How does the plastic affect the fish?

Answers

Answer 1

Answer:

Some fish May feel That plastic is food and eat.when the plastic is put in water, The fish may get suffer and get Sick.

Explanation:

Answer 2

Answer: Plastic affects fish because plastic contains chemicals and toxins that can harm fish. The fish’s digestive system will not be able to function well and eventually die.

Hope this helped!


Related Questions

Distinguish between gaseous exchange and respiration

Answers

Answer:

Respiration is the process in which food is oxidized to release energy. Complex organic compounds are converted into simpler ones, e.g glucose into CO2 water and energy released. Gaseous exchange is the diffusion of gases from a region of higher concentration to a region of lower one.

Explanation:

Breathing is the physical process by which air is passed on a gaseous exchange surface i.e. ventilation of the gaseous exchange surface. It involves Inhalation and Exhalation.

Gas/Gaseous exchange is the process whereby gasses diffuse across a gaseous exchange surface. In humans, oxygen diffuses from the inhaled air into the blood and carbon dioxide diffuses from the blood into the exhaled air. The gaseous exchange surface here being the Alveoli.

Respiration is the metabolic process whereby organic molecules are broken down to release energy in the cells. In humans, this process takes place inside the mitochondria of cells. Aerobic respiration requires oxygen whereas qnqerobic respiration takes place in absence of oxygen.

What process is used when the transport protein insulin helps glucose enter the cell?

Answers

Answer:

The insulin signal transduction pathway

Explanation:

The stages of mitosis were originally defined by cellular features observable through a light microscope. The six micrographs below show animal cells (lung cells from a newt) during the five stages of mitosis, plus cytokinesis. (Note that interphase is not represented in these micrographs.) In these images the chromosomes have been stained blue, microtubules green, and microfilaments red. Drag each micrograph to the target that indicates the stage of mitosis or cytokinesis it shows. ► View Available Hint(s) Reset Help prophase prometaphase metaphase anaphase telophase cytokinesis Micrographs by Conly L. Rieder, Division of Molecular Medicine, Wadsworth Center, Albany, New York 12201-0509

Answers

Prophase is the initial phase of mitosis, during which the nuclear chromatin begins to arrange and condense into thick strands that eventually become chromosomes visible under an optical microscope.

How can the different stages of mitosis be seen?

These are the phases of mitosis:

In prophase, the chromosomes get shorter and thicker.

In the middle of the cell, during the metaphase, the chromosomes align.

Chromatids separate during the anaphase process and travel to the opposing poles. Telophase: Two nuclei are produced when nuclear envelopes have reformed around each chromosomal group.

Can you actually see mitosis?

The division of a cell nucleus' chromosomes into two identical sets of chromosomes occurs during the cell cycle process known as mitosis. It is a division of cells by equations.

To know more about mitosis visit:-

https://brainly.com/question/26678449

#SPJ4

Why do nervous system
responses tend to be more rapid
than endocrine system responses

Answers

The endocrine and nervous system are similar in that both involve the transmission of a message that is triggered by stimulus and produces a response. But because nerve impulses can travel much faster than blood-borne substances, nervous system responses are more rapid

Which product in photosynthesis is a waste product for the organisms that produce It? (2 points) OATP Oxygen OGlucose x Carbon dioxide​

Answers

Answer:

Oxygen

Explanation:

Organisms performing photosynthesis use sunlight and carbon dioxide to produce glucose, which is then turned into sugar. Oxygen is the waste product in the process.

What type of cell is pictured to the right?



Hopefully I get a quick answer...

What type of cell is pictured to the right?Hopefully I get a quick answer...

Answers

Answer:

This cell is a prokaryotic cell

Answer:

Prokaryotic

Explanation:

It has pili, the little hair looking things, on the outside. eukaryotic cells don't have that.  also, if you don't believe me, search up prokaryotic cells, click on images, and this exact picture pops up.

relate the events of meiosis to the law of segregation

Answers

During meiosis, the events of crossing over, independent assortment, and the separation of homologous chromosomes and sister chromatids relate to the law of segregation. These events ensure that each gamete carries a unique combination of alleles and that the alleles segregate from each other, leading to genetic variation in offspring.

Meiosis is a process of cell division that occurs in sexually reproducing organisms. It consists of two rounds of division, resulting in the formation of four haploid cells. The law of segregation, proposed by Gregor Mendel, states that during the formation of gametes, the two alleles for each gene segregate from each other, so that each gamete carries only one allele for each gene.

During meiosis, several events relate to the law of segregation:

crossing over: During prophase I of meiosis, homologous chromosomes pair up and exchange genetic material through a process called crossing over. This results in the recombination of alleles between homologous chromosomes, creating new combinations of genes. This event contributes to genetic variation and ensures that each gamete carries a unique combination of alleles.independent assortment: During metaphase I of meiosis, homologous pairs of chromosomes align randomly along the equator of the cell. This random alignment leads to the independent assortment of alleles. As a result, each gamete receives a random combination of maternal and paternal chromosomes, further increasing genetic diversity.separation of homologous chromosomes and sister chromatids: During anaphase I of meiosis, homologous chromosomes separate and move to opposite poles of the cell. This ensures that each resulting cell receives only one homologous chromosome from each pair. During anaphase II, sister chromatids also separate and move to opposite poles, resulting in the formation of four haploid cells.

These events of meiosis, including crossing over, independent assortment, and the separation of homologous chromosomes and sister chromatids, relate to the law of segregation by ensuring that each gamete carries a unique combination of alleles and that the alleles segregate from each other, leading to genetic variation in offspring.

Learn more:

About meiosis here:

https://brainly.com/question/10621150

#SPJ11

The Law of Segregation explains that during the production of gametes, the two copies of each hereditary factor segregate so that offspring acquire one factor from each parent.

The segregation of homologous chromosomes during meiosis occurs, and this is relevant to the law of segregation. In the production of gametes, homologous chromosomes come together and then divide, separating the two copies of each hereditary factor. This separation indicates that the offspring will get one factor from each parent as per the law of segregation. Each gene in an organism has two copies, and these copies come from each parent. For instance, let's say that a gene determines an organism's eye color.

In such a scenario, one copy of this gene could indicate blue eyes, while the other copy might indicate brown eyes. When an organism reproduces, each parent contributes one copy of this gene, which means the offspring has two copies, one from each parent. The segregation of chromosomes during meiosis guarantees that the two copies of each gene segregate into different gametes. In turn, each gamete gets one copy of the gene, which leads to each offspring having two copies of each gene. This phenomenon is in line with the Law of Segregation, which states that offspring inherit one factor from each parent.

Learn more about Law of Segregation:

https://brainly.com/question/25710344

#SPJ11

which process of genetic recombination involves genes from both parents?crossing overindependent assortmentfertilizationtetrad formation

Answers

The Fertilization is the process of genetic recombination involves genes from both parents.

Fertilization is described because the union of gametes. During fertilization, sperm and egg fuse to shape a diploid zygote to provoke prenatal development. In mammals, fertilization entails a couple of ordered steps, which includes the acrosome reaction, zona pellucida penetration, sperm–egg attachment, and membrane fusionGenetic fertilization is the procedure of fertilization of male gametes with the oospore.

It includes numerous elements that include - synergids, egg, crucial cee, antipodals, etc. Synergids - They are haploid cells that shape finger-like projections.Fertilization may be described because the union of haploid gametes, the spermatozoa and the oocyte, hereto known as egg, to repair the diploid state, shape a zygote via the procedure of egg activation, and start a chain of mitotic divisions that outcomes in mobileular differentiation and embryo development.

Read more about fertilization;

https://brainly.com/question/24544067

#SPJ4

Cell phone vs Intoxicated driving 1. Is this an experiment? 2. What is the independent variable? 3. What is the dependent variable? 4. What are the operational definitions? 5. What is the experimental group/condition? 6. What is the control group/condition? 7. What confounds are present? 8. Who is the population? 9. Who is the sample? 10. Was there random assignment? 11. Was there selection bias?

Answers

This study compares the effects of cell phone usage and intoxicated driving on driving performance. It examines the independent variables of using a cell phone and driving under the influence, with the dependent variable being driving skills. The study includes experimental and control groups, while potential confounds include factors such as age, type of phone, alcohol/drug consumption, and duration of phone usage while driving. Random assignment is utilized, and to prevent selection bias, diverse participants could be included through stratified random sampling.

Cell phone vs Intoxicated driving is an example of a comparative study. Below are the answers to the given questions:

1. No, it is not an experiment.

2. The independent variable is the usage of a cell phone and intoxicated driving.

3. The dependent variable is the driving performance or skills.

4. The operational definition of cell phone usage is the participant talking on their phone while driving. The operational definition of intoxicated driving is the participant driving under the influence of alcohol or any other drugs.

5. The experimental group/condition is the participants who are driving while talking on their cell phones or driving under the influence of alcohol/drugs.

6. The control group/condition is the participants who are driving without any distraction or influence.

7. The confounds present in this study are the age of the participant, type of phone, quantity of alcohol/drugs consumed, and duration of using a phone while driving.

8.The population is the group of drivers who have a cell phone and can drive under the influence of alcohol/drugs.

9. The sample is the group of drivers who have volunteered to participate in the study.

10. Yes, the participants were randomly assigned to either the experimental or control group.

11. There could be selection bias if only certain types of participants were chosen. To prevent selection bias, the researchers could use stratified random sampling or randomly select from a diverse pool of participants.

Learn more about dependent variable at:

https://brainly.com/question/32711473

#SPJ11

Why do scientists divide Earth's core into and outer core and inner core?
Group of answer choices

They exist in different states of matter.

They have a different chemical composition.

They were formed in different geological eras.

They are divided by a layer of partly molten material called the mesosphere.

Answers

Answer:

because they consider the the difference of chemical components

Scientists divide Earth's core into outer and inner core because ; ( A ) They exist in different states of matter

The inner core of the earth is very hot and is composed mainly of Iron, it is as big as the size of the moon and is solid in nature. while the outer core which is liquid in nature is composed of iron and nickel and surrounds the Earth's inner core, acting as a boundary between the inner core the Earth's mantle.

Therefore the main reason why scientists divide the Earth core into outer and inner core is due to the difference in state of the inner and outer earth core, and not its chemical composition because they both contain Iron.

Hence we can conclude that Scientists divide Earth's core into outer and inner core because, They exist in different states of matter.

Learn more :  https://brainly.com/question/1529121

Why do scientists divide Earth's core into and outer core and inner core?Group of answer choicesThey

What is the significance of knowing the animal breeding value? Support your answer by giving specific example. Give and explain the various hormones in the animal's body and its functions.

Answers

The significance of knowing the animal breeding value lies in the fact that it enables breeders to select better animals as breeding stock to get the desired genetic traits that could enhance performance in subsequent generations. An example is a bull with a high breeding value for meat production.

The breeding value of an animal is an estimate of the animal’s genetic worth for a particular trait, such as milk production, meat quality, or disease resistance, compared to other animals within a population. For instance, a bull with a high breeding value for meat production would be used to sire offspring with desirable traits in the beef industry.

Hormones are chemical messengers in an animal's body that play a crucial role in controlling various physiological processes, including growth, metabolism, and reproduction. There are different hormones in an animal's body, each with its specific function. Some of these hormones include:

1. Testosterone: Testosterone is the primary male sex hormone that is responsible for the development of male sexual characteristics. It plays a vital role in the production of sperm and maintaining sexual desire in males.

2. Estrogen: Estrogen is the primary female sex hormone that regulates menstrual cycles and the development of female sexual characteristics. It also plays a crucial role in the growth and maintenance of reproductive organs in females.

3. Progesterone: Progesterone is a hormone that plays an essential role in pregnancy and the menstrual cycle. It helps to maintain the lining of the uterus and supports the growth of the embryo during pregnancy.

4. Growth hormone: Growth hormone plays a crucial role in the growth and development of animals. It stimulates cell division and growth in various tissues, including muscle, bone, and cartilage.

5. Insulin: Insulin is a hormone produced by the pancreas that regulates blood sugar levels in animals. It helps to transport glucose from the blood into cells, where it can be used for energy.

Learn more about animal breeding: https://brainly.com/question/14848406

#SPJ11

what is heat capacity?

Answers

Answer:

The heat capacity or thermal capacity of a material is a physical property defined as the quantity of heat to be supplied to a given mass of a material in order to alter the temperature of the unit. Joule per kelvin is the SI unit of heat power. A detailed property is heat power. Heat capacity is defined as the quantity of heat needed to increase the temperature of the material mass by 1 °C.

Explanation:

have a good day :)

Explanation:

Heat capacity,ratio of heat absorbed by a material to the temperature change. it is usually expressed as calories per degree in terms of the actual amount of material being considered,most commonly applied mole ( the molecular weight in gram).The heat capacity in calories per gram is called specific heat.

I hope it's helpful!

Why are proteins so small but so important to living organisms .

Answers

Explanation: because carry out all the functions in the human body necessary for living. Proteins make up hormones that are required for living. Insulin - responsible for stabilising blood sugar. Haemoglobin - responsible for carrying oxygen around the body. Melatonin - responsible for helping us get to sleep. Adrenalin - responsible for the flight-fight-freeze response. There are many more but here are just a few.

Answer:

Protein is a nutrient your body needs to grow, as well as to support and maintain your life. ... For example, proteins help cells develop and communicate, act as enzymes and hormones, conduct the transport of nutrients throughout your bloodstream and repair damaged tissue. In other words, you can't live without protein.

Explanation:




Question: How is wind speed and direction related to air temperature?

1. Think about it Imagine a pocket of air over the land ("land air"), and another pocket of air

over the ocean ("ocean air").

A Which air pocket would you expect to heat up more during the day?

Why?

B

Which air pocket would you expect to cool down more at night

Answers

Answer:

The wind  moves from regions of lower air temperature to regions of higher air temperature because of a pressure differential set up by the two air masses

Explanation:

Relationship between wind speed and direction to air temperature:

wind flows from regions of lower air temperature to regions of higher air temperature because of a pressure differential set up by the two air masses.

A.  The land air will heat up more during the day. This is because the land has a lower specific heat capacity than water, hence increases a lot more rapidly in temperature than the sea when the sun comes up.

B.  The air packet over the land will cool down more rapidly at night due to the lower specific heat capacity of land when compared to the sea.

Does anyone knows the skeletal structure for this one?

Does anyone knows the skeletal structure for this one?

Answers

CH3-CH(CH3)-CH2-CH2-CH2-C(CH3)2-CH(CH3)-CH3

it's named

2,3,3,7-tertamethyloctane

Does anyone knows the skeletal structure for this one?

Explain at least three ways in which a mutation in an individual's DNA could occur, and describe at least 2 effects a mutation could have on an individual's traits.


Please help!


(This is science, but I just put Biology because science wasn't there.)

Answers

Changing an organism's DNA sequence is known as a mutation. An infection with a virus, exposure to mutagens, or mistakes in DNA replication during cell division can all cause mutations.

Numerous mutations are not transmissible to the progeny. Such changes are referred to as somatic mutations since they take place in somatic cells. The reproductive cells are where the germline alterations take place, which are transmissible to subsequent generations. A population's genetic diversity can increase as a result of mutations, which can produce new alleles. To have an effect on an organism's progeny, a mutation must both occur in the cells that form the next generation and change the genetic code. In the end, the interaction of genetic mutations is what creates diversity among organisms.

Learn more about DNA sequence here:

https://brainly.com/question/29925842

#SPJ4

what is the name of semi-permeable membrane which encloses the cytoplasm and all of the cellular organelles?

Answers

The semi-permeable membrane that encloses the cytoplasm and all of the cellular organelles is called the plasma membrane.

The semi-permeable membrane which encloses the cytoplasm and all of the cellular organelles is called the Plasma Membrane. This membrane is made up of two layers of phospholipids, which form a lipid bilayer. The phospholipids have a hydrophilic (water-loving) head and a hydrophobic (water-fearing) tail, which ensures that the membrane is impermeable to large molecules, such as proteins and sugars. In addition, the membrane contains various proteins and carbohydrates which give it a variety of functions. These proteins act as receptors for molecules, allowing them to move into and out of the cell, and as enzymes that catalyze reactions. Additionally, the carbohydrates on the outer surface of the membrane help to identify the cell and enable it to recognize other cells. The plasma membrane also contains cholesterol, which helps to maintain its fluidity and stability.

To learn more about semi-permeable membrane:

https://brainly.com/question/14925714

#SPJ4

Approximately once in every _____ births, and infant is born with 45, 47, or even 48 or 49 chromosomes instead of the usual 46.

Answers

An newborn is born with 45, 47, 48, or even 49 chromosomes instead of the typical 46 chromosomes approximately once every        166           births.

What Does It Mean When a Baby Is Born With an Extra Chromosome?

Pregnancy is a vulnerable time when your unborn child may be exposed to a number of illnesses. However, several anatomical anomalies that are typically harmful and can lead to difficulties in babies may be present in infants with additional chromosomes.

A human cell contains 46 chromosomes, 23 of which are inherited from each parent. However, in some circumstances, either parent's chromosomes may have been added to or deleted from the growing fetus.

If you are unaware of this genetic phenomena and are interested in learning more, read this post to learn about the potential origins, illnesses, symptoms, and other details about extra chromosomes in newborns.

What Does It Mean When a Baby Is Born With an Extra Chromosome?

Genes are strung like beads along chromosomes, which are threadlike structures. The 47th chromosome in human cells is an additional chromosome. As a result, a child with an additional chromosome will have 23 pairs of chromosomes overall (one from the mother and two from the father or vice versa). Trisomy, which stands for "three bodies," is the term used to describe this disorder.

To learn more about human chromosomes click blow-

https://brainly.com/question/4091424

#SPJ4

Layer of meninges which is in contact with the spinal cord is called
A dura mater
B pia mater
C arachnoid mater
D corpora quadrigemina

Answers

Option B: Pia mater is the layer of meninges which is in direct contact with the spinal cord.

Your brain's surface and the surface of your spinal cord are securely bound together by a thin layer called your pia mater, which is the innermost layer. This layer is perforated by numerous blood arteries that deliver blood to the brain region. It aids in keeping cerebrospinal fluid contained. The pia mater in your spinal cord aids in keeping the cord rigid.

Your brain and spinal cord (central nervous system) are covered and protected by three membrane layers called meninges. The dura mater, arachnoid mater, and pia mater are three membranes that wrap and protect your brain. They also serve as a support system for lymphatics, blood vessels, neurons, and the cerebrospinal fluid that surrounds your central nervous system.  

To know more about meninges, refer:

https://brainly.com/question/14149316

#SPJ4

Which organelle produces a new cell membrane between the two nuclei of a plant cell going through cytokinesis?

cell wall

Golgi apparatus

centriole

mitochondria

Answers

Mitochondria is the correct answer, Mitochondria is also refered as cell organelle.

Mitochondria, also referred to as the "Powerhouse of the Cell," are double membrane-bound organelles that are present in the majority of eukaryotic species. They are located inside the cytoplasm and serve as the "digestive system" of the cell.

They are crucial in the breakdown of nutrients and the production of molecules that are high in energy for the cell. The mitochondria are the sites of many metabolic processes involved in cellular respiration. The Greek terms "mitos" and "chondrion," which mean "thread" and "granules-like," respectively, are the source of the English word "mitochondrion." Richard Altmann, a German pathologist, published the first description of it in 1890.

To learn more about Mitochondria please click on below link

https://brainly.com/question/14740753

#SPJ4

describe the tissue type and function of the following structures in relation to a synovial joint

Answers

Articular cartilage: This is a type of hyaline cartilage that covers the ends of bones at the joint. Its function is to provide a smooth surface for the bones to move against each other with minimal friction and to absorb shock.

Synovial membrane: This is a thin layer of connective tissue that lines the inner surface of the joint capsule. Its function is to secrete synovial fluid, which lubricates the joint and provides nutrients to the articular cartilage.

Joint capsule: This is a fibrous connective tissue structure that surrounds the joint and is attached to the bones. Its function is to hold the bones in place and provide stability to the joint.

Ligaments: These are tough bands of fibrous connective tissue that connect bones to each other and provide additional stability to the joint.

Tendons: These are dense connective tissue structures that attach muscles to bones and help to move the joint.

Learn more about hyaline cartilage

https://brainly.com/question/14249623

#SPJ4

Please help hurry I’ll mark brainly

Please help hurry Ill mark brainly

Answers

D. non of the above

Which field studies viruses and bacteria and
how they evolve and respond to their
surroundings?
A. ecology
B. biotechnology
C. evolution of diseases
D. the Tree of Life field

Answers

Answer:

A. Ecology

Explanation:

Ecology is the branch of biology dealing with the relations and interactions between organisms and their environment, including other organisms. Ecologists study the relationships between organisms (and plants/animals) and their environment.

Answer: The answer is evolution of diseases.

Explanation:

which structure is highlighted and indicated by the leader line? lumbar region cervical region acromial region gluteal region scapular region vertebral region sacral region

Answers

The structure highlighted and indicated by the leader line is the lumbar region.

The cervical region refers to the anatomical region of the body located in the neck area. It is specifically associated with the cervical spine, which consists of a series of vertebrae that provide support, flexibility, and protection to the spinal cord and nerves.

Here are some key features and structures related to the cervical region:

Cervical Vertebrae: The cervical spine is composed of seven cervical vertebrae, labeled C1 to C7. These vertebrae are smaller in size compared to the other regions of the spine and have unique features to facilitate movement of the head and neck. The first cervical vertebra, C1, is called the atlas, and it supports the skull. The second cervical vertebra, C2, is called the axis, and it allows rotational movement of the head.

Spinal Cord: The cervical region is the location of the upper part of the spinal cord, which is a long, cylindrical bundle of nerve tissue. The spinal cord transmits nerve signals between the brain and the rest of the body and is protected by the vertebrae of the cervical spine.

Nerves: Emerging from the spinal cord in the cervical region are pairs of spinal nerves. These nerves branch out and innervate various regions of the upper body, including the neck, shoulders, arms, and hands. The cervical nerves play a vital role in motor control, sensation, and communication between the brain and the upper extremities.

Muscles: The cervical region contains numerous muscles that are involved in movement and stabilization of the head and neck. These muscles include the sternocleidomastoid, scalene muscles, trapezius, and many smaller muscles that control intricate movements of the neck.

To know more about lumbar region visit :

https://brainly.com/question/33732286

#SPJ11

There are 12 players on a baseball team. In how many different ways can the coach choose players for left field, right field, and center field?

Answers

the coach has 1,320 different ways to choose players for left field, right field, and center field.

The product of the number of players available for each position gives the coach the number of ways he can choose players for left field, right field, and centre

field.

The coach has 12 players to choose from for the left field position. Once a player has been selected for left field, the coach has 11 options for right field. Finally, after selecting players for left and right field, the coach has 10 players to choose from for centre field. As a result, the total number of options for selecting the three positions of players is:

12 × 11 × 10 = 1,320

learn more about position of players here:

https://brainly.com/question/23609206

#SPJ4

if heterozygous round crossed with homozygous round produce 2400 plant how many plant are pure round

Answers

If heterozygous round plant is crossed with a homozygous round plant, then it will produce 2400 plant from which 1200 plants were pure round i.e., homozygous (RR).

What is Inheritance?

Inheritance is the transfer of characters from the parent generation to the offspring. It takes place through the DNA which contains chromosomes and genes. The genes are responsible for the development of various characteristics in the daughter generation.

According to Mendel's genetics, for each character or gene a pair of contrasting alleles which code for different phenotype is present.

Here, a heterozygous round plant (with two different alleles) is crossed with a homozygous round plant, which results into the production of 2400 plants in the F1 generation.

Therefore, the total number of plants which are pure round can be calculated by Punnett square.

Pure round plants are the plants which are homozygous (RR) and pure wrinkled plants are (rr).

Therefore, the number of plants which are pure red = 1/2 of the total plants or 50% of the total plants.

Thus, number of pure round plants = 1/2 × 2400

Number of pure round plants = 1200

Learn more about Inheritance here:

https://brainly.com/question/14930526

#SPJ1

if heterozygous round crossed with homozygous round produce 2400 plant how many plant are pure round

pleaseee help me fasttt​

pleaseee help me fasttt

Answers

Answer:

1. A  2.B  3.B 4.C 6.A 7.B 8.C 9.D

Explanation:

What is reproductive isolation?
when two similar populations can no longer produce viable, fertile offspring
when two similar populations produce fertile offspring
when two similar populations can no longer produce offspring
none listed are true

What is reproductive isolation?when two similar populations can no longer produce viable, fertile offspringwhen

Answers

This one look like confused

6. What type of body blan do sponges have?
A. Cephalization
B.asymmetry
C.bilateral symmetry
D.radial symmetry

Answers

The Option B is correct. The body blan  have the assymetry types of sponges in them

What are sponges?

Sponges (Phylum Porifera) are a type of aquatic animal that lack true tissues and organs. They are considered the simplest of all animals and do not have a body plan based on symmetry.

Instead, sponges exhibit a type of symmetry known as "asymmetry," which means they have no plane of symmetry or any organization of body parts around a central axis. Therefore, the correct answer is B. asymmetry.

Read more on sponges here: https://brainly.com/question/25991002

#SPJ1

Cytokinesis differs between animal and plant cells. In animal cells, the
membrane pinches together to form a cleavage furrow. In plant cells, the
membrane cannot pinch together because of the
Instead, a
is laid down between the two nuclei.
This structure develops into the new cell walls and cell membranes.
PLEASE HELP

Answers

Answer:

Whats the question

Explanation:

I don’t really get what you’re writing but,

They can’t really pinch together because of the cell wall, instead, a cell plate is laid down between the two nuclei. This structure develops into the new cell walls and cell membranes.

Other Questions
What do all the atoms of Group 1A elements have in common? the bee is a very industrious insect in negative form A CSI team arrives at a murder scene and immediately measures the temperature of the body and the temperature of the room. The body temperature is 23 C and the room temperature is 17 C. Ten minutes later, the temperature of the body has fallen to 20 *C. Assuming the temperature of the body was 37 C at the time of the murder, how many minutes before the CSi team's arrival did the murder occur? Round your answer to the nearest whole minute. Answer: minutes before the team's arrival. Submit Question [tex] \frac{80}{100} = [/tex]what's the answer In what ways would you like to be involved in government? Check all that apply.voting in electionsbeing elected to officeworking in a government jobworking for someone running for officecalling or writing to your government representatives Given log6^3=p. Express log1/9^(6)1/2 in terms of p PLEASE HELPPPPPPPP MEEEEEEEEEE which tectonic setting has these main pieces of evidence? 1) an ocean trench on the ocean floor and 2) deeper earthquakes located progressively further from the trench, and 3) a chain of mountain volcanoes. in the long run, currency exchange rates are considered to be determined by ____. in the short run, exchange rates are mainly determined by _____. The gold at Fort Knox is stored in bars that measure 9 x 4 x 18 cm. Gold weighs 19.3 grams per cubic centimeter.What is the volume of each bar of gold? cm3What is the mass of each bar? Which fraction is equivalent to 2/8?? Exercise 2 Circle the infinitive or the infinitive phrase in each sentence.Conan Doyle received a degree in medicine and decided to work as an eye specialist. Determine the place value of digit 5 in the whole number 5068 Anyone please help in this part! What is towards a holistic appreciation of culture? What are the major political parties in Canada What was one reform that Louis-Napoleon made after coming to power in 1848?He allowed criticism of his government in opposition speeches and newspapers.He made sure that France would never again be ruled by a king or an emperor.He put an end to the corrupt Second Republic.He expanded voting rights across France. Is a cash float a asset,owners equity or liability Find the value of 4a - 3for a = 4 Check Your UnderstandingAn ice-skating rink charges $4 per hour to skate on the rink and the option to rentskates for an additional cost. Marlo paid $13 to rent ice skates and to skate fortwo-and-a-half hours.a. What is the cost of renting skates?m-2b=$41XX71b. How much would it cost to rent skates and be on the ice for 4 hours?