how do I solve this?

How Do I Solve This?

Answers

Answer 1

Answer:

Explanation:

When you divide exponentials, you subtract the powers. For the numbers infront, just use a basic calculator for.

7.95/6.02 = 1.32

10^22/10^23 = 10^-1

1.32 x 10^-1 is your answer


Related Questions

Which quantum number describes the energy level of an electron?
Spin quantum number
Principal quantum number
Magnetic quantum number
Angular momentum quantum number

Answers

Answer:

principle quantum number :)

Explanation:

I took the test and got it right

Quantum numbers are defined as the set of four numbers with the help of which we can get complete information about the electrons in an atom. The energy level of an electron is given by Principal quantum number. The correct option is B.

What is Principal quantum number?

The Principal quantum number represents the main energy level or shell in which the electron is present. It also determines the average distance of the orbital or electron from the nucleus. It is denoted by the letter 'n' and can have any whole number values like 1, 2, 3, 4,....

The value of principal quantum number usually stand for different energy shells K, L, M, N .... the value of 'n' can be any integer with a positive value which is equal to or greater than 1.

The value of 'n' denotes the innermost electron shell of an atom which indicates the lowest energy state of an electron. It cannot be a negative value.

Thus the correct option is B.

To know more about Principal quantum number, visit;

https://brainly.com/question/30656222

#SPJ2

50 points, and I’ll mark as brainliest!!!!!
Tasks are in the picture.

50 points, and Ill mark as brainliest!!!!!Tasks are in the picture.

Answers

pH determines the acidic or alkaline a solution is using the pH scale, which has a range of 0 to 14. An alkaline pH is greater than 7, while an acidic pH is less than 7.

Thus, The pH of a solution is defined mathematically as the negative logarithm of the molar concentration of hydrogen ions therein.

NaOH is a strong alkaline, as indicated by a pH testing strip, but in order to determine its exact pH, you must first determine its molarity.

A scale known as pH is used to describe how basic or acidic a water-based solution is. Basic solutions have a higher pH than acidic solutions, which have a lower pH.

Thus, pH determines the acidic or alkaline a solution is using the pH scale, which has a range of 0 to 14. An alkaline pH is greater than 7, while an acidic pH is less than 7.

Learn more about pH, refer to the link:

https://brainly.com/question/15289741

#SPJ1

The pH of HNO₂ is 2.15, pH of NH₄OH is 10.98 and pH of H₂S is 3.76.

pH is defined as the negative logarithm of H⁺ ion concentration.

pH is a measure of how acidic or basic a substance is. In our everyday routine, we encounter and drink many liquids with different pH. Water is a neutral substance. Soda and coffee are often acidic.

The pH is an important property, since it affects how substances interact with one another and with our bodies. In our lakes and oceans, pH determines what creatures are able to survive in the water.

Given,

1. Concentration = 0.1

Ka = 4.5 × 10⁻⁴

\(pH = \frac{1}{2} (pka - log c)\)

pH = 0.5 × ( 3.3 + 1)

= 2.15

2.  Concentration = 0.05

Ka = 1.8 × 10⁻⁵

\(pOH = \frac{1}{2} (pkb - log c)\)

pOH = 0.5 × ( 4.74 + 1.3)

= 3.02

pH = 14 - pOH

= 14 - 3.02

= 10.98

3. Concentration = 0.3

Ka = 1 × 10⁻⁷

\(pH = \frac{1}{2} (pka - log c)\)

pH =  0.5 × ( 7 + 0.52)

= 3.76

Learn more about pH, here:

https://brainly.com/question/15289714

#SPJ1

Identify the limiting reactant in the reaction of methane (CH4) and carbon tetrachloride to form CH2Cl2, if 2.96 g of CH4 and 32.0 g of CCl4 are combined. Determine the amount (in grams) of excess reactant that remains after the reaction is complete.

Answers

Answer:

d

Explanation:

yes

Indicate which molecules demonstrate the correct bonding for carbon atoms. Check all that apply.
CH4
CH3CH4CH2
CH3CH2CH2CH3
CH2CH2CH4


The correct answer is:
CH4
CH3CH2CH2CH3

Answers

Answer:

CH4 and CH3 CH2 CH2 CH3

Explanation:

Answer:

CH4 and CH3CH2CH2CH3

Explanation:

its right on edg

5. What measures how stressful exercise is on your body?
O A. Frequency
O B. Duration
O C. Volume
D. Intensity

Answers

Answer: D. Intensity

Explanation: Intensity is correct, because if you originally were working on a treadmill with a speed of 8, that is how much intensity your putting your body on. And if you put the speed for a treadmill at 11 to increase your exercise, you are increasing the speed you have to run, making it more intense. The more intense you make your workout or training, the more stressful exercise you are doing.

Hope this helps,

:)

An early arrangement of the then known elements was proposed by a British scientist John Newlands, which he called the Law of Octaves. Like other scientists at the time, Newlands arranged the elements in order of increasing atomic mass and noted that every eighth element had similar physical/chemical properties. In the modern Periodic Table, which of the following represents the last pair of elements for which Newlands' Law of Octaves would hold true?​

Answers

In the modern Periodic Table, the last pair of elements for which Newlands' Law of Octaves would hold true is Calcium (Ca) and Titanium (Ti).

Why isn't salt water safe for humans to drink?
O A. Salt water has too many water molecules and too few salt molecules.
B. Salt water has too few water molecules and too many salt molecules.
O
C. Salt water contains molecules that are poisonous to humans.
O
D. Salt water contains molecules that are too large for humans to process.

Answers

Answer:

B. Salt water has too few water molecules and too many salt molecules

Explanation:

Seawater is toxic to humans because your body is unable to get rid of the salt that comes from seawater. Your body normally gets rid of excess salt by having the kidneys produce urine, but it needs freshwater to dilute the salt in your body for the kidneys to work properly.

A rotameter calibration curve (flow rate versus float position) obtained using a liquid is mistakenly used to measure a gas flow rate. Would you expect the gas rate determined in this manner to be too high or too low?

Answers

Answer:

I would expect the gas rate determined in this manner to be too low

Explanation:

A Rotameter can be designed to respond to the sensitivity of density, velocity, to measure the flow rate of liquid or gas enclosed in a tube. Liquids are denser than gas, and since the gas rate to be determined needed to respond to the velocity head alone of the rotameter so as to bring the forces in the tube equilibrium. Knowing if there is no flow, then the float would remain at the bottom, so gas has to flow at a higher rate compared to the liquid so the float would be in a similar position making it easier to measure the flowrate. This leaves the gas rate to be determined too low.

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Which one of the following would not be affected by boiling with aqueous sodium hydroxide?
A: ethyl ethanoate
B: glycerol
C: olive oil
D: propanoic acid

what is the answer and why? thanks!

Answers

Glycerol would not be affected by boiling with aqueous sodium hydroxide. The correct option is B

What is Glycerol ?

Glycerol, usually referred to as glycerin, is a sticky liquid with a sweet taste that is frequently used in the manufacturing of food, medicines, and cosmetics. It is a triol, which is an alcohol since it has three hydroxyl (-OH) groups.

Therefore, Glycerol (option B) is a triol that lacks either a carboxylic acid group or an ester functional group. Since it doesn't react with aqueous sodium hydroxide, boiling it with it won't have any negative effects.

Learn more about Glycerol here : brainly.com/question/3315306

#SPJ1

Thinking about valence electrons, which groups would go best together? Name 2 sets

Answers

Valence electrons are the electrons present  in the outermost shell s and p, or outermost energy level, of an atom.


valence electrons in each group are:-

In Alkali metals – Group 1 (I)=1In Alkaline earth metals – Group 2 (II)=2In Boron group – Group 13 (III)=3In Carbon group – Group 14 (IV)=4In Nitrogen group – Group 15 (V)=5In Oxygen group – Group 16 (VI)=6In Halogens – Group 17 (VII)=7In Noble gases – Group 18 (VIII or 0)=8

Groups 3-12 (transition metals)= 2* (Here  4s shell is complete and it  cannot hold any more electrons).

Valence electrons  determine the electrical conductivity of an element. Depending on the nature of elements it can be metal, non-metal, or metalloid.

learn more about valence electron here-

https://brainly.com/question/371590

#SPJ9

How many molecules are in 0.0023 moles of CO2?​

Answers

Taking into account the definition of Avogadro's Number, 1.38529×10²¹ molecules in 0.0023 mole of CO₂ .

Definition of Avogadro's Number

Avogadro's number is defined as the number of particles (atoms, molecules, ions, electrons) in 12 grams of carbon-12, that is, in one mole of the substance or compound.

Its value is 6.023×10²³ particles per mole and it applies to any substance.

Molecules of CO₂ in this case

Considering the definition of Avogadro's number, you can apply the following rule of three: If 1 mole of CO₂ contains 6.023×10²³ molecules, 0.0023 mole of CO₂ contains how many molecules?

amount of molecules of CO₂= (0.0023 moles × 6.023×10²³ molecules)÷ 1 mole

amount of molecules of CO₂= 1.38529×10²¹ molecules

Finally, there are 1.38529×10²¹ molecules.

Learn more about Avogadro's Number:

brainly.com/question/11907018

#SPJ1

5.
5.555 x 1014 ounces = ? millipounds

Answers

3.5678 is your answer

How could you distinguish a compound from a mixture​

Answers

Answer:

Compound are substances which can be formed by chemically combining two or more elements. Mixtures are substances that are formed by physically mixing two or more substances.

Before balancing this equation, how many oxygen atoms are present on the product side of the following equation:

Before balancing this equation, how many oxygen atoms are present on the product side of the following

Answers

Answer:

3

Explanation:

co2 has 2 and h2o has 1

product is right side

Someone help answer this

Someone help answer this

Answers

it is water energy :) this is easy

Answer: Heat

Explanation:

Also considered as thermal energy. So when the person dives in water their heat temperature balances out.

When nitrogen dioxide (NO2) gas from car exhaust combines with water in the air, it forms nitrogen oxide and nitric acid (HNO3), which causes acid rain, and nitrogen oxide. Balanced eqjation:
(NO); 3NO2(g) + H20(l) --> 2HNO3(aq) + NO(g).
A) How many molecules of NO2 are needed to react with 0.250 mol of H2O?
B) How many grams of HNO3 are produced when 60.0 g of NO2 completly reacts?
C) How many grams of HNO3 can be produced if 225 g of NO2 is mixed with 55.2 g of H2O?

Answers

Answer:

A. 0.75 moles NO2 are required

B. 82.2 gnof HNO3 are produced

C. 205.3 g of HNO3 are produced

Explanation:

Check attachment below for explanation and calculations

When nitrogen dioxide (NO2) gas from car exhaust combines with water in the air, it forms nitrogen oxide

What is the charge in coulombs on an electron?

Answers

\(▪▪▪▪▪▪▪▪▪▪▪▪▪  {\huge\mathfrak{Answer}}▪▪▪▪▪▪▪▪▪▪▪▪▪▪\)

The charge on an electron is ~

\( \sf{ - 1.602 \times 10 {}^{ - 19} \: \: Coulombs}\)

" - " symbol is used to show that its negative.

Which of the following is a compound? *
A. aluminum
B. carbon
C. oxygen
D. sugar

Answers

CARBON IS A COMPOUND

Answer:

C. OXYGEN

Explanation:

The degree of contrast between two opposing forces is called______?

Answers

Answer:

polarity

Explanation:

What is the closest to potassium

Answers

Metal
Alkali metal
Period 4 element

How much heat, in kilojoules, must be added to a 580 g aluminum pan to raise its temperature from 25∘C to 150∘C?
---The specific heat capacity for aluminum is 0.897 J/g∘C.
---Round the answer to two significant figures.

Answers

Answer:

Q = 65 kJ

Explanation:

Given that,

Mass, m = 580 g

Initial temperature, \(T_i=25^{\circ} C\)

Final temperature, \(T_f=150^{\circ} C\)

The specific heat capacity for aluminum is 0.897 J/g°C

We need to find the heat added to the aluminium pan so that its heat raised to a temperature from 25°C to 150°C. It is given by :

\(Q=mc\Delta T\\\\Q=580\ g\times 0.897\ J/g^{\circ} C\times (150-25)^{\circ} C\\\\Q=65032.5\ J\)

or

Q = 65.03 kJ

or

Q = 65 kJ

Hence, the heat added to the pan is 65 kJ.

please help! what is the correct answer to this picture

please help! what is the correct answer to this picture

Answers

Answer:

i think its c [everything is so blury]

Explanation:

1. HCI (aq) + NaOH (aq) → NaCl (aq) + H₂O (1)
a. What are the reactants?
b. What are the products?

Answers

In the given reaction, the reactants are hydrochloride acid (HCI) and sodium hydroxide (NaOH). The products are sodium chloride (NaCl) and water.

The chemical equation provided represents a neutralization reaction between hydrochloric acid (HCI) and sodium hydroxide (NaOH) in aqueous solution.

A neutralization reaction is a type of double displacement reaction in which an acid and a base react to form salt and water.

The reactants in this equation are hydrochloric acid (HCI) and sodium hydroxide (NaOH). Hydrochloric acid is a strong acid that dissociates in water to form hydrogen ions (H+) and chloride ions (Cl-). Sodium hydroxide, on the other hand, is a strong base that dissociates in water to form sodium ions (Na+) and hydroxide ions (OH-).

To learn more about reactants, follow the link:

https://brainly.com/question/29816521

#SPJ1

the chunks of fluid magma fall back to the surface to feed a lava flow, which may have a rough …?
… (type of lava) surface or a smooth …?

Answers

The chunks of fluid magma that fall back to the surface to feed a lava flow can give rise to two different types of surfaces: rough and smooth.

A rough lava surface is often associated with a type of lava called 'aa' (pronounced "ah-ah"). Aa lava flows are characterized by a jagged and clumpy texture. This occurs because the chunks of magma, known as clinkers, are fragmented and accumulate on top of the flow. As the flow advances, the clinkers are pushed forward, creating a rough and uneven surface. Aa lava flows tend to be slower-moving and can be hazardous to walk on due to their rough texture.On the other hand, a smooth lava surface is typically associated with a type of lava known as 'pahoehoe' (pronounced "pah-hoy-hoy"). Pahoehoe lava flows are characterized by a smooth, undulating surface with a rope-like or ropy texture. The fluid magma of pahoehoe lava allows it to flow more freely, resulting in a surface that appears molten and smooth. Pahoehoe flows can travel greater distances compared to aa flows and are generally easier to traverse.The type of lava surface, whether rough or smooth, depends on various factors such as the viscosity of the magma, eruption style, and the rate of cooling during the lava flow.

for such more questions on fluid

https://brainly.com/question/30543213

#SPJ8

importance of hematology​

Answers

Answer:

Haematology is the specialty important for the diagnosis and management of a wide range of benign and malignant disorders of the red and white blood cells, platelets and the coagulation system in adults and children.

The ionic compound MX(s) is formed from the metal M(s) and the diatomic gas X2(g) at standard conditions. Calculate the lattice energy given the following data( data in picture)

The ionic compound MX(s) is formed from the metal M(s) and the diatomic gas X2(g) at standard conditions.

Answers

The lattice energy of MX is 459.2 kJ/mol.

The lattice energy (ΔH° lattice) of an ionic compound is the energy released when one mole of the solid is formed from its constituent gaseous ions under standard conditions. The lattice energy is calculated using the Born-Haber cycle, which involves several steps including atomization, ionization, dissociation, and sublimation energies.

The lattice energy is related to the Coulombic attraction between the oppositely charged ions in the solid. To calculate the lattice energy for MX, we can use the following equation:

ΔH° lattice = ΔH° sub + ΔH° ion + ΔH° diss + ΔH° formation

where ΔH° sub is the sublimation energy of M(s), ΔH° ion is the first ionization energy of M(g), ΔH° diss is the dissociation energy of X2(g), and ΔH° formation is the enthalpy of formation of MX(s).

Using the given data, we can calculate each of these values and substitute them into the equation to obtain the lattice energy. The final answer should be in units of kJ/mol.

ΔH° sub (M) = 107.3 kJ/mol

ΔH° ion (M) = 577.5 kJ/mol

ΔH° diss (X2) = 242 kJ/mol

ΔH° formation (MX) = -467.6 kJ/mol

ΔH° lattice = 107.3 + 577.5 + 242 + (-467.6) = 459.2 kJ/mol

As a result, MX has a lattice energy of 459.2 kJ/mol.

To know more about the Ionic compound, here

https://brainly.com/question/1603676

#SPJ1

The half-life of the radioactive isotope magnesium-20 is 0.600 seconds.

How long will it take for the mass of a sample of magnesium-20 to decay from 65.6 micrograms to 8.20 micrograms?
____________seconds

Answers

It will take less 1.8 seconds for the mass of a sample of magnesium-20 to decay from 65.6 micrograms to 8.20 micrograms.

What is Half-Life of radioactive a radioactive substance?

The half-life of a radioactive element is the time for half the amount of a sample of the substance to decay.

After 0.6 seconds 31.25 remains

After 1.2 seconds, 15.625 remains

After 1.8 seconds, 7.9 micrograms remains.

In conclusion, it will take less 1.8 seconds for the sample to decay to 8.20 micrograms.

Learn more about Half-Life at: https://brainly.com/question/2320811

#SPJ1

The time taken for the radioactive sample to decay is 1.8 s.

What is the half life?

The half life is the time taken for only half of the number of the radioactive isotopes to remain. Now we have;

No = 65.6 micrograms

N = 8.20 micrograms

t1/2 = 0.600 seconds

t = ?

Hence;

N/No = (1/2)^t/t1/2

8.20/ 65.6  = (1/2)^t/0.600

0.125 =  (1/2)^t/0.600

1/8 =  (1/2)^t/0.600

(1/2)^3 =  (1/2)^t/0.600

3 = t/0.600

t = 3 * 0.600

t = 1.8 s

Learn more about half life:https://brainly.com/question/24710827

#SPJ1

Which of the following accurately pairs the part of an atom to its charge? A. Proton—no charge B. Neutron—positive charge C. Electron—negative charge D. Electron—no charge

Answers

Answer:

I think it's c but I'm not sure

Answer: C

Explanation:

Element A has 15 protons. Determine the number of neutrons in its isotope with mass number 33

Answers

Answer:

18 i think

Explanation:

Other Questions
TRUE / FALSE. a precedent is any legal authority or source of law that a court may look to for guidance but need not follow when making its decision. What does it mean to say that one data set or distribution has more variability than another?. An interview with a subject matter expert is what type of information source?O ScientificO PrimaryO SecondaryO Specialty We define the commutator, denoted by [ X , Y ], of two squarematrices X and Y to be [ X , Y ] = X Y Y X. Let A, B, and C be 2 2 real matrices.Prove or disprove: What is 5 degrees Celsius in Fahrenheit? Please help me asp Ill mark as brainliest if the specimen is loaded until it is stressed to 65 ksi , determine the approximate amount of elastic recovery after it is unloaded. express your answer as a length. Which of these terms is used to describe a solution that results when both the salute and solvent are solid. Is it alloy, surface solution or aqueous solution convenience, reliability and assurance are dimensions of service quality.O TRUEO FALSE Calculate Marginal Revenue when output rises from 310 to 370 pounds.Total Output (Q)(Pounds)(1) Price per Pound($1.50)(2) Total Revenue(3) Marginal Revenue(4)0 $1.50 $150.00 -100 $1.50 $375.00 250 $1.50 $465.00 310 $1.50 $555.00 370 $1.50 $660.00 440 $1.50 $690.00 460 $1.50 $840.00 380 $1.50 $570.00$1.00$2.50$2.00$1.50 Let f(x,y) be a joint probability density, that is, f(x,y) dxdy is the probability that X lies between x and x + dx and Y lies between y and y + dy. If X and Y are independent, thenIf X and Y are independent, show that the mean and variance of their sum is equal to the sum of the means and variances, respectively, of X and Y; that is, show that if W= X+Y, then What in the text indicates historical events? what in the text would not fit in a different time period? what in the text indicates the beliefs and values of the author? Which electrode negative or positive poduced the most gas? if you name this type of flute then you get 90 points from me :> Complete this paragraph, which describes an ice cube changing from a solid to a liquid to a gas. Water can exist in three states of matter. Imagine examining the changes of state from solid to liquid to gas by adding blank to ice. What would change or not change? As water changes state, the mass of the sample blank . The size of the water molecules blank . However, the blank of the water molecules does change during a change in state. The evidence that supports this conclusion is that the volume of the sample changes. i need a girl please?? what conclusion can be drawn from the authors use of the word pollution in paragraph 4? The graph shows a proportional relationship between the number of kilometers traveled by a bicycle (y) and the number of minutes (x).What is the unit rate, expressed in kilometers per minute?0.30 km/min0.33 km/min3.10 km/min3.33 km/mingraph with x axis labeled time in minutes and y axis labeled distanced traveled in kilometers. a line starts at the origin 0 comma 0 and runs through the point 40 comma 12 How does changing the amount of copper wire affect an electromagnets strength? 3/32 in lowest terms