<
A 83.5 g sample of a nonelectrolyte is dissolved in 291.7 g of water.
The solution is determined to have a boiling point of 102.3 °C. What is
the molar mass of the compound? (Kb for water is 0.510 °C/m).

Answer:

they lose energy. because of that, they slow down and get closer together

A fruit fly with long wings can have either LL genotype or Ll genotype.

Explanation:

The allele for long wings (L) is dominant, meaning that it will express itself over the recessive allele for short wings (l). A fruit fly can inherit one of each allele from each parent, resulting in three possible genotypes: LL (homozygous dominant), Ll (heterozygous), or ll (homozygous recessive).

If a fruit fly has long wings, then it must have at least one L allele. It could have inherited one L allele from one parent and another L allele from the other parent (LL genotype), or it could have inherited one L allele from one parent and a l allele from the other parent (Ll genotype). Therefore, the likely genotype of a fruit fly with long wings is either LL or Ll.

Answer:

E°(Ag⁺/Fe°) = 0.836 volt

Explanation:

3Ag⁺ + 3e⁻ => Ag°;            E° = +0.800 volt

Fe° => Fe⁺³ + 3e⁻ ;             E° = -0.036 volt

_________________________________

Fe°(s) + 3Ag⁺(aq) => Fe⁺³(aq) + 3Ag°(s) ...    

E°(Ag⁺/Fe°) = E°(Ag⁺) - E°(Fe°) = 0.800v - ( -0.036v) = 0.836 volt

Answer:

A.

The moon's gravitational pull on Earth causes water to bulge on two sides of the Earth.

Reactions in our natural world range from classical chemical reactions to nuclear reactions.

A classical chemical reaction is a natural process that occur when one or more elements called reactants change to form one or more products.

Chemical reactions can be speed up by the action of enzymes, which are biological catalysts capable of lowering the activation energy of the reactions.

On the other hand, nuclear reactions occur when atoms react among them to generate new elements.

Nuclear reactions can be classified into fusion reactions where atomic nuclei fuse and fusion reactions where an atomic nucleus gives rise to two different atoms.

In conclusion, Reactions in our natural world range from classical chemical reactions to nuclear reactions.

Learn more about chemical reactions here:

https://brainly.com/question/11231920

#SPJ1

The emission of a transmitter is caused by the action of calcium ions, which also cause synaptic vesicle exocytosis, which releases the neurotransmitters inside the vesicles and starts synaptic transmission.

Nearly all bodily biological processes, including heart and muscle pulses, neurotransmission of information, memories and learning baby creation, cell proliferation, and Calcium ions enter the cytoplasm of organelles through calcium channels.

Calcium plays a critical role in the brain's regulation of synaptogenesis and memory formation. This process activates certain calmodulin signal transmission pathways and involves important protein effectors such CaMKs, MAPK/ERKs, or CREB.

To know more about Calcium ions visit:

https://brainly.com/question/28186243

#SPJ4

Answer:

Explanation:

First, we need to determine the limiting reactant and the theoretical yield of TiCl4.

To do this, we need to calculate the amount of TiCl4 that should be produced based on the amount of each reactant, assuming that each reacts completely. We can start by calculating the amount of Ti and Cl2 in moles:

Next, we need to determine which reactant is limiting. To do this, we can calculate the amount of TiCl4 that would be produced if each reactant were completely consumed:

If Ti is limiting: 0.215 moles Ti × (1 mole TiCl4 / 1 mole Ti) × (189.68 g TiCl4 / 1 mole TiCl4) = 40.8 g TiCl4

If Cl2 is limiting: 0.179 moles Cl2 × (1 mole TiCl4 / 1 mole Cl2) × (189.68 g TiCl4 / 1 mole TiCl4) = 34.0 g TiCl4

Since the actual yield of TiCl4 is 16.2 g, which is less than the theoretical yield calculated when Cl2 is limiting, we can conclude that Cl2 is the limiting reactant.

Therefore, the theoretical yield of TiCl4 is 34.0 g.

We can calculate the percent yield by dividing the actual yield by the theoretical yield and multiplying by 100%:

percent yield = (actual yield / theoretical yield) × 100%

percent yield = (16.2 g / 34.0 g) × 100% = 47.6%

Therefore, the theoretical yield of TiCl4 is 34.0 g, the limiting reactant is Cl2, and the percent yield is 47.6%.

"Sam is being a good digital citizen by following a code of conduct.

A code of conduct is a set of rules that govern how people should behave online. It is important to follow a code of conduct because it helps to create a safe and respectful environment for everyone.

Here, Sam is following the code of conduct for his gaming group. This code of conduct may include rules about using offensive language, cheating, and griefing. By following these rules, Sam is helping to create a positive experience for everyone in his gaming group.

Therefore, Sam is following the code of conduct.

Learn more on code of conduct :https://brainly.com/question/30093328

#SPJ1

We can see here that the catalytic cycle for the hydrogenation of alkenes using Wilkinson's catalyst involves several steps.

Here's an overview of the catalytic cycle, including the necessary details:

i. Chemical structure of the catalyst:

Wilkinson's catalyst, also known as chloridotris(triphenylphosphine)rhodium(I), has the following chemical structure: [RhCl(PPh3)3]

ii. Molecular geometry of the catalyst:

The Wilkinson's catalyst has a trigonal bipyramidal geometry around the rhodium center. The three triphenylphosphine (PPh3) ligands occupy equatorial positions, while the chloride (Cl) ligand occupies an axial position.

iii. Type of reactions involved:

The catalytic cycle involves several reactions, including:

iv. Starting material, reagent, and solvent:

The starting material is an alkene, and the reagent is Wilkinson's catalyst ([RhCl(PPh3)3]). The reaction is typically carried out in a suitable solvent, such as dichloromethane (CH2Cl2) or tetrahydrofuran (THF).

v. Major and minor end-products:

The major end-product of the hydrogenation reaction is the fully saturated alkane, resulting from the addition of hydrogen across the double bond. The minor end-product may include cis- or trans-configured alkanes if the original alkene substrate possesses geometric isomers.

vi. Intermediates:

The intermediates in the catalytic cycle include:

These intermediates play a crucial role in facilitating the hydrogenation reaction and enabling the catalytic cycle to proceed.

Learn more about Wilkinson’s catalyst on https://brainly.com/question/31972308

#SPJ1

Answer:

B

Explanation:

B is the only answer choice that provides a rate

(like 3ºC/ hr meaning 3ºC per hour)

all the other answer choices don't have a /hr

so best answer choice is B

The Correct electron configuration of carbon as 1s² 2s² 2p². Option B.

To understand why this is the correct electron configuration, let's break it down step by step:

The atomic number of carbon is 6, which means it has six electrons. Electrons are distributed in energy levels or shells around the nucleus.

The first shell, known as the 1s orbital, can hold a maximum of 2 electrons. Therefore, the first part of the electron configuration is 1s², indicating that two electrons occupy the 1s orbital.

The second shell has two subshells: the 2s orbital and the 2p orbital. The 2s orbital can hold a maximum of 2 electrons, while the 2p orbital can hold a maximum of 6 electrons. In the case of carbon, after the 1s orbital, two more electrons occupy the 2s orbital. So far, we have 1s² 2s².

The remaining two electrons in carbon are placed in the 2p orbital. The 2p orbital consists of three separate p orbitals: 2px, 2py, and 2pz. Each p orbital can hold a maximum of 2 electrons. Therefore, the last part of the electron configuration for carbon is 2p², indicating that two electrons occupy the 2px and 2py orbitals. Option B is correct.

For more such question on electron. visit :

https://brainly.com/question/28420589

#SPJ8

Answer:

The molar mass of NaOH is given to be 39.99 g/mol. Therefore, we need 59.985 grams of NaOH.

Explanation:

Answer:

0.000577 Mol/L

Explanation:

We know that;

ppm = moles/L * molar mass * 1000

It then follows that;

moles/L = ppm/molar mass  * 1000

ppm concentration = 63.3 ppm

molar mass = 329.3 g/mol

moles/L = 63.3 ppm/329.3 g/mol * 1000 * 3 moles of K^+

moles/L = 0.000577 Mol/L

Answer:

\(\boxed {\boxed {\sf 0.495 \ mol}}\)

Explanation:

We are given a number of particles and asked to convert to moles.

1 mole of any substance contains the same number of particles (atoms, molecules, formula units) : 6.022 *10²³ or Avogadro's Number. For this question, the particles are not specified.

So, we know that 1 mole of this substance contains 6.022 *10²³ particles. Let's set up a ratio.

\(\frac { 1 \ mol }{6.022*10^{23 } \ particles}}\)

We are converting 2.98*10²³ particles to moles, so we multiply the ratio by that value.

\(2.98*10^{23} \ particles *\frac { 1 \ mol }{6.022*10^{23 } \ particles}}\)

The units of particles cancel.

\(2.98*10^{23} *\frac { 1 \ mol }{6.022*10^{23 } }}\)

\(\frac { 2.98*10^{23}}{6.022*10^{23 } }} \ mol\)

\(0.4948522086 \ mol\)

The original measurement of particles (2.98*10²³) has 3 significant figures, so our answer must have the same.

For the number we found, 3 sig figs is the thousandth place.

The 8 in the ten-thousandth place (0.4948522086) tells us to round the 4 up to a 5 in the thousandth place.

\(0.495 \ mol\)

2.98*10²³ particles are equal to approximately 0.495 moles.

Answer:

Metabolism is the set of life-sustaining chemical reactions in organisms. The three main purposes of metabolism are: the conversion of the energy in food to energy available to run cellular processes

Explanation:

Answer:

the total number of protons and neutrons in a nucleus.

The mass number, also called atomic mass number or nucleon number, is the total number of protons and neutrons in an atomic nucleus. It is approximately equal to the atomic mass of the atom expressed in atomic mass units.

When NH3 is initially added to copper sulfate solutions, a precipitate of copper(II) hydroxide will form.

Copper is a reddish-brown, malleable metal that is used in many fields, from electrical wiring to jewelry making. It is the 29th element on the periodic table, and is known to be the best conductor of electricity, which makes it an important component of electronics. Copper has been used since ancient times due to its availability, malleability and high melting temperature. Its uses range from coins and jewelry to plumbing and electrical wiring.

This is because copper sulfate is an insoluble salt and NH3 is a strong base. The reaction between the two substances results in the formation of copper(II) hydroxide, which is an insoluble salt. This forms a precipitate and can be observed as an indication of the reaction taking place.

To learn more about copper
https://brainly.com/question/30571270
#SPJ1

Answer:

it's answer is 2.564M

Explanation:

M= 250/58.5

=2.564M

Explanation:

The brain is like a computer that controls the body's functions, and the nervous system is like a network that relays messages to parts of the body. Click through this slideshow to learn more about the brain and nervous system.

The concentration of H3O+ ions in the solution of aluminum chloride is \(3.16×10^-5\) mol/L.

Aluminum chloride is an acidic salt that contains a cation, Al3+, and an anion, Cl-. When aluminum chloride is dissolved in water, it dissociates into its constituent ions, and the Al3+ cations hydrolyze to produce H+ ions.

This reaction leads to the formation of an acidic solution. The pH of a solution of aluminum chloride is \(4.5×10^0\). We need to determine the concentration of H3O+ ions in this solution.

The concentration of H3O+ ions in a solution is given by the equation: pH = -log[H3O+] where pH is the negative logarithm of the concentration of H3O+ ions in the solution. The negative sign indicates that the pH is inversely proportional to the concentration of H3O+ ions. To determine the concentration of H3O+ ions, we need to rearrange the equation:

[H3O+] = \(10^-pH\) Substituting the value of pH =\(4.5×10^0\), we get: [H3O+] = \(10^-4.5\)

The value of \(10^-4.5\) can be calculated using scientific notation: \(10^-4.5\)= \(3.16×10^-5\) mol/L

for more such questions on  concentration

https://brainly.com/question/28564792

#SPJ8

The equilibrium constant for the reaction at 655 K is \(e^{6.96}\) ≈ 1.05 × 10^3.

The equilibrium constant (K) for a reaction is related to the change in Gibbs free energy (ΔG) through the equation:

ΔG = -RTlnK

where R is the gas constant, T is the temperature in kelvin, and ln is the natural logarithm. Since ΔG and ΔH (the change in enthalpy) are related by the equation:

ΔG = ΔH - TΔS

where ΔS is the change in entropy, we can rearrange the first equation to get:

lnK = -ΔH ÷ RT + ΔS ÷ R

At 298 K, we can use the given values of ΔH and K to solve for ΔS:

lnK = -ΔH ÷ RT + ΔS ÷ R

ln(1.4 × 10³) = (-(-25.8 × 10³ J/mol) ÷ (8.314 J/mol K × 298 K)) + ΔS ÷ 8.314 J/mol K

ΔS = 78.2 J/mol K

Now we can use the equation above to solve for lnK at 655 K, using the same value of ΔH and the newly calculated value of ΔS:

lnK = -ΔH ÷ RT + ΔS ÷ R

lnK = -(-25.8 × 10³ J/mol) ÷ (8.314 J/mol K × 655 K) + (78.2 J/mol K) ÷ 8.314 J/mol K

lnK = 6.96

e ≈ 1.05 × 10³

To learn more about equilibrium follow the link:

https://brainly.com/question/30694482

#SPJ1

Answer:

lol i know this isnt the best but Your comic strip can be about how when you put smores in a campfire, the smores become burnt  that is example of energy transfer because energy is traveling as heat to another object.

Explanation:

Answer:

solar energy

Explanation:

Answer:

See explanation

Explanation:

The atoms of metals have fewer valence electrons than the atoms of metals and metalloids.

Atoms of metals have only very few valence electrons in their outermost shells hence they donate electrons during bonding. However, atoms of nonmetals have more electrons in their outermost shells and rather accept electrons during bonding. The atoms of metalloids just have a number of valence electrons that are intermediate between those of metals and nonmetals and mostly share electrons in covalent bonds.

Similarly, atoms of metallic elements differ from each other in the number of valence electrons present in the valence shell of the atom of each element. For instance, sodium has one electron in the valence shell of its atom while aluminium has three electrons in the valence shell of its atom.

The atoms of metallic elements are different from the atoms of non metals or metalloids base on the outer electron/ valency electrons and the its bonding pattern.

The atoms of different metals varies in it ability to bond quickly.

The atoms of metallic elements are different from the atoms of non metals or metalloids base on the outer electron/ valency electrons and how it bonds.

Metallic atoms have very few electrons in the outermost shell. The valency electrons of this metallic atoms are few and are easily lost during bonding. They have the ability to release there valency electrons easily. Example of this metals are sodium, potassium , calcium etc.

On the other hand non metallic elements have numerous electron in the outermost shell and easily receive electron during bonding. Example are chlorine, fluorine, oxygen etc.

The metalloid atoms like silicon and germanium have an average number of electron in their outermost shell. They are in between.

The atoms of different metals varies in it ability to bond quickly. For example the group 1 metals are very reactive than the group 2 metals. This simply means the group 1 metals(alkali metals) goes into bonding more easily than the group 2 metals(alkali earth metals).    

read more: https://brainly.com/question/1903992?referrer=searchResults

Answer:

\( \huge{4.969 \times {10}^{ - 19} \:J }\)

Explanation:

The energy of the purple lamp can be found by using the formula

E = hf

where

E is the energy

f is the frequency

h is the Planck's constant which is

6.626 × 10-³⁴ Js

From the question.

\( f = 7.5 \times 10^14 \: Hz \)

We have.

\( E = 6.626 \times 10^{-34} \times 7.5 \times 10^{14} \)

We have the final answer as

\(4.969 \times {10}^{ - 19} \: J\)

Ionic bonding is a strong type of bonding, in which will occur predominantly with metals + nonmetals, because of their difference in electronegativity, so for our question, we are looking for metals and nonmetals together since they are likely to form ionic bonds

A. RbCl and MgO

In this case, we have a situation that perfectly follows the explanation, a metal + nonmetal, both compounds are ionic

B. Na2SO3 and NH3

Although we have an ionic bonding with Na2SO3, NH3 will present a more covalent type of bonding

C. SC12 and HF

HF is considered to be covalent

D. BaF and H2O

H2O is a polar covalent compound, it has charges but not as much as an ionic compound

Therefore the best answer will be number 1 or letter A

Answer:

The ratio of volumes in the given case illustrates the Gay Lussac's Law of Gaseous Volumes.

- The law was given by the french chemist Gay Lussac in the year 1806.

- He stated that when gases are combined or are produced in a chemical reaction, they do so in a simple ratio by volume.

- It is given that 2 volumes of hydrogen combine with 1 volume of oxygen producing 2 volumes of water.

- This is in accordance with this law.

Explanation:

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

they are:-

venturi meter.

orfice plate.

Dall tube .

pitot tube.

Averaging pitot tube .

cone meter.

linear resis meter.