What is impossible for a machine to do?
A. do a greater amount of work than the amount of work done on the machine
B. apply a force in a direction that is different than the direction of the force applied to the machine
C. move an object a greater distance than the distance that part of the machine was moved
D. apply a force that is less than the force that is applied to the machine

Answers

Answer 1

Answer:

C

Explanation:

move an object a greater distance than the distance that part of the machine was moved

Answer 2

Answer:

a, sorry for late answer!!

Explanation:

What Is Impossible For A Machine To Do? A. Do A Greater Amount Of Work Than The Amount Of Work Done On

Related Questions

A 13.0kg iron weightlifting plate has a volume of 1650cm^3. What is the density of the iron plate?

Answers

A 13.0kg iron weightlifting plate has a volume of 1650cm³. Therefore, 7.87g/cm³ is the density of iron plate.

What is density?

The density of a substance is described as its weight per unit volume. In other words, density is the mass-to-volume ratio or weight per unit volume. It quantifies how much "stuff" a thing possesses inside an unit of volume (cubic meter or cubic centimeter).

Density is a measure of how closely stuff is packed together. Archimedes, a Greek scientist, developed the density principle.

density= mass / volume

            = 13000/  1650

            =7.87g/cm³

Therefore, 7.87g/cm³ is the density of  iron plate.

To learn more about density, here:

https://brainly.com/question/13434141

#SPJ9

Why does hot tea brew faster than cold tea? Provide scientific data.

Answers

Answer:

Increased heat makes all the molecules in the tea/water mix vibrate and move around a great deal more, thus increasing the rate of diffusion, and therefore increasing the rate of brewing.

Explanation:

hope i help lol :)

Write the equation for the acid dissociation, write the Ka expression, solve for Ht concentration, then do an ICE chart. Put the values into the Ka expression (the one you solved for Ht and find Ht, convert to pH and input that to 2 decimal place. Or use the Henderson-Hasselbalch equation:
pH = pka, + log ( Base/Acid)
Calculate the pH of a buffer solution consisting of 0.39 M HA (Ka = 8.8 x 10^-6) and 0.2 M NaA.

Answers

Answer:

The pH of the buffer is 4.77

Explanation:

Using Henderson-Hasselbalch equation we can solve the pH of the buffer:

pH = pKa + log [A⁻] / [HA]

Where pH is the pH of the buffer

pKa is -log Ka = 5.056

[A⁻] = [NaA] = 0.2M

[HA] = 0.39M

Replacing:

pH = 5.056+ log [0.2] / [0.39]

pH = 4.77

The pH of the buffer is 4.77

what are the two sources of energy for earths geological systems?

Answers

Answer:

radioactive decay or solar radiation

Explanation:

Which scenario would be classified as a conceptual model?
A. A student thinks of bouncing balls as representing gas molecules.
B. Marshmallows and toothpicks are used to show the composition
of a water molecule.
C. A map and a map scale are used to represent a larger area of land.
D. A weather map shows different temperatures over most of the
United States.

Answers

The correct answer is A. A student thinks of bouncing balls as representing gas molecules.

What is molecules?

When one effectiveness liquefies into another, a resolution is formed. A solution is a homogenous mixture consisting of a solute liquefied into a solvent. The solute is the substance that is being dissolved, while the solvent is the dissolving medium.

Solutions can be formed with numerous different varieties and forms of solutes and solvents. In this department, we will focus on a solution where the solvent is water. An aqueous solution is moisture that contains one or more additional dissolved essence. The dissolved importance in an aqueous resolution may be solids, gases, or different liquids.In directive to be a true explanation, a variety must be stable. When sugar is fully dissolved into water, it can stand for an indefinite quantity of time, and the sugar will not recompense out of the solution. Further, if the sugar-water solution is passed through a filter, it will remain with the water. This is because the liquefied particles in a solution are very small, usually smaller than 1nm in diameter. Solute particles can be particles, ions, or molecules, counting on the classification of nature that has been dissolved.

To learn more about molecules, refer to:

https://brainly.com/question/26044300

#SPJ9

Introduction
Sodium bicarbonate, NaHCO3 (MW 84.007 g/mol), is commonly known as baking soda. Sodium bicarbonate is a solid crystalline and
appears as a white powder. Sodium bicarbonate can be easily be converted to sodium carbonate, Na2CO3 (MW 105.988 g/mol) by
decomposition to produce H₂O and CO₂. This can be accomplished by placing the sample in the oven at 176 deg F.
Unbalanced chemical equation: NaHCO3 (s) + heat-> Na₂CO3 (s)+ H₂O(g) + CO₂(g)
Demonstration Video: [Click here for video]
Percent yield - (actual yield/ theoretical yield) x 100
Purpose
This assignment is designed to teach students about decomposition reactions and determine the percent yield. At the end of the experiment, the
student will have a better understanding of how this assignment will benefit their learning.
Task
-Write a balanced chemical equation
- Calculate the percent yield of the decomposition reaction (Must show your work)

IntroductionSodium bicarbonate, NaHCO3 (MW 84.007 g/mol), is commonly known as baking soda. Sodium bicarbonate

Answers

We can actually deduce here that the purpose of this assignment is to teach students about decomposition reactions and allow them to determine the percent yield.

What is the experiment all about?

By performing the experiment, students will gain a better understanding of the concepts involved and how they relate to their overall learning.

The specific focus of this assignment is the decomposition of sodium bicarbonate (NaHCO3) to produce sodium carbonate (Na2CO3), water (H2O), and carbon dioxide (CO2). The unbalanced chemical equation for this reaction is:

NaHCO3 (s) + heat -> Na2CO3 (s) + H2O (g) + CO2 (g)

To understanding the reaction itself, students will also learn about the concept of percent yield. Percent yield is a measure of the efficiency of a chemical reaction and is calculated by dividing the actual yield of the desired product by the theoretical yield, then multiplying by 100.

This calculation allows students to assess how well the reaction proceeds in terms of producing the expected amount of sodium carbonate.

Learn more about experiment onhttps://brainly.com/question/25303029

#SPJ1

How much ice in grams would have to melt to lower the temperature of 352 mL
of water from 15 ∘C
to 0 ∘C
? (Assume that the density of water is 1.0 g/mL

Answers

Answer:

66 grams of ice would have to melt to lower the temperature of 352 mL of water from 15 °C to 0 °C.

Explanation:

To calculate the amount of ice that would have to melt to lower the temperature of 352 mL of water from 15 °C to 0 °C, we need to use the formula:

Q = m_water * c_water * ΔT_water + m_ice * Lf

where,
Q = the amount of heat transferred,
m_water = the mass of water, c_water is the specific heat capacity of water,
ΔT_water = the change in temperature of water, m_ice = the mass of ice,
Lf = the specific latent heat of fusion of ice.

First, let's calculate the amount of heat transferred to the water:

Q = m_water * c_water * ΔT_water
Q = 352 g * 1.0 cal/(g*°C) * (15-0) °C
Q = 5,280 cal

Next, we can use the specific latent heat of fusion of ice, which is 80 cal/g, to calculate the amount of heat required to melt the ice:

Q = m_ice * Lf
Q = m_ice * 80 cal/g
m_ice = Q / Lf
m_ice = 5,280 cal / 80 cal/g
m_ice = 66 g

HELLLLPPP PLEASEEEEE, Light travels through some materials, but not others. The table shown organizes materials under three headings: transparent, translucent, and opaque.
Transparent: window, ice cube, lens.
Translucent: air, wax paper, jelly fish
Opaque: wood, mirror, water
Which materials are listed under the wrong heading?

Answers

Answer:

hello lets talk here

Explanation:

Answer:

Ice Cube, Water, and Air

Explanation:

An Ice cube is cloudy so you can't exactly see through it. It's Opaque.

You can't look through water clearly. It's Translucent.

You can see straight through air. It's Transparent.

Hope this helps. Have a nice day you amazing bean child

PLEASE HELP...

Balance this nuclear reaction by supplying the missing nucleus. Replace each question mark with an appropriate integer or symbol.
Cf98249 + ? ⟶Db105260+410n

Answers

The balanced form of the nuclear equation is as follows; 249/98 Cf + 15/7 N⟶ 260/105 Db + 4(1/0) n.

What is a nuclear equation?

A nuclear equation is process such as the fission of an atomic nucleus, or the fusion of one or more atomic nuclei and/or subatomic particles in which the number of protons and/or neutrons in a nucleus changes.

According to this question, Californium element is a reactant to produce dubnium and a neutron as products.

However, the law of conservation of mass must be fulfilled by ensuring the mass and atomic numbers of elements in reactant and product side are the same.

249/98 Cf + 15/7 N⟶ 260/105 Db + 4(1/0) n

Learn more about nuclear equation at: https://brainly.com/question/13315150

#SPJ1

Zircons from the basalt flow we’re measured to have 95.8% uranium-238, and 4.2% Lead-206. What is the age of the basalt flow?

Answers

Answer:

5

Explanation:

what processes add methane (CH4) to the atmosphere

Answers

Answer:

Cultivated rice paddies

Drilling of natural deposits

Fossil fuel use

Burning of biomass

Landfills

Explanation:

The bulk of the methane released into the atmosphere are as a result of various human activities.

Cultivated rice paddies are a known source of methaneThe drilling of natural deposits and their exploration can release some methane into the atmosphereBurning of fossil fuel and biomass is a source of methane Landfills produces methane as organic materials begins to decay.

How many grams of lead(II) nitrate, pb(NO3)2,are present in 4.05 moles

Answers

1340 is the answer I think

Answer:

1341.1737 gm in 4.05 moles

Explanation:

From periodic table

  mole weight pb = 207.2  gm

                         N   14.007      *2 = 28.014 g,

                          O  15.99        *6 = 95.94  gm

total= 331.154 gm per mole     * 4.05 moles =

_C4H10 +_02 -> CO2+ _H2O

Balancing Equations

Answers

Answer:

2C4H10 + 13O2 -> 8CO2 + 10H2O

Explanation:

c = 8 8

h = 20 20

o = 26 26


Which one of these anions would have an "ic" ending as an acid?
(FO3)-1
Br-1
(NO3)-1
(SO3)2

Answers

the (so3)2hope this help
The so32 hope this help

An auto mechanic spills 67 mL of 2.6 M H2SO4 solution from a rebuilt auto battery. How many milliliters of 1.3 M NaHCO3 must be poured on the spill to react completely with the sulfuric acid?

Answers

Answer:

2 NaHCO₃ + H₂SO₄  →  Na₂SO₄ + 2 H₂O + 2 CO₂

we are supposed to find the volume of a 1.3 M solution, which has twice the number of moles as H2SO4 in 67 mL of 2.6M solution; since we need 2 moles of NaHCO₃ to react with 1 mole

Number of Moles of H₂SO₄ Spilled:

Since the molarity is 2.6M,

We have 2.6 moles in 1000 mL of the solution

We have 0.26 moles in 100 mL of the solution

Moles in 67mL:

Since we have 0.26 moles in 100 mL

to get the number of moles in 67 mL, we have to find 67% of 0.26

Moles in 67 mL = 67 * 26 / 10000 = 0.1742 moles OR 0.17 moles (approx)

Volume of NaHCO₃ which has (0.17*2) = 0.34 moles:

The molarity of NaHCO₃ is 1.3 M, So:

We have 1.3 moles in 1000 mL

We have 0.13 moles in 100 mL

To get the volume required, we have to find what percent of 0.13 is 0.17:

x*13/100 = 34

13x = 3400

x = 3400 / 13

x = 261.5 %

since 261.5% of 0.13 is 0.34

So, volume which contains 0.34 moles = 261.5% of the volume that contains 0.13 moles

Volume = 261.5% * 100

Volume = 261.5 mL

What is the formula to calculate heat energy required to raise the temperature of any substance?​

Answers

Answer:

\(\huge \dag \sf{Specific \: Heat}\)

Specific Heat is the quantity of heat required to raise the temperature of one gram of a substance by one Celsius degree.Specific heat is a characteristic property that measures how much energy it takes to raise the temperature 1 gram of a material 1°C.

\(\huge\bold\red{Formula}\)

mass x specific heat x change of temperature

Or,

c = Q / (mΔT)

\(\Large\textsf{Hope \: It \: Helped}\)

\({\blue{Formula}}\)

The formula for specific heat is the amount of heat absorbed or released = mass x specific heat x change in temperature.

\({\green{explanation}}\)

Specific heat is the amount of heat required to raise one gram of any substance one degree Celsius or Kelvin.

If the reaction of 23.3 grams of Cr2O3 produces 5.35 grams
of Al2O3, what is the percent yield?

Answers

Answer:

34.2%

Explanation:

We'll begin by writing the balanced equation for the reaction. This is illustrated below:

Cr₂O₃ + 2Al —> Al₂O₃ + 2Cr

Next, we shall determine the mass of Cr₂O₃ that reacted and the mass of Al₂O₃ produced from the balanced equation. This can be obtained as follow:

Molar mass of Cr₂O₃ = (52×2) + (3×16)

= 104 + 48

= 152 g/mol

Mass of Cr₂O₃ from the balanced equation = 152 × 1 = 152 g

Molar mass of Al₂O₃ = (27×2) + (16×3)

= 54 + 48

= 102 g/mol

Mass of Al₂O₃ from the balanced equation = 1 × 102 = 102 g

SUMMARY:

From the balanced equation above,

152 g of Cr₂O₃ reacted to produce 102 g of Al₂O₃.

Next, we shall determine the theoretical yield of Al₂O₃. This can be obtained as follow:

From the balanced equation above,

152 g of Cr₂O₃ reacted to produce 102 g of Al₂O₃.

Therefore, 23.3 g of Cr₂O₃ will react to produce = (23.3 × 102)/152 = 15.64 g of Al₂O₃.

Thus, the theoretical yield of Al₂O₃ is 15.64 g.

Finally, we shall determine the percentage yield of Al₂O₃. This can be obtained as follow:

Actual yield of Al₂O₃ = 5.35 g

Theoretical yield of Al₂O₃ = 15.64 g.

Percentage yield of Al₂O₃ =?

Percentage yield = Actual yield /Theoretical yield × 100

Percentage yield = 5.35 / 15.64 × 100

Percentage yield of Al₂O₃ = 34.2%

moles of each product that would form as a result of the decomposition of aspirin

Answers

The decomposition of aspirin (acetylsalicylic acid,\(C_{9} H_{8} O_{4}\)) can occur through the hydrolysis reaction, resulting in the formation of acetic acid (\(CH_{3} COOH\)) and salicylic acid (\(C_{7} H_{6}O_{3}\)).

The decomposition of aspirin (acetylsalicylic acid, \(C_{9} H_{8} O_{4}\)) can occur through the hydrolysis reaction, resulting in the formation of acetic acid (\(CH_{3} COOH\)) and salicylic acid (\(C_{7} H_{6}O_{3}\)). To determine the moles of each product formed, we need to consider the balanced chemical equation for the reaction:

\(C_{9} H_{8} O_{4} = > C_{7} H_{6}O_{3} +CH_{3} COOH\)

From the equation, we can see that for every 1 mole of aspirin, 1 mole of salicylic acid and 1 mole of acetic acid are produced.

Therefore, the moles of salicylic acid and acetic acid formed will be equal to the number of moles of aspirin that decomposes. If we know the amount of aspirin in moles, we can directly calculate the moles of each product based on stoichiometry.

For more question on aspirin

https://brainly.com/question/25794846

#SPJ8

PLEASE ANSWER QUICKLY!!

100 NaNO3
90
Solute per 100 g of H₂O (g)
0,80
NH,CI
70 KNO3
60
50
40
30
20
10
0
0 10 20 30 40 50 60 70 80 90 100
Temperature (°C)
KCIO3
60 g KNO3 has
been added to
100 g H₂O at
30 °C. What
type of solution
is this?
A. unsaturated
B. saturated
C. supersaturated

PLEASE ANSWER QUICKLY!!100 NaNO390Solute per 100 g of HO (g)0,80NH,CI70 KNO360504030201000 10 20 30 40

Answers

If 60 grams of the substance are added to 100 g of water, the solution can be categorized as supersaturated.

How saturated is this solution?

The graph shows the number of grams that can be dissolved in 100 grams of water at different temperatures. In general, solubility increases with temperature.

According to the graph, at a temperature of 30°C, it is possible to dissolve a total of 48 to 49 grams of \(KNO_{3}\). This information implies that if we add 60 grams at this temperature not all the substance would be dissolved, and therefore the solution would be supersaturated.

Learn more about solubility in https://brainly.com/question/31493083

#SPJ1

The materials and procedures are listed in your virtual lab. You do not need to repeat them here. Please clearly define the dependent and independent variables of the experiment.

Independent

Variable:


Dependent

Variable:

Answers

The experiment looks into how temperature impacts how quickly magnesium metal reacts with hydrochloric acid. The creation of hydrogen gas over time is used to determine the dependent variable, which is the reaction rate.

The experiment can be run at various temperatures to change the experiment's independent variable, which is the reaction mixture's temperature. Higher temperatures cause molecules to move more quickly, increasing the likelihood of reactant collisions and kinetic energy. By enabling more successful collisions between magnesium atoms and hydrochloric acid, can quicken the reaction and increase the amount of hydrogen gas produced. In contrast, it is anticipated that the reaction rate will be slower at lower temperatures since there will be less molecular mobility and fewer successful collisions.

To know more about hydrochloric acid, here

brainly.com/question/15102013

#SPJ1

--The complete Question is, What is the effect of temperature on the rate of reaction between hydrochloric acid and magnesium metal?

The dependent variable in this experiment is the rate of reaction, which can be measured by monitoring the production of hydrogen gas over time. The independent variable is the temperature of the reaction mixture, which can be controlled and varied by conducting the experiment at different temperatures.--

1 . An electromagnetic wave forms when a particle that has an electric charge
experiences which movement?
A. It speeds up
B. It slows down.
C. It changes direction.
D. It makes any of the above motions,

1 . An electromagnetic wave forms when a particle that has an electric chargeexperiences which movement?A.

Answers

Try D l hope u get it right

Which of the following technique is used to purify the impurities that are not very different in chemical properties of element? [a] Gas chromatography [b] Column chromatography [c] TLC [d] HPLC​

Answers

Answer:

Explanation: Liquid Chromatography  

I'm sorry if i'm wrong

which atom would need more energy to lose an electron Be or N?

Answers

Ionization energy i think
I hoped I helped

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

A student performed a recrystallization and after the solid dissolved, the solution was immediately placed in an ice bath. Within a few seconds, a large amount of solid formed and was collected by vacuum filtration. The percent recovery was high but the melting point of the dried solid showed that the solid was contaminated with impurities. Could you explain very specifically why it happened?

Answers

You poop on a pop tart smell like a raw tart you’re welcome

Which statement about stars is correct?


A. Star formation begins in a nebula.

B. White dwarfs become main-sequence stars when they gain mass.

C. Supergiants are stars that can absorb black holes.

D. Main-sequence stars are formed by comets.

Answers

Answer:

A. star formation begins in a nebula.

Explanation:

Which factor does not influence whether a substance will be a liquid at room temperature and normal atmospheric pressure?
O molecular mass
O surface tension
O molecular shape
O strength of intermolecular forces

20pts

Answers

The correct answer is Molecular mass
Answer:
Surface tension
Hope it helps

What is the chemical name of the compound NH4SCN?

Answers

Its called "Ammonium thiocyanate" Have a great day!! <3

Answer:

it is called Ammonium Thiocyanate or Thiourea

Explanation:

it is made made up of 2 nitrogen atoms, 4 hydrogen atoms, 1 sulfur atom and 1 carbon atom. stay safe and have a great day! TPWK

What is the definition of lava?

Answers

Answer:

Lava, magma (molten rock) emerging as a liquid onto Earth's surface. The term lava is also used for the solidified rock formed by the cooling of a molten lava flow.

Explanation:

A balloon containing 7.2 L of gas at 27℃ and 760 mmHg is launched into the atmosphere. The balloon travels upward before bursting where the temperature is -32℃ and the pressure is 9.76 mmHg. What is the volume of the balloon just before it bursts?
A. 660 L
B. 45.0 L
C. 560 L
D. 450 L

Answers

B. 45.0 L.The balloon has a 45.0 L volume shortly before it bursts.

When temperature is held constant, a gas's volume and pressure have an inverse relationship. This implies that the volume increases as the pressure falls.

Using the Ideal Gas Law, we can calculate the change in volume with the following equation:

\(\frac{V2}{T2} = \frac{V1}{T1}\)

where T1 denotes the starting temperature, T2 denotes the finished temperature, V1 denotes the starting volume, and V2 is the finished volume.

Given:

V1 = 7.2 L

T1 = 27℃ = 300 K

T2 = -32℃ = 241 K

We can solve for V2:

\(V2 = \frac{(V1 * T2) }{ T1} \\\)

\(V2 =\frac{ (7.2 L * 241 K) }{ 300 K }\\V2 = 45.0 L\)

Therefore, the volume of the balloon just before it bursts is 45.0 L.

learn more about Ideal Gas Law Refer:brainly.com/question/28257995

#SPJ1

Other Questions
A+5560557075808590B5560657075808590HH-5560657075808590DH1+60556570758085902) Four sets of data are shown in box-and-whisker plots. Which set has the largest MEDIAN?)B) BOCD) D Two ice skaters stand together as illustrated in Figure (a) below. They "push off" and travel directly away from each other, the boy with a velocity of v = 0.540 m/s to the left. If the boy weighs 747 N and the girl weighs 497 N, what is the girl's velocity (in m/s) after they push off? (Consider the ice to be frictionless.) strabismus during the critical period leads to visual cortex responses in adulthood that are: part c. chlorine is used extensively as a disinfectant and bleaching agent. without regard to adverse effects or costs, would bromine be a more or less effective disinfectant and bleaching agent? explain. 5. part c. is fluorine gas predicted to be more or less reactive than chlorine gas? explain. 6. part c. not much is known of the chemistry of astatine. would you expect astatine to more or less reactive than iodine? explain. 7. part e.2. predict the reactivity of silicon metal relative to that of magnesium and aluminum. explain. KB. If the net present value of a project is zero, the project is earning a required rate of return equal to: In the United States, which of the following types of elections typically receives the lowest turnout?A.primary electionsB.presidential electionsC.midterm electionsD.general elections The mean distance between the earth and the sun is 1. 5010^11 m. The average intensity of solar radiation incident on the upper atmosphere of the earth is 1390 w/m2. Assuming that the sun emits radiation uniformly in all directions, determine the total power radiated by the sun. Convert the polar equation to a rectangular equation, f=7 /7+3 sin Simplify the rectangular equation by moving all of the terms to the left side of the equation, and combining like forms. The right side of the equation will then be 0 Enter the left side of the resulting equation . -------- = 0 1. What are the sub-atomic particles of Ti+ --50 what is the of the 8 phases of the moon average mass of adult cat is normally distributed with a mean mass of 10 kg and a standard deviation of 1.8 kg. what percentage of cats would have mass more than 12 kg? what percentage of cats would have mass between 7.2 kg and 9.8 kg? round answers to two decimals, if necessary. make sure to include % sign. Which of the points shown below are on the line given by the equation y = 4x?Check all that apply. Kitchen Innovations, inc. is considering introducing a new line of toaster ovens Before proceeding with a more thorough analysis, the company wants to know what the financial break even quantity is for the project. The data they have gathered are as follows: The company believes it will be able to produce and sell 10,000 units per year at a retail price of $100 each Variable costs for the project are $25 per unit Fixed costs have been estimated as $200.000 per year The production equipment needed for the project will cost $400,000, which will be depreciated to cover its 5 year estimated life on a straight line basis . The company tax rate is 27%. A. 8,740 B. 7.617 C. 3,734 D. 10,814 E. 8,684 t: Linear Regression Use linear regression to find the equation for the linear function that best fits this data. Round both numbers to two decimal places. Write your final answer in a form of an equation y mx + b X 1 2 3 4 5 6 y 88 129 153 162 101 116 Looking at the equation, 5x + 6 = 46, willx = 7 make the equation true?Why or why not? What is 19 roman numeral You are the Chief Underwriter of Debt Products for Mutual Life Insurance Company. The institution's Senior Lending Officer walks into your office and shares the following:"I'm short on my quota of deals for this year and my wife just told me that her BMW needs a new transmission. I'm trying to finance a 300,000 square foot office building. The Property will appraise at a 6.5% cap all day long. I've offered The Borrower two financing alternatives, Food contents before and now What innovations led to the Industrial Revolution? -The Second Agricultural Revolution: -The Textile Industry: Twenty-four out of forty pies at a Bake Sale Are cocount pies. What percent of the pies is cocount? A. 24% B. 40% C. 60% D. 75%