2.651 * 10⁴kg
Explanations:
The balanced reaction between limestone (CaCO₃) and sulfuric acid (H₂SO₄) is given as:
\(CaCO_3+H_2SO_4\rightarrow H_2CO_3+CaSO_4\)Given the following parameters
• volume of sulfuric acid = 5.2 x 10⁹ L
,• Mas of sulfuric acid = 0.005g
Determine the moles of sulfuric acid.
\(\begin{gathered} moles\text{ of H}_2SO_4=5.2\times10^9L\times\frac{0.005g}{L}\times\frac{mol}{98.079} \\ moles\text{ of }H_2SO_4=2.651\times10^5moles \end{gathered}\)According to stochiometric, 1 mole of limestone reacted with 1mole of sulfuric acid, hence the number of moles of limestone required is 2.651 * 10⁵moles
Determine the required mass of limestone
\(\begin{gathered} Mass\text{ of }CaCO_3=moles\times molar\text{ mass} \\ Mass\text{ of C}aCO_3=2.651\times10^5g\times\frac{100.09g}{mol}\frac{}{} \\ Mass\text{ of CaCO}_3=2.651\times10^7grams \end{gathered}\)Convert the result to kilogram
Recall that 1000g =1kg
Hence;
\(\begin{gathered} Mass\text{ of CaCO}_3=2.651\times\frac{10^7}{10^3}kg \\ Mass\text{ of CaCO}_3=2.651\times10^4kg \end{gathered}\)Hence the mass of limestone in kg would be required to completely neutralize a 5.2 x 10⁹ L lake containing 5.0 x 10-3 g of H₂SO₄ per liter is 2.651 * 10⁴kg
26. In Rutherford's alpha scattering experiment, a few of the alpha particles aimed at a thin gold foil bounced back because
A. The positively charged alpha particles were repelled by a negatively charged nucleus in the gold atom.
B. The positively charged alpha particles were repelled by a positively charged nucleus in the gold atom.
C. The negatively charged alpha particles were repelled by a negatively charged nucleus in the gold atom.
D. The negatively charged alpha particles were attracted to a positively charged nucleus in the gold atom.
Answer:
A
Explanation:
The positively charged alpha particles were repelled by a negatively charged nucleus in the gold atom.
a. Identify the structures shown in the diagram. b. Identify the information that is contained within these structures. c. Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person. d. Explain why the structures are in pairs.
The answer responses to the structures shown in the diagram are:
A. chromosomes
C. They would be the same.
B. They are in pairs because each one comes from a different parent.
What is the structure about?The chromosomes are in pairs because humans have a diploid number of chromosomes, meaning they have two sets of chromosomes, one inherited from each parent.
The nucleus is important in eukaryotic cells and has many important parts that help the cell work properly. There are some parts inside cells called the nuclear membrane, nucleoplasm, nucleolus, and chromatin. Chromatin is made up of DNA and other proteins.
Every part of a person's body has the same genes, but the way they are organized can be different in different types of cells. The chromosomes in our skin cells might not be the same as the chromosomes in our muscle cells, even if they come from the same person.
Learn more about nucleus from
https://brainly.com/question/9376695
#SPJ1
Identify the structures shown.
A. chromosomes
B. mitochondria
C. nuclei
D. vacuoles
C
Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.
A. There would be longer.
B. They would be shorter.
C. They would be the same.
D. They would be different.
Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.
A. There would be longer.
B. They would be shorter.
C. They would be the same.
D. They would be different.
Explain why the structures are in pairs.
A. They aren't in pairs.
B. They are in pairs because each one comes from a different parent.
C. This cell is making a copy of itself.
D. The cell always has 2 copies in case 1 is damaged.
Matter is defined as a substance made up of particles that has weight and can occupy space.
There are three main states of matter which include:
Solid: They have their particles vibrate in their fixed positions.
Liquid: The particles are generally slightly further apart than in a solids; and
Gas: particles are widely spaced and tend to be only slightly attracted to each other.
The windsurfer, his board, and his surroundings is made up of particles that are tightly packed together and vibrate in their fixed positions.
Therefore, the components that make up the windsurfer, his board, and his surroundings is matter.
Answer:
what is th question??????????
mc016-1
Which represents the correct mass-volume relationship at STP?
32.00 g of O2 react with an excess of H2 to produce (2 ´ 22.4) L of H2O.
2.00 g of H2 react with an excess of O2 to produce (2 ´ 22.4) L of H2O.
32.00 g of O2 react with an excess of H2 to produce 22.4 L of H2O.
(2 ´ 2.00) g of H2 react with an excess of O2 to produce 22.4 L of H2O.
The correct mass-volume relationship at STP is A. 32.00 g of \(O_{2}\) react with an excess of \(H_{2}\) to produce (2 ´ 22.4) L of \(H_{2}O\)
To determine the correct mass-volume relationship at STP (Standard Temperature and Pressure), we need to consider the stoichiometry of the balanced chemical equation, the molar masses of the substances involved, and the molar volume of gases at STP.
The balanced equation indicates that 2 moles of \(H_{2}\) react with 1 mole of \(O_{2}\) to produce 2 moles of \(H_{2}O\). At STP, 1 mole of any gas occupies 22.4 liters.
In option A, it states that 32.00 g of \(O_{2}\) react with an excess of \(H_{2}\) to produce (2 × 22.4) L of \(H_{2}O\). The molar mass of \(O_{2}\) is 32.00 g/mol, which corresponds to 1 mole of \(O_{2}\). According to the balanced equation, 1 mole of \(O_{2}\) reacts to form 2 moles of \(H_{2}O\). Therefore, the given mass of \(O_{2}\) (32.00 g) corresponds to 1 mole of \(O_{2}\), which will produce 2 moles of \(H_{2}O\).
Since 1 mole of any gas occupies 22.4 L at STP, 2 moles of \(H_{2}O\) would occupy (2 × 22.4) L, which is equal to 44.8 L. Hence, the correct answer is A, where 32.00 g of \(O_{2}\) react with an excess of \(H_{2}\) to produce (2 × 22.4) L of \(H_{2}O\). This choice represents the correct mass-volume relationship at STP based on the given equation and stoichiometry. Therefore, Option A is correct.
The question was incomplete. find the full content below:
Consider the equation. 2\(H_{2}\)(g) + \(O_{2}\)(g) >>>> 2\(H_{2}O\)(g)
Which represents the correct mass-volume relationship at STP?
A. 32.00 g of \(O_{2}\) react with an excess of \(H_{2}\) to produce (2 ´ 22.4) L of \(H_{2}O\)B. 2.00 g of \(H_{2}\) react with an excess of \(O_{2}\) to produce (2 ´ 22.4) L of \(H_{2}O\).
C. 32.00 g of \(O_{2}\) react with an excess of \(H_{2}\) to produce 22.4 L of \(H_{2}O\)
D. (2 ´ 2.00) g of \(H_{2}\) react with an excess of \(O_{2}\) to produce 22.4 L of \(H_{2}O\).
Know more about molar volume here:
https://brainly.com/question/11676583
#SPJ8
Which of the following is the best explanation for why it is important to follow lab safety guidelines?
Answer:
Following laboratory safety guidelines minimizes the chance of lab accidents.
Explanation:
ASAP!!
Identify the limiting reactant when 6 moles of CaCl2 is combined with 6 moles of Al2O3.
Reaction: 3CaCI2 + Al2O3 -> 3CaO + 2AlCI3
Answer:
just downloud smart
Explanation:
thank me later
Combination and decomposition reactions can be identified based on their typical characteristics. Which statements best describe the
characteristics of combination and decomposition reactions? Select all that apply.
D Combination reactions are typically exothermic and reactants are molecular compounds of single elements.
O Combination reactions are typically endothermic and the reactant is a compound with two or more elements.
Decomposition reactions are typically endothermic and the reactant is a compound with two or more elements.
Decomposition reactions are typically exothermic and reactants are molecular compounds of single elements.
The characteristics of combination and decomposition reactions are as follows:
Combination reactions are typically exothermic and reactants are molecular compounds of single elements (option A)Decomposition reactions are typically endothermic and the reactant is a compound with two or more elements (option C)What are combination and decomposition reaction?Combination reactions are chemical reaction where two or more elements or compounds combine to form a single compound.
Decomposition reaction is a reaction in which chemical species such as chemical compounds break up into simpler parts or elements. Usually, decomposition reactions require energy input i.e. endothermic.
Combination reactions give off energy as heat when compounds are formed by joining bonds i.e. they are exothermic.
Learn more about combination and decomposition reaction at: https://brainly.com/question/15192790
#SPJ1
A student is investigating potential and kinetic energy by stretching a spring across a table. When the student lets go
The spring recoils.
Answer: When the spring is recoiling
Explanation:
Answer:
When the spring is recoiling
Explanation:
PLEAS EHELPP!!
True or false: lone pairs of electrons around the central atom do not influence the shape
of the molecule.
a. 1.7 grams of Ca are mixed with 850.6 ml of 0.043 M HBr. What is the maximum theoretical yield of the gaseous product in grams?
b. how many grams of the excess reagent are left over?
c. what is the pH of the HBr solution?
d. what is the OH- concentration of the HBr solution?
e. if the gas is produced at 89C and 1.7 atm of pressure, what is the volume of gaseous product in mL?
f. the pressure of the gas is changed to 250 mmHg and the volume is changed to 1.54 L. what is the temperature of the gas now?
A. The maximum theoretical yield of the gaseous product in grams is 0.037 g
B. The grams of the excess reagent are left over is 0.97 g
C. The pH of the HBr solution is 1.37
D. The OH¯ concentration of the HBr solution is 2.33×10¯¹³ M
E. The volume (in mL) of the gaseous product is 323 mL
F. The new temperature of the gas is 61 °C
How to determine the mass of HBrWe'll begin by calculating the mole of HBr in the solution. This is illustrated below:
Volume = 850 mL = 850.6 / 1000 = 0.8506 L Molarity = 0.043 MMole of HBr =?Molarity = mole / Volume
Mole = molarity × volume
Mole of HBr = 0.043 × 0.8506
Mole of HBr = 0.0366 mole
Thus, the mass of HBr can be obtained as follow:
Mole of HBr = 0.0366 moleMolar mass of HBr = 81 g/molMass of HBr =?Mass = mole × molar mass
Mass of HBr = 0.0366 × 81
Mass of HBr = 2.96 g
A. How to determine the maximum theoretical yieldBalanced equation
Ca + 2HBr --> CaBr₂ + H₂
Molar mass of Ca = 40 g/mol
Mass of Ca from the balanced equation = 1 × 40 = 40 g
Molar mass of HBr = 81 g/mol
Mass of HBr from the balanced equation = 2 × 81 = 162 g
Molar mass of H₂ = 2 g/mol
Mass of H₂ from the balanced equation = 1 × 2 = 2 g
SUMMARY
From the balanced equation above,
40 g of Ca reacted with 162 g of HBr to produce 2 g of H₂
Next, we shall determine the limiting reactant.
From the balanced equation above,
40 g of Ca reacted with 162 g of HBr.
Therefore,
1.7 g of Ca will react with = (1.7 × 162) / 40 = 6.885 g of HBr.
Since a higher amount of HBr is needed, therefore HBr is the limiting reactant and Ca is the excess reactant
Finally, we shall determine the maximum theoretical yield of the gaseous product. details below
From the balanced equation above,
162 g of HBr reacted to produce 2 g of H₂.
Therefore,
2.96 g of HBr will react to produce = (2.96 × 2) / 162 = 0.037 g of H₂
Thus, The maximum theoretical yield of the gaseous product obtained is 0.037 g
B. How to determine the mass of the excess reactant leftoverCa is the excess reactant
From the balanced equation above,
162 g of HBr reacted with 40 g of Ca.
Therefore,
2.96 g of HBr will react with = (2.96 × 40) / 162 = 0.73 g
Thus, the mass of the excess reactant leftover can be obtained as illustrated below:
Mass of excess reactant given = 1.7 gMass of excess reactant that reacted = 0.73 gMass of excess reactant leftover =?Mass of excess reactant leftover = 1.7 - 0.73
Mass of excess reactant leftover = 0.97 g
C. How to determine the pH of HBrMolarity of HBr = 0.043 MHydrogen ion concentration [H⁺] = 0.043 MpH =?pH = –Log H⁺
pH = –Log 0.043
pH = 1.37
D. How to determine the OH¯ concentrationHydrogen ion concentration [H⁺] = 0.043Hydroxide ion concentration [OH¯] =?[H⁺] × [OH¯] = 10¯¹⁴
0.043 × [OH¯] = 10¯¹⁴
Divide both side by 0.043
[OH¯] = 10¯¹⁴ / 0.043
[OH¯] = 2.33×10¯¹³ M
E. How to determine the volume of the gas productTemperature (T) = 89 °C = 89 + 273 = 362 KPressure (P) = 1.7 atmGas constant (R) = 0.0821 atm.L/Kmol Mass of gas product (H₂) = 0.037 g Molar mass of H₂ = 2 g/molNumber of mole (n) = 0.037 / 2 = 0.0185 moleVolume (V) =?Using the ideal gas equation, the volume of the gas can be obtained as follow:
PV = nRT
Divide both side by P
V = nRT / P
V = (0.0185 × 0.0821 × 362) / 1.7
V = 0.323 L
Multiply by 1000 to express in mL
V = 0.323 × 1000
V = 323 mL
F. How to determine the new temperatureInitial volume (V₁) = 323 mL = 323 / 1000 = 0.323 LInitial pressure (P₁) = 1.7 atmInitial temperature (T₁) = 89 °C = 89 + 273 = 362 KNew Volume (V₂) = 1.54 L New pressure (P₂) = 250 mmHg = 250 / 760 = 0.329 atmNew temperature (T₂) =?The new temperature of the gas can be obtained by using the combined gas equation as illustrated below:
P₁V₁ / T₁ = P₂V₂ / T₂
(1.7 × 0.323) / 362 = (0.329 × 1.54) / T₂
Cross multiply
1.7 × 0.323 × T₂ = 362 × 0.329 × 1.54
Divide both side by 1.7 × 0.323
T₂ = (362 × 0.329 × 1.54) / (1.7 × 0.323 )
T₂ = 334 K
Subtract 273 to obtain answer in °C
T₂ = 334 – 273 K
T₂ = 61 °C
Learn more about molarity:
https://brainly.com/question/9468209
Learn more about stoichiometry:
https://brainly.com/question/14735801
Learn more about pH:
https://brainly.com/question/3709867
Learn more about ideal gas equation:
https://brainly.com/question/4147359
Learn more about gas laws:
https://brainly.com/question/6844441
#SPJ1
true/false. label the functional groups in the molecule. you are currently in a labeling module. turn off browse mode or quick nav, tab to items, space or enter to pick up, tab to move, space or enter to drop.a molecule is composed of several functional groups.
The statement is true that a molecule is composed of several functional groups.
What is molecules?A molecule is a group of two or more atoms held together by chemical bonds. Atoms can form chemical bonds by sharing electrons with other atoms, leading to the formation of stable molecules with unique chemical and physical properties. Molecules can be made up of atoms of the same element or different elements, and they can vary widely in size and complexity. In biology, many important molecules are made up of carbon, hydrogen, oxygen, nitrogen, and other elements, and they play critical roles in biological processes such as metabolism, cellular signaling, and genetic information storage and transmission. Examples of important biological molecules include DNA, RNA, proteins, carbohydrates, lipids, and many others. These molecules are responsible for carrying out the various functions of cells and organisms and are critical for life as we know it.
Here,
Many molecules in biology are composed of several functional groups, which are specific atoms or groups of atoms within the molecule that give it its chemical properties and reactivity. Examples of common functional groups in biological molecules include amino (-NH2), carboxyl (-COOH), hydroxyl (-OH), phosphate (-PO4), and methyl (-CH3) groups, among others. The presence of these functional groups can determine how a molecule interacts with other molecules in the cell and can influence its function and activity.
To know more about molecules,
https://brainly.com/question/11932695
#SPJ1
Suppose you added some solid potassium nitrate (KNO3) to a saturated solution of KNO3 at 20°C and then warmed the mixture to 40°C. What would happen to the added KNO3? What would happen if you repeated the procedure, except with sodium chloride (NaCl)?
If you added solid potassium nitrate (KNO3) to a saturated solution of KNO3 at 20°C and then warmed the mixture to 40°C, the added KNO3 would dissolve in the solution.
What is potassium nitrate?The inorganic salt potassium nitrate has the chemical formula KNO3. It is a naturally occurring source of nitrate that has been utilised as a component in a variety of products, such as fertilisers, tree stump grinders, rocket propellants, and pyrotechnics.
What is the purpose of potassium nitrate?Potassium nitrate is a crystalline (sand-like), clear, white, or colourless powder or solid with such a salty, pungent flavour. It is employed in the production of glass, rocket fuel, fireworks, fertiliser, explosives, and matches. Due to DOT's citation, potassium nitrate is included on the Hazardous Material List.
To know more about potassium nitrate visit :
https://brainly.com/question/9458006
#SPJ1
What is the conjugate base of the following acids:
1. HCIO,
2. PH4^+
Answer:
ECUACIÓN:HClO 2 + H 2O → ClO− 2 + H 3O
ACIDO: HClO2
BASECONJUGADA:ClO-2
Explanation:
How do I solve the radius of the metal Cylinder, volume & Density?
e. The radius of the metal cylinder is 1.27 cm / 2 = 0.635 cm.
f. The volume of the metal cylinder is 4.745 cm³
g. The density of the metal cylinder is 7.53 g/cm³
What are the radius, volume & Density of the metal Cylinder?Data given:
b. Mass of metal cylinder: 35.732 g
c. Length of metal cylinder: 3.15 cm
d. Diameter of metal cylinder: 1.27 cm
e. Radius of metal cylinder: The radius (r) of a cylinder is half of its diameter. Therefore, the radius of the metal cylinder is 1.27 cm / 2 = 0.635 cm.
To calculate the volume (V) of the metal cylinder;
V = πr²h, where π is approximately 3.14159, r is the radius, and h is the height (length) of the cylinder.
Volume of metal cylinder:
V = 3.14159 * (0.635 cm)² * 3.15 cm = 4.745 cm³
Density of metal cylinder:
Density (ρ) is defined as mass (m) divided by volume (V). Therefore, the density of the metal cylinder is ρ = 35.732 g / 4.745 cm³ = 7.53 g/cm³ (rounded to two decimal places).
So, the radius of the metal cylinder is 0.635 cm, the volume is 4.745 cm³, and the density is 7.53 g/cm³.
Learn more about density and volume at: https://brainly.com/question/1354972
#SPJ1
Which portion of a molecule of F2O has partial positive charge?
Question 3 options:
A)
The F atoms
B)
The central O atom
C)
The partial charge on each atom is zero
D)
The partial charge on each atom is negative
The partial charges on each fluorine atom are negative. Option B) The central O atom is the correct answer. Option B
The partial charges in a molecule are determined by the electronegativity values of the atoms involved. Electronegativity is the ability of an atom to attract electrons towards itself in a chemical bond. In the case of \(F_2O\), fluorine (F) is more electronegative than oxygen.
Fluorine is the most electronegative element on the periodic table, meaning it has a high ability to attract electrons. Oxygen is also relatively electronegative but less so than fluorine. When fluorine atoms bond with oxygen, the shared electrons will be pulled more towards the fluorine atoms, creating a polar covalent bond.
In \(F_2O\), each fluorine atom will pull the shared electrons towards itself, resulting in a higher electron density around the fluorine atoms. This creates a region of partial negative charge around the fluorine atoms.
Conversely, the oxygen atom will have a region of lower electron density and, therefore, a partial positive charge. This is because the shared electrons spend more time around the fluorine atoms due to their higher electronegativity.
Option B
For more such question on partial charges visit:
https://brainly.com/question/29974793
#SPJ8
A balloon at 30.0°C has a volume of 222 mL. If the temperature is increased to 64.1°C and the pressure remains constant, what will the new volume be, in mL?
Answer:
Explanation:
I forgot
Which of the atoms listed below has the largest radius?
A) AI
B) P
C) Si
D) Na
E) Mg
According to the given statement Na of the atoms listed below has the largest radius.
What is an atom?An atom is made up of a core nucleus and one or even more electrons with negative charges that orbit it. The positively charged, comparatively hefty protons and neutrons that make it up the nucleus may be present. The fundamental building components of matter are atoms.
How are atoms made?Atoms are made up of a nucleus in the center that is surrounded by protons, neutrons, and electron. Uranium is divided into smaller atoms during the fission process, creating new atoms. The creation or atoms in enormous numbers can be seen in the Big Bang and Supernova phenomena.
To know more about Atoms visit:
https://brainly.com/question/1566330
#SPJ13
Describe the cause and effect relationship between density and ocean currents.
Answer:
Differences in water density affect vertical ocean currents. Denser water tends to sink, while less dense water tends to rise. Other causes of currents include tides, rain, runoff, and ocean bottom topography. Topography is the surface features of a place. Ocean topography includes slopes, ridges, valleys, and mountains! All these things are found at the bottom of the ocean, and can influence currents.
The cause-and-effect relationship between density and ocean currents is the mixing and circulation are influenced by the density differences between the various layers of the water column.
What are ocean currents?The continuous, predictable, and directional movement of seawater known as ocean currents is caused by gravity and wind.
Ocean vertical currents are influenced by variations in water density. Less dense water tends to rise, while denser water sinks. Tides, rainfall, runoff, and the topography of the ocean bottom are additional causes of currents.
Thus, the mixing and circulation are influenced by the differences in densities between the various layers of the water column, which is the cause-and-effect relationship between density and ocean currents.
To learn more about ocean currents, refer to the below link:
https://brainly.com/question/1543125
#SPJ2
A muffi n recipe calls for cream of tartar, or potassium
hydrogen tartrate, KHC4H4O6(s). Th e amount of
cream of tartar that is required contains 2.56 × 1023
atoms of carbon. What amount in moles of
potassium hydrogen tartrate is required?
A muffi n recipe calls for cream of tartar, or potassium hydrogen tartrate. The amount of cream of tartar that is required contains 2.56 ×10²³atoms of carbon. 0.42moles of potassium hydrogen tartrate is required
In the Global System of Units (SI), the mole represents the unit of material quantity. How many fundamental entities of a particular substance are present within an object a sample is determined by the quantity of that material. An elementary entity can be a single atom, a molecular structure, an ion, a charged particle pair, or a particle that is subatomic like a proton depending on the makeup of the substance.
For instance, despite the fact that the two substances have different volumes and masses, 10 moles of water because 10 moles of the chemical element mercury both contain the same quantity of stuff, because the mercury comprises exactly one particle for each molecule of water.
mole = 2.56 ×10²³/ 6.022×10²³
= 0.42moles
To know more about mole, here:
https://brainly.com/question/26416088
#SPJ1
how many atoms are in 20.34 grams of aluminum (Al)
A) 6.02 x 10^23 atoms
B) 4.54 x 10^23 atoms
C) 4.54 atoms
D) 548.8 grams
Notice that the value 12.01 grams of natural carbon is the same as the atomic mass value (12.01 amu). It also tells us that 20.34 grams of aluminum contains exactly 6.022 x 1023 atoms of aluminum.
✅
So, the answer is A) 6.02 x 10^23 atoms
IamSugarBee
Answer:
Option A: 6.03 * 10^23 atoms
At what stage of development are fish the most vulnerable?
Answer:
child stage.
Explanation:
they are more vubnlerabke at that stage
A 200 N force is applied to an object, which then accelerates at 2 m/s². What is the mass of the object?
The mass of the object that is acted on by a force of 200 N is 100 kg
What is mass?Mass can be defined as the quantity of matter a body contains.
To calculate the mass of the object, we use the formula below.
Formula:
m = F/a................ Equation 1Where:
m = Mass of the objectF = Force of the objecta = Acceleration due to gravityFrom the question,
F = 200 Na = 2 m/s²Substitute these values into equation 1
m = 200/2m = 100 kgHence, the mass of the object is 100 kg.
Learn more about mass here: https://brainly.com/question/19385703
#SPJ1
copper reacts with oxygen to form two oxides x and y. on analysis 1.535g of x yielded 1.365g of copper and 1.450g of y yielded 1.160g of copper (I) determine the chemical formula for x and y (ii) calculate the mass cooper which can react with 0.5g of oxygen to yield x and y (iii) which of the laws of chemical combination is illustrated by the result above?
The chemical formula for x and y is Cu₂O and CuO. The mass cooper which can react with 0.5g of oxygen to yield x and y is 2.745 g.
What is chemical formula ?A chemical formula is a phrase that lists the constituent parts of a compound together with their relative quantities. No subscript is used if there is just one atom of a certain kind. A subscript is added to the symbol of an atom if it contains two or more of a certain type of atom.
1. 1.535 g of X → 1.365 g of Copper
1.535 – 1.365 = 0.170g of Oxygen
Atomic weight of Cu = 63.5,
Atomic weight of Oxygen = 16
For Cu 1.365 g / 63.5 = 0.02 mol
For Oxygen 0.170 g / 16 = 0.01 mol
X = Cu₂O
1.450 g of Y → 1.160 g of Cu
1.450 – 1.160 = 0.290 g of Oxygen
For Cu = 1.160 g / 63.5 = 0.018 mol
For Oxygen = 0.290 g / 16 = 0.018 mol
Y = CuO
2. The total mass of Oxygen = 0,170 g + 0,290 g
= 0.460 g
Total mass of Cu = 1.160 g + 1. 365 g
= 2.525 g
0.460 g of Oxygen → 2.525 g of Cu
0.500 g of Oxygen → (2.525 x 0.5) / 0.460
= 2.745 g of Cu
Thus, The law of multiple proportions was formulated by John Dalton in 1804.
To learn more about the chemical formula, follow the link;
https://brainly.com/question/29031056
#SPJ9
What is more dense, a rock or water and why?
Answer:if a rock sinks, it is more dense than water. Liquid Density examples based upon differences in mass or weight per unit volume. Density of a liquid with a constant volume, varies according to the weight. The higher the weight, the higher the density.
Explanation:
The irreversible isomerization A
B was carried out in a batch reactor and the following concentration time data were obtained:
Time vs Concentration data in a Batch reactor
t 0 3 5 8 10 12 15 7.5
mol/h 4 2.89 2.25 1.45 1.0 0.65 0.25 0.07
Determine the reaction order,
, and the specific reaction a rate constant, k, using any method of your choice.
The reaction order and specific reaction rate constant can be determined by performing the kinetics experiment on irreversible polymerization A. Kinetic experiments can be used to investigate the rate and mechanism of chemical reactions. Chemical kinetics is the study of chemical reactions' speed and pathway.
The term "kinetics" refers to the study of reaction rates, which are determined by measuring the concentration of reactants and products as a function of time.Kinetics experiments can be used to determine the reaction rate and order of reaction. A chemical reaction's rate is defined as the change in the concentration of a reactant or product per unit time. The order of a reaction refers to the number of molecules that must react to produce a product. The order of reaction can be determined by measuring the initial rate of the reaction as a function of concentration.Methods for determining the reaction rate order include the initial rate method, the half-life method, and the integrated rate method. The initial rate method determines the reaction order by measuring the initial rate of the reaction at different reactant concentrations. The half-life method determines the reaction order by measuring the time it takes for the reactant concentration to decrease by half.The integrated rate method determines the reaction order by measuring the concentration of the reactant or product at different times.The specific rate constant can be determined by using the Arrhenius equation, which relates the rate constant to the activation energy, temperature, and frequency factor. The frequency factor can be determined by measuring the rate constant at different temperatures.For such more question on polymerization
https://brainly.com/question/1602388
#SPJ8
It was shown that 150 J was required to raise the temperature of 20.0 g of an unknown metal from 30°C to 50°C. Using a table of specific heat
capacities, identify the unknown metal.
Answer:
0.375 J/g°C
Brass
Explanation:
To identify the unknown metal, you first need to calculate the specific heat capacity using the following equation:
Q = mcΔT
In this equation,
-----> Q = heat energy (J)
-----> m = mass (g)
-----> c = specific heat capacity (J/g°C)
-----> ΔT = change in temperature (°C)
You can find the specific heat capacity by plugging the given values into the equation and simplifying to find "c".
Q = 150 J c = ? J/g°C
m = 20.0 g ΔT = 50°C - 30°C = 20°C
Q = mcΔT <----- Given equation
150 J = (20.0 g)c(20°C) <----- Insert values
150 J = (400 g°C)c <----- Multiply 20.0 g and 20°C
0.375 J/g°C = c <----- Divide both sides by 400 g°C
The specific heat capacity of the unknown metal is 0.375 J/g°C. According to my research, there is no metal with this exact specific heat capacity. However, the closest I could find was brass (0.377 J/g°C).
what is vascuoles ?
Answer:
Vacuoles are essentially enclosed compartments which are filled with water containing inorganic and organic molecules including enzymes in solution, though in certain cases they may contain solids which have been engulfed.
Explanation: i hoped this helped :)
Answer:
vacuole
Explanation:
a space within a cell that is empty of cytoplasm
vacuole is a membrane-bound
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Which sequence represents the relationship between temperature and volume as explained by the kinetic-molecular
theory?
higher temperature → less kinetic energy
higher temperature → more kinetic energy→more space between particles → higher volume
less space between particles → higher volume
higher temperature → more kinetic energy less space between particles → lower volume
higher temperature → less kinetic energy→more space between particles lower volume
The correct sequence is higher temperature→ more kinetic energy→ more space between particles→ higher volume.
According to the postulates of Kinetic gas theory:
Postulate 1: It states that the average kinetic energy of gas particles is proportional to the absolute temperature of the gas.
Which states that the higher temperature, the higher the kinetic energy of the molecules, which is the start of the sequence of the relationship between temperature and volume.
Postulate 2: Average kinetic energy is proportional to the square of the speed, it shows that at higher the kinetic energy the faster the molecules will move.
Postulate 3: As the particles move faster, the particles will collide more frequently so they will move away from each other, occupying more space.
Postulate 4: More space between the molecules results in more volume.
So, the complete and correct sequence is higher temperature → higher kinetic energy (higher speed) → more space → more volume.
Learn more about the Kinetic Gas Theory here:
https://brainly.com/question/7563496
#SPJ10
which is the graph of the function g(x) = f(-x)
To graph the function g(x) = f(-x), you can start with the graph of f(x) and then reflect it about the y-axis.
What is a graph of the function g(x) = f(-x)?To find the graph of the function g(x) = f(-x), we can start with the graph of the function f(x) and then reflect it about the y-axis.
If the graph of f(x) is symmetric with respect to the y-axis, meaning it is unchanged when reflected, then g(x) = f(-x) will have the same graph as f(x).
However, if the graph of f(x) is not symmetric with respect to the y-axis, then g(x) = f(-x) will be a reflection of f(x) about the y-axis.
In either case, the resulting graph of g(x) = f(-x) will be symmetric with respect to the y-axis.
Learn more about the graph of functions at: https://brainly.com/question/17089414
#SPJ1