what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Answer 1

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356


Related Questions

How many joules of heat are absorbed when 73 g water are heated from 30*C to 43*C? *

Answers

Answer:

3966.82 J

Explanation:

q=sm∆T

q=73×13×4.18

the specific heat for water is 4.18

Answer:

\(\boxed {\boxed {\sf 39,668.2 \ Joules}}\)

Explanation:

We are given the mass and change in temperature, so we must use this formula for heat energy:

\(q=mc \Delta T\)

The mass is 73 grams. Water's specific heat is 4.18 J/g × °C. Let's calculate the change in temperature

ΔT= final temperature - initial temperatureΔT= 43 °C - 30°C ΔT= 13 °C

Now we know all the variables and can substitute them into the formula.

\(m= 73 \ g \\c= 4.18 \ J/g* \textdegree C \\\Delta T= 13 \ \textdegree C\)

\(q= (73 \ g )(4.18 \ J/g*\textdegree C)(13 \textdegree C)\)

Multiply the first numbers together. The grams will cancel.

\(q= 3051.4 \ J/\textdegree C (13 \textdegree C)\)

Multiply again. This time, the degrees Celsius cancel.

\(q= 39668.2 \ J\)

39,668.2 Joules of heat energy are absorbed.

how do you make a skit?

Answers

The ways to  make a skit are:

Create Your Idea.Give an Outline of the StoryThen note down the First Draft. Make the Action Up. Keep making better your Drafts. Give a Performance of your Skit.

What is the steps of skit  making  about?

In skit making, one can start by coming up with humorous concepts for your skit. Write out your scenario, practice it, and then perform it in front of an audience or record it. Then Continue to create fresh drafts.

Note that one can ask someone you trust's opinion should see your sketch. Then make a note of what people found amusing and not amusing.

Therefore, skit  is seen as short comedy show that can be performed by second graders.

Learn more about video making from

https://brainly.com/question/26957083

#SPJ1


Which statement would most likely be found in an
advertisement from a cell phone provider?

Answers

Answer:

the year of cellphone users increases every year

Explanation:

i did the test

Graphically, a point is a solution to a system of two inequalities if and only if the point

Answers

the point lies in the shaded regions of both the top and bottom inequalities
Hope this helps

Answer:

b

Explanation:

Which of the following statements correctly describe freezing point depression for a solution? Select all that apply.
ΔTf is a positive value.

Freezing point depression is proportional to the molality of the solution.

The freezing point constant Kf is characteristic of the solvent.

Answers

Freezing point depression is the phenomenon that occurs when the freezing point of a solution is lower than the freezing point of the pure solvent.

The following statements correctly describe freezing point depression for a solution:

Freezing point depression is proportional to the molality of the solution. The freezing point depression is proportional to the molality of the solute in the solution.

The molality of the solute is the number of moles of solute per kilogram of solvent.

The more solute added to the solvent, the greater the freezing point depression.

Mathematically, the relationship can be expressed as ΔTf = Kf m where ΔTf is the change in freezing point, Kf is the freezing point depression constant (a characteristic of the solvent), and m is the molality of the solution.

ΔTf is a positive value. The freezing point depression is a positive value because it represents the difference between the freezing point of the pure solvent and the freezing point of the solution.

As more solute is added, the freezing point of the solution decreases and ΔTf becomes more positive.

The freezing point constant Kf is characteristic of the solvent.

The freezing point constant (Kf) is a characteristic of the solvent and is related to its molecular weight, freezing point, and latent heat of fusion. The value of Kf is determined experimentally by measuring the freezing point depression of a solution of known molality.

Once Kf is known for a particular solvent, it can be used to calculate the molality of an unknown solute in that solvent.

To know more about solvent visit:

https://brainly.com/question/11985826

#SPJ11

Substance X is added to the mixture shown below to reduce the __________ __________ of the aluminium oxide in bauxite. What two words complete the sentence?

Answers

Answer:

what is sentence X?

.

write your answer clearly

BRAIBLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST

please answer quickly thank you

BRAIBLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIEST BRAINLIESTplease

Answers

Answer:

13

Explanation:

Answer:

it is 13

Explanation:

a certain reaction has an activation energy of 34.34 kj/mol. 34.34 kj / mol. at what kelvin temperature will the reaction proceed 3.00 3.00 times faster than it did at 357 k?

Answers

The reaction will proceed 3 times faster than it did at 357 k at a temperature of 828 K.

The Arrhenius equation describes the effect of temperature on reaction rate. It is given by:

k = Ae^(-Ea/RT)

where k is the rate constant, A is the pre-exponential factor, Ea is the activation energy, R is the gas constant, and T is the temperature in Kelvin.

Rearranging this equation, we have ln(k) = ln(A) - (Ea/RT).

A certain reaction has an activation energy of 34.34 kJ/mol. At 357 K, the rate constant for the reaction is k1. When the reaction is 3 times faster, the rate constant will be 3k1.

Substituting these values in the Arrhenius equation, we have:

ln(3k1) = ln(A) - (34.34 kJ/mol)/(R*T)

ln(k1) = ln(A) - (34.34 kJ/mol)/(R*357 K)

Subtracting these two equations, we obtain:

ln(3) = (34.34 kJ/mol)/(R*k1*T)

Solving for T, we have:

T = (34.34 kJ/mol)/(R*k1*ln(3))

Putting the given values, we get:

T = (34.34 kJ/mol)/(8.314 J/K*mol*3.00*ln(3))

T = 828 K

Therefore, the reaction will proceed 3.00 times faster at 828 K compared to 357 K.

Learn more about Arrhenius equation here: https://brainly.com/question/13467424.

#SPJ11

which would more easily give up electrons during bonding?
Li
Si
I​

Answers

Answer:

Lithium, Li

Explanation:

Metallic elements are elements which form ions by loss of electrons. They are electropositive elements. During the formation of compounds, they easily give up or donate their electrons to other atoms to become positively charged ions. Examples of metals include, sodium, lithium, magnesium, etc

The ionization process of metals is generally shown below:

X ---> X+ + e-

Where X is a metal, and e- rare electrons

Non-metals are elements which form ions by gain of electrons. They are electronegative elements. During the formation of compounds, they accept electrons from electropositive elements to form negatively charged ions or anions. Examples of non-metals include oxygen, chlorine, iodine, etc.

The ionization process of non-metals generally, is shown below:

Y + e- ----> Y-

Semi-metals like silicon, usually form compounds by sharing of electrons with other elements.

A value of 25 °C is a measurement of
O distance.
O density.
O mass.
O volume.
O temperature

Answers

Temperature ……..’mmm
E tempature is the correct answer

Write and balance the chemical equation that represents nitrogen and hydrogen reacting to produce ammonia, NH₃.

Answers

N2 + 3H2 = 2NH3 - this is because hydrogen is a diatomic molecule just like nitrogen so a single hydrogen or nitrogen would never be present (they have to be in pairs)

An ethylene glycol solution contains 30.8 g of ethylene glycol (C2H6O2) in 96.6 mL of water. (Assume a density of 1.00 g/mL for water.) Determine the freezing point of the solution. Determine the boiling point of the solution

Answers

The freezing point of the solution is -11.8 °C.

The boiling point of the solution is 103.31 °C.

To determine the freezing point of the solution, we can use the equation:

ΔTf = Kf * m

where:

ΔTf is the freezing point depression,

Kf is the cryoscopic constant (for water, Kf = 1.86 °C/m),

m is the molality of the solution (moles of solute per kilogram of solvent).

First, let's calculate the molality (m) of the solution:

Molar mass of ethylene glycol (C2H6O2):

C = 12.01 g/mol

H = 1.01 g/mol (x 6) = 6.06 g/mol

O = 16.00 g/mol (x 2) = 32.00 g/mol

Total molar mass = 12.01 g/mol + 6.06 g/mol + 32.00 g/mol = 50.07 g/mol

Number of moles of ethylene glycol (C2H6O2) = mass / molar mass

Number of moles = 30.8 g / 50.07 g/mol = 0.615 mol

Mass of water = volume x density = 96.6 mL x 1.00 g/mL = 96.6 g

Now, let's calculate the molality:

Molality (m) = moles of solute / mass of solvent (in kg)

Molality = 0.615 mol / 0.0966 kg = 6.36 mol/kg

Now we can calculate the freezing point depression (ΔTf):

ΔTf = Kf * m

ΔTf = 1.86 °C/m * 6.36 mol/kg = 11.8 °C

To find the freezing point of the solution, subtract the freezing point depression from the freezing point of pure water (0 °C):

Freezing point = 0 °C - 11.8 °C = -11.8 °C

To determine the boiling point of the solution, we can use the equation:

ΔTb = Kb * m

where:

ΔTb is the boiling point elevation,

Kb is the ebullioscopic constant (for water, Kb = 0.52 °C/m),

m is the molality of the solution (same value as calculated before: 6.36 mol/kg).

ΔTb = 0.52 °C/m * 6.36 mol/kg = 3.31 °C

To find the boiling point of the solution, add the boiling point elevation to the boiling point of pure water (100 °C):

Boiling point = 100 °C + 3.31 °C = 103.31 °C

To know more about ethylene glycol

https://brainly.com/question/32452413

#SPJ11

how was the molar solubility of calcium hydroxide impacted by the addition of calcium chloride? why?

Answers

When calcium chloride is added to aqueous calcium hydroxide, the molar solubility of calcium hydroxide increases.

This is because the chloride ion competes with the hydroxide ion for solvation, thereby reducing the effective concentration of hydroxide ion and increasing the molar solubility of calcium hydroxide.

Chloride ions are one of the most important ions in the human body. They are responsible for many functions, including keeping the body hydrated, regulating blood pressure, and helping to create stomach acid. Without chloride ions, the human body would not be able to function properly.While calcium is responsible for healthy teeth and bones.

Learn more about solubility at : https://brainly.com/question/8591226

#SPJ4

Can someone help me find the 5 digits numbers in here?

Can someone help me find the 5 digits numbers in here?

Answers

Answer:

20322

Explanation:

Could it have something to deal with the teeth or mouths? The first pumpkin you have two teeth, second pumpkin looks like a 0, the third pumpkin I’m unsure of. The forth pumpkin has two teeth again same with the fifth.

So first pumpkin - 2
The second pumpkin - 0
The third pumpkin I’m unsure of
The forth pumpkin - 2
The fifth pumpkin - 2
So 20?22

Just an idea for ya. Hopefully it helps

Identify the atom below.
a.) H
b.) He
c.) Bе
d.) С

Identify the atom below.a.) Hb.) Hec.) Bd.)

Answers

Answer:

B. Helium

Explanation:

Correct me if I'm wrong

you study the rate of a reaction, measuring both the concentration of the reactant and the concentration of the product as a function of time, and obtain the following results: time b a concentration (a) which chemical equation is consistent with these data: (i) a b, (ii) b a, (iii) a 2 b, (iv) b 2 a? (b) write equivalent expressions for the rate of the reaction in terms of the appearance or disappearance of the two substances. [section 14.2]

Answers

a. The chemical equation consistent with the results is (iv) b 2 a

b. Rate of appearance of product a:  \(2 * \Delta[a]/ \Delta t\)

Rate of disappearance of reactant b: \(-\Delta [b]/ \Delta t\)

(a) Based on the given data, the chemical equation consistent with the results is (iv) b 2 a. This means that the reactant b is being converted into two moles of product a.

(b) The equivalent expressions for the rate of the reaction in terms of the appearance or disappearance of the two substances are as follows:

Rate of appearance of product a: \(2 * \Delta[a]/ \Delta t\)

Rate of disappearance of reactant b: \(-\Delta [b]/ \Delta t\)

The factor of 2 in the rate expression for product a indicates that two moles of the product are formed for every one mole of reactant consumed, as suggested by the chemical equation (iv) b 2 a.

To know more about reactant, here

brainly.com/question/30129541

#SPJ4

How could you convert your qualitative data into

quantitative data?

Answers

You can convert qualitative data into quantitative data by creating categories and assigning numerical values to each category.

Qualitative data is non-numerical data that is collected through methods such as interviews, observations, and focus groups. While qualitative data provides rich insights, it cannot be analyzed statistically without converting it into quantitative data. To convert qualitative data into quantitative data, you need to create categories and assign numerical values to each category.

For example, if you conducted an interview and asked participants to rate their satisfaction with a product on a scale of 1-5, you could assign numerical values to each rating. 1 could represent very dissatisfied, 2 could represent somewhat dissatisfied, 3 could represent neutral, 4 could represent somewhat satisfied, and 5 could represent very satisfied. By assigning numerical values to each category, you can analyze the data statistically and draw conclusions based on numerical data.

Learn more about qualitative data here:

https://brainly.com/question/1417786

#SPJ11

what volume in liters of fluorine gas is needed to form 639 l of sulfur hexafluoride gas if the following reaction takes place at 2.00 atm and 273.15 k: s(s) 3f₂(g) → sf₆ (g)?

Answers

For producing 639L of \(SF_6\), a volume of 1916.96L of \(F_2\) gas is required for the reaction.

If the pressure and temperature at which the reaction occurs is known, we may use the ideal gas law to compute the stoichiometry of processes involving gases by using the connection between the volume (in liters) and quantity of gases (in moles). A chemical reaction's volume of gas can be evaluated by collecting it in an inverted vessel filled with water. The gas pushes water out of the vessel, and the amount of liquid displaced is proportional to the amount or volume of gas.

Given:

Volume of \(SF_6\) = 639L

Pressure, P = 2atm

Temperature, T = 273.15K

To find:

Volume, V of \(F_2\) gas = ?

Formula:

PV = nRT

Calculations:

No. of moles of \(SF_6\) = 2 x 639 / 0.082 x 273.15

No. of moles of \(SF_6\) = 57.057 moles

\(S (s) + 3F_2 (g) \rightarrow SF_6 (g)\)

From the reaction,

1 mole of \(SF_6\) is formed from 3 moles of \(F_2\)

Therefore,

No. of moles of \(F_2\) = 3 x 57.057 = 171.171 moles

Volume of \(F_2\) = 171.171 x 0.082 x 273.15 / 2

Volume of \(F_2\) = 1916.96L

Result:

1916.96L of \(F_2\) gas is required to produce 639L of \(SF_6\).

Learn more about the volume of a gas in a reaction here:

https://brainly.com/question/23612430

#SPJ4

Wen hyurated ironi) sulfate is heated the following reaction takes place
FeSO, 7H,0 m Feso, + 7H,0
The colour changes from green to white
What is the meaning of the symbol en
• What two observations are made when water is added to anhydrous
Frondl sulfate:
steeribe how cobalt chloride can be used to test for the presence
of water
[1)
12]
[2]
[Total:

Answers

The symbol "en" in this context is not related to the chemical reaction given in the question. "en" is actually an abbreviation for ethylenediamine, which is a type of ligand commonly used in coordination chemistry.

When water is added to anhydrous copper(II) sulfate, two observations are made:

The blue color of anhydrous copper(II) sulfate turns into a deep blue color as the water is added. This is because the anhydrous copper(II) sulfate is undergoing an exothermic reaction with the water to form hydrated copper(II) sulfate, which is blue in color.

As more water is added, the color becomes lighter and eventually the solution becomes clear. This indicates that all of the anhydrous copper(II) sulfate has reacted with water to form hydrated copper(II) sulfate.

Cobalt chloride can be used as a test for the presence of water because it is a hydrate that changes color when it loses its water of hydration. Anhydrous cobalt chloride is blue in color, while hydrated cobalt chloride is pink. When water is added to anhydrous cobalt chloride, it reacts with the water to form hydrated cobalt chloride, which is pink in color. This color change can be used to test for the presence of water in a sample.

To know more about the Anhydrous, here

https://brainly.com/question/14745510

#SPJ4

Click Reset Balloon. Choose the button that shows two balloons. Move each balloon over the sweater so that half of the sweater’s electrons move to one balloon and half of the electrons move to the other balloon. Try to bring the balloons close together. What happens to the balloons?

Answers

If you bring the two balloons close together, they would experience a force of attraction. This is because like charges would repel each other, while opposite charges attract each other. The balloons would experience an electric force, which would cause them to move towards each other.

What do you mean by electrostatic force?

Electrostatic force is a type of force that occurs between charged particles. It is a fundamental force of nature that arises from the interaction between charged objects.

How do electrostatic force play an important role?

The electrostatic force plays a crucial role in many natural phenomena, such as the behavior of charged particles in electric and magnetic fields, the formation of lightning, and the behavior of colloidal suspensions. In technology, the electrostatic force is used in many applications, such as electrostatic precipitators, electrostatic spraying, and electrophoresis.

To know more about electrophoresis, visit here:

https://brainly.com/question/13949940

#SPJ1

Answer:

The balloons move away from each other.

Explanation:

This is 100% Correct

if the illustration of thomson's atom represents a neutral atom, what must be true about the total amount of positive charge and the total amount of negative charge?

Answers

The illustration of Thomson's atom represents a neutral atom. In this case, the total amount of positive charge and the total amount of negative charge must be equal. This means that there are equal numbers of protons and electrons in the atom. This is what makes the atom neutral.

What is a neutral atom?

A neutral atom is an atom that has no electrical charge. An atom is neutral because it has the same amount of positively charged protons and negatively charged electrons. The nucleus of an atom contains protons, which are positively charged particles. Electrons, which are negatively charged particles, are located in the atom's electron cloud around the nucleus.

Electrons, protons, and neutrons are the three components of atoms. Electrons are negatively charged, protons are positively charged, and neutrons have no charge. Electrons are found outside the nucleus of the atom and are continually moving at high speeds.

In summary, if the illustration of Thomson's atom represents a neutral atom, then the total amount of positive charge and the total amount of negative charge must be equal. This means that there are equal numbers of protons and electrons in the atom. This is what makes the atom neutral.

Learn more about Thomson's atom on the given link:

https://brainly.com/question/1597441

#SPJ11

differences between properties of convalent and ionic bond.​

Answers

Ionic bonds will be a metal + a nonmetal, and electrons

are transferred from the metal to the nonmetal.

A covalent bond will be a nonmetal only. Nonmetals will not give up their electrons so electrons are shared.

I have also written this on the whiteboard in the image provided.

differences between properties of convalent and ionic bond.

I need help for number 2, I don’t quite get it

I need help for number 2, I dont quite get it

Answers

0.8154 =(rounded) 0.82

455(50)=22,750
620(45) 27,900

M/V=0.8154

which element has the lowest atomic mass in group 6A

Answers

tell me when you know I need the answer too :))
Oxygen is the correct answer

For the following reaction, the initial [CH4] = 0.115M and at equilibrium the [C₂H₂] = 0.035M. What is the value for Kc? (give the value to 2 sig figs without units) 2 CH (g) = C₂H₂(g) + 3H₂(g)​

Answers

Answer:

0.15

Explanation:

The equilibrium constant expression for the given reaction is:

Kc = ([C₂H₂][H₂]³)/[CH₄]²

Substituting the given equilibrium concentrations, we get:

Kc = [(0.035 M)(0.115 M)²]/(0.035 M)³

Simplifying, we get:

Kc = 0.15

Therefore, the value of Kc for the reaction is 0.15, rounded to 2 significant figures.

5. How much water would need to be added to 750 mL of a 2.8 M HCl solution to
make a 1.0 M solution?

6. If I add 25 mL of water to 125 mL of a 0.15 M NaOH solution, what will the molarity of the diluted solution be?

7. If I add water to 100 mL of a 0.15 M NaOH solution until the final volume is 150 mL, what will the molarity of the diluted solution be?

8. How much 0.05 M HCl solution can be made by diluting 250 mL of 10 M HCl?

9. I have 345 mL of a 1.5 M NaCl solution. If I boil the water until the volume of the solution is 250 mL, what will the molarity of the solution be?

10.
How much water would I need to add to 500 mL of a 2.4 M KCl solution to make a 1.0 M solution

please help me

Answers

The values of molarity and volumes for the given questions are  2,100 mL, 0.75 M, 0.1 M, 50,000 mL, 2.07 M and 1,200 mL respectively.

What is the relation between the molarity & volume of solution?

Relation between the molarity and volume of the solution will be shown by the following equation:
M₁V₁ = M₂V₂, where

M₁ & V₁ is the molarity and volume of one solution whereas M₂ & V₂ are the molarities and volume of the another solution.

Required volume of water needed to add at 750 mL of a 2.8 M HCl solution to make a 1.0 M solution will be calculated by using the above formula:

V₂ = (750)(2.8) / (1) = 2,100 mL

Required molarity of diluted solution obtained on adding 25 mL of water to 125 mL of a 0.15 M NaOH solution will be calculated by using the above formula:

M₂ = (0.15)(125) / (25) = 0.75 M

Required molarity of diluted solution obtained on adding 100 mL of a 0.15 M NaOH solution until the final volume is 150 mL will be calculated by using the above formula:

M₂ = (100)(0.15) / (150) = 0.1 M

Required volume of HCl of 0.05M HCl can be made by diluting 250 mL of 10 M HCl will be calculated by using the above formula:

V₂ = (10)(250) / (0.05) = 50,000 mL

Molarity of the resultant solution is:

M₂ = (1.5)(345) / (250) = 2.07 M

Required volume of water to add on KCl solution is:

V₂ = (2.4)(500) / (1) = 1,200 mL

Hence required values of molarity and volume are 2,100 mL, 0.75 M, 0.1 M, 50,000 mL, 2.07 M and 1,200 mL respectively.

To know more about molarity & volume, visit the below link:
https://brainly.com/question/27208890

#SPJ1

Osmium forms a number of molecular compounds with carbon monoxide. One light-yellow compound was analyzed to give the following elemental composition: 15.89% C, 21.18% O, and 62.93% Os.
a) What is the empirical formula of this compound?
b) From the mass spectrum of the compound, the molecule was determined to have a molar mass of 907 g/mol. What is its molecular formula?

Answers

The empirical formula of this compound can be determined using the percent composition data. Since the atomic masses are 12 g/mol for C, 16 g/mol for O, and 190 g/mol for Os, the molar ratio of C, O, and Os are 1.32:1.75:12.50, respectively. Thus, the empirical formula of the compound is CO2Os.

Since the molar mass of the compound is 907 g/mol, the molecular formula can be determined by dividing the molar mass by the empirical formula mass.

The empirical formula mass of CO2Os is 304 g/mol. Dividing 907 g/mol by 304 g/mol yields 3, which means that the molecular formula of the compound is CO2Os3. Thus, the compound is composed of three empirical formula units, forming an Osmium-Carbon Monoxide complex with three Os atoms and two CO molecules.

Know more about empirical formula here

https://brainly.com/question/14044066#

#SPJ11

Are two atoms of the same element identical?

Answers

Answer:

No they are not identical.

Explanation:

They are not identical because there are many ranges of states that the electrons could have.


I hope it helps! Have a great day!

Muffin ^^

Answer:

No.

Explanation:

It could vary so it wouldn’t be identical.


I hope it helps! Have a great day!

bren~

Does it require more work to raise a 15 kg block by 4 m
or to raise a 20 kg block by 2 m, if both are moving at
a constant velocity? Draw a free-body diagram to help
solve the problem.

Answers

I have no clue sorry
But it’s probably c

The 15 kg block require more work to raise by 4 meter compare to  20 kg blocks .

The free body diagram is attached below,

We know that,  Weight \(W=m*g\)

where m is mass of object and g is gravitational acceleration.

Value of  \(g=9.8m/s^{2}\)

So that, weight is depend on mass of object.

And , \(workdone=force*distance\)

Work done require to raise 15kg block by 4 m is,

                 \(W=15*4*g=60g\)

Work done require to raise 20kg block by 2 m is,

               \(W=20*2*g=40g\)

Hence, The 15 kg block require more work to raise by 4 meter compare to  20 kg blocks .

Learn more:

https://brainly.com/question/21854305

Does it require more work to raise a 15 kg block by 4 mor to raise a 20 kg block by 2 m, if both are

Consider the data set displayed to the right, showing the results of changing temperature on the volume of a gas.

Which is the best range for the y-axis (vertical axis)?

Answers

Answer:

1) line graph

2) temperature

3) 260 to 330

Explanation:

Edge 2020

Answer: 50-70

Explanation:

Got it right on edge 2020

Other Questions
arrange the nitrogen-nitrogen bond lengths in order from shortest to longest for n2, n2h2, n2h4. select one: a. n2, n2h2, n2h4 b. n2, n2h4, n2h2 c. n2h4, n2h2, n2 d. n2h4, n2, n2h2 Simplify the following expression by expanding and collecting like terms.-2(-8x+7)-(-3x - 7)Give your answer in the form ax + b. Which state does not border Nevada?A) ArizonaB) CaliforniaC) IdahoD) Montana his friends' frequent concerned mentions of jefferies' obsession with his neighbors in rear window would qualify as an example of , and the filmmakers' use of frequent camera shots from jefferies' perspective to make us complicit in his voyeurism would qualify as an example of . group of answer choices form, content content, form form, form content, content the most common test used in the medical office for visual acuity is the A client looking to add muscle and bulk over the next few months asks for advice on how to consume extra calories. Which of the following would be the most appropriate advice, while remaining within scope of practice To incorporate, which of the following will the state want to know about your company? A. first year, gross profit goals B. the gross profit from the first quarter C. board of director education level D. the purpose of your business which of the following statements are true? check all that apply group of answer choices in some languages, variable scope is defined by a block, in which case a block is typically stack-dynamic a variable is non-local if it is visible inside a program unit or block but it is declared somewhere else in the program non-local variable scope could be created either by the language nested structures such as subprograms, blocks, or classes, or by creating global variables defined outside of any such units in all languages, the scope of a local variable starts at its declaration and ends where the block ends lifetime and scope of a variable always overlap since a variable that is live is always visible in all program units Solve the following polynomial equation by grouping and factoring.9y316y=0 Malik spent $7.00 for a drink and a sandwich. His drink cost $ 2.00. Did he have a ham sandwich for $ 3.00, a tuna sandwich for $ 5.00, or a turkey sandwich for $ 4.00 Use the equation s + 2.00 = 7.00 to justify your answer. Write a fragment of code that writes the even numbers between 0 and 10000 to a text file separated by one space: 0 2 4 6 and so on the last one is 10000).A. Declare and open the file (make up a file name)B. Declare any other variables you need to accomplish this taskC. Write the required values to the fileD. Close the file. Can you build another triangle with an area of 1/2 that is not congruent to your triangle.If not why All of the following are steps toward professionalization except?a. offering services that are identical to services b. offered by other similar professions Find m_DBG.(6x + 7)(8x 27) Someone help me with this ___________ pipelines carry crude oil from gathering-line concentration points to the oil refineries. a) Product b) Trunk c) Slurry d) Collection what is the electron geometry of clf5 ? enter the electron geometry of the molecule. 1. How did Aristotle classify organisms, and why didhis method prove inadequate? what is the estimated cost to complete one year of fulltime study at a TVET college ? Make Closing statement on why crocs should be allowed in schoolReasons 1.stability 2.breathable 3.Waterpfroof