Answer:
a nonspontanenous reaction is forced to occur
Hope this helps :)
Element X is a solid metal that reacts with chlorine to produce a water-soluble binary compound. The metal combines with chlorine to form a compound with the formula MCl2 MCl2 . What Group of the Periodic Table is Ma member of?
Element X is a member of Group 17 of the Periodic Table, also known as the Halogen family.
What is chemical elements?Chemical elements are the building blocks of all matter in the universe. They are the simplest form of matter, consisting of single atoms or molecules, and are composed of the same type of atom. There are 118 known elements that make up the periodic table, which are either naturally occurring or artificially created. Each element has unique properties that can be used to describe its characteristics.
All Group 17 elements, including X, are non-metals that are highly reactive and form compounds with most other elements. Element X is likely to be either fluorine, chlorine, bromine, or iodine. When element X reacts with chlorine, it forms a binary compound with the formula MCl2. This compound is water-soluble, meaning it can be dissolved in water.
To know more about chemical elements click-
https://brainly.com/question/28376204
#SPJ4
Use the balanced chemical equation below. If I have 3.7 moles of AgNO3, how much Cu(NO3)2 should I produce?
Cu + 2 AgNO3 --> Cu(NO3)2 + 2 Ag
All metal nitrates are soluble in water, how are you going to do that?
But just for a theoretical exercise:
2AgNO3(aq) + Cu^2+(aq) >>>> 2Ag+(aq) + Cu(NO3)2
2 moles of silver nitrate produce 1 mole of copper nitrate.
Therefore 3 moles would produce 3/2 moles of copper nitrate.
Explanation:
how does the melting point of a substance indicate the strength of its intermolecular force of attraction
Answer:
The molecules are held together by intermolecular force of attraction. More the force the fusion takes after some time only that means the melting point is high. So molecules with greater molecular forces have high melting point and less molecular forces have low melting point.
Answer:
On heating a solid, the kinetic energy of the particle increases. The particle start vibrating with greater speed. The energy supplies by heat overcomes the force of attraction between the particles.
If this force of attraction is more, then more heat energy will be necessary to overcome this force. So, the melting point of the solid will be higher.
What is the weight of:
i) 1 mole of oxygen atoms?
ii)
i) 3 moles of iron atoms?
3 ?
iii) 20 moles of calcium carbonate?
Answer:
Oxygen = 15.999 g/mol
Iron = 3 × 55.845 = 167.535 g/mol
CaCO3 = 20 × 100.0869 = 2001.738 g/mol
In an experiment on gases, you are studying a 1.0L sample of hydrogen gas at 20° C and 2.40 atm. You heat the gas until the root mean Square speed of the molecules of the sample has been doubled. What will be the final pressure of the gas.
The final pressure of the gas is obtained as 4.80 atm.
What is the final pressure?We know that the root mean square speed of the gas would depend on the temperature of the molecules of the gas. Here we are told that the root mean square speed of the gas molecules is doubled and it means that the temperature was also doubled.
We have;
P1/T1 =P2/T2
2T1 = 2P1
The final pressure would be 2(2.40)atm = 4.80 atm
Thus we ought to have the temperature at the end as 4.80 atm from the calculation that has been done.
Learn more about pressure:https://brainly.com/question/18124975
#SPJ1
Convert 100.6 Kelvin to degrees C.
°C = K - 273
[?] °C
Answer:
-172.6 °C
Explanation:
You want to know the Celsius equivalent of the temperature 100.6 K.
ConversionThe relation is ...
C = K - 273.15
C = 100.6 -273.15 = -172.55
The temperature is -172.55 °C, about -172.6 °C.
__
Additional comment
We have rounded to tenths, because that is precision of the temperature given. If you use 273 as the conversion constant, you will get -172.4.
The beaker is left until there is no further change in the appearance of the liquid. And the options for the answer are : A : All the liquid is purple. B : None of the liquid is purple. C : Only the bottom half of the liquid is purple. D : Only the top half of the liquid is purple
Answer:
none of the liquid is purple
Please do question 9 and 10
Answer:
9) 60; 10) 0.2583
Explanation:
9) M(SiO₂)=28+16*2=60 (gr/mol);
10) if one mole is in 60gr., then for 15.5 gr.:
1/60=x/15.5; ⇒ x=15.5/60≈0.2583(mol).
In the diagram below, west is to the left, east is to the right, and the observer is looking toward the north. What is the direction of the wind?
A. NE
B. NW
C. SE
D. SW
Read each description of the various conditions that are likely to affect the pressure of a gas. Drag each description into the correct box. temperature of the container rises from 20°C to 30°C more molecules of the gas are introduced in the container volume of the container holding the gas is increased temperature of surroundings is lowered from 15°C to 10°C
Temp. is lowered from 15 to 10 degrees C: Pressure decreased
Temp. rises from 20 to 30 degrees C: Pressure increased
More molecules of gas are introduced into the container: Pressure increased
The volume of the container holding gas is increased: Pressure decreased
The pressure of a gas is affected by several factors, such as temperature, the number of gas molecules present, and the volume of the container.
When the temperature of a gas is lowered, the kinetic energy of the gas molecules decreases. As a result, the molecules move slower and exert less force on the walls of the container, causing the pressure to decrease.
Conversely, when the temperature is raised, the kinetic energy of the gas molecules increases, leading to more collisions with the walls of the container and an increase in pressure.
When more gas molecules are added to a container, there are more collisions between the gas molecules and the walls of the container. This increase in collisions leads to an increase in pressure. On the other hand, if the number of gas molecules is decreased, there are fewer collisions with the walls of the container, resulting in a decrease in pressure.
Finally, the pressure of a gas is inversely proportional to the volume of the container holding the gas. When the volume of the container is increased, the gas molecules have more space to move around, and fewer collisions occur with the walls of the container.
As a result, the pressure decreases. Conversely, when the volume of the container is decreased, the gas molecules have less space to move, leading to more collisions with the walls of the container and an increase in pressure.
For more question on pressure click on
https://brainly.com/question/24719118
#SPJ11
PROPER QUESTION
Read each description of the various conditions that are likely to affect the pressure of a gas. Drag each description into the correct box.
Temp. is lowered from 15 to 10 degrees C
Temp. rises from 20 to 30 degrees C
More molecules of gas are introduced into the container
The volume of the container holding gas is increased
Box:
Pressure increased
Pressure decreased
In which environment is erosion likely to have the most impact?
a steep hillside with little vegetation and strong downpours
a steep hillside covered with grasses and mild downpours
a flat valley with little vegetation and heavy downpours
a flat valley covered with grasses and mild downpours
Answer:
A. Steep hillside, little vegetation, strong downpours
Explanation:
between a steep hill and a flat valley, the hill is more likely to be affected because of gravity. with a valley theres less places for the dirt to actually move to. So C and D are not correct
a lack of vegetation and heavy downpour is the perfect condition for erosion. plants' root system makes dirt and rock more stable. without a lot of roots to hold the dirt in place and absorb water before it runs over the rocks and breaks them down, heavy rain would be a lot more likely to erode the area. so B isnt right either
Calculate the mass of the white solid calcium carbonate that forms with 25.0L of a 0.100 M calcium nitrate solution mixed with 20.0 mL of a 0.15M sodium carbonate solution.
Answer:
The mass of the white solid calcium carbonate that forms is 0.300 g.
Explanation:
To calculate the mass of the white solid calcium carbonate that forms, we first need to determine the limiting reagent in the reaction between calcium nitrate and sodium carbonate. The balanced chemical equation for the reaction is:
Ca(NO3)2(aq) + Na2CO3(aq) → CaCO3(s) + 2NaNO3(aq)
From the equation, we can see that one mole of calcium nitrate reacts with one mole of sodium carbonate to produce one mole of calcium carbonate. Therefore, the limiting reagent is the one that produces the least amount of calcium carbonate.
To determine the limiting reagent, we need to calculate the moles of calcium nitrate and sodium carbonate used in the reaction:
Moles of calcium nitrate = volume of solution (L) x concentration (mol/L) = 25.0 L x 0.100 mol/L = 2.50 mol
Moles of sodium carbonate = volume of solution (L) x concentration (mol/L) = 0.0200 L x 0.150 mol/L = 0.00300 mol
Since the moles of sodium carbonate are much smaller than the moles of calcium nitrate, sodium carbonate is the limiting reagent.
The balanced chemical equation tells us that one mole of calcium carbonate is produced for every mole of sodium carbonate used. Therefore, the moles of calcium carbonate produced are also equal to 0.00300 mol.
Finally, we can calculate the mass of calcium carbonate produced using the molar mass of calcium carbonate:
Mass = moles x molar mass = 0.00300 mol x 100.1 g/mol = 0.300 g
Therefore, the mass of the white solid calcium carbonate that forms is 0.300 g.
In biology class, we had to______ the parts of a plant cell under a microscope.
Answer:
In biology class we had to look at the parts of a plant in a microscope
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
A sample of krypton gas at a pressure of 1.10 atm and a temperature of 22.6 °C, occupies a volume of 694 mL. If the gas is allowed to expand at constant temperature until its pressure is 0.765 atm, the volume of the gas sample will be
mL.
Considering the Boyle's law, the volume of the gas sample will be 997.908 mL.
Boyle's lawBoyle's law states that the pressure of a gas in a closed container is inversely proportional to the volume of the container, when the temperature is constant: if the pressure increases, the volume decreases while if the pressure decreases, the volume increases.
Mathematically, this law expresses that if the amount of gas and the temperature remain constant, the product of the pressure by the volume always has the same value:
P×V= k
where P is the pressure, V is the volume, and k is a constant.
Analyzing an initial state 1 and a final state 2, it is fulfilled:
P₁×V₁= P₂×V₂
New volume in this caseIn this case, you know:
P₁= 1.10 atm
V₁= 694 mL
P₂= 0.765 atm
V₂= ?
Replacing in Boyle's law:
1.10 atm× 694 mL= 0.765 atm×V₂
(1.10 atm× 694 mL)÷ 0.765 atm= V₂
997.908 mL= V₂
Finally, the new volume will be 997.908 mL.
Learn more about Boyle's law:
brainly.com/question/4147359
#SPJ1
The principal quantum number for the outermost electrons in a Te atom in the ground state is ________.
Answer:
The principal quantum number for the outermost electrons in a Te atom in the ground state is 5
Explanation:
In quantum chemistry, the region of maximum probability of where an electron is located is sometimes referred to as cloud or orbital.
The principal quantum number is used to express the state of an electron
The principal quantum number for the outermost electrons in a Te atom in the ground state is 5
The atomic number of Tellurium Te is Kr 4d¹⁰ 5s² 5p⁴
so quantum no is 5
An individual weighing 150 pounds jogging at 5 mph for 30 minutes would burn 231 kcal . How many moles of glucose would need to be metabolized to generate this required energy?
The moles of glucose that produces that amount of energy is 0.825 moles of glucose.
What is metabolism?The process of metabolism is the process by which food is broken down in the body to generate the energy that we need to carry out our daily tasks. We know that the energy that is burnt by the individual that is weighing 150 pounds jogging at 5 mph for 30 minutes is 231 kcal but the energy that is produced by the metabolism of one mole of the glucose molecule is 280 kilocalories of energy.
Now we are required to obtain the moles of glucose would need to be metabolized to generate this required energy. We can write that;
231 = 280n
n = 231/280
n = 0.825 moles of glucose.
Learn more about metabolism:https://brainly.com/question/8885449
#SPJ1
How many moles of (CH3)3NH+ are in 6.0 g of (CH3)3NH+?
Answer:
0.1 mol
Explanation:
6/(15*3+15)
0.1 mol moles of (CH3)3NH+ are in 6.0 g of (CH3)3NH+
What is mole?
The mole, symbol mol, exists as the SI base unit of the amount of substance. The quantity amount of substance exists as a measure of how many elementary entities of a provided substance exist in an object or sample.A mole corresponds to the mass of a substance that includes 6.023 x 1023 particles of the substance. The mole exists the SI unit for the amount of a substance. Its symbol stands mol.
The compound trimethylamine, (CH3 )3N, exists as a weak base when dissolved in water.
A mole exist expressed as 6.02214076 × 1023 of some chemical unit, be it atoms, molecules, ions, or others. The mole exists as a convenient unit to utilize because of the great number of atoms, molecules, or others in any substance.
To find the amount of the substance (CH3)3NH+ to calculate its molar mass:
M((CH3)3NH+) = (12+3)*3 + 14+1 = 60 g/mol
n((CH3)3NH+) = m/M
m((CH3)3NH+) = 6g
Thus,
n((CH3)3NH+) = 6g/60 g/mol = 0.1 mol
Hence,
n((CH3)3NH+) = 0.1 mol
To learn more about mole refer to:
https://brainly.com/question/27952946
#SPJ2
calculate the relative formula mass of copper oxide if O=16 and Cu=64
Copper oxide, CuO has a relative formula mass of 80.
What is the Relative Formula mass?
This refers to the total of the relative atomic masses of the atoms in the numbers seen in the formula.
What is Relative Atomic mass?This refers to the relative mass of atoms when compared with the carbon-12 atoms Ar. Relative formula mass is a measure of relative mass, thus it has no unit.
Calculating Relative Formular mass?Solve for the number of atoms each element presents in the chemical formula. Sum the Relative atomic values for all the atoms present. From the question:O=16 and Cu=64
copper oxide, CuO= (1 * 64) + (1 * 16)
= 64 + 16
=80
Where,
1 = The subscript value of the element present.
Learn more about Relative Formular mass on
https://brainly.com/question/10632827
#SPJ1
sodium chloride is an ionic compound. Explain the difference in the ability of solid sodium chloride and molten sodium chloride to conduct electricity in terms of their structures. brainly
Explanation:
Molten sodium chloride is able to conduct electricity due to the presence of free mobile ions in solution or the molten state.
The free mobile ions are the carriers of electricity.
Solid sodium chloride does not have free mobile ions because the structure is fixed. Particles are not free to move as such. But in the molten state, free ions are able to move in the solution.The blank
and
blank
of atoms are the same on both sides of
a chemical equation.
Please just answer the question directly instead of giving me some weird cryptic answer that I can’t use. I’ve seen this exact question answered before and nobody would give a straight answer.
identify the example of a physical change. please choose the correct answer from the following choices, and then select the submit answer button. answer choices the formation of ash as a piece of wood burns the formation of a yellow solid when two colorless liquids are mixed the formation of sugar crystals as water evaporates from a mixture of sugar and water the formation of bubbles as baking soda and vinegar are mixed
The combustion of wood results in the generation of new substances such as carbon dioxide gas, water vapor, ash, and so on. Some compounds do not completely burn or do not react at all, resulting in the formation of fire ash.
When we burn wood, it transforms into ashes, a new material, and the process is irreversible, resulting in a chemical shift. No new material is generated while chopping the wood into little pieces. It is a bodily transformation. When two colorless liquids are put together, the creation of a solid precipitate indicates the presence of a chemical reaction. When a colorless solution of lead(II) nitrate is added to a colorless solution of potassium iodide, an immediate yellow solid known as a precipitate is formed. Dense hardwood species, such as maple and oak, contain more energy, burn hotter and slower, and release more heat, resulting in longer-lasting fires and coal beds. Because softwoods are less thick than hardwoods, they burn quicker in short-lived flames.
Learn more about potassium from here;
https://brainly.com/question/13321031
#SPJ4
explain what is ment by solvent front
Answer:
In paper chromatography, the wet moving edge of the solvent that progresses along the surface where the separation of the mixture is occurring.
Explanation:
I hope this helps and pls mark me brainliest :)
Determine the mass of a substance whose density is 3.5g/mL and has a volume of 140 mL. Show your
work!
The general formula for Density is \(p=\frac{m}{v}\)
p = density
m = mass
v = volume
Given density and volume, the equation can be rearranged
\(pv=m\)
\((3.5g/mL)(140mL) = 490 g\)
The mass of the substance is 490 g.
Find the volume of methane measured at 298 K
and 1.64 atm
required to convert 0.510 L
of water at 298 K
to water vapor at 373 K
.
Answer:
0.938 L.
Explanation:
The ideal gas law states that the product of pressure and volume is equal to the product of moles, the ideal gas constant and the temperature.
Since the pressure and temperature are constant and we know the volume of water vapor is 0.510 L, we can use that information to find the moles of water vapor.
n = PV/RT
The ideal gas constant R = 8.314 Latm/molK
n = 0.510 L * 1.64 atm / (8.314 Latm/molK * 373 K) = 0.001085 mol
Now we know the moles of water vapor at 373 K and 1.64 atm.
The reaction that takes place is:
CH4(g) + 2H2O(l) --> CO2(g) + 4H2(g)
This is a balanced equation, with the number of moles of each substance on both sides of the equation being equal.
So, the number of moles of methane required to convert 0.510 L of water to water vapor is 0.001085 mol/2 = 0.0005425 mol
Now we can use the ideal gas law to find the volume of methane measured at 298 K and 1.64 atm required to convert 0.510 L of water to water vapor at 373 K
V = nRT/P
V = 0.0005425 mol * 8.314 Latm/molK * 298 K / 1.64 atm = 0.938 L
Therefore, the volume of methane measured at 298 K and 1.64 atm required to convert 0.510 L of water to water vapor at 373 K is 0.938 L.
PLEASE HELP ! :D
WILL GIVE BRAINLIEST
The chemical equation, 2 Cr + 3 Fe(NO3)2 - 3 Fe + 2 Cr(NO3)3, is an
example of which type of reaction?*
Answer:
Single replacement reaction (aka single displacement reaction)
Explanation:
In a single replacement reaction, one element is substituted for another in a compound to create a new compound and a new element in the products. The general form is:
A + BC --> B + AC
In the case of this question, Cr and Fe "trade places."
Pewter is a solidified solution of tin and lead or tin and zinc. In both cases, tin is the main component. Which metal would you classify as the solute in each type of pewter?
What is the half-life when the initial concentration is 0.52 M ?
The half-life of a reaction when the initial concentration is 0.52 M is equal to the half-life of the reaction in general.
What is the reaction ?The reaction to a particular event or situation can vary greatly depending on the individual. Generally speaking, a reaction is an emotional, mental, or physical response to a stimulus. It could be anything from a feeling of fear or surprise to a physical response such as a smile or a laugh. People may also react differently to the same stimulus, based on their personal experiences or beliefs. For example, a person who is exposed to a large, loud noise may respond with fear, while another person may respond with excitement. Reactions can also be unpredictable and highly subjective.
To learn more about reaction
https://brainly.com/question/24795637
#SPJ1
Based on its location on the periodic table, how many electrons does nitrogen have in its outer energy level?
Answer:
its 5 got it right