There are several variations of the Aldol reaction. Which of the following types ofreactants leads to only one possible product with the Aldol condensation reaction?A) Two different aldehydes with alfa-hydrogens are able to form a single aldolcondensation product.B) Two different ketones with alfa-hydrogens are able to form a single aldolcondensation product.C) Any aldehyde and ketone mixed together can react to form a single condensationproduct.D) Any pair of aldehyde or ketone reactants where one of the reactants has no alfa-hydrogens will lead to a single aldol product.
Option D; Any pair of aldehyde or ketone reactants where one of the reactants has no alfa-hydrogens will lead to a single aldol product.
Aldehydes are carbonyl compounds that are produced both naturally and artificially and are present everywhere in the environment. Aldehydes are reactive species, therefore naturally, they are hazardous to the body. Any member of the family of organic compounds known as an aldehyde contains a carbon atom that also shares a single bond with a hydrogen atom, a double bond with an oxygen atom, and a double bond with another atom or group of atoms (designated R in general chemical formulas and structure diagrams). All aldehydes have what is known as the carbonyl group, a double bond between carbon and oxygen. Many aldehydes have pleasant aromas, and in theory, they are created by dehydrogenating (removing hydrogen) alcohols, which is how the word "aldehyde" originated.
Learn more about aldehyde here:
https://brainly.com/question/29756072
#SPJ4
how do i get money in real life
Teaching, working at the restaurant, online work and freelancing are the work that make money.
How do I get money in real life?In real life, we can get money by doing teaching in the school or academy, working at the restaurant or any other public places. Freelancing and online teaching are the best jobs for making good money. Doing small business able you to make good money in a short period of time. Make deliveries on Amazon and start your own business. So there are a lot of jobs for making money and better your financial condition.
So we can conclude that teaching, working at the restaurant, online work and freelancing are the work that make money.
Learn more about money here: https://brainly.com/question/24373500
#SPJ1
The composition of a compound is 28.73% K, 1.48% H, 22.76% P, and 47.03% O. The molar mass of the
compound is 136.1 g/mol.
I
The compound has an empirical formula of \(K_2H_2P_2O_8\) and a molecular formula of \(K_2HPO_4\).
The given compound has a percent composition of K = 28.73%, H = 1.48%, P = 22.76%, and O = 47.03%. Its molar mass is 136.1 g/mol. To determine its molecular formula, we need to find its empirical formula and calculate its molecular formula from its empirical formula.The empirical formula is the smallest whole number ratio of atoms in a compound. It can be determined by converting the percent composition of the elements into their respective moles and dividing each by the smallest number of moles calculated. The moles of K, H, P, and O in 100 g of the compound are: K = 28.73 g x (1 mol/39.1 g) = 0.734 molH = 1.48 g x (1 mol/1.01 g) = 1.46 molP = 22.76 g x (1 mol/30.97 g) = 0.736 molO = 47.03 g x (1 mol/16.00 g) = 2.94 molDividing each by the smallest number of moles gives the following ratios: K = 0.734/0.734 = 1H = 1.46/0.734 = 2P = 0.736/0.734 = 1.002O = 2.94/0.734 = 4. The empirical formula of the compound is \(K_2H_2P_2O_8\). To calculate the molecular formula, we need to determine the factor by which the empirical formula should be multiplied to obtain the molecular formula. This can be done by comparing the molar mass of the empirical formula to the molar mass of the compound.The molar mass of \(K_2H_2P_2O_8\) is: \(M(K_2H_2P_2O_8)\) = (2 x 39.1 g/mol) + (2 x 1.01 g/mol) + (2 x 30.97 g/mol) + (8 x 16.00 g/mol) = 276.2 g/mol. The factor by which the empirical formula should be multiplied is: M(molecular formula)/M(empirical formula) = 136.1 g/mol/276.2 g/mol = 0.4935. The molecular formula is obtained by multiplying the empirical formula by this factor: \(K_2H_2P_2O_8 * 0.4935 = K_2HPO_4\). Therefore, the molecular formula of the compound is \(K_2HPO_4\).The molecular formula of the given compound having a composition of 28.73% K, 1.48% H, 22.76% P, and 47.03% O with a molar mass of 136.1 g/mol is \(K_2HPO_4\). The empirical formula of the compound is \(K_2H_2P_2O_8\). The compound's molecular formula is calculated by determining the factor by which the empirical formula should be multiplied to obtain the molecular formula. The factor is M(molecular formula)/M(empirical formula) = 136.1 g/mol/276.2 g/mol = 0.4935. The molecular formula of the compound is obtained by multiplying the empirical formula by this factor, resulting in the molecular formula \(K_2HPO_4\).For more questions on empirical formula
https://brainly.com/question/13058832
#SPJ8
The correct question would be as
The composition of a compound is 28.73% K. 1.48% H, 22.76% P, and 47.03% O. The molar mass of the compound is 136.1 g/mol. What is the Molecular Formula of the compound?
\(KH_2PO_4\\KH_3PO_4\\K_2H_4P_20_{12}\\K_2H_3PO_6\)
What is the coefficient for sodium chloride when this equation is balanced?
Answer:
To resolve this, we need to place the coefficient “2” in front of the sodium in the reactant, to give the equation shown below. 2 Na (s) + Cl 2 (g) → 2 NaCl (s) In this equation, there are two sodiums in the reactants, two sodiums in the products, two chlorines in the reactants and two chlorines in the products; the equation is now balanced.
Explanation:
b) 2.38 gm of a metal on treatment with nitric acid and sub sequent ignition gave 3.022 gm of the oxide. Specific heat of the metal is 0.055, calculate the extra atomic weight.
The extra atomic weight in a metal on treatment with nitric acid is 100.361 g/mol.
How to calculate extra weight?The first step is to calculate the mass of oxygen in the oxide formed:
Mass of oxygen = Mass of oxide - Mass of metal
Mass of oxygen = 3.022 g - 2.38 g
Mass of oxygen = 0.642 g
Use the specific heat of the metal to determine its identity:
specific heat = 6.4 / atomic weight
Solving for atomic weight:
atomic weight = 6.4 / specific heat
atomic weight = 6.4 / 0.055
atomic weight = 116.36 g/mol
The atomic weight to calculate the extra atomic weight:
extra atomic weight = atomic weight - atomic weight of oxygen
extra atomic weight = 116.36 g/mol - 15.999 g/mol
extra atomic weight = 100.361 g/mol
Therefore, the extra atomic weight is 100.361 g/mol.
Find out more on nitric acid here: https://brainly.com/question/22698468
#SPJ1
Create an isotope of the atom on the
holotable. Click the red submit button when
you are done.
The diagrammatic illustration showing the reference of an isotope of the atom on the holotable is shown in the image attached below.
An isotope is known as one or even more species or forms of an atom that share some similar and different characteristics from each other.
e.g
An isotope has the same atomic number and chemical properties.They have the same number of protons and electrons.They also have a different number of neutrons, atomic mass numbers, and different physical properties.Since we are not given any atom, Let's use Hydrogen for an example:
Hydrogen is the first element on the periodic table. It is denoted by the chemical symbol H and is highly regarded as the most abundant element.
Its oxidation state is +1 and it exhibits three isotopes known as protium ¹₁H , deuterium ²₁H , and tritium ³₁H.
The protium consist of only 1 proton and 1 electronThe deuterium consists of 1 proton, 1 neutron, and 1 electronThe tritium consists of 1 proton, 2 neutrons. and 1 electron.
Therefore, from the above explanation, we can conclude that we've understood what is an isotope and how to draw the types of an isotope of a hydrogen atom.
Learn more about hydrogen here:
https://brainly.com/question/943897?referrer=searchResults
Multiplying each value by two gives
the ratio below. What is the empirical
formula for the compound?
20
5 C 8 H
:
2
1) C₂.5H4O 2) C5H8O₂
3) C5H4O 4) C5H4O2
Enter the answer choice number.
The chemical formula of a combination that provides the quantities (ratios) of the elements contained in the complex but not the actual numbers or order of atoms is known as an empirical formula. This would be the elemental compound's lowest whole integer percentage.
What is an empirical formula in chemistry?The empirical formula of a chemical substance in chemistry is the simplest whole number quantity of atoms contained in the product. [1] As an illustration, the empirical formula of sulfur monoxide, or SO, is merely SO, as is the empirical formula of disulfur dioxide, S2O2.
Thus, sulfur monoxide and disulfur dioxide, both sulfur and oxygen molecules, have the same empirical formula. Their molecular formulas, which describe the amount of atoms in each molecule of a chemical substance, are, however, not identical.
Learn more about empirical formula
https://brainly.com/question/14044066
#SPJ1
Answer:
2
Explanation:
A reaction occurs in a calorimeter, resulting in the starting temperature of 38.8 ℃ and final temperature 21.0 ℃. What can you say about the reaction and the enthalpy change (ΔH) during the reaction?
Answer:
hola comoe stas
Explanation:
gracias x los puntos
Mention one structural difference between oligosaccharides and polysaccharides.
One structural difference between oligosaccharides and polysaccharides is their respective chain lengths. Oligosaccharides are composed of a relatively small number of monosaccharide units (typically 3 to 10), whereas polysaccharides consist of a larger number of monosaccharide units, often hundreds or thousands. This difference in chain length gives rise to variations in their properties and functions.
\(\huge{\mathcal{\colorbox{black}{\textcolor{lime}{\textsf{I hope this helps !}}}}}\)
♥️ \(\large{\textcolor{red}{\underline{\texttt{SUMIT ROY (:}}}}\)
which of the following has 54 electrons? group of answer choices 118sn4 128te2- 112cd 132xe 132xe2
128Te-2 has 54 electrons because it is a negative ion of tellurium, which has an atomic number of 52. The two extra electrons are what give it the negative charge.
Number of electrons present in the given compound = atomic number + negative charge on the atom - positive charge on the atom
(a) Given that For Te-2
The Atomic number of Te = 52
The Charge on Te-2 present is = -2
So, Number of electrons = 52+2 = 54 .
(b) Given that for 132Xe+
The atomic number of Xe = 54
The Charge on Xe+ present is = +1
So, Number of electrons = 54 - 1 = 53
(c) Given that for 118Sn+4
The atomic number of Sn+4 = 50
The Charge on Sn+4 present is = +4
So, Number of electrons = 50 - 4 = 46
(d) Given that for 132Xe+2
The atomic number of Xe = 54
The Charge on Xe+2 present is = +2
So, Number of electrons = 54 - 2 = 52
(e) Given that for 112Cd
The atomic number of Cd = 48
The Charge on Cd present is = 0
So, Number of electrons = 48
To learn more about electrons click here https://brainly.com/question/28977387
#SPJ4
complete question: Which of the following has 54 electrons? Group of answer choices
128Te2-
132Xe+
118Sn4+
132Xe2+
112Cd
Use the PhET simulation to identify what happens to the concentrations of a dilute Drink mix mixture or a pure Drink mix solution for the following scenarios. A pure Drink mix solution can be obtained by draining all the mixture, then adding Drink mix to the container as a Solution (radio button in the upper right area of the simulation). Note that the Concentration meter can be placed toward the bottom of the container or in the stream of the Drink mix. Drag the appropriate items to their respective bins.
Hello user, you did not add a picture of an attachment to enable me help you solve this problem. Please check the attachment I added i believe it is the question that needs to be solved.
Explanation:
1. In the first column
INCREASE CONCENTRATION: these are the items that needs to be placed in this bin
a. Add drink mix solid to a diluted mixture of drink mix in pure water
b. Add drink mix solution to a diluted mixture of drink mix in pure water
c. Add drink mix solid to pure drink mix solution
d Evaporate water from a diluted mixture of drink mix in pure water
e Evaporate water from pure drink mix solution
2. The items below are what should be placed in this bin,DECREASE CONCENTRATION:
a. Add water to a diluted mixture of drink mix in pure water
b. Add water to pure drink mix solution
3. These items here should be placed here. DOES NOT AFFECT CONCENTRATION:
a. Add pure drink mix solution to pure drink mix solution
b. Drain the pure drink mix solution
c. Drain the diluted mixture
How do the physical and chemical
properties of the glass cleaner, glass, and paper
towels enable these items to be used for their
intended purposes?
Both physical and chemical properties helps in performing function to these materials.
The physical and chemical properties of materials enable them to do their functions because their physical and chemical properties is responsible for their structure as well as helps in performing their functions. The physical properties provides the shape and components which helps in their function and the chemical properties of the material gives strength and support to the object so that it can perform its function very well.
Learn more: https://brainly.com/question/24638765
Groups are electronegativity increases
(3) because they all have the same number of
(2) that show elements that are
(5) are sometimes called families. Periods are
(6) that show elements with the same number of
(7)
A) If we were to fill in the blanks:(3) because they all have the same number of [valence electrons] (2) that show elements that are [chemically similar] (5) are sometimes called families. Periods are [rows] (6) that show elements with the same number of [electron shells or energy levels]
The statements provided seem incomplete, and it's not clear what exactly needs to be filled in the blanks. However, I can provide some general information about electronegativity, groups, periods, and families in the context of the periodic table.
Electronegativity: Electronegativity is a measure of an atom's ability to attract electrons in a chemical bond. It generally increases from left to right across a period and decreases from top to bottom within a group on the periodic table.
Elements with higher electronegativity tend to attract electrons more strongly, whereas elements with lower electronegativity have a weaker attraction for electrons.
Groups: Groups in the periodic table refer to the vertical columns. Elements within the same group have similar chemical properties and the same number of valence electrons, which are the electrons in the outermost shell of an atom.
This similarity in valence electrons contributes to similar chemical behavior among elements in the same group.
Periods: Periods in the periodic table refer to the horizontal rows. Elements within the same period have the same number of electron shells or energy levels. However, elements within the same period may have different chemical properties because they have different numbers of valence electrons.
Families: Families are sometimes used as an alternative term for groups. They are groups of elements that share similar chemical properties due to their similar electronic configurations and valence electron arrangements.
For more such questions on elements visit:
https://brainly.com/question/18096867
#SPJ11
When I was a boy, Uncle Wilbur let me watch as he analyzed the iron content of runoff from his banana ranch. A 25.0-mL sample was acidified with nitric acid and treated with excess KSCN to form a red complex. (KSCN itself is colorless.) The solution was then diluted to 100.0 mL and put in a variable-path length cell. For comparison, a 10.0-mL reference sample of 6.74 times 10^-4 M Fe^3+ was treated with HNO_3 and KSCN and diluted to 50.0 mL, The reference was placed in a cell with a 1.00-cm light path. The runoff sample exhibited the same absorbance as the reference when the path length of the runoff cell was 2.41 cm. What was the concentration of iron in Uncle Wilbur's runoff?
Answer:
C = 2.24x10⁻⁴ M
Explanation:
The concentration of iron in Uncle Wilbur's runoff can be calculated using Beer-Lambert law:
\( A = \epsilon*C*l \) (1)
Where:
A: is the absorbance of the compound
ε: is the molar absorptivity of the compound
C: is the concentration of the compound
l: is the optical path length
Since the runoff sample exhibited the same absorbance as the reference sample, we can find the concentration using equation (1):
\( \epsilon*C_{1}*l_{1} = \epsilon*C_{2}*l_{2} \) (2)
Where:
Subscripst 1 and 2 refer to Uncle Wilbur's runoff and to reference sample, respectively.
l₁ = 2.41 cm
l₂ = 1.00 cm
We can find C₂ as follows:
\( C_{2} = \frac{C_{2i}*V_{i}}{V_{f}} \) (3)
Where:
\(C_{2i}\): is the initial concentration of the reference sample = 6.74x10⁻⁴ M
\(V_{i}\): is the initial volume = 10.0 mL
\(V_{f}\): is the final volume = 50.0 mL
\( C_{2} = \frac{6.74 \cdot 10^{-4} M*10.0 mL}{50.0 mL} = 1.35 \cdot 10^{-4} M \)
Now, we can find C₁ using equation (2):
\( C_{1} = \frac{C_{2}*l_{2}}{l_{1}} = \frac{1.35 \cdot 10^{-4} M*1.00 cm}{2.41 cm} = 5.60 \cdot 10^{-5} M \)
Finally, since the runoff solution was diluted to 100.0 mL, the initial concentration can be calculated using equation (3) for \(C_{1i}\):
\(C_{1i} = \frac{C_{1}*V_{f}}{V_{i}} = \frac{5.60 \cdot 10^{-5} M*100.0 mL}{25.0 mL} = 2.24 \cdot 10^{-4} M\)
Therefore, the concentration of iron in Uncle Wilbur's runoff is 2.24x10⁻⁴ M.
I hope it helps you!
Refer to the Bohr model and the periodic table to answer the following
questions.
Element #2
00
O
o
00
21
What element does this Bohr Model representa
(A) Lithium
B Potassium
Magnesium
(D) Sodium
Answer:
D) Sodium
Explanation: The atomic number of sodium is 11 and its electronic configuration is 2,8,1.
Hope it helps you:)))))
Have a good day.
What is the wavelength of a wave that has a frequency of 60 Hz and a speed
of 45 m/s?
O A. 0.75 m
O B. 15 m
O c. 1.3 m
D. 2700 m
The wavelength of the wave having a frequency of 60 Hz and a speed of 45 m/s is 0.75 m (Option A)
Relationship between velocity, frequency and wavelengthThe velocity, frequency and wavelength are related according to the following equation:
v = λf
where
v is the velocityλ is the wavelengthf is the frequencyHow to determine the wavelengthFrequency (f) = 60 HzVelocity (v) = 45 m/sWavelength (λ) = ?λ = v / f
λ = 45 / 60
λ = 0.75 m
Learn more about wave:
https://brainly.com/question/14630790
#SPJ1
Which is an advantage of using gymnosperms as decorative outdoor plants around homes and businesses?
Most of them do not grow very tall.
Most of them stay green all year.
All of them produce colorful flowers,
All of them have sharp needle-like leaves.
Answer:
i just took the test the correct answer is "most of them stay green all year"
Explanation:
Answer:
its B :)
Explanation:
cuz im mr beast
What process is represented by this redox equation?
C6H12O6 + 602 -> 6H20 + 6CO2
A. Rusting
B. Photosynthesis
C. Cellular respiration
D. Combustion
The redox equation C6H12O6 + 6O2 -> 6H2O + 6CO2 represents the process of cellular respiration. Option C
Cellular respiration is a biochemical process that occurs in living organisms, including plants and animals, to convert organic compounds, such as glucose (C6H12O6), into usable energy in the form of adenosine triphosphate (ATP). It is the primary process by which cells derive energy to carry out their functions.
In the given equation, glucose (C6H12O6) is being oxidized, losing electrons, and releasing carbon dioxide (CO2) as a byproduct. This oxidation process results in the production of energy-rich molecules, such as ATP.
Additionally, oxygen (O2) is being reduced, accepting the electrons from glucose and combining with hydrogen (H) to form water (H2O). This reduction process allows for the transfer of electrons and the generation of energy.
The process of cellular respiration is essential for the survival and functioning of organisms, as it provides the necessary energy for various metabolic activities, growth, and maintenance of cellular processes.
It is a fundamental metabolic pathway found in both plants and animals, enabling them to extract energy from organic molecules through the oxidation of glucose or other fuel sources.
Therefore, option C, cellular respiration, is the correct answer that represents the process described by the given redox equation.
For more such questions on redox equation visit:
https://brainly.com/question/21851295
#SPJ8
0.350g of an organic compound gave 100ml of Nitrogen collected at
250K temperature and 700mm pressure. Calculate the percentage
composition of Nitrogen in the compound.
Use Dumas method
The percentage composition of Nitrogen in the compound is 35.71%
How to determine the mole of nitrogenVolume (V) = 100 mL = 100 / 1000 = 0.1 LPressure (P) = 700 mmHg Temperature (T) = 250 KGas constant (R) = 62.364 torr.L/Kmol Number of mole (n) =?Using the ideal gas equation, the mole of nitrogen can be obtained as follow
PV = nRT
n = PV / RT
n = (700 × 0.1) / ( 62.364 × 250)
n = 0.00448 mole
How to determine the mass of nitrogenMole of nitrogen = 0.00448 moleMolar mass of nitrogen = 28 g/molMass of nitrogen = ?Mass = mole × molar mass
Mass of nitrogen = 0.00448 × 28
Mass of nitrogen = 0.125 g
How to determine the percentage of nitrogenMass of nitrogen = 0.125 gMass of compound = 0.35 gPercentage of nitrogen =?Percentage = (mass of element / mass of compound) × 100
Percentage of nitrogen = (0.125 / 0.35) × 100
Percentage of nitrogen = 35.71%
Learn more about mass composition:
https://brainly.com/question/11617445
#SPJ1
Calculation Questions (2 Questions, 12 Points Each)1. Electrical charge is sometimes reported in coulombs (C). On this scale, 1 electronhas a charge of -1.6 x 10-19 C. Suppose your body acquires a -125 mC charge on adry day. How many excess electrons has it acquired?
Calculations:
• Let ,x , represent electron in a body.
,• use the following formula tocalculagte excess electrons acquired.
,• Charge = 125mC /10000 =1.25 x10^-2
\(\begin{gathered} \text{Charge = electron }\cdot\text{ electron charge } \\ 1.25X10^{-2\text{ }}=\text{ x }\cdot1.6X10^{-19} \\ x\text{ = }\frac{1.25X10^{-2}}{1.6X10^{-19}} \\ \text{ }\therefore x\text{= }7.8125X10^{-22} \end{gathered}\)This means that there are 7.8125x10^-22 excess electron aqcuired.write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
3 elements that have similar properties
Answer:The elements in the first column of the Periodic Table (other than hydrogen) are known as Group 1A metals, or alkali metals. When you compare the chemical properties of these elements (lithium, sodium, potassium, rubidium, cesium, and francium), what you'll notice is that they are all remarkably similar.
Explanation:
Lithium, sodium, and potassium are the three elements from group number 1 of the periodic table that has similar chemical and physical properties, these group 1 metals are also known as alkali metals.
What is the atomic number?The total number of protons present in an atom is known as the atomic number of that atom. The atomic number has no correlation either with the number of neutrons or the number of electrons present inside an atom.
Group 1 metals, often known as alkali metals, are a trio of elements from the periodic table that have similar chemical and physical characteristics. They are lithium, sodium, and potassium.
Thus, Lithium, sodium, and potassium are the three elements from group number 1 of the periodic table that has similar chemical and physical properties.
To learn more about the atomic number from here, refer to the links;
brainly.com/question/14190064
#SPJ2
When determining whether the forces acting on an object are balanced or unbalanced, you need to know how much force is
applied to the object. What is force measured in?
ASAP help
Answer:
Force is measured in Newtons
Explanation:
To find normal force on an incline, use the equation N = mg cos(x), “m” being the object's mass, “g” being the acceleration of gravity, and “x” being the angle of incline. Then, use a calculator to find the cosine of the angle and write down that value.
cl-+peg=hcl+peg rate law, rate constant k
a. The rate law for this reaction is: Rate = k[Cl] [H₂]. This means that the rate of the reaction is directly proportional to the concentrations of both Cl and H₂ molecules.
What is rate law?Rate law is an equation that describes the rate of a chemical reaction as a function of the concentrations of reactants. The rate law allows us to describe how the rate of a reaction changes when the concentrations of reactants are changed. It is derived from the rate equation, which is a mathematical expression that can be used to calculate the rate of a reaction from the concentrations of the reactants and the rate constant.
b. The rate law for this reaction is: Rate = k[O] [Os]. This means that the rate of the reaction is directly proportional to the concentrations of both O and Os molecules.
c. The rate law for this reaction is: Rate = k[NO₂]₂. This means that the rate of the reaction is directly proportional to the square of the concentration of NO₂ molecules.
To learn more about rate law
https://brainly.com/question/16981791
#SPJ1
Complete Question:
When two substances combine to form a mixture, the properties of the substances change. True False
Answer:
Tell students that sometimes when two (or more) substances are mixed together, a change occurs and another substance (or substances) is created. This is called a chemical reaction. Gas may form, heat may be produced, and color may change. These types of changes indicate that a chemical reaction has occurred.
ACHIEVE (Sapling) CHEMISTRY ASSESSMENT:
Question(please help):
Convert 5.90km/s to units of meters per hour. Show the unit analysis by dragging conversion factors into the uni-factor slots.
CH4 Structural formulas
Explanation:
Methane = CH4(formula)
Problem 1. What masses of 15% and 20% solutions are needed to prepare 200 g of 17% solution?
Problem 2. What masses of 18% and 5% solutions are needed to prepare 300 g of 7% solution?
Problem 3. 200 g of 15% and 350 g of 20% solutions were mixed. Calculate mass percentage of final solution.
Problem 4. 300 g of 15% solution and 35 g of solute were mixed. Calculate mass percentage of final solution.
Problem 5. 400 g of 25% solution and 150 g of water were mixed. Calculate mass percentage of final solution.
Problem 1:
we need 80 g of the 15% solution and 120 g of the 20% solution.
Let x be the mass of the 15% solution needed and y be the mass of the 20% solution needed.
x + y = 200 (total mass of the two solutions)
0.15x + 0.2y = 0.17(200) (total amount of solute in the two solutions)
Solving these equations, x = 80 g and y = 120 g.
Therefore, we need 80 g of the 15% solution and 120 g of the 20% solution.
Problem 2:
we need 120 g of the 18% solution and 180 g of the 5% solution.
Let x be the mass of the 18% solution needed and y be the mass of the 5% solution needed.
x + y = 300
0.18x + 0.05y = 0.07(300)
Solving these equations, x = 120 g and y = 180 g.
Therefore, we need 120 g of the 18% solution and 180 g of the 5% solution.
Problem 3:
The mass percentage of the final solution is 135 g/550 g × 100% = 24.55%.
The total mass of the final solution is 200 g + 350 g = 550 g.
The total amount of solute in the final solution is:
0.15(200 g) + 0.20(350 g) = 65 g + 70 g = 135 g.
Therefore, the mass percentage of the final solution is 135 g/550 g × 100% = 24.55%.
Problem 4:
The mass percentage of the final solution is 110 g/335 g × 100% = 32.84%.
The total mass of the final solution is 300 g + 35 g = 335 g.
The total amount of solute in the final solution is:
0.15(300 g) + 35 g = 75 g + 35 g = 110 g.
Therefore, the mass percentage of the final solution is 110 g/335 g × 100% = 32.84%.
Problem 5:
The mass percentage of the final solution is 18.18%.
Calculate the final mass of the solution:
Final mass = 400 g + 150 g = 550 g
Calculate the mass of solute in the 25% solution:
Mass of solute = 0.25 x 400 g = 100 g
Calculate the mass percentage of the final solution:
Mass percentage = (mass of solute ÷ final mass) x 100%
Mass percentage = (100 g ÷ 550 g) x 100%
Mass percentage = 18.18%
To know more about mass of solutions, visit:
https://brainly.com/question/29482678
#SPJ1
Based on the given examples, what do you think is the main characteristic
of a liquid?
Characteristics of Liquids
Liquids have definite volume, but indefinite shape. They are free to form droplets and puddles when they are not inside a container. When a liquid is inside a container, it will take its shape. Unlike gases, a liquid will not change its volume to spread out and completely fill a container.
What is the volume of the gas if there are 3.20 mol of gas at 265 K and 2.50 atm of pressure?
Answer:
27.81 L
Explanation:
Assuming the gas is ideal, we can solve this problem by using the following formula:
PV = nRTWhere:
P is Pressure, 2.50 atmV is Volumen is the number of moles, 3.20 molR is a constant, 0.082 atm·L·mol⁻¹·K⁻¹T is temperature, 265 KWe input the data:
2.50 atm * V = 3.20 mol * 0.082 atm·L·mol⁻¹·K⁻¹ * 265 KAnd solve for V:
V = 27.81 L