Equilibrium expression =\(\frac{[N_2O(g)]^2}{[N_2]^2 [0_2]}\). Hence, option D is correct.
What does equilibrium mean?Equilibrium is generally defined as a state of rest, where there is no change.
The ratio of the concentrations of the reactants and products is known as the equilibrium constant expression.
The equilibrium expression for the reaction is:
\(\frac{[N_2O(g)]^2}{[N_2]^2 [0_2]}\)
Hence, option D is correct.
Learn more about the equilibrium here:
https://brainly.com/question/13463225
#SPJ1
How many calories are in 7501 J ? (1 cal = 4.184 J)
There are different forms of energy on earth. The sun is considered as the elemental form of energy on earth. It is a quantitative property which can be transferred from an object to do work. The amount of calories in 7501 J is 1792.7 calories.
The ability to perform work is defined as the energy. The law of conservation of energy states that energy can neither be created nor be destroyed. The SI unit of energy is Joule.
Here joule is a derived unit equal to the energy expended in applying a force of 1N through a distance of 1m.
1 cal = 4.184 J
7501 J = 1792.7 calories
To know more about energy, visit;
https://brainly.com/question/29763772
#SPJ1
what is the compound formula for FeF2 and how do i write it
Answer:
Iron(II) fluoride
Explanation:
Iron(II) fluoride or ferrous fluoride is an inorganic compound with the molecular formula FeF2. It forms a tetrahydrate FeF2·4H2O that is often referred to by the same names.
Consider this reaction: 6 CO2 + 6 H2O + light equation C6H12O6 + 6 O2
If there were 2.38 x 102 g of H2O, 18.6 moles of CO2, and plenty of light, what would be the theoretical yield of the reaction?
As per the balanced reaction, 6 moles of water gives one mole of glucose. Here the limiting reactant is water. 238 g or 13.2 moles of water will give, 396 g or 2.2 moles of glucose.
What is photosynthesis ?The photosynthetic reaction involves the combination of water and carbon dioxide producing glucose and oxygen gas. The reaction takes place in the presence of light.
As per the given chemical equation 6 moles of water and 6 moles of carbon dioxide gives one mole of glucose.
molar mass of water = 18 g/mol
no. of moles in 238 g of water = 238 /18 = 13.22 moles.
no.of carbon dioxide = 18.6
Thus, water is the limiting reactant here.
Number of moles of glucose produced from 13.2 moles of water is :
= (13.2/6) = 2.2 mole.
molar mass of glucose = 180 g.
Then mass of 2.2 mol = 2.2 × 180 = 396g.
Therefore, the theoretical yield of the reaction will be 396 g of glucose.
Find more on theoretical yield:
https://brainly.com/question/14966377
#SPJ1
You titrate 234.0 mL of a 0.444 M sodium hydroxide solution with 100.0 mL of an unknown concentration sulfuric acid solution. What is the molarity of H2SO4? Show work
The molarity of the sulfuric acid solution used in the titration is 1.038 M.
How to calculate molarity?Molarity is the concentration of a substance in solution, expressed as the number of moles of solute per litre of solution.
Molarity of a solution involved in titration can be calculated using the following expression;
CaVa = CbVb
Where;
Ca = acid concentrationVa = acid volumeCb = base concentrationVb = base volumeAccording to this question, 234.0 mL of a 0.444 M sodium hydroxide solution is titrated with 100.0 mL of an unknown concentration sulfuric acid solution.
100 × Ca = 234 × 0.444
100Ca = 103.87
Ca = 1.038 M.
Learn more about molarity at: https://brainly.com/question/31545539
#SPJ1
Example of change in substance
The original substance has undergone a transformation into a new substance with different properties, indicating a change in the chemical composition of the material.
An example of a change in substance is the process of combustion. When a substance, such as wood, is burned, it undergoes a chemical reaction with oxygen in the air, which produces a new substance: carbon dioxide gas, water vapor, and ash. This change in the chemical composition of the wood means that it has transformed into a completely new substance with different physical and chemical properties.
Another example is the process of electrolysis, where an electric current is passed through a solution containing ions. This can cause a chemical reaction to occur, resulting in the breakdown of the original substance into its component parts or the formation of a new substance.
for more questions on transformation
https://brainly.com/question/29713522
#SPJ11
Why was meteorology such a late developer compared to other branches of science?
Answer:
Because of the difficulties of measuring the atmosphere's properties above the earth's reachable surface
Explanation:
Hello,
In this case, meteorology is the branch of science studying the atmosphere in its weather processes and forecasting and it had a late development because of the difficulties of measuring the atmosphere's properties above the earth's reachable surface. We cannot forget that even nowadays, it is very difficult to predict upcoming weathers with the 100 % assurance and with many days in advance.
Best regards.
Meteorology is developed lately as compared to other branches of science due to far away from the reach of humans.
Meteorology is a late developer compared to other branches of science because the measuring the climatic conditions in the atmosphere is difficult and even impossible without the presence of advance technologies.
To find out the weather as well as climatic conditions can't be measured due to it is not reachable to the human like other materials present on the earth surface so we can conclude that meteorology is developed lately as compared to other branches of science due to far away from the reach of humans.
Learn more: https://brainly.com/question/16565664
What organelle in your cell breaks down food into molecules that the cell can use?
chloroplasts
endoplasmic reticulum
nucleus
mitochondria
Answer:
(D) Mitochondria.
Mitochondria is the cell organelle which breaks down food into energy which is released in the sell in the form of ATP molecules for the cell to use and it stores some of the proteins too.
The organelle in your cell breaks down food into molecules that the cell can use is:
d) Mitochondria
The organelle that breaks down food into molecules that the cell can use is the mitochondria. Mitochondria are often called the "powerhouses" of the cell because they are responsible for producing the cell's energy.
Mitochondria are found in all eukaryotic cells, which are cells that have a nucleus. They are not found in prokaryotic cells, which are cells that do not have a nucleus.
Mitochondria are made up of two membranes, an outer membrane and an inner membrane. The inner membrane is folded into cristae, which increase the surface area of the membrane. This allows more enzymes to be located on the membrane, which helps to increase the efficiency of energy production.
The mitochondria contain a number of enzymes that are involved in the process of cellular respiration. Cellular respiration is a series of chemical reactions that break down food molecules and produce energy in the form of ATP. ATP is the cell's main source of energy, and it is used to power all of the cell's activities.
To know more about organelle here
https://brainly.com/question/2135497
#SPJ6
If 119.3 g of PCI 5 are formed from the reaction of 61.3 g Cl 2 with excess PCI 3. what is the percent yield
PCI 3(g) + Cl2(g) → PCI 5(9)
57.3%
48.6%
51.3%
94.6%
66.3%
66.3% is the percent yield for the reaction PCl3(g) + Cl2(g) -> PCl5(g).
The correct option is E.
What is yield in percent?The % ratio of the theoretical yield to the actual yield is known as the percent yield. It is calculated as the theoretical yield multiplied by 100% divided by the experimental yield. The percent yield is 100% if the theoretical and actual yields are equal.
A greater yield percentage may be an indication that your product is tainted with water, too much reactant, or other impurities. A lower yield percentage could mean that you miscalculated a reactant or spilled some of your product.
How are percent yields calculated?Divide the theoretical yield by the experimental yield. Calculate the percent yield by multiplying this figure by 100.
To know more about Percent yield visit:
https://brainly.com/question/17042787
#SPJ9
The complete question is-
What is the percent yield for the reaction PCl3(g) + Cl2(g) -> PCl5(g). if 119.3 g of PCl5 (M = 208.2 g/mol) are formed when 61.3 g of Cl2 (M = 70.91 g/mol) react with excess PCl3?
a-57.3%
b-48.6%
c-51.3%
d-94.6%
e-66.3%
What type of bonds are shown in this diagram?
metallic bonds
covalent bonds
hydrogen bonds
ionic bonds
Answer:
metallic bonds
Explanation:
atoms in a metallic solid loose their outer electrons and form a regular lattice of positive metallic ions.
The chemical bondings are present between the atoms due to the attractive forces. The bond shown in the diagram represents the metallic bonds. Thus, option A is correct.
What are metallic bonds?A metallic bond is a chemical bonding present due to the electrostatic attractive forces present between the delocalized electrons and the ions of the metals.
The metal produces cations that bond with the electrons delocalized around them. This type of bonding accounts for the malleability and conductivity of the metallic species.
The delocalized electrons are shared by the positively charged metal ions. The cations are largely spread in space. It is seen in the elements of aluminum, magnesium, copper, sodium, zinc, calcium, etc.
Therefore, option A. the metallic bond is seen in the diagram.
Learn more about metallic bonds here:
https://brainly.com/question/20536777
#SPJ2
What is the resource population of the weebugs?
Insects from the genus Cimex known as bed bugs feast on blood, typically at night and skin rashes.
Thus, Their bites can have a variety of negative health repercussions, such as skin rashes, emotional effects, and allergy symptoms.
The effects of bed bug bites on the skin might range from little redness to obvious blisters. Itching is typically prevalent, and symptoms might take anywhere from minutes to days to manifest.
Some people might experience fatigue or a fever. Usually, impacted bodily parts are those that are exposed. There is no known contagious disease that their bites can spread.Vasculitis and regions of dead skin are unusual complications.
Thus, Insects from the genus Cimex known as bed bugs feast on blood, typically at night and skin rashes.
Learn more about Weedbugs, refer to the link:
https://brainly.com/question/21683913
#SPJ1
2HCI + Na₂CO3 → H₂O + CO₂ + 2NaCl
He mixes exactly 235.0 mL of 0.600 M HCI
with 7.472 g Na2CO3.
8.24 g NaCl form. What is the molar
concentration of the salt in the solution?
A. 4.29 x 10-4 M
B. 0.600 M
C. 0.429 M
D. 3.00 x 10 4M
The molar concentration of the salt is 0.600 M. Option B
What is the molar concentration of the salt?We know that the term molar concentration has to do with the number of moles of the salt that is present in one liter of the solution. We have been given the mass of the salt that is formed, we need to obtain the number of moles of the salt that has been formed and use the volume of the solution that have been given in the question to find the molar concentration of the salt.
Mass of the salt = 8.24 g
Molar mass of the salt = 58.5 g/mol
Number of moles of the salt = mass/molar mass
= 8.24 g/ 58.5 g/mol
= 0.14 moles
Volume of the solution = 235.0 mL or 0.235 L
Molar concentration = 0.14 moles/ 0.235 L
= 0.595 M or 0.600 M
Learn more about concentration:https://brainly.com/question/10725862
#SPJ1
2 ml of silver nitrate piece of copper metal 2 ml of lead(ii) nitrate piece of zinc metal (sit for 10 minutes) 1 ml of potassium iodide
The lead(II) nitrate solution has a molarity of 1.2M if 22.00 mL of 2.00 M potassium iodide is required to equilibrate with 18.00 mL of lead(II) nitrate.
The following formula can be used to determine a solution's molarity:
na/nb = CaVa/CbVb
Where;
Ca is the acid concentration.
Cb = base concentration
Va = acid volume
Vb = base volume
na = number of acid moles
nb = number of base moles
The reaction's balanced equation is as follows:
2KNO3 (aq) + PbI2 Pb(NO3)2 (aq) + 2KI (s)
22 × 2/18 × Cb = 2/1
44/18Cb = 2
Cb = 44 ÷ 36
Cb = 1.2M
Since 22.00 mL of 2.00 M potassium iodide is required to equilibrate with 18.00 mL of lead (II) nitrate, the lead(II) nitrate solution's molarity is 1.2M.
To learn more about molarity please click on below link
https://brainly.com/question/27133333
#SPJ4
In which type of rock would scientists most commonly find a fossil of triceratops?
Answer:
shale and siltstone
Explanation:
The Triceratops dinosaur fossils are approximately 70 million years old, because they are found in shale and siltstone that contain volcanic ash radiometrically dated at 70 million years.
Matter are anything that is made up of atoms. The quantity of matter can be observed only on the basis of mass and volume calculation. Therefore, in shale and siltstone, Scientists would most commonly find a fossil of triceratops.
What is matter?Matter is a substance that has some mass and can occupy some volume. The matter is mainly used in science. Matter can be solid, liquid or gas.
Matter is anything that is made up of atoms. Anything around us that can be physically seen and touched are matter. Ice, water and water vapors are example of matter.
So as we saw that matter has some mass so mass can be measured in gram only. Mass can also be represented as number of molecules. We also saw that matter occupy some volume and that volume is measured only in liter.
Scientists would most commonly find a fossil of triceratops in shale and siltstone that contain volcanic ash radiometrically dated at 70 million years.
Therefore, in shale and siltstone, Scientists would most commonly find a fossil of triceratops.
To learn more about matter, here:
https://brainly.com/question/4562319
#SPJ2
A student made a sketch of a potential energy diagram to represent an endothermic reaction.
A curve line graph is shown. The y axis of the graph has the title Potential Energy and kJ written in parenthesis. The x axis of the graph has the title Reaction Pathway. The curve begins at a higher level and ends at a slightly lower level. A broken horizontal line is shown from a point labelled X on the y axis to the point where the curve begins. Another broken horizontal line is shown from a point labeled Y on the y axis to the point where the curve ends.
Explain, using complete sentences, why the diagram made by the student is correct or incorrect. Be sure to also explain what the values of X and Y represent.
Based on the description of the potential energy diagram provided, the diagram made by the student appears to be correct.
The potential energy diagram represents the energy changes that occur during a chemical reaction. In an endothermic reaction, the products have higher potential energy than the reactants, meaning energy is absorbed from the surroundings.
The curve line on the graph indicates the energy changes throughout the reaction pathway. It starts at a higher level, representing the initial potential energy of the reactants. As the reaction progresses, the potential energy decreases, indicating the formation of products with lower potential energy.
The broken horizontal line from point X on the y-axis to the point where the curve begins represents the activation energy (Ea) of the reaction. Activation energy is the energy barrier that must be overcome for the reactants to convert into products.
Point X on the y-axis indicates the potential energy of the reactants at the start of the reaction, and the broken line shows the energy required to initiate the reaction.
The broken horizontal line from point Y on the y-axis to the point where the curve ends represents the potential energy of the products. Point Y represents the potential energy of the products at the end of the reaction.
Overall, the student's diagram correctly represents an endothermic reaction, showing the potential energy changes, the activation energy, and the final potential energy of the products. The curve line starts at a higher level (representing the higher potential energy of the reactants) and ends at a slightly lower level (representing the lower potential energy of the products).
For more such questions on potential energy diagram visit;
https://brainly.com/question/23343697
#SPJ8
The half reaction with a more positive standard reduction potential will
The half reaction with a more positive standard reduction potential will proceed spontaneously in a redox reaction
The half reaction with a more positive standard reduction potential will undergo reduction when compared to the half reaction with a more negative standard reduction potential.
Oxidation-reduction reactions, often known as redox reactions, are a set of chemical reactions that involve electron transfer between reactants. In a redox reaction, one reactant is oxidized, losing electrons, while the other reactant is reduced, gaining electrons.
The oxidation half-reaction is the process of losing electrons and increasing the oxidation number, whereas the reduction half-reaction is the process of gaining electrons and decreasing the oxidation number. The total reaction is referred to as the redox reaction.
Half-reaction:Half-reaction refers to the two parts of an oxidation-reduction reaction that happen separately. A half-reaction must always be either an oxidation reaction or a reduction reaction. It also describes the movement of electrons and hydrogen ions in an equation.
Know more about redox reaction here:
https://brainly.com/question/21851295
#SPJ8
15.0 g of Calcium reacts with excess Oxygen gas to form Calcium Oxide 2Ca + O2 -> 2CaOif the percent yield is 77% what mass of CaO is produced by the rection.
Explanation
Given
Mass of Calcium = 15.0 g
we know the molar mass of Ca = 40,078 g/mol, CaO = 56,0774 g/mol
Solution
Step 1: Fine the moles of Ca
n = m/M where n is the moles, m is the mass and M is the molar mass
n = 15.0g/40.078g/mol
n = 0.374 mol
Step 2: Use stoichiometry to find the moles of CaO
The molar ratio between Ca and CaO is 2:2
Therefore the number of moles of CaO = 0.374 mol
Step 4: Find the theoretical mass of CaO
m = n x M
m = 0.374 mol x 56,0774 g/mol
m = 6.674x10^-3 g
%yield = (actual yield/theoretical yield) x 100
0.77 = actual yield/6.674x10^-3
Actual yield = 5.14x10^-3 g
Answer
Mass of CaO = 5.14x10^-3 g
(a) Write a balanced equation for the coupling reaction of bromobenzene on the metal surface to form biphenyl.
(b) Write balanced equations for the reactions of phenylmagnesium bromide and trityl fluoborate with water.
The balanced equation for the coupling reaction of bromobenzene on the metal surface to form biphenyl is mentioned below.
What is a coupling reaction?The coupling reactions are a class of chemical reactions where unification of two or more hydrocarbons coupled with the help of a metal catalyst.
(a) The balanced equation for the coupling reaction of bromobenzene on the metal surface to form biphenyl is:
2C₆H₅Br + 2Na → (C₆H₅)₂ + 2NaBr
(b) The balanced equations for the reactions of phenylmagnesium bromide and trityl fluoborate with water are:
PhMgBr + H₂O → PhH + MgBrOH
Trityl fluoborate + H₂O → Trityl alcohol + HBF₄
Therefore, the balanced equations are given above.
Learn more about coupling reactions, here:
https://brainly.in/question/26247883
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
A chemist measures the amount of chlorine gas produced during an experiment. He finds that 98.2 of chlorine gas is produced. Calculate the number of moles of chlorine gas produced.
Answer:
\(1.385\ \text{moles}\)
Explanation:
\(m\) = Mass of chlorine gas produced = \(98.2\ \text{g}\)
\(M\) = Molar mass of chlorine gas \(Cl_2\) = \(70.9\ \text{g/mol}\)
Number of moles is given by
\(n=\dfrac{m}{M}\)
\(\Rightarrow n=\dfrac{98.2}{70.9}\)
\(\Rightarrow n=1.385\ \text{moles}\)
Number of moles of chlorine gas produced is \(1.385\ \text{moles}\).
A more electronegative atom A) will have more attraction to the electrons in a chemical bond. B) is more likely to lose an electron. C) is less likely to form a chemical bond. D) is more likely to form an ionic bond with another highly electronegative atom.
Answer: A more electronegative atom will have more attraction to the electrons in a chemical bond.
Explanation:
An atom that is able to attract electrons or shared pair of electrons more towards itself is called an electronegative atom.
For example, fluorine is the most electronegative atom.
Due to its high electronegativity it is able to attract an electropositive atom like H towards itself. As a result, both fluorine and hydrogen will acquire stability by sharing of electrons.
Thus, we can conclude that a more electronegative atom will have more attraction to the electrons in a chemical bond.
Need answer to #6 of my chemistry homework
The actual yield of NaCl produced in the reaction is 9.85 g.
What is combination reaction?A combination reaction is a type of chemical reaction in which two or more substances react to form a single new substance. In other words, the reactants combine or "combine together" to form a product. This type of reaction is also sometimes referred to as a synthesis reaction. Combination reactions often involve the transfer of electrons from one reactant to another, and may involve the breaking and forming of chemical bonds. The general form of a combination reaction can be written as:
A + B → AB
Equation:The balanced chemical equation for the reaction of sodium (Na) with chlorine (Cl₂) to form sodium chloride (NaCl) is:
2Na + Cl₂ → 2NaCl
To determine the limiting reactant, we need to first calculate the number of moles of each reactant:
Number of moles of Na = 8 g / 23 g/mol = 0.348 moles
Number of moles of Cl₂ = 8 g / 71 g/mol = 0.113 moles
According to the stoichiometry of the balanced equation, 2 moles of Na react with 1 mole of Cl₂ to produce 2 moles of NaCl. Therefore, the number of moles of NaCl that can be produced from the given amounts of reactants is limited by the amount of Cl₂ present.
The theoretical yield of NaCl can be calculated based on the limiting reactant, which in this case is Cl₂:
Moles of NaCl = 0.113 moles Cl₂ x (2 moles NaCl / 1 mole Cl₂) = 0.226 moles NaCl
Mass of NaCl = Moles of NaCl x Molar mass of NaCl
Mass of NaCl = 0.226 moles x 58.44 g/mol = 13.22 g
The actual yield of NaCl is given to be 74.5% of the theoretical yield:
Actual yield = 74.5% x 13.22 g = 9.85 g
To know more about combination reaction, click here?
https://brainly.com/question/3664113
#SPJ1
For electricity to flow, what do you need?
A
only a battery
B
only a battery and a light bulb
only a battery, light bulb and wire
D
a battery, light bulb and wire in a closed circuit
Answer:
D
Explanation:
you need battery, light bulb and wire in a close circuit
Answer:
D - a battery, light bulb and wire in a closed circuit.
Explanation:
A battery due to the charge in it.
A light bulb so the energy has somewhere to go to.
A wire in a closed circuit, so that the energy has a place for transport without interruptions.
Can someone please help me on this?
Answer:
a liquid
Explanation:
I'm not for sure but I just looked it up
What mass of carbon dioxide is produced upon complete combustion
Answer:
1 mole CO2 = 44g i.e.by the complete combustion of 12g of carbon, 44g of CO2 is produced.
Explanation:
Answer:
1 mole CO2 = 44g i.e.by the complete combustion of 12g of carbon, 44g of CO2 is produced.
Explanation:
What is the mass of 7.8 x 1022 carbon atoms?
The mass of 7.8 x 10^22 carbon atoms is 1.553 grams.
To determine the mass of 7.8 x 10^22 carbon atoms, we need to use the concept of molar mass and Avogadro's number.
The molar mass of carbon (C) is approximately 12.01 g/mol, which represents the mass of one mole of carbon atoms. Avogadro's number states that there are 6.022 x 10^23 atoms in one mole of any substance.
Now, let's calculate the mass of 7.8 x 10^22 carbon atoms:
Determine the number of moles:
Number of moles = Number of atoms / Avogadro's number
Number of moles = (7.8 x 10^22) / (6.022 x 10^23) = 0.1295 moles
Calculate the mass:
Mass = Number of moles x Molar mass
Mass = 0.1295 moles x 12.01 g/mol = 1.553 g
Therefore, the mass of 7.8 x 10^22 carbon atoms is approximately 1.553 grams.
The calculation is based on the understanding that the molar mass of carbon represents the mass of one mole of carbon atoms. By dividing the given number of atoms by Avogadro's number, we obtain the number of moles. Multiplying the number of moles by the molar mass gives us the mass in grams.
Know more about Avogadro's number here:
https://brainly.com/question/1513182
#SPJ11
Why KHPo4 ignore effective as a buffer but kh2po4 is not
KH2PO4 is a more suitable choice as a buffer because it has a greater buffering capacity due to the presence of the weak acid and its conjugate base.
KHPo4 is not considered an effective buffer compared to KH2PO4 due to its limited buffering capacity. The effectiveness of a buffer is determined by the concentration and dissociation properties of its conjugate acid-base pair.
KH2PO4 is a salt composed of the weak acid H2PO4- and its conjugate base HPO4^2-. In an aqueous solution, KH2PO4 can dissociate to release H+ ions from the H2PO4- component, which acts as a weak acid, and the HPO4^2- component can accept H+ ions, acting as a weak base. This allows KH2PO4 to effectively resist changes in pH when small amounts of acid or base are added to the solution.
On the other hand, KHPo4 consists of the strong acid H3PO4 and the weak base HPO4^2-. H3PO4 fully dissociates in water, providing a large concentration of H+ ions, making it difficult for the HPO4^2- to effectively act as a base and maintain pH stability.
Therefore, KH2PO4 is a more suitable choice as a buffer because it has a greater buffering capacity due to the presence of the weak acid and its conjugate base.
For more question on conjugate
https://brainly.com/question/14684465
#SPJ8
how would you prepare 2000 ml of a pH = 1.50 solution using concentrated (12 M) HCl? (A 2 L volumetric flask is available.) explain procedure steps of solution preparation.
You would need to take 5 mL of the 12 M acid and then make up to the 2000 mL mark.
What is the dilution formula?The dilution formula is a mathematical expression used to calculate the new concentration of a solution . The dilution formula can be used to calculate the volume of a solution required in dilution. To use the formula, you must ensure that the units of concentration and volume are consistent
The final concentration of the solution is = Antilog (-1.5) = 0.03 M
Then;
12 * V = 2 * 0.03
Where V is the initial volume of the acid.
V = 0.005 L or 5 mL
Learn more about dilution formula:https://brainly.com/question/31598121
#SPJ1
Q1. Consider the gravitational interactions among Earth, the Sun, and the Moon. Does this constitute a system? If so, what are its boundaries? Is it open or closed? What forms of energy are involved?
When two objects descend towards one another, the potential energy related to the gravitational field is released (transformed into kinetic energy).
The potential energy that a huge item has in relation to a different massive object due to gravity is known as gravitational energy and gravitational potential energy. When two objects descend towards one another, the potential energy related to the gravitational field is released (transformed into kinetic energy). Bringing two things farther apart increases the gravitational potential energy.
To know more about gravitational, here:
https://brainly.com/question/3009841
#SPJ1
2LiClO+KHSO - Li2SO4 + Cl2 + KOOH
1. How many moles of KOOH is produced, if you started the reaction with 5 moles of
LiCIO?
Answer:
2.5 moles of KOOH are produced.
Explanation:
1)Given data:
Number of moles of KOOH produced = ?
Number of moles of LiClO = 5 mol
Solution:
Chemical equation:
2LiClO + KHSO₄ → Li₂SO₄ + Cl₂ + KOOH
now we will compare the moles of KOOH and LiClO.
LiClO : KOOH
2 : 1
5 : 1/2×5 = 2.5
2.5 moles of KOOH are produced.
You want to go swimming, and the pH of a water in your swimming pool is 7.9. You want it to be between 7.4-7.6. What should you add to the pool to lower its pH?
1. Water
2. Alkali
3. Acid
Answer:
i think Alkali is a right ans