Answer:
Follows are the solution to this question:
Explanation:
Please find the image file of the chemical reaction in the attachment:
In a water medium, the CH3- type CH 3Li is a heavy nucleophile that attacks the carbonyl carbon atom to form the alkoxide ion, which will then be protonated to form alcohol.
A student weighed 0.550 g of lithium chloride, LiCl, to use in a reaction. How many moles is this? a. 5.11 b. 42.39 c. 23.31 d. 77.08 e. 0.0130
Answer:
The answer is option eExplanation:
To find the number of moles we must first find the molar mass of LiCL
From the question
mass = 0.550g
M(Li) = 6 Cl = 35.5
Molar mass of LiCL = 6 + 35.5 = 41.5 g/mol
Then we use the formula
\(n = \frac{m}{M} \)
where
n is the number of miles
m is the mass
M is the molar mass
So we have
\(n = \frac{0.550}{41.5} \)
We have the final answer as
0.0130 molHope this helps you
characteristics. of. rusting
Answer: metal turn orange and weaker as it gets oxidised
Explanation:
Given the following skeleton equation, what are the coefficients for the chemicals in the reaction? __ FeSO4 + __ Al(OH)3 → __ Al2(SO4)3 + __ Fe(OH)2
Answer:
3 FeSO4 + 2 Al(OH)3 -> 1 Al2(SO4)3 + 3 Fe(OH)2
Explanation:
In the barium chloride laboratory activity, what change occurred in the physical appearance of the barium chloride during the heating process?
A. Barium chloride changed from sparkly white to dull white.
B. Barium chloride changed from dull white to sparkly white.
C. Barium chloride changed from sparkly yellow to dull yellow.
D. Barium chloride changed from dull yellow to sparkly yellow.
Barium chloride turned from sparkly white into dull white during the heating process.
Barium chloride: What is it?An inorganic substance with the formula BaCl2 is barium chloride. It is among the most popular barium salts that dissolve in water. Like the majority of some of the other water-soluble barium salts, is also white, extremely hazardous, and gives flames a yellow-green tint.
What results from consuming barium chloride?Among the most common barium salts is barium chloride. Bacl2 is hygroscopic and soluble in water. Deep hypokalemia, generalized muscle weakness, and eventually paralysis of the limbs and breathing muscles can occur within 1 to 4 hours of consumption.
To know more about barium chloride visit :
https://brainly.com/question/2572464
#SPJ1
Which of the following best predicts the type of bond that forms between Br and Br?
Answer
nonpolar covalent
Procedure
The bond type can be predicted by electronegativity difference, in this case, and in all cases that we have exactly the same elements (which are nonmetals), the electrons will be shared equally between both elements, resulting in a nonpolar covalent bond.
Plz guys help me plz
Explanation:
Can you edit your question and get a better pic because I cant see anything. Its blurry.
How does the chemical structure of a substance affect its interaction with other substances?
This is due to the fact that a substance's chemical qualities, such as its molecular form, polarity, and functional groups, govern how it behaves and interacts with other substances.
How does their chemical makeup impact their chemical characteristics?By illustrating the spatial arrangement of atoms and chemical bonds within the molecule, chemical structure establishes the molecular geometry of a compound. In doing so, chemists are given a crucial visual depiction of a chemical formula.
In what ways do drugs interact with one another?In a chemical reaction, reactants come into contact with one another, atoms in the reactants break their connections with one another, and then the atoms reorganise and form new bonds to create the products.
To know more about molecule visit:-
https://brainly.com/question/19556990
#SPJ1
What forms of energy are produced when
fossil fuels burn?
When fossil fuels burn, several forms of energy are produced, including:
Heat energy: The primary form of energy released during fossil fuel combustion is heat. Fossil fuels contain chemical energy stored for millions of years, and when they burn, this energy is released in the form of heat. The heat energy can be harnessed for various purposes, such as heating buildings or generating steam to drive turbines.
Light energy: Burning fossil fuels can also produce light energy in the form of flames or glowing embers. This light energy is a byproduct of combustion.
Mechanical energy: Heat generated by burning fossil fuels can be converted into mechanical energy. This is typically achieved by using heat to produce steam, which drives a turbine connected to a generator. The rotating turbine converts the heat energy into mechanical energy, which is further transformed into electrical energy.
Electrical energy: Through the process described above, burning fossil fuels can ultimately generate electrical energy. The mechanical energy produced by the turbine is converted into electrical energy by the generator. Electrical energy can power various devices, appliances, industries, and infrastructure.
It's critical to note that while burning fossil fuels can produce useful forms of energy, it also results in the release of carbon dioxide and other greenhouse gases. This contributes to climate change and environmental concerns. As a result, there is a global shift towards cleaner and renewable energy sources to mitigate these negative impacts.
The decomposition of nitrogen dioxide is described by the following chemical equation:
2NO_2 (g) --------> 2NO (g) + O_2 (g)
Suppose a two-step mechanism is proposed for this reaction, beginning with this elementary reaction:
NO_2 (g) --------> NO_(g) + O_(g)
Suppose also that the second step of the mechanism should be bimolecular.
a) Suggest a reasonable second step. That is, write the balanced chemical equation of a bimolecular elementary reaction that would complete the proposed mechanism.
Answer:
The balanced chemical equation will be "\(NO_{2}+O\rightarrow NO+O_{2}\)".
Explanation:
The given equation is:
\(2NO_{2}\rightarrow 2NO+O_{2}\)
Step 1:
\(2NO_{2}\rightarrow NO+O\)...(equation 1)
Step 2:
\(NO_{2}+O\rightarrow NO+O_{2}\)...(equation 2)
On adding "equation 1" and "equation 2", we get
⇒ \(NO_{2}+NO_{2}+O\rightarrow NO+O+NO+O_{2}\)
⇒ \(2NO_{2}\rightarrow 2NO+O_{2}\)
The second step:
⇒ \(NO_{2}+O\rightarrow NO+O_{2}\)
Iron titanate (FeTiO3) forms in the ilmenite crystal structure that consists of an HCP arrangement of O2- ions. (a) Which type of interstitial site will the Fe2 ions occupy
In this case, according to the given information, whereas iron titanate forms in the ilmenite crystal structure that consists of an HCP arrangement, it'd be necessary to use the following equation, in order to figure out the ionic radii ratio of Fe²⁺ to O²⁻ which provides the interstitial site type:
\(\frac{r_{Fe^{2+}}}{r_{O_2^{2-}}}\)
Now, the ionic radii depends on the source that is considered, that is why in this case, we will consider the data reported by Askeland, The Science And Engineering Materials 6th edition for the required radii:
\(r_{Fe^{2+}}=0.074 nm\\\\r_{O_2^{2-}}=0.132 nm\)
Thus, the ratio will be:
\(\frac{0.074nm}{0.132 nm}=0.561\)
Which is within the range of octahedral sites (0.414–0.732).
Learn more:
https://brainly.com/question/19425314PLEASE ANWSER THIS!!
which is the best definition m of pitch?
A: pitch is how high or low a sound is
B: pitch is how loud a sound is
C: pitch is how well a sound travels through a medium
Answer:
A. because there both high pitched voice and low pitched ( girls have sweet, shrill ,high pitched good voice ) where as boys have horase ,low pitched medium voice )
I NEED HELP ASAPPPPP!!!!!!!
Objects with similar volume always have the same mass.
True or false?
The mass of 2.50 moles of calcium fluoride (CaF2) is how many
grams.
Answer:
195.199 grams
Write in Scientific Notation 1,060,000,000
Calculate the formula weight or molecular for the following:
a. LiCI
b. SO2 (The 2 is in subscript)
Answer:
42.39, 64.06
Explanation:
Formula Weight can be calculated by adding the atomic mass of the elements in the formula.
LiCl
AM for Li is 6.94 amu, AM for Cl is 35.45 amu
\((6.94)+(35.45)=42.39\)
SO₂
AM for S is 32.06 amu, AM for O is 16 amu
\((32.06)+2(16.00)=64.06\)
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
A solution containing 0.026 moles of H2O2 at 25.0 °C is placed in a coffee cup calorimeter and
allowed to decompose completely according to the thermochemical equation shown below. The final temperature of the solution is 44.9 °C. Calculate the enthalpy of the reaction shown, in kJ/mol. The mass of the solution is 30.0 g and the specific heat capacity of the solution
is 4.18 J/g°C.
CHEMICAL Formula is in the photo
The enthalpy (in kJ/mol) of the reaction, given that 0.026 moles of H₂O₂ at 25.0 °C is placed in a coffee cup calorimeter is 95.98 KJ/mol
How do i determine the enthalpy of the reaction?First, we shall determine the heat energy of the reaction. Details below:
Mass of solution = 30 gInitial temperature of statue (T₁) = 25 °CFinal temperature of statue(T₂) = 44.9 °CChange in temperature (ΔT) = 44.9 - 25 = 19.9 °C Specific heat capacity of solution (C) = 4.18 J/gºC Heat energy (Q) =?Q = MCΔT
Q = 30 × 4.18 × 19.9
Q = 2495.46 J
Finally, we shall determine the enthalpy of the reaction. Details below:
Heat absorbed (Q) = 2495.46 J = 2495.46 / 1000 = 2.49546 KJMole of H₂O₂ (n) = 0.026 moleEnthalpy of reaction (ΔH) =?Q = n × ΔH
2.49546 = 0.026 × ΔH
Divide both sides by 0.026
ΔH = 2.49546 / 0.026
ΔH = 95.98 KJ/mol
Thus, the enthalpy of reaction is 95.98 KJ/mol
Learn more about enthalpy change:
https://brainly.com/question/24170335
#SPJ1
Which of the following scenarios describes an example of a sustainable practice that individuals or families can implement?
A family uses a sprinkler system to water their lawn on a daily basis.
A family uses a sprinkler system to water their lawn on a daily basis.
A) An individual always uses single-use plastic bottles for their drinking water.
B) An individual always uses single-use plastic bottles for their drinking water.
C) An individual rides their bicycle or uses public transportation to go to work.
D) An individual rides their bicycle or uses public transportation to go to work.
E) A family washes and dries multiple loads of laundry each day of the week.
The right response is C) A person commutes to work on a bicycle or by taking public transit. This is an illustration of a sustainable behaviour that people or families may adopt since it lessens their carbon footprint and promotes energy conservation.
People may decrease their dependency on vehicles, which are a significant source of greenhouse gas emissions, by adopting a bicycle or public transit. This promotes a healthier environment and lowers air pollution.
Additionally, users may save money on petrol and automobile maintenance by switching from driving to public transit. People may also lessen their reliance on oil, which is a limited resource, by using bicycles or public transit. This environmentally friendly method can assist to protect the environment.
Learn more about environment at:
https://brainly.com/question/5511643
#SPJ1
Determine the value of Kc for the following reaction, if the equilibrium concentrations are as follows: [N2]eq = 2.66 M, [H2]eq = 0.64 M, [NH3]eq = 3.34 M.
N2(g) + 3 H2(g) ⇌ 2 NH3(g)
The value of Kc for the given reaction is 0.0579 (rounded to four decimal places).
The formula for the equilibrium constant, Kc, of a reaction is given by the ratio of the product of the concentrations of the products raised to their respective stoichiometric coefficients to the product of the concentrations of the reactants raised to their respective stoichiometric coefficients.
The stoichiometric coefficients are the coefficients in the balanced chemical equation.
To determine the value of Kc for the reaction given by the following chemical equation:N2(g) + 3 H2(g) ⇌ 2 NH3(g)
we first need to write the expression for Kc.
The expression for Kc is given by the following formula:Kc = [NH3]² / [N2][H2]³.
We are given the equilibrium concentrations as follows:[N2]eq = 2.66 M[H2]eq = 0.64 M[NH3]eq = 3.34 M
We can substitute these values into the expression for Kc and obtain the following:Kc = (3.34)² / (2.66)(0.64)³ = 0.0579 (rounded to four decimal places).
For more such questions on Kc
https://brainly.com/question/15225808
#SPJ8
Please help i have an exam tomorow!!
1. Oxygen is a reactant needed for all _________ reactions.
2. The products of the complete combustion reaction of a hydrocarbon (compound containing carbon and hydrogen) are ______ and _____ .
3. ______ combustion takes place if the quantity of oxygen is sufficient.
4. Incomplete combustion takes place if the quantity of oxygen is _______.
5. Combustion is a ______ change.
6. In a combustion reaction, oxygen is the oxidizer and the substance
which burns is the ______.
7. The lower the kindling temeperature, the _____ is the combustion.
8. If a substance burns at room temperature in the absence of a flame the
combustion is said to be _____.
9. combustion reactions are accompanied by _____ and _____ effect.
10. combustion reactions dont take place at the same _______.
2,6,8, and 10 are the ones i need the most help with
1. Oxygen is a reactant needed for all combustion reactions.
2. The products of the complete combustion reaction of a hydrocarbon (compound containing carbon and hydrogen) are carbon dioxide and water.
3. Complete combustion takes place if the quantity of oxygen is sufficient.
4. Incomplete combustion takes place if the quantity of oxygen is insufficient.
5. Combustion is a exothermic change.
6. In a combustion reaction, oxygen is the oxidizer and the substance which burns is the fuel.
7. The lower the kindling temperature, the easier is the combustion.
8. If a substance burns at room temperature in the absence of a flame the combustion is said to be spontaneous.
9. Combustion reactions are accompanied by heat and light effect.
10. Combustion reactions don't take place at the same rate.
1)Oxygen is a reactant needed for all combustion reactions. Combustion reactions are chemical reactions that involve the rapid combination of a fuel (usually a hydrocarbon) with oxygen gas. Oxygen acts as the oxidizing agent, providing the necessary component for the reaction to occur. Without oxygen, combustion cannot take place.
2)The products of the complete combustion reaction of a hydrocarbon are carbon dioxide and water. In the presence of sufficient oxygen, hydrocarbons undergo complete combustion, resulting in the production of carbon dioxide (\(CO_2\)) and water (\(H_2O\)). This reaction releases a significant amount of energy in the form of heat and light.
3)Complete combustion takes place if the quantity of oxygen is sufficient. Complete combustion occurs when there is an adequate supply of oxygen available for the reaction. In this case, the fuel (hydrocarbon) reacts completely with oxygen, resulting in the formation of carbon dioxide and water as the only products
4)Incomplete combustion takes place if the quantity of oxygen is limited. In situations where there is insufficient oxygen available, incomplete combustion occurs. This leads to the formation of products such as carbon monoxide (CO) and carbon (soot) in addition to carbon dioxide and water. Incomplete combustion is less efficient and can release harmful pollutants into the environment.
5)Combustion is a chemical change. Combustion is classified as a chemical change because it involves the breaking and forming of chemical bonds between atoms and molecules. The reactants (fuel and oxygen) undergo a chemical reaction to produce new substances (products) with different properties, such as carbon dioxide and water. Heat and light are also typically released during combustion.
6)In a combustion reaction, oxygen is the oxidizer, and the substance that burns is the fuel or combustible material. Oxygen acts as the oxidizing agent, meaning it accepts electrons from the fuel, leading to the oxidation (burning) of the fuel. The fuel provides the carbon and hydrogen atoms that combine with oxygen to form carbon dioxide and water.
7)The lower the kindling temperature, the easier the combustion. The kindling temperature is the minimum temperature at which a substance can ignite and sustain combustion. If the kindling temperature is lower, it means that less heat is required to initiate the combustion process. Substances with lower kindling temperatures are more prone to catching fire and sustaining combustion.
8)If a substance burns at room temperature in the absence of a flame, the combustion is said to be spontaneous. Spontaneous combustion refers to the ignition and burning of a substance without the need for an external ignition source, such as a flame. It occurs when certain materials, under specific conditions, undergo self-heating and eventually reach their ignition temperature, leading to combustion.
9)Combustion reactions are accompanied by heat and light effects. Combustion reactions are highly exothermic, meaning they release a significant amount of heat energy. This energy is released in the form of heat and light, resulting in flames or glowing embers during combustion.
10)Combustion reactions don't take place at the same rate for all substances. The rate of combustion can vary depending on factors such as the nature of the fuel, the availability of oxygen, temperature, and pressure. Different substances have different combustion rates due to variations in their chemical properties and reactivity.
Know more about carbon dioxide here:
https://brainly.com/question/30355437
#SPJ8
Please explain using Newton’s Laws of Motion (All of them) what happens when a car hits an SUV on the street, given that the first vehicle (car) is moving, while the second vehicle (SUV) is standing still. You may decide which way the SUV moved and how it hits the car, but you have to explain this in this assignment.
According to Newton's second law, force equals mass multiplied by acceleration. As a result, in a car accident, the force exerted by the vehicle and its occupants decreases as the time required for the vehicle to stop increases.
What is Newton's second law?We clearly observed in the Exploration that when two cars collide, each feels a force from the other.
According to Newton's third law, when one object exerts a force on another, the second object feels an equal and opposite force exerted by the first object. This is very clear in the two-object collision.
The force with which your body is struck in a collision is referred to as crash force. Crash force is equal to your body weight multiplied by the vehicle's speed.
Newton's second law states that force equals mass multiplied by acceleration. As a result, the force exerted by the vehicle and its occupants in a car accident decreases as the time required for the vehicle to stop increases.
Thus, this way it hits the car.
For more details regarding Newton's law, visit:
https://brainly.com/question/15280051
#SPJ1
The ____________________ is the organ associated with the sense of touch.
a.
nose
c.
heart
b.
liver
d.
skin
Please select the best answer from the choices provided
Find the concentration of the missing substance
11) A + B = C
K=20,
IAl=2,
[B=5
[C] =
12) A(s) + B(ag) = C(g)
K = 10
B=
11. The concentration of C is 200
12. The concentration of B is 0.4
How do i determine the equilibrium concentrations?Equilibrium constant, K is defined as follow:
nReactant ⇌ mProduct
Equilibrium constant, K = [Product]ᵐ / [Reactant]ⁿ
With the above formula, we can obtain the equilibrium concentration of the missing substance as follow:
11. For concentration of C
A + B ⇌ CEquilibrium constant (K) = 20Concentration of A, [A] = 2Concentration of B, [B] = 5Concentration of C, [C] =?K = [C] / [A][B]
20 = [C] / (2 × 5)
20 = [C] / 10
Cross multiply
[C] = 20 × 10
Concentration of C, [C] = 200
12. For concentration of B
A(s) + B(aq) ⇌ C(g)Equilibrium constant (K) = 10Concentration of C, [C] = 4Concentration of B, [B] = ?K = [C] / [B]
10 = 4/ [B]
Cross multiply
10 × [B] = 4
Divide both sides by 10
[B] = 4 / 10
Concentration of B, [B] = 0.4
Learn more about equilibrium concentration:
https://brainly.com/question/15691608
#SPJ1
Complete question:
Find the concentration of the missing substance
11) A + B = C
K = 20
[A] = 2
[B] = 5
[C] =?
12) A(s) + B(ag) = C(g)
K = 10
[C] = 4
[B] = ?
Which of these reservoirs contains the most water?
Answer:
Glaciers
Explanation:
Reservoirs refers to paces where water are stored. The largest water reservoir on earth are the oceans which contain about 97% of all the water on the earth.
The next highest reservoir are the glaciers or the polar ice caps. These hold quite an enormous amount of the water found on earth.
Surface and other fresh water only account for about 1.2% of all the surface water on earth.Ground water accounts for a very minute percentage of the water found on earth.
Match the term with the correct definition or example.
3
Energy directly involved in
movement of molecules
2
1. TEMPERATURE
The transfer of energy from
a substance to its
surroundings
2
2. THERMAL ENERGY
-
3. KINETIC ENERGY
The sum of all the energy
within a substance, both
moving and potential
energy
4. HEAT
The amount of motion
energy within a substance
Here's link to the answer:
tinyurl.com/wtjfavyw
HELP ME SOLVE THIS WORKSHEET
Which of the following subject areas contains questions that can be answered by science?
O Astronomy
O Alchemy
O Ethics
O Religion
Answer:
A
Explanation:
K took the test
Astronomy subject areas contains questions that can be answered by science. Thus option A is correct.
What is Astronomy?The science deals with extraterrestrial objects and phenomena, that is everything in our universe beyond the atmosphere of our planet.
This science is more observational than experimental. Astronomy can be up two types such as observational astronomy and theoretical astronomy.
Now a day, the field of astronomy has been expanded enormously in different field of subjects like astrometry, planetary astronomy, astrophysics, astrobiology, astrochemistry, etc.
The field of astrophysics is used understand the nature of celestial objects and their physical processes involve in the formation and emission of radiation.
Other research application include the chemical composition of stars, study of nuclear reactions to know the details about the the radiation energy release from stars.
Thus, Option A is correct.
Learn more about astronomy, here:
https://brainly.com/question/13050965
#SPJ2
How many moles of methane gas will combust to produce 330 grams of water? Answer must be to the correct number of sig figs and include the correct unit with the chemical formula.
9.162 moles of methane gas will combust to produce 330 grams of water.
What is the balanced chemical equation for the combustion of methane?The balanced chemical equation for the combustion of methane (CH₄) in the presence of oxygen (O₂) to produce water (H₂O) and carbon dioxide (CO₂) is:
CH₄ + 2O₂ -> CO₂ + 2H₂O
From the equation, we can see that one mole of methane produces two moles of water.
The molar mass of water (H₂O) is approximately 18.015 g/mol. Therefore, 330 g of water is equivalent to 330/18.015 ≈ 18.324 moles of water.
Since one mole of methane produces two moles of water, the number of moles of methane required to produce 18.324 moles of water is half that value, or 9.162 moles.
Therefore, the answer is:
9.162 moles of CH₄ (to 4 significant figures)
Learn more about moles here:
https://brainly.com/question/26416088
#SPJ9
6. Which of the following statements is/are TRUE of metals and non-metals?
l. Non-metals are heat conductors.
ll.Aluminum, copper and iron are non-metals.
III. Phosphorus and sulfur are poor conductors of heat and electricity
IV. Metals have luster.
A. I only
B. III only
C. III and IV
D. I and II
Answer:
I= true
III=false
iv=true
How many kilojoules of heat are needed to raise the temperature of 10g of aluminum from 22 degrees C to 55 degrees C, if the specific heat of aluminum is .901 j/gc?
Answer:
name four agricultural inputs are subsidized by the government
0.297 kJ of heat is needed to raise the temperature of 10g of aluminum from 22 degrees Celsius to 55 degrees Celsius.
The specific heat is the amount of heat per unit mass required to raise the temperature by one degree Celsius.
It is a measure of how much energy it takes to raise the temperature of a substance. It is the amount of heat necessary to raise one mass unit of that substance by one temperature unit.
It is given by the formula -
Q = mcΔT
where, Q = amount of heat
m = mass
c = specific heat
ΔT = Change in temperature
Given,
mass = 10g
c = 0.901J/g⁰C
Initial temperature (T₁) = 22⁰C
Final Temperature (T₂) = 55⁰C
Q = mcΔT
= 10 × 0.901 × (55 -22)
= 297.33 J = 0.297 kJ
Learn more about Specific heat, here:
https://brainly.com/question/31608647
#SPJ1