Option C is correct. High-resolution mass spectrometry is advantageous in determining the key feature of an unknown molecule will be molecular formula.
High-resolution mass spectrometry (HRMS) is an analytical technique which is used to determine the atomic masses of an organic and inorganic molecules or monatomic ions which is present in different kinds of samples. High resolutions can be achieved through a variety of different mass spectrometers, yet the fundamental workings will be similar.
HRMS analysis begins by passing a sample into the spectrometer, where it will be ionized. The formed ions will travel along with the spectrometer's length, and it is separated by their relative charges and masses. Once the ions reach the end of the spectrometer, they are picked up by a detector, and the information will be logged on a computer.
To know more about High-resolution mass spectrometry here
https://brainly.com/question/28587595
#SPJ4
--The given question s incomplete, the complete question is
"High-resolution mass spectrometry is advantageous in determining what key feature of an unknown molecule? A) functional group B) atomic structure C) molecular formula D) carbon hydrogen structure"--
draw arrows to show the path of the electricity in this series circuit
pls answer quickly as possible
Explanation:
from positive to negative terminal
There will be a flow of current from the battery through the wires to the bulbs.
What is a circuit?The term circuit speaks of a path that is designed for the flow of current. We know that current often flows from the battery to other circuit components.
It then follows that in the circuit as shown, there will be a flow of current from the battery through the wires to the bulbs.
Learn more about circuit:https://brainly.com/question/21505732
#SPJ6
The ideal gas law predicts gas behavior including the relationships between the number of moles, volume, pressure, and temperature. Predict the changes in volume of a helium-filled balloon at different temperatures. When you took the balloon outside on a cold day, the helium atoms inside move slower and its volume decreased because the atoms didn't exert as much pressure on the balloon walls. Calculate the volume in L of a balloon filled with 0.200 moles of helium at 1.00 atm at 0.00°C.
The volume in L of a balloon filled with 0.200 moles of helium at 1.00 ATM at 0.00°C is 48.90 L
What is ideal gas equation?
The equation of state for a fictitious ideal gas is known as the ideal gas law, also known as the ideal gas equation. Although it has some restrictions, it is a fair estimate of the behaviour of many gases under various circumstances. Benoît Paul Émile Clapeyron introduced it for the first time in 1834 as a synthesis of a empirical Boyle's law, Charles' law, Avogadro's law, and Gay-law. Lussac's An amount of gas's pressure, volume, as well as temperature all affect its state. These are simply related in two ways by the equation as it is used today. The kelvin is the proper SI unit to use when expressing the temperature in the equation of state because it is an absolute temperature.
ideal gas equation
PV = nRT
v = nRT/P
V= 0.2 x 0.08206 x 298 / 1
V = 48.90
learn more about ideal gas equation
https://brainly.com/question/20348074
#SPJ4
What’s the distance between propane particles?
Answer:
10 ft
Explanation:
What are the roles of fungi? Check all that apply.
Fungi can be used to develop medicine.
Fungi are a food source for animals and humans.
Fungi produce oxygen to breathe.
Fungi destroy rocks and minerals.
Fungi are natural recyclers.
Fungi cause infections.
Please help me I am so lost in this question!
Answer:
A,B,E,F
Explanation:
how many molecules of water are needed to completely hydrolyze a polymer that is ten monomers long?
Nine, with each coupled pair of monomers requiring the hydrolysis of one water.
What is meant by hydrolyze?In general, hydrolysis refers to the breaking of chemical bonds brought about by the presence of water and entails the reaction of an organic compound with water to produce two or more new chemicals.Any chemical reaction in which a water molecule breaks one or more chemical bonds is referred to as hydrolysis. The phrase is commonly used to refer to substitution, elimination, and solvation reactions in which water serves as the nucleophile. Using water to break down a binding is known as hydrolysis.The word "hydrolyze" comes from the Greek words hydro and lysis, which mean "water break." Water (or H2O) separates into two components: a positive hydrogen atom, H+, and a negative hydroxide atom, (OH)-. The word "hydrolysis" literally means "water reaction."To learn more about hydrolyze refer to:
https://brainly.com/question/30468294
#SPJ4
Why are many drugs administered as salts rather than as the corresponding neutral compounds?
A. Salts have greater water solubility and stability than the neutral compound.
B. As a general rule, salts are more active than the neutral compounds.
C. Salts are generally liquid and therefore more active than the neutral compounds.
D. The salts are less expensive to produce than the corresponding neutral compounds.
When a drug is administered as a salt, it is typically combined with an appropriate counterion to form a salt form of the drug. This salt form enhances the solubility of the drug in aqueous solutions, which can improve its bioavailability and allow for better dissolution and absorption in the body.
The correct answer is Many drugs are administered as salts rather than as the corresponding neutral compounds because salts often have greater water solubility and stability. This is important for effective delivery and absorption of the drug in the body. Furthermore, salts often provide improved stability compared to the corresponding neutral compounds. The addition of counterions in the salt form can enhance the chemical and physical stability of the drug molecule, protecting it from degradation or hydrolysis.
Learn more about hydrolysis here ;
https://brainly.com/question/31132313
#SPJ11
Draw a structural formula for the alkene you would use to prepare the alcohol shown by hydroboration/oxidation.
Answer:
See explanation
Explanation:
The question is incomplete because the image of the alcohol is missing. However, I will try give you a general picture of the reaction known as hydroboration of alkenes.
This reaction occurs in two steps. In the first step, -BH2 and H add to the same face of the double bond (syn addition).
In the second step, alkaline hydrogen peroxide is added and the alcohol is formed.
Note that the BH2 and H adds to the two atoms of the double bond. The final product of the reaction appears as if water was added to the original alkene following an anti-Markovnikov mechanism.
Steric hindrance is known to play a major role in this reaction as good yield of the anti-Markovnikov like product is obtained with alkenes having one of the carbon atoms of the double bond significantly hindered.
the backbone of the dna molecule consists of what molecules?
Backbone of DNA is made of phosphate and sugar residues
What is Phosphate Backbone?DNA consists of two strands that wind around each other like a twisted ladder. Each strand has a backbone made of alternating sugar (deoxyribose) and phosphate groups. Attached to each sugar is one of four bases--adenine (A), cytosine (C), guanine (G), or thymine (T).A phosphate backbone is the portion of the DNA double helix that provides structural support to the molecule. DNA consists of two strands that wind around each other like a twisted ladder. Each strand has a backbone made of alternating sugar (deoxyribose) and phosphate groups.It consists of 5-carbon deoxyribose sugars and phosphate groups. These sugars are linked together by a phosphodiester bond, between carbon 4 of their chain, and a CH2 group that is attached to a phosphate ion. They are extremely important in the function of DNA.To learn more about Phosphate Backbone refers to:
brainly.com/question/8627667
#SPJ4
how many coefficients need to be changed to make this chemical equation balanced? Zn + HNO3 --> Zn (No3)2 + H2
Coefficient 2 should be placed in the equation before the nitric acid in the reactant so that the chemical reaction becomes balanced.
The given chemical reaction is,
Zn + HNO3 --------> Zn (No3)2 + H2
Here, the elements Hydrogen, Nitrogen, and Oxygen are unbalanced.
These elements are altogether found in HNO₃ on the reactant side and are found as nitrate and hydrogen gas on the product side.
To balance the equation, the coefficient 2 is to be added in the reactant side so that 2 moles of Hydrogen, Nitrogen, and Oxygen would be balanced with 2 moles of Nitrate and two moles of Nitrogen.
On adding 2 on reactant side, we get
Zn + 2HNO3 -----------> Zn(NO3)₂ + H₂
This gives us a balanced equation and thus the equation could be balanced this way.
Therefore, coefficient 2 is to be added to make the equation to be balanced.
To know more about the balanced equation, click below:
https://brainly.com/question/26694427
#SPJ1
Can someone please help me
In a race, you run 3000 meters east in 12 seconds. What is your velocity?
Answer:
250m/s
Explanation:
velocity formula is distance (m) over time(s)
3000 / 12 = 250
Answer: Your answer is 250m/s
Explanation: V= d/t
V= velocity
d= distance
t= time
So, 3000 meters divided by 12 seconds = 250 meters per second
Calculate the pH of a buffer that is 0.145 M HC 2H 3O 2 and 0.202 M KC 2H 3O 2. The K a for HC 2H 3O 2 is 1.8 × 10^ -5.
4.89
9.01
4.60
5.05
4.74
pH of the given buffer solution is 4.89, where [HC2H3O2] = 0.145 M, [KC2H3O2] = 0.202 M, and pKa = 1.8 × 10^-5.
What is the pH of a buffer solution with [HC2H3O2] = 0.145 M, [KC2H3O2] = 0.202 M, and pKa = 1.8 × 10^-5?
To calculate the pH of a buffer solution, we can use the Henderson-Hasselbalch equation:
pH = pKa + log([A^-]/[HA]),
where pKa is the negative logarithm (base 10) of the acid dissociation constant (K a), [A^-] is the concentration of the conjugate base (acetate ion, C2H3O2^-), and [HA] is the concentration of the weak acid (acetic acid, HC2H3O2).
First, let's calculate the pKa of acetic acid using the given K a value:
K a = [H+][C2H3O2^-]/[HC2H3O2]
1.8 × 10^ -5 = x^2/0.145
x = 0.00377 M, which is the concentration of H+
pKa = -log(K a) = -log(1.8 × 10^ -5) = 4.74
Now, let's plug in the values for the concentrations of HC2H3O2 and KC2H3O2 to find [A^-]/[HA]:
[A^-]/[HA] = [KC2H3O2]/[HC2H3O2]
= 0.202 M / 0.145 M
= 1.39
Finally, we can use the Henderson-Hasselbalch equation to find the pH:
pH = pKa + log([A^-]/[HA])
= 4.74 + log(1.39)
= 4.89
Therefore, the pH of the buffer solution is 4.89. The answer is closest to option A (4.89).
To learn more about buffer solution, visit: https://brainly.com/question/8676275
#SPJ4
Water has many unique chemical properties. Which property of water makes water a good solvent of crystalline salts?.
The property of water that makes it a good solvent for crystalline salts.
The property that makes water an effective solvent for crystalline salts is its polar nature.
Water molecules have a bent shape, with one oxygen atom bonded to two hydrogen atoms.
. Oxygen is more electronegative than hydrogen, which means it attracts electrons more strongly.
This creates a partial negative charge on the oxygen atom and partial positive charges on the hydrogen atoms.
The polar nature of water allows it to interact effectively with the positively and negatively charged ions in crystalline salts.
These hydration shells keep the ions separated and prevent them from re-forming a solid crystal.
In summary, the polar nature of water makes it a good solvent for crystalline salts, as it effectively separates and stabilizes the ions in the salt.
Learn more about crystalline salts
brainly.com/question/2016127
#SPJ11
What will happen when 1.57 x 10-3 M Phenolax is combined 1.0 M NaOH? The rate order with respect to the molar concentration of Phenolax will be two (2). I can't tell without exploration of the system the absorbance at 590 nm will rise over time. the absorbance at 550 nm will not change.
If 1.57 x 10-3 M Phenolax is combined with 1.0 M NaOH, The absorbance at 550 nm may not change.
When 1.57 x 10-3 M Phenolax combine with 1.0 M NaOH, the reaction will proceed according to the following equation:
Phenolax + NaOH → NaPhenolax + H2O
The rate order with respect to the molar concentration of Phenolax will be two (2), meaning that the rate of the reaction is proportional to the square of the concentration of Phenolax. This means that if the concentration of Phenolax is doubled, the rate of the reaction will increase by a factor of four.
As for the absorbance at 590 nm and 550 nm, it is difficult to predict how these will change without further exploration of the system. However, it is possible that the absorbance at 590 nm will rise over time as the reaction proceeds and the concentration of NaPhenolax increases.
The absorbance at 550 nm may not change, depending on the absorption properties of the reactants and products at this wavelength.
Learn more about absorbance at: brainly.com/question/28812538
#SPJ11
What is temperature
Answer:
I just love the killua pfp
I think b
Answer:
c
Explanation:
because it forces and help it
help asap ??????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????????
Answer:
Option C
Explanation:
Something white solid forms means here is any salt reacted .And it has been reacted with any hydroxide or acid or another salt. And an undissolved solid product formed.which is white.Its totally chemical change
calculate the number of atoms in 2.5 mol manganese.
Answer:
1.5 × 10²⁴ atoms Mn
General Formulas and Concepts:
Chemistry - Atomic Structure
Reading a Periodic TableUsing Dimensional AnalysisAvogadro's Number - 6.022 × 10²³ atoms, molecules, formula units, etc.Explanation:
Step 1: Define
2.5 mol Mn
Step 2: Identify Conversions
Avogadro's Number
Step 3: Convert
\(2.5 \ mol \ Mn(\frac{6.022 \cdot 10^{23} \ atoms \ Mn}{1 \ mol \ Mn} )\) = 1.5055 × 10²⁴ atoms Mn
Step 4: Check
We are given 2 sig figs. Follow sig fig rules and round.
1.5055 × 10²⁴ atoms Mn ≈ 1.5 × 10²⁴ atoms Mn
Which of the following are not characteristics of a eukaryotic cell?
Multicellular
No nucleus
O Membrane bound organelles
Reproduce by mitosis
What type of energy does photosynthesis turn energy from the sun into?
Explanation:
it turn into chemical energy
Which is an example of a beneficial mutation? ANSWER AND ILL GIVE BRAINLY POINTS !!!!!! HELP ASAP !
Answer:
Some humans are randomly immune to malaria or have increased bone density due to random beneficial mutations.
Explanation:
Answer: one that changes the color of a rabbit, allowing it to hide from predators.
Explanation:Hey give me brainliest award need it
in order for a titration to be effective, all of the following must be true of the reaction, except a. reaction must be stoichiometric b. reaction must produce a precipitate c. reaction must be quantitative d. reaction must be rapid
In order for a titration to be effective, the reaction must produce a precipitate. The correct answer is option B, "reaction must produce a precipitate."
For a titration to be effective, the reaction must be stoichiometric, quantitative, and rapid. A stoichiometric reaction is one in which the amount of reactants is proportional to the amount of products.
A quantitative reaction is one in which all the reactants are consumed, leaving no excess. A rapid reaction is one that occurs quickly and does not take a long time to complete.
However, a reaction producing a precipitate is not necessary for the titration to be effective. Hence option B is correct.
Learn more about titration here:
brainly.com/question/2728613
#SPJ11
When k–1 > k2 (that is, when the rate constant for dissociation of the enzyme substrate complex is greater than the rate constant for conversion to product), the KM is most analogous to
1) the Kd
2) the Ka
3) the Kcat
4) the 1/Kcat
When k1 > k2, the KM is most analogous to the Kd. This is because KM is the concentration of substrate at which the reaction rate is half of its maximum velocity, and Kd is the dissociation constant, which is the concentration of ligand at which half of the receptor binding sites are occupied.
In both cases, they represent the affinity of the enzyme or receptor for the substrate or ligand, respectively. The Ka is the association constant, which is the inverse of Kd, and is not directly related to KM. The Kcat is the turnover number, which represents the maximum number of substrate molecules converted to product per unit time by a single enzyme molecule when it is saturated with substrate, and 1/Kcat is the catalytic efficiency, which is not directly related to KM either.
When k-1 > k2 (the rate constant for dissociation of the enzyme-substrate complex is greater than the rate constant for conversion to product), the KM is most analogous to: 1) the Kd
Visit here to learn more about enzyme brainly.com/question/31385011
#SPJ11
Select any and all of these molecules that have at least one chiral carbon atom. Group of answer choices 3,4-dimethylhexane 3,3-dimethylpentane CH3CH2CH(OH)CH3 CH3CH2CH(CH3)CH2CH2CH3 CH3C(CH3)2CH(CH2CH3)C(CH3)3
Answer:
3,4-dimethylhexane, CH3CH2CH(OH)CH3, CH3CH2CH(CH3)CH2CH2CH3
Explanation:
A chiral carbon atom is also referred to as a asymmetric carbon atom. This is a carbon atom that is bonded to four different substituents.
So what we need to do is to look at each compound and consider all the carbon atoms in each compound. Drawing out the full structural formula is very helpful here.
After drawing each structure out, we now look out for carbon atoms that have four dissimilar substituents. Those are the chiral carbons. If we do so for all the molecules listed in the answer, we will discover that each of them contains an asymmetric carbon atom.
Commercial sulfuric acid H
2
SO
4
, is often purchased as a 93%(w/w) weight percent solution. Find the mg/L of H
2
SO
4
and the molarity (mol/L) and normality (eq/L) of the solution (in three units). Sulfuric acid has a specific gravity of 1.839(M.W, of H
2
SO
4
=98 g/mol ).
The molarity of the solution is 0.01876 mol/L, and the normality is 0.03752 eq/L. Molarity is a measure of the concentration of a solute in a solution. It is defined as the number of moles of solute dissolved in one liter of the solution.
To find the mg/L of H2SO4 in the 93%(w/w) solution, we need to consider the specific gravity of sulfuric acid.
Given:
Weight percent of H2SO4 solution = 93%(w/w)
Specific gravity of sulfuric acid = 1.839
Molecular weight of H2SO4 = 98 g/mol
First, we need to calculate the weight of H2SO4 in 1 liter of the solution:
Weight of H2SO4 (g) = Volume (L) * Specific gravity * Density of water (g/mL)
Since the specific gravity of sulfuric acid is given, we can assume that the density of water is 1 g/mL.
Weight of H2SO4 (g) = 1 L * 1.839 * 1 g/mL = 1.839 g
Next, we can calculate the weight of H2SO4 in mg/L:
Weight of H2SO4 (mg/L) = Weight of H2SO4 (g) * 1000 mg/g = 1.839 g * 1000 mg/g = 1839 mg/L
Therefore, the concentration of H2SO4 in the solution is 1839 mg/L.
To calculate the molarity (mol/L) of the solution, we can use the formula:
Molarity (mol/L) = Weight of solute (g) / Molar mass of solute (g/mol)
Molarity (mol/L) = 1.839 g / 98 g/mol = 0.01876 mol/L
Lastly, to calculate the normality (eq/L) of the solution, we need to consider the number of equivalents of H2SO4 in one mole. Since sulfuric acid is a diprotic acid, it can donate two moles of H+ ions per mole of H2SO4.
Normality (eq/L) = 2 * Molarity (mol/L) = 2 * 0.01876 mol/L = 0.03752 eq/L
Therefore, the molarity of the solution is 0.01876 mol/L, and the normality is 0.03752 eq/L.
To know more about sulfuric acid , click here, https://brainly.com/question/30039513
#SPJ11
The human skeleton is made mostly
of hard blank
tissue.
Balance the following chemical equation: \text{Mg} Mg M, g, plus \text{O}_2 \rightarrowO 2 →O, start subscript, 2, end subscript, right arrow \text{MgO}MgO
The balanced chemical equation is: Mg + 2O2 -> MgO
To balance the chemical equation:
Mg + O2 -> MgO
We need to ensure that the number of atoms of each element is the same on both sides of the equation.
Let's start by balancing the magnesium (Mg) atoms. There is one Mg atom on the left side, so we place a coefficient of 1 in front of MgO on the right side.
Mg + O2 -> 1MgO
Next, let's balance the oxygen (O) atoms. On the left side, we have two oxygen atoms from O2. To have the same number of oxygen atoms on the right side, we need to place a coefficient of 2 in front of O2.
Mg + 2O2 -> 1MgO
Now the equation is balanced with one magnesium atom, two oxygen atoms, and two oxygen atoms on both sides. The balanced chemical equation is:
Mg + 2O2 -> MgO
This equation represents the reaction between magnesium and oxygen to form magnesium oxide.
learn more about chemical equation here
https://brainly.com/question/28792948
#SPJ11
Question 5 (1 point)
Which pair of elements will form a covalent bond between them?
N and O
Li and F
Na and Cl
Mg and S
Nitrogen and oxygen are the elements which will form a covalent bond between them due to small difference in electronegativity.
What is a covalent bond?
Covalent bond is defined as a type of bond which is formed by the mutual sharing of electrons to form electron pairs between the two atoms.These electron pairs are called as bonding pairs or shared pair of electrons.
Due to the sharing of valence electrons , the atoms are able to achieve a stable electronic configuration . Covalent bonding involves many types of interactions like σ bonding,π bonding ,metal-to-metal bonding ,etc.
Sigma bonds are the strongest covalent bonds while the pi bonds are weaker covalent bonds .Covalent bonds are affected by electronegativities of the atoms present in the molecules.Compounds having covalent bonds have lower melting points as compared to those with ionic bonds.
Learn more about covalent bond,here:
https://brainly.com/question/19382448
#SPJ1
What is the key difference between a liquid and a gas?
A. average kinetic energy
B. intermolecular attractions
C. the ability to flow
B. intermolecular attractions.
which sugar is called milk sugar
Answer:
Lactose is called milk sugar.
Explanation:
Hope It Helps!!!
Answer:
lactose
Explanation:
credits to the answer above !
The gaseous state of a substance is due to:
A) the strong bonds between particles
B) the attractions between electrostatically charged particles
C) the high inertia of the small particles
D) the high inertia of the large particles
E) the high-speed motion of particles
Answer:
A the strong bonds between particles.
Explanation:
this is because in solids we say that they have a weak boling point due to the strong bond that makes it hard to melt