Hydrogen bonds are describe as a force between molecules, but might there be conditions under which it could also exist as a force within a molecule? Explain.

Answers

Answer 1

Answer:

Explanation:

Hydrogen bonds are described as a force between molecules. However, hydrogen bonds can also exist as a force within a molecule under certain conditions. This is called intramolecular hydrogen bonding. It occurs when a hydrogen atom is sandwiched between two strongly electronegative atoms (such as F, O, N) in the same molecule1.


Related Questions

Element A has two isotopes. The first isotope is present 18.18% of the time and has a mass of
147.99. The second isotope has a mass of 127.76. Calculate the atomic mass of element A. (To two
decimals places)

Answers

The atomic mass of element A, given that the first isotope has abundance of 18.18% and a mass of 147.99, is 131.43 amu

How do i determine the atomic mass of element A?

From the question given above, the following data were obtained:

Abundance of 1st isotope (1st%) = 18.18%Mass of 1st isotope = 147.99Mass of 2nd isotope = 127.76 Abundance of 2nd isotope (2nd%) = 100 - 18.18 = 81.82%Atomic mass of element A=?

The atomic mass of the element A can be obtain as illustrated below:

Atomic mass = [(Mass of 1st × 1st%) / 100] + [(Mass of 2nd × 2nd%) / 100]

Inputting the given parameters, we have:

Atomic mass = [(147.99 × 18.18) / 100] + [(127.76 × 81.82) / 100]

Atomic mass = 26.90 + 104.53

Atomic mass = 131.43 amu

Thus, the atomic mass of element A obtained from the above calaculation is 131.43 amu

Learn more about average atomic mass:

https://brainly.com/question/24185848

#SPJ1

Help me with this please ASAP

Help me with this please ASAP

Answers

Answer:

70% sure it is chemical bonds

Explanation:

:)

2C +2H yield C2H4 Delta H=+52.4 kj/mol
What is the kj of energy absorbed for every mole of carbon reacted

Answers

The kJ of the energy absorbed for the every mole of the carbon reacted is 104.8 kJ.

The chemical equation is as :

2C + 2H ---> C₂H₄   ,     ΔH = + 52.4 kJ/mol

The ΔH is the enthalpy change that is determined by the subtracting the energy of the reactants to the products.

The  ΔH = energy of the products - energy of the reactants

The expression for the energy is as :

q = n ΔH

Where,

n = number of the moles

ΔH = enthalpy change

The kJ of the energy absorbed for the every mole of the carbon reacted :

q = 2 mol × 52.4 kJ/mol

q = 104.8 kJ

To learn more about energy here

https://brainly.com/question/12716509

#SPJ4

Helen knit a total of 175 centimeters of scarf over 35 nights. How many nights will Helen have to spend knitting in order to knit a total of 180 centimeters of scarf? Solve using unit rates.

Answers

Helen takes 35 nights to knit a total of 175 centimeters of scarf. Hence, she will take 36 nights to knit 180 centimeters of scarf.

What are length units?

Length is a basic measurement in for an object which is basically taken in meters or centimeters. The basic unit of length in American standard is meters (m) and in CGS system it is centimeters.

It is given that, Helen knit a total of 175 centimeters of a scarf over 35 nights. Then, the length she knit in one nigh is calculated as:

175/35 = 5 cm.

Therefore, the number of nights required to complete 180 cm is :

180 /5 = 36

Thus, she will take 36 nights to knit a total of 180 cm of scarf.

Find more on length units:

https://brainly.com/question/3217720

#SPJ1

!!!!!PLEASE HELP!!!!!
On which of the following factors does the amount of energy absorbed by an endothermic reaction depend?


Number of reactants

Physical state of the reactant

Sum of the potential energy of the reactants and products

Difference in the potential energy of the reactants and products

Answers

Answer:

Difference in the potential energy of the reactants and products

Explanation:

 

The products have a lower potential energy than the reactants, and the sign of ΔH is negative. In an endothermic reaction, energy is absorbed. The products have a higher potential energy than the reactants, and the sign of ΔH is positive.

The factor on which the energy absorbed during an endothermic reaction depends upon is difference in the potential energy of the reactants and products.

What is an endothermic Reaction ?

All the reactions that absorb energy from the environment, this energy is used as the activation energy required to carry out the reaction.

This reaction feels cold

In Endothermic Reaction the potential energy of the products that are being made is higher than the potential energy of the reactants.

The difference of the energy is taken from the environment or surrounding.

The difference is due to the bond strength of the reactants is more stronger than the bond strength in the products.

Strong bonds have lower potential energy than weak bonds.

Therefore the factor on which the energy absorbed during an endothermic reaction depends upon is difference in the potential energy of the reactants and products .

To know more about Endothermic Reaction

https://brainly.com/question/23184814

#SPJ2

!!!!!PLEASE HELP!!!!!On which of the following factors does the amount of energy absorbed by an endothermic

Determine the empirical formulas for compounds with the following percent compositions:
. 81.68% carbon and 18.32% hydrogen

Answers

The empirical formula of a compound that has the following percent composition; 81.68% carbon and 18.32% hydrogen is C2H5.

How to calculate empirical formula?

The empirical formula is a notation indicating the ratios of the various elements present in a compound, without regard to the actual numbers.

The empirical formula of a compound that has 81.68% carbon and 18.32% hydrogen can be calculated as follows:

81.68% C = 81.68g 18.32% H = 18.32g

First, we convert mass to moles;

C = 81.68g ÷ 12g/mol = 6.81mol H = 18.32 ÷ 1g/mol = 18.3mol

Next, we divide each mole value by the smallest (6.81mol)

C = 6.81 ÷ 6.81 = 1H = 18.32 ÷ 6.81 = 2.7

We multiply each ratio by 5 to make an whole number:

C = 1 × 2 = 2H = 2.7 × 2 = 5.4 = 5

Therefore, the empirical formula of a compound that has the following percent composition; 81.68% carbon and 18.32% hydrogen is C2H5.

Learn more about empirical formula at: https://brainly.com/question/14044066

#SPJ1

What happens after excitation in spectroscopy.

Answers

Answer:

When a molecule is excited to a higher state it often ends up in its lowest excited state S1 and then emits radiation.

Now, inspect the properties of the unknown elements, compare them to the properties of your known elements, and see where the unknown elements best fit in the table above. Once you’re done, use your periodic table to identify each unknown element below.

Answers

Based on the comparison between the properties of the unknown elements and those of known elements, the elements are alkali metals.

The unknown elements are sodium and potassium.

What are the properties of alkali metals?

Alkali metals exhibit metal properties such as strong thermal and electrical conductivity, luster, ductility, and malleability. In the outermost shell of each atom of an alkali metal, there is just one electron. Compared to those in inner shells, this valence electron is significantly more loosely bonded.

Other properties of the alkali earth metals are:

Stored in a mineral oil solution.Low melting points.Low densitiesLow electronegativity.Low ionization energy.

Learn more about alkali metals at: https://brainly.com/question/30391109
#SPJ1

compare the pH value of the solution before the battery is connected to the pH value of the solution after the cell operates for 20 minutes

Answers

Without further details on the specific cell and its components, it is not possible to provide a definitive answer regarding the pH change before and after the cell operates for 20 minutes.

The pH value of a solution can potentially change before and after the operation of a cell, depending on the specific reaction occurring in the cell and the nature of the electrodes involved.

However, without additional information about the specific cell and its components, it is difficult to provide a definitive answer. The pH of a solution is influenced by the concentration of hydrogen ions (H+) in the solution, which can be affected by various chemical reactions, including oxidation and reduction reactions occurring in the cell.

During the operation of a cell, the electrodes undergo chemical reactions, and ions from the electrolyte may participate in these reactions. These reactions can influence the concentration of hydrogen ions and potentially alter the pH of the solution. The direction of the pH change depends on the specific reactions occurring at the electrodes.

For example, in an electrolytic cell, the flow of electric current causes non-spontaneous redox reactions to occur. These reactions might involve the generation or consumption of hydrogen ions, which can affect the pH of the solution.

In a galvanic cell or battery, spontaneous redox reactions take place, and the pH changes can be more complex. The electrode materials, their potential, and the specific reaction kinetics can influence the pH changes in the solution.

Therefore, without further details on the specific cell and its components, it is not possible to provide a definitive answer regarding the pH change before and after the cell operates for 20 minutes. The pH change would depend on the specific reactions occurring in the cell and the behavior of the electrodes involved.

for more such question on cell visit

https://brainly.com/question/31409928

#SPJ8

Students want to gather evidence for the claim that the number of atoms present before a chemical reaction is equal to the number of atoms present after the chemical reaction. They decide to react vinegar and baking soda in a sealed plastic bag. Which of the following would provide evidence the students need

Answers

Answer:

The mass of the plastic bag, baking soda, and vinegar before the reaction was equal to the mass after the reaction.

Explanation:

The two main postulates that was given by Antoine Lavoisier are, oxygen play an important role in combustion and the other is mass of the reactant and product is conserved. Therefore, the reaction shows the law of conservation of mass.

What is law of conservation of mass?

According to Law of conservation of mass, mass can neither be created nor be destroyed. Mass can only be transformed from one form to another. The law of conservation of mass was given by Antoine Lavoisier.

Every reaction in nature follow the law given by Antoine Lavoisier that is mass is always conserved. The mass of the plastic bag, baking soda, and vinegar before the reaction was equal to the mass after the reaction.

Therefore, the reaction shows the law of conservation of mass.

To know more about law of conservation of mass, here:

https://brainly.com/question/28711001

#SPJ2

HQ5.40
Homework Answered Due Today, 11:59 PM
The reaction 3H₂(g) + N₂(g) → 2NH3(g) has an enthalpy of reaction of -92.6 kJ/mol. If 1 g of hydrogen and 2 g of nitrogen are
reacted, how much heat is produced (kJ)?

Answers

The amount of heat energy produced when 1 g of hydrogen and 2 g of nitrogen are reacted, is -6.61 KJ

How do i determine the heat energy produced?

First, we shall obtain the limiting reactant. Details below:

3H₂ + N₂ -> 2NH₃

Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g Molar mass of H₂ = 2 g/molMass of H₂ from the balanced equation = 3 × 2 = 6 g

From the balanced equation above,

28 g of N₂ reacted with 6 g of H₂

Therefore,

2 g of N₂ will react with = (2 × 6) / 28 = 0.43 g of H₂

We can see that only 0.43 g of H₂ is needed in the reaction.

Thus, the limiting reactant is N₂

Finally, we the amount of heat energy produced. Details below:

3H₂ + N₂ -> 2NH₃ ΔH = -92.6 KJ

Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g

From the balanced equation above,

When 28 grams of N₂ reacted, -92.6 KJ of heat energy were produced.

Therefore,

When 2 grams of N₂ will react to produce = (2 × -92.6) / 28 = -6.61 KJ

Thus the heat energy produced from the reaction is -6.61 KJ

Learn more about heat energy:

https://brainly.com/question/31429264

#SPJ1

a) Percy's goal is to create 22g of oxygen gas in one hour. How many moles of oxygen gas does it need to produce? Round to the nearest tenth (1 decimal place). b) Based on the molar ratios found in Step 2 (which is 2:1 ratio), how many moles of carbon dioxide must be reacted to create the oxygen required. Round to the nearest tenth.

Answers

Explanation:

a) We have to find the number of moles of oxygen gas that are present in 22 g of it. To convert from grams to moles we usually use the molar mass. To find the molar mass of oxygen gas we need the atomic mass of O.

atomic mass of O = 16.00 amu

molar mass of O = 16.00 g/mol

molar mass of O₂ = 2 * 16.00 g/mol

molar mass of O₂ = 32.00 g/mol

moles of O₂ = 22 g * 1 mol/(32.00 g)

moles of O₂ = 0.6875 moles = 0.7 moles

b) 2 CO₂ --> 2 CO + O₂

According to the coefficients of the reaction 2 moles of CO₂ will produce 2 moles of CO and 1 mol of O₂. Then the molar ratio between CO₂ and O₂ is 2:1. We will use that ratio to find the number of moles of CO₂ that are required to produce 0.7 moles of O₂.

2 moles of CO₂ : 1 mol of O₂

moles of CO₂ = 0.7 moles of O₂ * 2 moles of CO₂/(1 mol of O₂)

moles of CO₂ = 1.4 moles

Answer:

a) Percy has to produce 0.7 moles of oxygen gas.

b) 1.4 moles of carbon dioxide are required.

Could really use a few pointers on this question!

Could really use a few pointers on this question!

Answers

From the calculations, we can see that the theoretical yiled of NO2 is 100L of NO2

What is the theoretical yield?

The theoretical yield is that calculated from the stoichiometry of the reaction.

We can see that 1 mole of O2 produced 2 moles of NO2. Thus;

2.23 moles of O2 will produce 4.46 moles of NO2

Since 1 mole of NO2 occupies 22.4 L

4.46 moles of NO2 occupies 100L of NO2

Learn more about theoretical yield:https://brainly.com/question/14966377

#SPJ1

In a titration, 25.0 of dilute sulfuric acid was used to react completely with 20.0 of 0.400 mol/ aqueous sodium hydroxide.

2 NaOH (aq) + (aq) → (aq) + 2 (1) (a)Calculate the number of moles of sodium hydroxide that reacted.

(b) Calculate the number of moles of sulfuric acid that reacted with the sodium hydroxide. (c) What is the concentration of sulfuric acid in g/

Answers

Answer:

Explanation:

The balanced chemical equation for the reaction between sulfuric acid and sodium hydroxide is:

H2SO4 + 2NaOH → Na2SO4 + 2H2O

From the equation, we can see that one mole of sulfuric acid reacts with two moles of sodium hydroxide. Therefore, the number of moles of sodium hydroxide used in the reaction is:

n(NaOH) = c(NaOH) x V(NaOH) = 0.400 mol/L x 0.0200 L = 0.00800 mol

Since one mole of sulfuric acid reacts with two moles of sodium hydroxide, the number of moles of sulfuric acid used in the reaction is twice that of sodium hydroxide:

n(H2SO4) = 2 x n(NaOH) = 2 x 0.00800 mol = 0.0160 mol

The concentration of the sulfuric acid can be calculated by dividing the number of moles by the volume used in the titration:

c(H2SO4) = n(H2SO4) / V(H2SO4) = 0.0160 mol / 0.0250 L = 0.640 M

Therefore, the concentration of the dilute sulfuric acid is 0.640 M.

If 4.55 mol of hydrogen were reacted with excess nitrogen as shown in the reaction above and 48.7g of ammonia product was recovered what would be the percent yield of the reaction?
Equation:
N2+ 3H2 —> 2NH3

Answers

As per the balanced reaction, 3 mole or 6 g of hydrogen gas produces 2 moles or 34 g of ammonia. Then, 4.55 mol may produce 51.6 g of ammonia. But the actual yield is 48.7 g. Thus, the percent yield is 94.5%.

What is percent yield ?

Percent yield of a reaction is the ratio of the actual yield of the product to the theoretical yield multiplied by 100.

In the given reaction, 3 moles of hydrogen gas produces 2 moles of ammonia.

molecular mass of H₂ = 2 g/mol

mass of 3 moles = 6 g

molar mass of ammonia = 17 g/mol

mass of 2 moles = 34 g.

Mass of 4.55 moles of hydrogen  gas = 4.55 × 2 = 9.1 g.

Mass of ammonia produced by 9.1 g of hydrogen gas is:

(9.1 × 34)/6 =51.5 g.

However, the actual yield  = 48.7 g

percent yield  = 48.7 g /51.5 g× 100 = 94.5 %.

Therefore, the percent yield of the reaction is 94.5%.

Find more on percent yield:

https://brainly.com/question/12704041

#SPJ1

Please help will give brainliest to right answer!!
You add 1.5 moles of HF to 6 liters of water. The concentration is at equilibrium when [H+] is at 0.10 M. What is the Ka of HF? HF -> H+ + F-.

A) 0.067
B) 0.10
C) 0.25
D) 1.5

Answers

Answer:

C

Explanation:

NP

A…………………………………………………..

At what temperature will 0.654 moles of neon gas occupy 12.30 liters at 1.95 kPa?

At what temperature will 0.654 moles of neon gas occupy 12.30 liters at 1.95 kPa?

Answers

For this question, we will be using the Ideal gas Law formula, which is the following:

PV = nRT

Where:

P = pressure

V = volume

n = number of moles

R = constant of gases

T = temperature

We have:

P = 1.95 kPa or 0.019 atm

V = 12.30 L

n = 0.654 moles

R = 0.082 (this is an experimental value)

T = ?

Now we add these values into our formula:

0.019 * 12.30 = 0.654 * 0.082 * T

0.2337 = 0.0536T

T = 4.36 K

Anyone know about this ?

Anyone know about this ?

Answers

Answer:

i think its vinegar

Explanation:

Answer:

Vinegar

Explanation:

It is made with several ingredients, including sugar.

4) Calculate the molar mass of the compound, if 0.0150 moles of it has mass 2.396g.

Answers

Answer: 159.733

Explanation:

Molar mass is in grams/moles

Using these units and the information provided in the question, we can deduce the molar mass by dividing the given mass by the moles of the compound

2.396 grams/0.0150 moles

Be careful of significant figures if the question asks for them!

Who used scientific investigations to study atoms?
Check all that apply.
Dalton
Democritus
Rutherford
Thomson

Who used scientific investigations to study atoms?Check all that apply.DaltonDemocritusRutherfordThomson

Answers

Answer:

Rutherford used scientific investigation to study atoms.

Scientist who used scientific investigations to study atoms is Rutherford.

What are atoms?

Atoms are the basic fundamental or functional unit of any substance present in the nature.

Rutherford is also known as the father of nuclear physics and he did scientific investigation on the massive part of atom called nucleus he discovered that there are two types of radiation, coming from the uranium atom are alpha and beta particles.

Scientific investigation is a method in which scientist will study, perform and observe results for the experiment.

Hence Rutherford used scientific investigation.

To know more about Scientific investigation, visit the below link:
https://brainly.com/question/17216882

The measure of the length of events and the duration of intervals between events

Answers

The measure of the length of events and the duration of intervals between events is time.

What is time?

The duration of events or the gaps between them can be measured, compared, or even ordered using time. The lengthy period of time that the Earth's geologic history takes up is known as geologic time. Starting at the beginning of the Archean Eon  formal geologic time runs until the present. Geology is defined as the "Science of the Earth."

Geology is the fundamental Earth science that examines how the earth created, its structure and composition, and the various forces acting on it. It is sometimes known as geoscience or earth science.

Learn more about time  at;

https://brainly.com/question/479532

#SPJ1

How many moles are in 0.1 g of Magnesium?

Answers

Answer:

there are approximately 0.004118 moles in 0.1 g of magnesium.

Explanation:

The molar mass of magnesium is approximately 24.31 g/mol. To calculate the number of moles in 0.1 g of magnesium, we can use the following formula:

Number of moles = Mass / Molar mass

Number of moles = 0.1 g / 24.31 g/mol

Number of moles = 0.004118 mol (rounded to 3 significant figures)

Therefore, there are approximately 0.004118 moles in 0.1 g of magnesium.

Answer:

Explanation:

To calculate the number of moles of magnesium in 0.1 g of magnesium, we first need to determine the molar mass of magnesium. The molar mass of magnesium is 24.31 g/mol.

Using this information, we can use the following formula to calculate the number of moles of magnesium:

moles of magnesium = mass of magnesium / molar mass of magnesium

moles of magnesium = 0.1 g / 24.31 g/mol

moles of magnesium ≈ 0.00412 mol

Therefore, there are approximately 0.00412 moles of magnesium in 0.1 g of magnesium.

Using the reading "Fossil Fuels" from lesson 12 describe the environmental and economic benefits and drawbacks of fossil fuels. Second, looking over the benefits and drawbacks, in your opinion, what do you think will happen to mining of fossil fuels in the next 50 years?

Answers

Fossil fuels are essential part of the power generation in the world. They are easily combustible and more reliable and cheaper. However, the burning of fossil fuels releases toxic gases  to the environment.

What are fossil fuels ?

Fossil fuels are fuel generated from the decomposition materials. Petroleum, coal, natural gas  etc. are fossil fuels which are excavating from the earth.

Fossil fuels are non-renewable sources of energy. Hence, as the existing fossil sources are exhausted no more fossil fuel can be made. It is cheaper, reliable and easy to use.

However, the toxic hydrocarbon gases released from the burning of fossil fuels make the environment polluted. Therefore, overuse of fossil fuel definitely rise the atmospheric pollution.

Its use over the next 50 years, will increase the global warming and more of it will be exhausted.

Find more on fossil fuels :

https://brainly.com/question/3371055

#SPJ1

A student prepares a 100.0 mL solution using 44.7 grams of potassium nitrite. They then take 11.9 mL of this solution and dilute it to a final volume of 200.0 mL. How many grams of potassium nitrite are in a 19.7 mL sample of this final diluted solution?

Answers

Answer:

0.52 g of KNO₃ are contained in 19.7 mL of diluted solution.

Explanation:

We can work on this problem in Molarity cause it is more easy.

Molarity (mol/L) → moles of solute in 1L of solution.

100 mL of solution = 0.1 L

We determine moles of solute: 44.7 g . 1mol /101.1 g = 0.442 mol of KNO₃

Our main solution is 0.442 mol /0.1L = 4.42 M

We dilute: 4.42 M . (11.9mL / 200mL) = 0.263 M

That's concentration for the diluted solution.

M can be also read as mmol/mmL, so let's find out the mmoles

0.263 M . 19.7mL = 5.18 mmol

We convert the mmol to mg → 5.18 mmol . 101.1 mg / mmol = 523.7 mg

Let's convert mg to g → 523.7 mg . 1 g / 1000 mg = 0.52 g

Which renewable resource is used to generate electricity? A coal B phosphate C silica D water

Which renewable resource is used to generate electricity? A coal B phosphate C silica D water

Answers

Option  D. Water is a renewable resource that can be used to generate electricity through a process called hydropower.

Hydropower is a clean and sustainable method of producing electricity, as it does not involve the burning of fossil fuels like coal, which contributes to air pollution and climate change.

In hydropower systems, the kinetic energy of flowing or falling water is harnessed and converted into electrical energy. This is typically achieved by constructing a dam across a river or using a run-of-the-river system, which does not require a large reservoir. As water flows through the dam or system, it turns a turbine connected to an electric generator, producing electricity.

To summarize, water is a renewable resource that can be effectively utilized to generate electricity through hydropower, offering a sustainable, clean, and reliable alternative to non-renewable resources like coal, phosphate, and silica. Therefore the correct option D

Know more about hydropower here:

https://brainly.com/question/30197735

#SPJ11

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

calculate the number of atoms of sodium in 0.125mol of sodium oxide​

Answers

Answer:

The chemical formula of sodium oxide is Na2O, which means that for every one mole of Na2O, there are two moles of sodium atoms. Thus, we can calculate the number of moles of sodium atoms in 0.125 mol of Na2O as follows:

Number of moles of sodium atoms = 2 x 0.125 mol = 0.25 mol

Next, we can use Avogadro's number, which is approximately 6.022 x 10^23 particles per mole, to calculate the number of atoms of sodium in 0.25 mol:

Number of atoms of sodium = 0.25 mol x 6.022 x 10^23 atoms/mol

= 1.506 x 10^23 atoms

Therefore, there are approximately 1.506 x 10^23 atoms of sodium in 0.125 mol of sodium oxide.

Hope this helps!

Answer:

Therefore, there are approximately 1.506 x 10^23 sodium atoms in 0.125 mol of sodium oxide.

Explanation:

The chemical formula of sodium oxide is Na2O, which means there are 2 sodium atoms for each molecule of Na2O.

We can use Avogadro's number to calculate the number of sodium atoms in 0.125 mol of Na2O:

1 mol of Na2O contains 2 mol of Na atoms (according to the formula Na2O).

So, the number of moles of Na atoms in 0.125 mol of Na2O is:

2 x 0.125 mol = 0.25 mol

Using Avogadro's number, we can calculate the number of sodium atoms in 0.25 mol:

Number of atoms = (0.25 mol) x (6.022 x 10^23 atoms/mol)

Number of atoms = 1.506 x 10^23 atoms

Therefore, there are approximately 1.506 x 10^23 sodium atoms in 0.125 mol of sodium oxide.

8.0g of certain gas occupies 5.6 L at STP.
A) How many moles of gas are present?
B) What is the molar mass of the gas?
C) What is the common atmospheric gas was collected?

Answers

Answer:

A) Using the ideal gas law, we can calculate the number of moles of gas present:

```

PV = nRT

```

where:

* P = pressure (atm) = 1 atm

* V = volume (L) = 5.6 L

* n = number of moles of gas

* R = ideal gas constant = 0.08206 L atm / mol K

* T = temperature (K) = 273.15 K

Solving for n, we get:

```

n = (P * V) / RT

```

```

n = (1 atm * 5.6 L) / (0.08206 L atm / mol K * 273.15 K)

```

```

n = 0.25 mol

```

Therefore, there are 0.25 moles of gas present.

B) The molar mass of the gas can be calculated by dividing the mass of the gas (8.0 g) by the number of moles of gas (0.25 mol):

```

Molar mass = Mass / n

```

```

Molar mass = 8.0 g / 0.25 mol

```

```

Molar mass = 32 g/mol

```

The molar mass of the gas is 32 g/mol.

C) The common atmospheric gas with a molar mass of 32 g/mol is oxygen (O2). Therefore, the gas that was collected is oxygen.

Explanation:

An American visiting Canada puts 41.2 liters of gas in his car. How much is that in gallons? (1 gal = 3.78 L)

Answers

Answer:

41.2/3.78=10.9

(this is rounded off to the first decimal)

Answer:

10.9 gal

Explanation:

Recall that 1gal = 3.78l

if 1gal = 3.78l

then Xgal = 41.2l

cross multiply

we have 1gal*41.2L=Xgal* 3.78L

divide both by 3.78L

1gal*41.2L/3.78= Xgal

Xgal = 10.89L or 10.9L

A student performs a titration of 51.0 mL of a phosphoric
acid (H PO) solution of unknown concentration with a
standardized 1.25 M NaOH solution. The titration requires
26.2 mL of base to reach the third equivalence point. What is
the concentration of the H3PO4
solution?

Answers

From the information available in the question, the concentration of the acid is 0.21 M.

H3PO4(aq) + 3NaOH(aq) -----> Na3PO4(aq) + 3H2O(l)

Volume of acid(VA) = 51.0 mL

Concentration of acid (CA) = ?

Volume of base (VB) = 26.2 mL

Concentration of base (CB) = 1.25 M

Number of moles of acid (NA) = 1

Number of moles of base (NB) = 3

Using the formula;

CAVA/CBVB = NA/NB

CAVANB = CBVBNA

CA =  CBVBNA/VANB

CA =  1.25 M × 26.2 mL × 1/51.0 mL × 3

CA = 0.21 M

The concentration of the acid is 0.21 M.

Learn more: https://brainly.com/question/8646601

Other Questions
Science is both the accumulated body of knowledge produced by many scientists and ______. How do you know if the graph opens upward or downward? If the sun is 67 above the horizon, find the length of the shadow cast by a building 61 ft tall. Round your answer to the nearest tenth. (plz help I list brainlist) Which word best describes the term vaccinate? healcurepreventpromote The consultant recommended that the financial statements ____examined carefully.(a) be(b) are Read the excerpt from "Yearbook."Which type of conflict is presented in this excerpt?AlbciO character vs. selfO character vs. character"Excuse me?" Fatima, rattled by Isaac's immediatebossiness, wasn't sure how to appropriately respond.Isaac oppressively barreled on despite Fatima'sinterjection. "And then you need to scan everything andlabel each image with an assigned number beforeentering it into the archives."O character vs. natureO character vs. society The average household income in the United States in 1975 was $13,800, and the CPI was 53.8. Convert the average income in 1975 to 2018 dollars. The CPI was 251.1 in 2018. Round your answer to the nearest cent. 1975 income in 2018 dollars: $ which of the following are the three fundamental problems of democracy that political parties solve? which part of the optical microscope is the eyepiece through which you view the image? enhancing qualitative characteristics of accounting information include each of the following except:multiple choice 12. Those with weak immune systems can have this vaccine?a. MMRb. Smallpoxc. Chickenpoxd. Hepatitis B 50 POINTS PLEASE HELP.Journal Entries Watsons go to Birmingham Write a summary (At least one paragraph) of theirexperiences at each location.( All locations: Cincinnati Ohio, Knoxville Tennessee, Appalachian Mountains Rest Stop) This will be written from afirst person point of view (I, we, us, our and ourselves).Pretend you are one of the characters and tell theexperience from their point of view. solve 3*4+5^676+345362+900 Kyle divides 14/9 on his calculator and gets 1.5555555. Where do all the 5's come from?A) kyle made an errorB) 5 is the last digit in the answerC) The calculator rounded the answerD) The calculator truncated the answer What is a major natural resource in Latin America?copperuraniumdiamondscornI believe it is copper can someone confirm? Express sin A, cos A, and tan A as ratios. Line u represents a bug and line v represents an ant. what would an equation showing the relationship look like? The sun creates solar ____. Matter wind 2. Wind and water power are types of ____ energy. Renewable nonrenewable 3. Wind farms and dams create kinetic energy, which uses turbines to make ___. Electricity steam Match the expressions to their verbal descriptions. Assume that all variables represent integer values and that none are equal to each other. m(2mn) - 6m m + 3n2 771 7mn m(-8m) -3mn2 m+ 3(m - 11)2 the difference between mand a factor depending on m the product of mand a multiple of m the product of mand a factor not depending on m the sum of mand a term depending on m isolated spinach chloroplasts evolve o2o2 when illuminated in the presence of potassium ferricyanide (a hill reagent), according to the equation