In circle t, s is a point of tangency. find the radius (r) of circle t. given ur = 36 cm and sr = 48 cm

Answers

Answer 1

In the given diagram, let's consider the following information:

ur = 36 cm (radius of the larger circle, Circle U)sr = 48 cm (radius of the smaller circle, Circle S)

Since point S is the point of tangency, it lies on the radius of Circle U. This means that the radius of Circle S (sr) is perpendicular to the radius of Circle U (ur) at point S.

We can use the properties of tangents to find the relationship between the radii of the two circles. According to the tangent radius theorem, the radius of Circle S is perpendicular to the tangent line at the point of tangency, which is also the radius of Circle U.

Therefore, the radius of Circle S (sr) is perpendicular to the radius of Circle U (ur) at point S. This creates a right triangle, where ur is the hypotenuse and sr is one of the legs.

Applying the Pythagorean theorem, we can find the length of the other leg, which is the radius of Circle T (rt):

rt^2 = ur^2 - sr^2rt^2 = 36^2 - 48^2rt^2 = 1296 - 2304rt^2 = -1008 (Since the result is negative, it means there is no real solution.)

Since we obtain a negative value for rt^2, it implies that there is no real solution for the radius of Circle T (rt) in this configuration.

Learn More About Perpendicular at https://brainly.com/question/17565270

#SPJ11


Related Questions

In a strand of dna, what other base does the base called adenine bond to?.

Answers

Answer: The base pair that adenine bonds to is thymine!

Explanation:

There are 4 base pairs in a DNA strand, adenine, thymine, guanine, cytosine. Adenine will always base pair with thymine, and guanine will always base pair with cytosine. But in RNA, thymine base pairs don't exist, so they will be replaced with uracil. And uracil will be paired with adenine, only in RNA.

A way you can remember these base pairs are; Apples in a Tree ( Adenine + Thymine ), and Cars in a Garage ( Cytosine + Guanine)

ENE-2.H Explain how concentration gradients affect the movement of molecules across membranes.

Answers

Concentration gradients play a crucial role in the movement of molecules across membranes. A concentration gradient is a difference in the concentration of a particular molecule between two regions.

A molecule is a group of two or more atoms bonded together chemically, forming a stable entity. Atoms are the basic building blocks of matter, and they combine to form molecules by sharing electrons or by forming ionic bonds. Molecules can be made up of the same type of atoms, such as oxygen molecules which are composed of two oxygen atoms, or different types of atoms, such as water molecules which are made up of two hydrogen atoms and one oxygen atom.

Molecules are the foundation of chemistry, as they form the basis for all chemical reactions and interactions. They have unique properties and behaviors based on their chemical makeup, including their shape, size, polarity, and reactivity. Understanding the structure and behavior of molecules is essential in fields such as biochemistry, pharmacology, and materials science, as it allows scientists to design and create new compounds for various applications.

To learn more about Molecule visit here:

brainly.com/question/30465503

#SPJ4

Social sciences are
a.
the observable facts or events that involve human society.
b.
how people relate to one another and influence each other’s behavior.
c.
the hidden meanings behind human actions.
d.
the disciplines that study human social behavior or institutions and functions of human society in a scientific manner.

Answers

Social sciences are the disciplines that study human social behavior or institutions and functions of human society in a scientific manner.

what are the application studying social science ?

Social science is the field of study where the paragliding word concerned with occurrences created by humans and opposed to traditional sciences.

under this sciences anthropology, evolutionary psychology is often categorized fall under that same group.

It can  be used to involve  in engineering field as either a decision science or other specialty with a technical bent.

To learn more about social science, refer to the link:

https://brainly.com/question/17560563

#SPJ1

fr.ee points for the hoomies


also plz answer my question abt stem cells ;,)

Answers

Answer:

STEM CELLS

They serve as a repair system for the body.

Stem cells provide new cells to the body as it grows and heals

No, the offspring of two black hair horses cannot have chestnut hair. Since the black hair allele is recessive, both parents have to be homozygous recessive (ee) and so do not carry the dominant chestnut hair allele.

Answers

When both parents have the dominant allele (E) for chestnut hair, they are homozygous recessive for black hair (ee), which prevents their offspring from inheriting chestnut hair.

What genotype does the black horse have if it is homozygous?

Red ("E") is subordinate to black ("e"). A horse with the genotype "E/e" (one black and one red allele) has a black base colour but can give birth to children with either a black base or a red base.

What genetic makeup makes a black horse?

The genetics of the black horse are very straightforward. Two genes, Extension and Agouti, are principally responsible for determining the colour black. The extension gene's functioning, dominant allele permits the horse to create black pigment for its hair.

To know more about genetics visit:-

https://brainly.com/question/2142579

#SPJ1

In what atmosphere layer do human live most of their lives

Answers

Answer:

troposphere

This is the lowest part of the atmosphere - the part we live in. It contains most of our weather - clouds, rain, snow.

Identify the type of mirror based on how the image is formed: A virtual
image appears to form behind the mirror. The image appears upright and
the same size as the object but left to right reversed.
*
concave mirror
convex mirror
plane mirror

Answers

explanation and answer to the question :

List at least five facts about brain health and protection.

Answers

Answer:

always use protection but of no one lisens to that saying.

1.)Weave heart-pumping exercise into your daily routine.

2.)Take care of any medical problems.

3.)Get enough sleep, and get help for existing sleep problems.

4.)Review the medications you’re taking with your doctor.

5.)Stay socially engaged.

Fluid in the inner ear creates a sense of ____.

Answers

Answer:

Balance

Explanation:

the joints connecting vertebral bodies (symphysis joints) allow only slight movement, yet we think of our vertebral columns as being (hopefully!) very flexible. how can you explain this

Answers

While it's true that the joints connecting the vertebral bodies, known as symphysis joints or intervertebral discs, allow only slight movement, the overall flexibility of the vertebral column is achieved through a combination of factors.

The flexibility of the vertebral column is achieved through the combined actions of intervertebral discs, facet joints, ligaments, muscles, and the structural design of the spine. These elements work together to provide a balance between stability and mobility, allowing for a wide range of movements while maintaining the necessary support and protection for the spinal cord and other vital structures.

Let us assess each of the factors which are responsible for overall flexibility:

Intervertebral Discs: While the symphysis joints between vertebral bodies have limited movement, the intervertebral discs between them provide flexibility. Intervertebral discs act as shock absorbers and allow for slight bending, twisting, and compression of the vertebral column. These discs consist of a fibrous outer ring called the annulus fibrosus and a gel-like center called the nucleus pulposus. The combination of these structures provides both support and flexibility.

Facet Joints: The facet joints, also known as zygapophyseal joints, are located on the posterior aspect of the vertebral column. These synovial joints connect adjacent vertebrae and play a crucial role in the flexibility and movement of the spine. The facet joints allow for various types of movements, including flexion, extension, rotation, and lateral bending.

Ligaments and Muscles: The vertebral column is supported by ligaments and muscles that surround and stabilize it. Ligaments, such as the anterior and posterior longitudinal ligaments, help maintain the alignment and stability of the vertebral column. Muscles, including the paraspinal muscles and the abdominal muscles, provide support and enable movement in different directions.

The curvature of the Spine: The natural curvature of the spine also contributes to its overall flexibility. The spine consists of several curves, including cervical lordosis (concave), thoracic kyphosis (convex), lumbar lordosis (concave), and sacral kyphosis (convex). These curvatures distribute the load evenly along the vertebral column and enhance its flexibility.

Learn more about the intervertebral discs: https://brainly.com/question/18094930

#SPJ11

How does Matter move throughout the ecosystem

Answers

Answer:

In ecosystems, matter and energy are transferred from one form to another. ... Nutrients and living matter are passed from producers to consumers, then broken down by decomposers.

Explanation:

How do body structures support evolution?

Answers

Answer:

Similar body parts may be homologous structures or analogous structures.

Explanation:

Similar body parts may be homologous structures or analogous structures. Both provide evidence for evolution. Homologous structures are structures that are similar in related organisms because they were inherited from a common ancestor. These structures may or may not have the same function in the descendants.

a byproduct of anaerobic respiration in humans

Answers

Answer:

Lactic Acid.

Explanation:

Because it is the byproduct of anaerobic respiration.

Scientists use the process of genetic engineering to

Answers

Answer:

Genetic engineering is used by scientists to enhance or modify the characteristics of an individual organism. ... For example, genetic engineering can be used to produce plants that have a higher nutritional value or can tolerate exposure to herbicides

Answer:

are you going to give me brainliest mark comment me

Scientists use the process of genetic engineering to

What is the exact amount of the energy input required to begin the process of cellular respiration?

Answers

Answer: The process of cell respiration has an input cost of 2 ATP and a total possible output of 38 ATP per molecule of glucose oxidized.

Explanation:

When sea levels rise as rapidly as they have been, even a small increase can have devastating effects on coastal habitats farther inland. It can cause destructive erosion, wetland flooding, aquifer and agricultural soil contamination with salt, and lost habitat for fish, birds, and plants. What happens to biodiversity in coastal communities as the sea level rises?

Answers

Biodiversity decreases because plants and animals adapted for fresh water will not survive and reproduce in a different environment.

What is sea rise?

The term sea rise has to do with a situation in which there is a sudden increase in the sea level. This could lead to a sudden overflow of water into rivers lakes and ponds.

We know that sea water is salty, there is excess salt concentration in a sea water while fresh water does not contain salt at all. In these cases whereby there is an overflow of seawater, the water carries salt along with it. This implies that land and fresh water could become contaminated with this salt and that would have catastrophic effects on these ecosystems.

Since fresh water organisms can not tolerate a sudden increase in the concentration of salt in the ecosystem, biodiversity decreases because plants and animals adapted for fresh water will not survive and reproduce in a different environment.

Learn more about sea water:https://brainly.com/question/15107402

#SPJ1

MISSING PARTS

When sea levels rise as rapidly as they have been, even a small increase can have devastating effects on coastal habitats farther inland. It can cause destructive erosion, wetland flooding, aquifer and agricultural soil contamination with salt, and lost habitat for fish, birds, and plants. What happens to biodiversity in coastal communities as the sea level rises?

A

Biodiversity increases due to the merging of salt water and fresh water ecosystems.

B

Biodiversity decreases because plants and animals adapted for fresh water will not survive and reproduce in a different environment.

C

Biodiversity decreases because there are fewer salt water species than there are fresh water species.

D

Biodiversity increases due to the survival of both fresh water and salt water species.

Name the 4 nucleotide bases and how they pair up.

Answers

Answer:

Adenine Thymine

Cystenine Guanine

Explanation:

hope it helps

HELPS PLEase ill give you brainlistt

Step 1: Choose one of the ocean currents shown on the maps.

Step 2: Conduct research and describe this current. Include such details as the location, direction, temperature, and any other details you can identify.

Step 3: Include the URL of any sources that you used in your research

HELPS PLEase ill give you brainlisttStep 1: Choose one of the ocean currents shown on the maps.Step 2:

Answers

Step 1: I have chosen the Gulf Stream as the ocean current from the map for this exercise.

How to describe the current?

Step 2: The Gulf Stream is a powerful warm ocean current that originates in the Gulf of Mexico and flows along the eastern coast of the United States before crossing the Atlantic Ocean towards Europe. It is part of the larger North Atlantic Gyre circulation system. The Gulf Stream is known for its swift speed and strong flow.

Location: The Gulf Stream begins in the Gulf of Mexico, near the coast of Florida, and then follows a northeastward path along the eastern seaboard of the United States. It eventually crosses the Atlantic Ocean and influences the climate of Western Europe.

Direction: The Gulf Stream flows from south to north along the eastern coast of the United States and then veers to the east as it crosses the Atlantic Ocean.

Temperature: The Gulf Stream is characterized by warm waters, with temperatures ranging from around 20°C (68°F) to 25°C (77°F) in its northern region. It carries warm water from the tropics towards higher latitudes, significantly affecting the climate of regions it passes through.

Other details: The Gulf Stream is an important ocean current that influences weather patterns, ocean ecosystems, and marine navigation. Its strong flow and warm waters have significant impacts on climate and contribute to the milder temperatures experienced in Western Europe compared to regions at similar latitudes.

Step 3: These are some sources that provide further information about the Gulf Stream:

National Ocean Service - Gulf Stream: https://oceanservice.noaa.gov/facts/gulfstream.html

National Geographic - Gulf Stream: https://www.nationalgeographic.org/encyclopedia/gulf-stream/

Woods Hole Oceanographic Institution - Gulf Stream: https://www.whoi.edu/know-your-ocean/ocean-topics/ocean-circulation/gulf-stream/

Britannica - Gulf Stream: https://www.britannica.com/place/Gulf-Stream

Find out more on Gulf Stream here: https://brainly.com/question/4890028

#SPJ1

What is that hole in the middle of the vertebra with in it?

Answers

Vertebrae have a central opening, called vertebral foramen, that form the spinal canal and contain the spinal cord.

What is that hole in the middle of the vertebra with in it?

What is spatial and temporal resolution of QuickBird satellites?

Answers

A satellite or a man-made object placed in the earth's outer orbit. A satellite is an instrument that has many uses such as communication and used for space study programs. They play an important role in weather forecasting as well.

Quick Bird is an imaging system used in satellites to take high-resolution images for study. The difference between the spatial and temporal Quick bird in the satellite is based on the resolution. Temporal has more high resolution than spatial. The spatial resolution is 5 x 5 m whereas the temporal has 2.4 x 2.8 m.

Learn more about satellite, here:

https://brainly.com/question/9266911

#SPJ4

Pioneer organisms modify their environment, establishing conditions under which more advanced organisms can live. True or false?.

Answers

Answer:

True

Explanation:

Because for example a pioneer organism helps the soil and that helps other organisms thrive

after the dna is unwound at the site of dna replication initiation,what binds to the unwound dna to prevent it from reannealing?

Answers

Single-stranded binding proteins (SSBs) play a crucial role in DNA replication by binding to the unwound DNA strands and preventing them from reannealing, thus ensuring accurate and efficient replication.

DNA replication is an essential process in which the genetic information is copied to produce two identical DNA molecules. After the DNA is unwound at the site of replication initiation, single-stranded binding proteins (SSBs) bind to the unwound DNA to prevent it from reannealing.
Here is a step-by-step explanation of the process:
1. DNA replication starts at a specific sequence called the origin of replication.
2. Helicase enzyme binds to the origin and unwinds the double-stranded DNA by breaking the hydrogen bonds between the base pairs.
3. As a result, two single-stranded DNA templates are formed, creating a replication fork.
4. Single-stranded binding proteins (SSBs) bind to the unwound DNA strands to keep them separated and prevent them from reannealing.
5. SSBs also protect the single-stranded DNA from degradation by nucleases and prevent the formation of secondary structures, ensuring that the DNA remains accessible for the replication machinery.
6. Primase enzyme synthesizes short RNA primers that serve as a starting point for the synthesis of the new DNA strand.
7. DNA polymerase enzymes attach to the primers and start adding complementary nucleotides to the single-stranded templates, forming the new DNA strands.
8. The replication process continues until the entire DNA molecule has been copied.
In conclusion, single-stranded binding proteins (SSBs) play a crucial role in DNA replication by binding to the unwound DNA strands and preventing them from reannealing, thus ensuring accurate and efficient replication.

For more such questions on DNA replication

https://brainly.com/question/21265857

#SPJ11

During sexual reproduction, gametes fuse to form a zygote. Sometimes when gametes are formed
during meiosis, the chromosomes do not completely separate. When a gamete with an extra
chromosome fuses with another gamete to form a zygote, the result is usually a genetic disorder. This
occurrence is an example of which chromosome process?
A. Deletion
B.duplication
C.inversion
D.crossing over

Answers

i am pretty sure it is duplication:)

the cell is capable of regulating gene expression in a variety of situations and environments. valid reasons for a cell to regulate gene expression include its ability to: make additional cells of the same type in response to a demand. (click to select) synthesize enzymes to metabolize a particular nutrient. (click to select) keep a gene product available under all conditions. (click to select) execute a specific program of development (e.g. to become a blood cell or immune cell). (click to select) stop synthesis of a cellular component when there is enough available in the cell. (click to select) synthesize mrna for every gene in the genome at all times. (click to select)

Answers

The capacity of a cell to carry out a particular programme of development (for example, to become a blood cell or immune cell) is a valid reason for it to regulate gene expression.

When the cell is fully capable for regulating gene expression( Gene regulation is the type of process which is used to control the timing, location and amount in which the genes are expressed. this  process can be complicated and is carried out by a variety of mechanisms, including through regulatory proteins and chemical modification of DNA----deoxyribonuclic acid) in a variety of situations and environments. Then the valid reasons for a cell to regulate gene expression include its ability to execute a specific program of development  .

To learn more about gene expression visit below link.

https://brainly.com/question/30969903

#SPJ4

What problems can occur while your immune system fights the corona virus?
plz help me ASAP

Answers

You could possibly experience some serious health problems or even worse possibly die but if you take care of yourself or go to the doctor with time you will have a better chance at surviving Corona

what is the smallest unit of life and can grow, reproduce, and perform certain basic functions.

Answers

The smallest structural and functional unit of living things that can exist independently is the cell. As a result, it is sometimes referred to as the foundation of life.

The most fundamental and smallest unit of life is a cell. Every living thing is made up of cells. Existing cells undergo a two-step division process to create new cells. Because of the union of two cells when they were still in your mother's womb, you are who you are. The two cells that hold all of your DNA joined together to start the process of creating new life. The body's multiple organs, systems, blood, blood arteries, bone, tissue, and skin were formed as a result of cell division and differentiation into additional cells with distinct tasks.

To learn more about the cell follow the link: https://brainly.com/question/3142913

#SPJ4

mitosis, followed by cytokinesis, results in the formation of two genetically identical daughter cells. this is because

Answers

In somatic (non-reproductive) cells, a kind of cell division called mitosis produces two genetically identical daughter cells.

What is mitosis?

Eukaryotic cells divide via a process known as mitosis. A single cell splits into two daughter cells, each of which has an entire set of chromosomes and is genetically identical to the parent cell.

Prophase, Metaphase, Anaphase, and Telophase are the several phases that make up Mitosis. The chromatin in the cell nucleus condenses into discernible chromosomes during prophase. The chromosomes align along the equator of the cell during metaphase. Each chromosome's sister chromatid separates and is yanked to one of the cell's ends during anaphase. During telophase, the chromosomes reach the opposite poles of the cell and the nuclear membrane reforms around each set of chromosomes.

Following mitosis, a procedure known as cytokinesis physically separates the original cell's cytoplasm and organelles into two daughter cells.As a result, two daughter cells are created that are genetically identical and have a full complement of chromosomes and other cellular components.

To know more about mitosis, visit:

https://brainly.com/question/18477575

#SPJ4

EASY 7TH GRADE SCIENCE QUESTION FIRST PERSON BRAINLIEST!!!!!

A. Velocity varies with the compass direction of motion

B. Measurement error causes multiple observations of motion to conflict

C. All motion is relative to the frame of reference chosen for measurement

D. Acceleration and velocity have different values because they are different measures of motion

EASY 7TH GRADE SCIENCE QUESTION FIRST PERSON BRAINLIEST!!!!!A. Velocity varies with the compass direction

Answers

Answer:

C. All motion is relative to the frame of reference chosen for measurement

Explanation:

ASAP PLS
What types of animal behaviors can harm plant populations?
NO COPY AND PASTE!!111!!!!1!!11

Answers

Answer:

The spread of invasive species is a threat to ecosystems worldwide. However, we know relatively little about how invasive species affect the behaviour of native animals, even though behaviour plays a vital role in the biotic interactions which are key to understanding the causes and impacts of biological invasions. Here, we explore how invasive plants - one of the most pervasive invasive taxa - impact the behaviour of native animals

Explanation:

is this what you were looking for

The dermis is the inner layer of the skin that contains within its structure
(Select all that apply)
melanocytes
keratin
Chair follicles
Carrector pill muscles

Answers

Answer:

Carrector pill muscles hair follicles

Explanation:

melanocytes and keratin are present in the epidermis

The dermis is the layer of skin, which is present beneath the epidermis and above the subcutaneous layer. It is the thickest layer of the skin, primarily composed of elastic and fibrous tissue.

The correct answer is:

Option C. hair follicles

Option D. Arrector pili muscles

The dermis consists of:

1. The hair follicles are found in the epidermis and the dermis. Hair follicles nourish the hair and are the tube-shaped structure that surrounds the part of the hair.

2. Arrector pili muscles are the tiny muscles, which attach hair follicles at one end and dermal tissue at the other end. The arrector pili muscles contract to generate heat, giving the feeling of goosebumps.

Thus, the hair follicles and arrector pili muscles are found in the dermis.

To know more about dermis, refer to the following link:

https://brainly.com/question/846437

Other Questions
Why was the space station assembled piece-by-piece in space, rather than on earth? a. it allowed the costs to be spread out over time. b. once completed, it would have been too heavy to send to space. c. it allowed for each piece to be developed with the best technology. d. it would have taken too long to put together on earth. Before determining a melting point must the unit always be cooled to room temperature? why? PLS 50PTSWILL MARK AS BRAINLIEST A fair die is tossed once. What is the probability that it shows 3? The Social Security numbers and other personal information from 22 million Americans were stolen by hackers from computers managed by th write the equation of an ellips in standard form.a. coordinates of vertex?b. coordinates of covertex?c. coordinates of foci?d. graph type the value that best answers the question. identify the daily individual income that the united nations defines as living in poverty. the slope of a linear demand curve is: multiple choice question. the change in price divided by the change in quantity demanded. the change in quantity demanded multiplied by the change in price. the change in quantity demanded divided by the change in price. the change in price multiplied by the change in quantity demanded. A 4.00-g particle confined to a box of length L has a speed of 1.00m / s. (b) If the energy of the first excited state (n=2) is equal to the kinetic energy found in part (a), what is the value of L ? the enzyme called rubisco: question 51 options: a) connects a 1-carbon molecule to a 5-carbon molecule. b) connects two 3-carbon molecules into a 6-carbon molecule. c) breaks a 3-carbon molecule into 1-carbon and 2-carbon molecules. d) breaks a 1-carbon molecule off of a 6-carbon molecule. e) connects a 3-carbon molecule to a 5-carbon molecule. goldmeyer company has used the fifo method of inventory valuation since it began operations in 2021. goldmeyer decided to change to the average cost method for determining inventory costs at the beginning of 2024. the following schedule shows year-end inventory balances under the fifo and average cost methods: year fifo average cost 2021 $ 45,500 $ 55,000 2022 79,500 71,500 2023 85,000 79,500 required: ignoring income taxes, prepare the 2024 journal entry to adjust the accounts to reflect the average cost method. how much higher or lower would cost of goods sold be in the 2023 revised income statement? the traditional american family farm is being replaced by which type of enterprise? Assume the following: Beginning finished goods inventory $ 10,000 Ending finished goods inventory $ 8,500 Cost of goods manufactured $ 52,000 What is the unadjusted cost of goods sold? Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 Discuss what is the risk or cost that you will bearfor all the investment or sources of financing that you used inyour business. Which statements best describe the third movement of Mozart's Eine kleine Nachtmusik?A. The harmony is consonant.B. It is in triple meter.C. The texture is homophonic. ((sec x -1) / x sec x) = (1 - cos x) / x. Verify When collecting semen from a boar, the collection container should be filled with water at __________. what happens when you press tab from within the last cell of a table Can you make all 8 unique colors using 3 bits per color? Which climate would be ideal if a person wanted to take a beach vacation?