Answer:
True
Explanation:
ion: an atom or molecule with a net electric charge due to the loss or gain of one or more electrons.
Ions are formed when atoms lose or gain electrons in order to fulfill the octet rule and have full outer valence electron shells. When they lose electrons, they become positively charged and are named cations. When they gain electrons, they are negatively charged and are named anions.
The total pressure of two unknown gases is 5 kPa. The partial pressure of one of the gases is 2.345 kPa, what is the partial pressure of the other gas?
Answer:
\(p_2=2.655kPa\)
Explanation:
Hello there!
In this case, according to the Dalton's law, which states that the total pressure is equal the sum of the pressures of the gases in the mixture, we write the following for this system:
\(P_T=p_1+p_2\)
Thus, we solve for the partial pressure of the gas #2 as shown below:
\(p_2=P_T-p_1\\\\p_2=5kPa-2.345kPa\\\\p_2=2.655kPa\)
Best regards!
How many rings/energy levels would the Bohe model for an element
have if it had 12 electrons?
PLEASE HELP
in which one of the following solutions will acetic acid have the greatest percent ionization?[A] 0.1 M CH3COOH[B] 0.1 M CH3COOH dissolved in 1.0 M HCl[C] 0.1 M CH3COOH plus 0.1 M CH3COONa [D] 0.1 M CH3COOH plus 0.2 M CH3COONa
The highest percentage of acetic acid ionisation will be seen in solution [D].
The answer is [D] 0.1 M \(CH_3COOH\) plus 0.2 M \(CH_3COONa\) \(CH_3COONa\). The presence of a common ion, in this case CH3COO-, will decrease the percent ionization of acetic acid. Solutions [A] and [B] do not have a common ion, while solutions [C] and [D] both have \(CH_3COO^-\). However, solution [D] has a higher concentration of the \(CH_3COO^-\) ion, which will result in a greater decrease in the percent ionization of acetic acid. Therefore, solution [D] will have the greatest percent ionization of acetic acid.
Learn more about ionisation here
https://brainly.com/question/27356170
#SPJ11
Show all work: A metal bar has a length of 5.0 cm, a width of 3.0 cm, and a height of 1.0 cm. What volume of water, measured in deciliters, would this bar displace?
15 cm
and I have to explain but there's nothing to explain so yea
Gold's natural state has a definite shape and a definite volume. What is gold's natural state(s)?
O solid
liquid
ОООО
solid or gas
O liquid or gas
Answer:
Solid
Explanation:
N
a You might have heard the phrase 'hot air rises'. Name the process of transferring
energy using moving gas or liquid.
(1 mark)
I think the word you're looking for is convection :)
PLEASE HELP!! WILL GIVE BRAINLIEST!!!
Calculate the number of atoms there are in 2. 75 moles of oxygen
Answer: 1.20x10^24 atoms O
Explanation:
Oxygen is a diatomic element and is O2
Each molecule of oxygen, O2, has 2 atoms of O.
Each mole has 6.022 x 10^23 molecules of O2.
So our equation is
(6.022x10^23) x 2 = 1.2044x10^24 atoms of O2.
and because our initial problem uses 3 sig figs we round that to
1.20 x 10^24 atoms of O.
how much energy is required to ionize hygrogen in each of the following states? (a) ground state
The energy needed is the energy that changes. The electron in a hydrogen atom is initially assumed to be in the ground state with n=1. The energy of the electron in its ground state is therefore 13.6 eV.
As a result, 12.75eV of the energy is needed to transfer electrons from the ground state to the third excited state. The 4th and 5th ionisation the energies differ significantly from one another. The fourth electron is attracted to the nucleus atom considerably less strongly than the fifth electron because it is in an inner main shell that is closer to the nucleus.
To learn more about electron, click here.
https://brainly.com/question/1255220
#SPJ4
What is the mass of 1.00 mole of carbon atoms?
Carbon atoms weigh 12.01g/mol in a mole.
12 grams of pure carbon-12 contain exactly one mole's worth of atoms (C-12). 12g of C-12 is equal to 1 mole, or 6.022 10²³ atoms.
On Earth, a compound's molar mass, which is also known as its molecular weight, is just the total mass of its constituent elements. The amount of matter in a substance or an object is measured by its mass. The kilogram (kg) is the fundamental SI unit of mass, while lower masses can also be measured in grams (g).
A substance's mole is equivalent to 6.022 x 10²³ of that material (such as atoms, molecules, or ions). The term "Avogadro's number" or "Avogadro's constant" refers to the number 6.022 10²³ .
To know more about carbon click here
https://brainly.com/question/22530423
#SPJ4
the overall charge of an atom is what
Answer:
Every atom has no overall charge (neutral). This is because they contain equal numbers of positive protons and negative electrons. These opposite charges cancel each other out making the atom neutral.
Explanation:
which of the following is a weak acid?
A) H2SO4 (Sulfuric acid)
B) HCl (Hydrochloric acid)
C) CH3COOH (Acetic acid)
D) HNO3 (Nitric acid)
correct answer is C).
Energy is transferred
between the ocean and the
air to make sure that the
temperature in the air is
higher than the temperature
on the surface.
True or false
is the reaction possible
Copper + Zinc ➡️ Copper sulphate + Zinc
is it possible or not possible
Answer: Copper and Zinc --> Copper Sulphate is possible
Explanation:
Will give brainliest if correct
Based on what you have observed in the Gizmo, which of the following chemical equations represents photosynthesis?
A. Carbon dioxide plus water yields glucose (sugar) and oxygen.
B. Oxygen plus carbon dioxide yields water and glucose.
C. Glucose plus oxygen yields carbon dioxide and water.
D. Water plus glucose yields oxygen and carbon dioxide.
Answer:
A.....
Explanation:
Carbon dioxide plus water yields glucose (sugar) and oxygen.
What can you infer if the fossil of a marine organism is found in an area that is now dry land?
Answer:
Fossils also help us to infer why dinosaurs and other organisms became extinct. Fossils tell us that there was a mass extinction at the time of the dinosaurs. They died out about 65 million years ago, along with more than half of all the other animal and plant species. ... Without plants, dinosaurs could not survive.
Explanation:
hope it will help you have a great day bye and Mark brainlist if the answer is correct
\(kai6417\)
#carry on learning
Vanilla, Caffine, Sugar and Water. Which ingredient is the solvent?
Explanation:
water is the solvent because all the other ingredients are dissolved in it
Answer:
Water
Explanation:
The solvent is a liquid that is able to dissolve another substance, so, the solvent is water, because it dissolves the vanilla, caffeine and sugar.
create the molecule that corresponds to this name (e)-3-methyl-3-hexene
The (E)-stereochemistry is displayed by having the highest-priority substituents (the ethyl and methyl groups) on opposite sides of the double bond.
To create the molecule that corresponds to the name (E)-3-methyl-3-hexene, follow these steps:
1. Identify the parent chain:
The name indicates that it is a hexene, which means there are six carbon atoms in the longest continuous chain and a double bond present.
2. Locate the double bond:
The "3" in 3-hexene indicates that the double bond starts at the 3rd carbon.
3. Determine the stereochemistry:
The (E) designation signifies the two highest-priority substituents on each carbon of the double bond are on opposite sides.
4. Add the methyl group:
The 3-methyl indicates that a methyl group (CH3) is attached to the 3rd carbon atom in the chain.
Your molecule will have the following structure:
CH3-CH2-CH=CH-CH(CH3)-CH3
In this molecule, the double bond is between the 3rd and 4th carbon atoms, and there is a methyl group attached to the 3rd carbon.
To learn more about (E)-3-methyl-3-hexene, visit:
https://brainly.com/question/12272011
#SPJ11
an exothermic reaction takes place. which is true of the entropy of the surroundings? group of answer choices it remains constant it decreases it increases insufficient information
The entropy of the surrounding when an exothermic reaction takes place increases.
What is an Exothermic Reaction?A reaction is defined as exothermic if the overall standard enthalpy change (H) is negative. Exothermic processes typically releases heat.
Example of Exothermic reaction:
CaO+H2O Ca(OH)3 + Heat
What is entropy?Entropy is a measurable physical characteristic and a scientific notion that is frequently connected to a condition of disorder, unpredictability, or uncertainty.
Now you know as in exothermic reaction heat is given to the surrounding hence more heat is added to the surrounding which results in the rising of entropy of the surrounding.
Hence, the entropy of the surrounding when an exothermic reaction takes place increases.
To know more about the Exothermic reaction visit
https://brainly.com/question/28909381
#SPJ4
how much time would it take for 326 mgmg of copper to be plated at a current of 5.1 aa ? Cu2 (aq) 2e- --> Cu(s)
express your answer using two significant figures.
Answer:
It would take approximately 193.4 seconds for 326 mg of copper to be plated at a current of 5.1 A.
Explanation:
To calculate the time required for the plating of copper, we can use Faraday's law of electrolysis, which states that the amount of substance deposited or liberated at an electrode is directly proportional to the quantity of electricity passed through the electrolyte.
The equation for the electrodeposition of copper is:
Cu2+(aq) + 2e- -> Cu(s)
First, we need to determine the number of moles of copper being plated. We can use the molar mass of copper to convert the mass given into moles:
Mass of copper = 326 mg = 0.326 g
Molar mass of copper (Cu) = 63.55 g/mol
Number of moles of copper = (0.326 g) / (63.55 g/mol) = 0.00512 mol
Now, we can use Faraday's law to calculate the time required:
1 mol of Cu2+ requires 2 faradays (F) of charge for electrodeposition.
The Faraday constant (F) is equal to 96,485 coulombs/mol.
Charge (Q) = number of moles of copper (mol) × Faraday constant (F)
Charge (Q) = 0.00512 mol × 2 × 96,485 C/mol = 987.3 C
Current (I) = 5.1 A
Time (t) = Charge (Q) / Current (I) = 987.3 C / 5.1 A ≈ 193.4 seconds
Therefore, it would take approximately 193.4 seconds for 326 mg of copper to be plated at a current of 5.1 A.
Learn more about Faraday's law here, https://brainly.com/question/1640558
#SPJ11
the aqueous aluminum sulfate formed is crystalized to make hydrated aluminum sulfate, Al2(SO4)3xH2O.
the relative formula mass of hydrated aluminum sulfate is 666.
calculate the value of x in the given formula.
(pls solve w explanation)
In the crystalized form of aluminum sulfate, Al₂(SO₄)₃xH₂O, the value of x which represents the molecules of water is approximately 6.
How to find water per sulfate?The formula mass of Al₂(SO₄)₃ can be calculated as follows:
Al = 2 x 26.98 = 53.96 g/mol
S = 3 x 32.06 = 96.18 g/mol
O = 12 x 16.00 = 192.00 g/mol
Total formula mass = 53.96 + 96.18 + 192.00 = 342.14 g/mol
The relative formula mass of hydrated aluminum sulfate is 666, so the mass of water in the formula can be calculated as:
mass of water = 666 - 342.14 = 323.86 g/mol
Since the formula for water is H₂O, the number of water molecules in the formula can be calculated as:
number of H₂O molecules = 323.86/18.02 = 17.92
Since there are 3 sulfate ions in the formula, the number of water molecules per sulfate ion can be calculated as:
number of H₂O per sulfate = 17.92/3 = 5.97
Therefore, the value of x in the formula Al₂(SO₄)₃xH₂O is 6 (rounded up).
Learn more on number of molecules here: https://brainly.com/question/15379971
#SPJ1
11 The cross section compares the densities of different Earth layers. Which Earth layer is most dense?
Answer:
b
Explanation:
i took the quiz
The total number of calcium atoms in the expression 3 cos 2 shown in the equation 3 CaCl 2 +2Na 3 PO 4 Ca(PO 4 ) 2 +6 NaCl is:
Answer:
\(C\)Explanation:
Here, we want to calculate the percentage composition of the compound formed when oxygen reacts with iron
We have the equation of reaction as follows:
\(4Fe_{(s)}\text{ + }3O_{2(g)}\text{ }\rightarrow\text{ }2Fe_2O_{3(s)}\)The compound formed is Fe2O3
Now, let us get its percentage composition
The molar mass of the compound is 160 g/mol
The atomic mass of iron is 56 amu
The atomic mass of oxygen is 16 amu
Now, let us get the percentage composition:
\(\begin{gathered} \text{Iron = }\frac{2\times56}{160}\text{ }\times\text{ 100 \% = }70\text{ \%} \\ \\ \text{Oxygen = }\frac{3\times16}{160}\text{ = 30\% } \end{gathered}\)The closest here is thus the option C
What is the pH of a 0.30 M solution of Ca(OH)2?
Explanation:
30 to the second power
Which is most useful in classifying stars? (1 point)
A. knowing the movements of a star
B. knowing the size of a star
C. knowing the apparent magnitude of a star
D. knowing the color and brightness of a star
Answer:
B. Knowing the color and brightness of a star
Explanation:
When a 16.50 g sample containing nickel and oxygen is analyzed, 5.87 g of nickel are found. What is the percent composition of this mineral?
Answer:
\(\%O=64.2\%\\\\\%Ni=35.8\%\)
Explanation:
Hello there!
In this case, according to the given information, it turns out possible for us to tell that since the total mass is 16.50 g and 5.87 g correspond to nickel, then the mass of oxygen is:
\(m_O=16.50g-5.87g=10.63g\)
And therefore, the resulting percent composition turns out to be:
\(\%O=\frac{10.60}{16.50} *100\%=64.2\%\\\\\%Ni=\frac{5.87}{16.50} *100\%=35.8\%\)
Regards!
Percentage composition is the percentage of the mass of the individual element. The percentage composition of oxygen is 64.2% and of nickel is 35.8%.
What is mass?Mass is the amount of weight occupied by the sample or an element in a compound or molecule.
Given,
The total mass of the compound = 16.50 gm
Mass of nickel = 5.87 gm
The mass of oxygen is calculated as: 16.50 - 5.87 = 10.63 gm.
The percentage composition of oxygen is calculated as:
\(\dfrac{10.60}{16.50} \times 100\% = 64.2\%\)
The percentage composition of nickel is calculated as:
\(\dfrac{5.87}{16.50} \times 100\% = 35.8\%\)
Therefore, the percentage of oxygen is 64.25% and of nickel is 35.8%.
Learn more about mass percentage here:
https://brainly.com/question/9248060
Could someone help me with this? URGENT
Answer:
The number of protons in a water molecule (H2O) is equal to the number of hydrogen atoms in the molecule, which is 2. The molar mass of water is approximately 18.015 g/mol, which means that one mole of water contains Avogadro's number (6.022 x 10^23) molecules. Therefore, the number of protons in one mole of water is:
2 x 6.022 x 10^23 = 1.2044 x 10^24
To find the number of protons in 306 mL of water, we need to first convert the volume to moles. The density of water is approximately 1 g/mL, so the mass of 306 mL of water is:
306 mL x 1 g/mL = 306 g
The number of moles of water is then:
306 g / 18.015 g/mol = 16.991 mol
Multiplying this by the number of protons per mole, we get:
16.991 mol x 1.2044 x 10^24 protons/mol = 2.049 x 10^25 protons
Therefore, the answer is option D, 1 * 10 ^ 25
Please help me on #2 giving BRAINLIEST!
Answer:
basic
Explanation:
because H is hydrogen
In which phase transition do molecules move directly from a state involving vibration of particles in a fixed position to a state involving random movement of high-speed particles?
Answer:
B: Sublimation
Explanation:
took the test on edge
Answer:
B on edge 2020
Explanation:
Please give brainliest
Which one is it ? I need help
PLEASE HELP ASAP How many moles are there in 2.25 x 10^25 atoms of Zinc?
How many atoms are there in 9500.0 mg of Fluorine?
Answer:
There are 6.023 x 10^23 fluorine atoms.
Explanation: