reaction to produce Aluminum Phosphide and Potassium. What coefficient is needed in front of the product potassium to properly balance this chemical equation?
2
3
4
5
Potassium Phosphide reacts with aluminum in a single replacement reaction to produce Aluminum Phosphide and Potassium. The coefficient is needed in front of the product potassium to properly balance this chemical equation is 3. Therefore, option B is correct.
What is potassium ?Potassium is the chemical element which is represented by the symbol K. Its atomic number is 19. Potassium metal reacts rapidly with atmospheric oxygen.
Potassium Phosphide reacts with aluminum in a single replacement reaction to produce Aluminum Phosphide and Potassium. The balance chemical equation is as follows:
2K₃PO₄ + Al₂(SO₄)₃ → 3K₂SO₄ + 2AlPO₄
Thus, option B is correct.
To learn more about the potassium, follow the link;
https://brainly.com/question/13321031
#SPJ1
What adaptation does a tufted titmouse have that allows it to stay in a broadleaf forest year-round?
They fluff their feathers for warmth.
They migrate for the winter.
They eat mice for energy to warm themselves.
They hibernate for the winter.
Answer:
They fluff their feathers for warmth.
Explanation:
It was in the explanation on Edge.
Tufted titmouse migrate for the winter that allows it to stay in broadleaf forest year round. Hence, option b is correct.
What is tufted titmouse?The Tufted Titmouse is a little, grey bird with an echoing call that is prevalent in eastern deciduous woodlands and a regular feeder visitor.
These birds have huge black eyes, a short, round beak, and a brushy crest, which give them a peaceful yet urgent appearance that complements the way they dart through trees, dangle from twigs, and land at bird feeders.
Tufted Titmice frequently visit backyard bird feeders, particularly in the winter. Although suet, peanuts, and other seeds are also acceptable, they prefer sunflower seeds.
The tufted titmice live in a variety of environments, such as disturbed areas, semi-open areas, and deciduous and mixed woods. They are a frequent visitor to bird feeders and are prevalent in residential settings with trees. Hence, option b is correct.
Find more on tufted titmouse:
https://brainly.com/question/27961147
#SPJ6
If you knew the volume of the solution containing NaCl(aq), determine how you would predict the mass of AlCl3(s) formed
Answer:
See explanation.
Explanation:
Hello there!
In this case, according to the given information, it turns out possible for us to realize that the NaCl solution must react with an aluminum-containing substance, say the hydroxide or any other salt, so that the following equation will take place:
\(3NaCl(aq)+Al^{3+}\rightarrow 3Na^+(aq)+AlCl_3(s)\)
In such a way, given the volume of the NaCl solution, it must be necessary to know its concentration, in order to get moles of this salt, further use the 3:1 mole ratio of NaCl to AlCl3 and the molar mass of the latter (133.34 g/mol) in order to solve an stoichiometric setup like the following:
\(m_{AlCl_3}=V_{NaCl}*M_{NaCl}*\frac{1molAlCl_3}{3molNaCl} *\frac{133.34gAlCl_3}{1molAlCl_3}\)
Besides, you must make sure the volume is in liters.
Best regards!
g Ions B and C react to form the complex BC. If 35.0 mL of 1.00 M B is combined with 35.0 mL of 1.00 M C, 0.00500 mol of BC is formed. Determine the equilibrium constant for this reaction.
Answer:
Kf = 0.389.
Explanation:
Hello there!
In this case, it turns out possible for us to solve this problem by firstly writing the equilibrium chemical equation and equilibrium expression for the formation of this complex:
\(B+C\rightleftharpoons BC\\\\Kf=\frac{[BC]}{[B][C]}\)
Thus, we firstly calculate the concentrations at equilibrium, knowing that the reaction extent in this case is 0.00500mol (same as the formed moles of BC):
\([B]=[C]=\frac{0.0350L*1.00mol/L-0.00500mol}{0.0700L} =0.429M\)
\([BC]=\frac{0.00500mol}{0.0700L} =0.0714M\)
And finally, the equilibrium constant:
\(Kf=\frac{0.0714}{[0.429][0.429]}\\\\Kf=0.389\)
Regards!
The pOH of a solution is 6.0. Which statement is correct?
Use pOH = -log[OH-] and PH+pOH = 14.
The pH of the solution is 20.0.
O The concentration of OH ions is 1.0 x 108 M.
The concentration of OH ions is 1.0 x 106 M.
O The pH of the solution is 8.0.
A
At pOH value of 6.0 the pH value of the following solution is 8.0 and the concentration of [\(H^{+}\) ] ion is \(10^{-8}\)
In this question we will apply the formula
pH +pOH = 14 . . . . . . . . . . . . .(1)
where pH = concentration of [\(H^{+}\) ] ion
pOH = concentration of [\(OH^{-}\) ] ion
As per the question
pOH =6.0
Putting the value of pOH in equation (1) we get the value of pH
pH + 6.0 =14
pH = 14 -6.0
pH = 8.0
The value of pH if the pOH value is 6.0 is 8.0
To find the concentration of \(H^{+}\) ion we will use the following formula
This is calculated by the formula
[\(H^{+}\)} = \(10^{-pH}\)
where we will write the values of pH
Hence the concentration of [\(H^{+}\)} ion is \(10^{-8}\)
Therefore at pOH of 6.0 the pH value of the following solution is 8.0 and the concentration of [\(H^{+}\) ] ion is \(10^{-8}\)
Read more about pH
https://brainly.com/question/11300720
The complete question is -
What is the pH value and concentration of [\(H^{+}\) ] ion of the following if the pOH value of the solution is 6.0 ?
write the chemical equation of the reaction with a change in colour
Answer:
(i) Change in colour (ii) Change in temperature (iii) Formation of precipitate
Explanation:
(i) Change in colour: Reaction between lead nitrate solution and potassium iodide solution. Pb(NO3)2(aq)+2KI → PbI2(s)+2KNO3(aq) In this reaction, colour changes from colourless to yellow. (ii)Change in temperature: Action of dilute sulphuric acid on zinc. Zn(s) + H2SO4(aq) → ZnSO4(aq) + H2 In this reaction, heat is evolved (iii) Formation of precipitate: Action of barium chloride on sodium sulphate. BaCl2(aq) +Na2SO4(aq) → BaSO4(s) +2NaCl(aq) BaSO4(s)
How did the experiment with the iron fillings and sulfur compare with experiment in which copper sulfate pentahydrate was heated?
Answer:
Both resulted in gas formation. Both resulted in color change.
Explanation:
Follow me!
Answer:
statement second and third are both corect
Explanation:
When iron(grey) reacts with sulfur(yellow) chemical change takes place in which iron sulfide is formed which black in color.
Fe(s) + S(s)\rightarrow FeS(s)Fe(s)+S(s)→ FeS(s)
When we heat copper sulfate-pentahydrate(blue) ,water molecule present in its crystal will get evaporated and it will become an anhydrous copper sulfate which will be white in color.
CuSO_{4}.5H_{2}O(s)\overset{heat}{\rightarrow} CuSO_{4}(s)+5H_2O(g)CuSO
4
.5H
2
O(s)
→
heat
CuSO
4
(s)+5H
2
O(g)
So, in both the reactions chang
request:
set as brainiest
Liam wants a test to find out if diet lemonade contains any sugar.Write a plan for Liam to use to test for sugar and predict the result he should get,with a reason. (6 marks)In this question you get marks for how well your answer is written.You will get marks for:spellinggrammarorganising your ideas and information clearlyusing key scientific words.
To find out if the diet lemonade contains any sugar, Liam should follow these steps (using Benedict's solution):
1. Take a sample of the diet lemonade and pour it into a test tube.
2. Add a few drops of Benedict's solution to the test tube with the diet lemonade sample.
3. Mix it to make it homogeneous.
4. Take the test tube to a water bath.
5. Heat the test tube in the water bath.
6. If the solution (sample of diet lemonade + drops of Benedict's solution) turns orange-red, the diet lemonade contains sugar.
I really need help with this!!!!!!!!
Which of the following electron models is the one currently accepted by modern science?
A.) Dalton's Billiard Ball.
B.) Thomson's Plum Pudding Model.
C.) Schrodinger's Quantum Mechanical Model.
D.) Rutherford-Bohr Planetary Model.
Schrodinger's Quantum Mechanical Model, which is currently recognised by modern science, is the electron model. The electron cloud model is another name for this one.
What electron model is in use right now?The term "electron cloud" refers to the current atomic structure model. A physicist from Austria named Edwin Schrodinger argued that electrons do not follow static or permanent trajectories.
What atom model is considered to be the most recent?The contemporary atomic model, often known as the cloud model, depicts atoms as having a nucleus made up of protons and neutrons and a diffuse gradient or cloud surrounding it that is made up of electrons. Because electron activity is probabilistic, electrons are often depicted as clouds.
To know more about electron visit:-
https://brainly.com/question/28977387
#SPJ1
Assignment Your Unde a professor in a University has Sent you an touration 6 his Inaugural lectore wate a letter to him, showing appreciation for him on halind gesture and Congratulating! his achievements So far
In this letter, express gratitude to your uncle, a university professor, for his invitation and congratulate him on his achievements.
Here are the steps to be followed:
By following these steps, you can write a thoughtful and appreciative letter to your uncle, expressing your gratitude for his invitation and congratulating him on his achievements.
Know more about Letter here:
https://brainly.com/question/18879087
#SPJ8
How many grams of H2 would be formed if 34 grams of carbon reacted with an unlimited amount of H2O?
Answer:
The reaction between carbon (C) and water (H2O) forms carbon monoxide (CO) and hydrogen gas (H2). The balanced chemical equation for this reaction is:
C(s) + H2O(g) -> CO(g) + H2(g)
According to this balanced equation, one mole of carbon reacts with one mole of water to produce one mole of carbon monoxide and one mole of hydrogen gas.
First, calculate the number of moles of carbon in 34 grams. The molar mass of carbon is approximately 12.01 grams/mole.
Moles of carbon = 34 grams / 12.01 grams/mole = 2.831 moles
As the stoichiometry of the reaction shows a 1:1 ratio between carbon and hydrogen, the moles of hydrogen produced would also be 2.831 moles.
The molar mass of hydrogen (H2) is approximately 2 grams/mole.
So, the mass of hydrogen produced = 2.831 moles * 2 grams/mole = 5.662 grams
Therefore, if 34 grams of carbon reacts with an unlimited amount of water, approximately 5.66 grams of hydrogen gas would be formed.
Explanation:
Approximations followed for answer.
If your equation includes 7(CrO4)2, how many Cr's are there?
If your equation includes 7(CrO4)2, how many O's are there?
If an equation includes 7(CrO₄)₂, the numbers of Cr's and O's atoms that are there are 14 and 56 respectively.
How to calculate number of atoms?The number of atoms present in a chemical compound can be calculated by multiplying the subscript of the particular element by any coefficient.
According to this question, 7 moles of chromate with the chemical formula; (CrO₄)₂ is given. The number of oxygen and chromium atoms in this compound can be calculated as follows:
Chromium = 7 (coefficient) × 2 = 14 atomsOxygen = 7 (coefficient) × 8 = 56 atomsLearn more about no of atoms at: https://brainly.com/question/14190064
#SPJ1
Lying in bed you notice that you get cold every time your brother opens the door. This is most closely associated with which step in the scientific method?
Answer:
Making an observation100% sure about that....just believe me
Hope u the best and hope that helps
A student mixes 100. mL of 0.25 M HCl(aq) with 200. mL of 0.50 M HClO4(aq) and then dilutes the mixture with distilled water to a total volume of 500. mL. The [H3O+] in the final solution is closest to
(A) 0.0025 M
(B) 0.12 M
(C) 0.25 M
(D) 0.75 M
Answer:
The answer is B: 0.0025 M
According to molar concentration and dilution concept, the [H₃O+] in the final solution is closest to 0.05 M.
What is molar concentration?Molar concentration is defined as a measure by which concentration of chemical substances present in a solution are determined. It is defined in particular reference to solute concentration in a solution . Most commonly used unit for molar concentration is moles/liter.
The molar concentration depends on change in volume of the solution which is mainly due to thermal expansion. Molar concentration is calculated by the formula, molar concentration=mass/ molar mass ×1/volume of solution in liters.
In terms of moles, it's formula is given as molar concentration= number of moles /volume of solution in liters.In case of 2 solutions concentrated and diluted it is calculated as, M₁V₁=M₂V₂ substitution gives M₂=0.25×100/500=0.05
Learn more about molar concentration,here:
https://brainly.com/question/15532279
#SPJ2
How many moles of KBr are dissolved in 60.2 mL of a 3.50 M solution?
There are 0.2107 moles of KBr are dissolved in 60.2 mL of a 3.50 M solution.
The molarity of a substance is defined as the number of moles of solute present in 1 litre of a solution.
According to the given data, the molarity of the solution tells us that there are 3.50 moles of KBr in 1000mL of solution. But we only have 60.2mL of solution, so with a mathematical rule of three we can calculate the amount of moles in 60.2mL:
1000 ml - 3.50 moles
60.2 ml -x = 60.2 ml× 3.50 moles/1000 ml
x= 60.2 ml -0.2107 moles
So, there are 0.2107 moles of KBr.
To know more about moles here
https://brainly.com/question/29293653
#SPJ1
If you have 50 grams of H2SO4 and excess
Al, how many grams of Al2(SO4)3 are
produced during the following reaction?
2 Al + 3 H2SO4 → Al2(SO4)3 + 3 H2
0.65mol \(Alx_{2} (So_{4} )_{3}\) are produced during the reaction.
What is the molar mass?The mass in grams of one mole of a chemical is its molar mass. A mole is the measurement of the number of things, such as atoms, molecules, and ions, that are present in a substance. Any substance's mole is. Molecules, 6.022 10 23.Divide each element's atomic weight (found in the periodic table) by the number of that element's atoms in the compound. 3. Add up the totals, and then follow the number with the units of grams/mole.The mass of every atom in a molecule, expressed in grams per mole, is known as the molar mass. We first obtain the atomic weights of the different elements in a periodic table to compute a molecule's molar mass. Then, we multiply the total number of atoms by each one's atomic mass.How many grams of Al2(SO4)3 are produced during the following reaction?
2 Al + 3 H2SO4 → Al2(SO4)3 + 3 H2
Molar mas:26.98 →341.15g/mol
All take 35g.
Moles of aluminum=35/26.98=1.29mol.
2mole of aluminum will give=1/2*1.29=0.65
Therefore, 0.65mol \(Alx_{2} (So_{4} )_{3}\).
To learn more about Molar mass, refer to:
https://brainly.com/question/837939
#SPJ9
I can’t figure out the names of these two organic compounds.
Step 1 - Remembering cis vs trans compounds
Whenever a molecule has a double-bond, it allows for cis/trans geometry. We will only see such isomers when the groups bonded to the double bond are different.
We call it "cis" when two identical groups (or similar ones) belong to the same "side" of the molecule. We call it "trans" otherwise. Let's look at an example:
Step 2 - Brief revision on naming organic molecules
a) Count the number of C atoms: this will give you the prefix (met, et, prop, but, pent, ..)
b) Look for double or triple bonds between C atoms: this will give you the infix (-an-, -en-, -in-). Don't forget to specify to which C the double bond is firstly attached.
c) Look for any functional groups or geometrical features (such as cis/trans isomery)
Step 3 - Naming the compound
Let's rewrite the formula of the compound as:
We can see the H are both in the same side of the molecule (bellow the red line). Therefore, this is a cis isomer. We can already exclude all alternatives containing "trans".
Note there are 6 C atoms, which means the prefix must be "hex". The double bond starts in the 2nd C (yellow numbers in the drawing). Therefore, its name will be cis-4-hexene.
Guysss how to explain nuclear chemistry? And define nuclear chemistry ?
Answer:
How do amoeba respire.
Define Diffusion.
Which of the following traits make a good index fossil?
a.were plants instead of animals
b.short-lived as a species
c.large body size
d.small geographic range