A student pushes a heavy lab table that weighs 400N for 15m across a room. How much work was done?

Answers

Answer 1

Answer:

The answer is 6000 N

Explanation:

The work done by an object can be found by using the formula

workdone = force × distance

From the question we have

workdone = 400 × 15

We have the final answer as

6000 N

Hope this helps you


Related Questions

Define exothermic and endothermic. What are the mathematical signs of the internal energy and enthalpy when a process is exothermic?

Answers

Exothermic refers to chemical interactions that aerobic respiration. Combustion reactions release higher energy. Endothermic refers to atoms and molecules that either use or absorb reactive power.

What is an exothermic explanation?

A chemical process known as an endothermic releases energy as heat or light. It is an endothermic reaction's opposite. Chemical equation expressed as reactants + products + energy. An reaction mechanism is one in which electricity is given off as light or warmth.

Exothermic example: What is it?

A response is deemed to be exothermic if it produces heat while also undergoing a net decrease in basic enthalpy change. Samples include those type of combustion, iron rust, including water froze. Exothermic processes are those that discharge heat and energy into the surroundings.

To know more about exothermic visit:

https://brainly.com/question/13243759

#SPJ1

Ibuprofen can be found in 800 mg doses in over-the-counter analgesics, such as Advil and Motrin. How many grams of iburofen
does such a tablet contain?
800 mg =
g

Answers

The grams of iburofen does such a tablet contain 800 mg =   0.8g Ibuprofen

1 g = 10^-3g = .001g

Ibuprofen has  800 mg doses in over-the-counter analgesic

800g = 800 × .001

        = 0.8g

Ibuprofen is Nondteriodal Anti-inflammatory Drug (NSAID)Ibuprofen's Mechanism of Action is Decreases inflammation, pain, and fever through inhibition of cyclooxygenase activity and prostaglandin synthesisnonsteroidal anti-inflammatory medication (NSAID) used for pain relief and to reduce fever by stops inflammation and  by blocking formation of cyclo-oxygenase (COX-2) a chemical mediator of inflammatory chemicals. i.e prostaglandinsIt comes under the Class analgesic (reduce pain) and antipyretic (FIRE - reduce fever)e side effects of ibuprofen NSAID are peripheral edema, fluid retention with edema, tinnitus, purpura, petechiae, anorexia, diarrhea, rash, nausea, vomiting, fatigue, dizziness, lightheadedness, anxiety, confusion

To know more about analgesic visit :

https://brainly.com/question/2189504

#SPJ9

Find the place of the digit 1 in the number 81389398.
Select the correct answer below:


billions

hundred millions

ten millions

millions

hundred thousands

Answers

Answer:

millions

Explanation:

the 1 is seven decimbal places to the left (seven places left of zero), which is the millions place

Millions. Good Luck!

List the following compounds in order from strongest acid to weakest acid. Rank the acids from strongest to weakest.
CH2CHCH2COOH CH2CH2CH2COOH CH3CHCH2COOH CH3CH2CH2COOH
Strongest Weakest

Answers

Answer:

CH3CH2CH2COOH<CH2(F)CH2CH2COOH<CH3CH(F)CH2COOH<CH2(F)CH(F)CH2COOH

Explanation:

We know that the presence of highly electronegative elements in carboxylic acid molecules lead to -I inductive effect. This implies that electrons are withdrawn along the chain towards the electronegative element. As electrons are withdrawn towards the electronegative element, the electron cloud of the carbonyl- hydrogen bond in the acid weakens and the hydrogen can now be easily lost as a proton, that is , the molecule becomes more acidic.

The -I inductive effect increases with increase in the number of electronegative elements present in the molecule and the proximity of the electronegative element to the carbonyl group. The closer the electronegative element is to the carbonyl group, the greater the acidity of the molecule since the -I inductive effect dies out with increasing distance from the carbonyl group. Also, the more the number of electronegative elements in the molecule, the greater the - I inductive effect and the greater the acidity of the molecule, hence the answer.

The rotational spectrum of 79BrºF shows a series of equidistant lines spaced 0-714 33 cm - apart. Calculate the rotational constant B, and hence the moment of inertia and bond length of the molecule. Determine the wavenumber of the J = 9+= 10 transition, and find which transition gives rise to the most intense spectral line at room temperature (say 300 K).
and calculate the number of revolutions per second which the Brf molecule undergoes when in (a) the J = 0 state, (b) the J = 1 state, and (c) the J = 10 state. Hint: Use E = {lwin conjunction with Eqs (2.10) and (2.13), but remember that here w is in radians per second.[its Q season 2 from fundamentals of molcular spectruscopy . banwell.c.n]​

Answers

In the J = 0 state, the BrF molecule does not undergo any revolutions per second. In the J = 1 state, it undergoes approximately 0.498 revolutions per second, and in the J = 10 state, it undergoes approximately 15.71 revolutions per second.

To calculate the rotational constant B, we can use the formula:

B = 1 / (2 * π * Δν)

Where:

B = rotational constant

Δν = spacing between consecutive lines in the rotational spectrum

Given that the spacing between consecutive lines is 0.71433 cm^(-1), we can substitute this value into the formula:

B = 1 / (2 * π * 0.71433 cm^(-1))

B ≈ 0.079 cm^(-1)

The moment of inertia (I) of the molecule can be calculated using the formula:

I = h / (8 * π^2 * B)

Where:

h = Planck's constant

Given that the value of Planck's constant (h) is approximately 6.626 x 10^(-34) J·s, we can substitute the values into the formula:

I = (6.626 x 10^(-34) J·s) / (8 * π^2 * 0.079 cm^(-1))

I ≈ 2.11 x 10^(-46) kg·m^2

The bond length (r) of the molecule can be determined using the formula:

r = sqrt((h / (4 * π^2 * μ * B)) - r_e^2)

Where:

μ = reduced mass of the molecule

r_e = equilibrium bond length

To calculate the wavenumber (ν) of the J = 9+ to J = 10 transition, we can use the formula:

ν = 2 * B * (J + 1)

Substituting J = 9 into the formula, we get:

ν = 2 * 0.079 cm^(-1) * (9 + 1)

ν ≈ 1.58 cm^(-1)

To determine the most intense spectral line at room temperature (300 K), we can use the Boltzmann distribution law. The intensity (I) of a spectral line is proportional to the population of the corresponding rotational level:

I ∝ exp(-E / (k * T))

Where:

E = energy difference between the levels

k = Boltzmann constant

T = temperature in Kelvin

At room temperature (300 K), the population distribution decreases rapidly with increasing energy difference. Therefore, the transition with the lowest energy difference will have the most intense spectral line. In this case, the transition from J = 0 to J = 1 will have the most intense spectral line.

To calculate the number of revolutions per second, we can use the formula:

ω = 2 * π * B * J

Where:

ω = angular frequency (in radians per second)

J = rotational quantum number

For J = 0:

ω = 2 * π * 0.079 cm^(-1) * 0 = 0 rad/s

For J = 1:

ω = 2 * π * 0.079 cm^(-1) * 1 ≈ 0.498 rad/s

For J = 10:

ω = 2 * π * 0.079 cm^(-1) * 10 ≈ 15.71 rad/s

For more such questiosn on  BrF molecule visit;

https://brainly.com/question/30624940

#SPJ8

why do we have to write the background of the study​

Answers

Answer:

Writing down background information can help you to remember what you learned and can be used for notes in the future when taking an assessment.

Explanation:

Can I get brainliest? It's for a challenge

How many O atoms are there in 1.51×10^23 molecules of trifluoroacetic acid, C2HF3O2?

Answers

Answer:

9.033 × 10²³ molec C₂HF₃O₂ x (2 O atoms / 1 molec C₂HF₃O₂) = 1.8066 x 10²⁴ O atoms

There are 3.01 × 10^23 atoms of oxygen in 1.51×10^23 molecules of trifluoroacetic acid, C2HF3O2.

The formula of trifluoroacetic acid is C2HF3O2

Number of moles of the trifluoroacetic acid(C2HF3O2)is given using the approach;

1 mole of the compound contains 6.02 × 10^23 molecules

x moles of the compound contains 1.51 × 10^23 molecules

x = 1.51 × 10^23 molecules × 1 mole /6.02 × 10^23 molecules

x = 0.25 moles of  trifluoroacetic acid.

Now;

Number of O atoms in the sample = 0.25 × 2 × NA

Where; NA = Avogadro's number

Number of O atoms in the sample = 0.25 × 2 × 6.02 × 10^23 atoms

= 3.01 × 10^23 atoms

Learn more: https://brainly.com/question/24798986

What is the volume of 6.40 grams of O₂ gas at STP?
O 4.49 liters
O 4.32 liters
04.18 liters
O 4.06 liters

Answers

The volume of 6.40 grams of O₂ gas at STP is 4.48L (option A). Details about volume can be found below.

How to calculate volume?

The volume of a gas can be calculated using the following formula:

p = m/v

Where;

p = densitym = massv = volume

According to this question, the mass of O₂ gas at STP is 6.40 grams. The density of the gas at STP is 1.43 g/L.

1.43g/L = 6.4g/V

Volume of O2 = 6.4 ÷ 1.43 = 4.48L

Therefore, the volume of 6.40 grams of O₂ gas at STP is 4.48L.

Learn more about volume at: https://brainly.com/question/1578538

#SPJ1

Answer:

This is right!!! the answer is A 4.49

Explanation:

The forensic technician at a crime scene has just prepared a luminol stock solution by adding 17.0 \({\rm g}\) of luminol into a total volume of 75.0 \(\rm mL\) of \(\rm H_2O\). What is the molarity of the stock solution of luminol

Answers

Answer:

1.28 M

Explanation:

Step 1: Given data

Mass of luminol (solute): 17.0 g

Volume of water: 75.0 mL (this is also the volume of solution)

Step 2: Calculate the moles corresponding to 17.0 g of luminol

The molar mass of luminol is 177.16 g/mol.

17.0 g × 1 mol/177.16 g = 0.0960 mol

Step 3: Calculate the molarity of the solution

We will use the definition of molarity

M = moles of solute / liters of solution

M = 0.0960 mol / 0.0750 L = 1.28 M

if you reply with a link, I will report you​

if you reply with a link, I will report you

Answers

Answer:

1 2 2

Explanation:

What is one similarity between metals and metalloids?

A) They are both durable
B) They are both ductile
C) They are both malleable
D)They both conduct electricity

Answers

The correct answer that explains similarities between metal and Metalloids as regards the question is They both conduct electricity

Metalloids can be regarded as elements that are  similar to metals, this is because they posses valence orbitals which is described as highly delocalized over macroscopic volumes.

As a result of this they can serve as electrical conductors.

metalloids posses small energy gap which is located between the valence band as well as the conduction band, as a result of this they are considered as  intrinsic semiconductors when compare to pure conductors like metal.

Example of metal is Calcium, sodium and that of Metalloids are silicon and  germanium

Therefore, metal and Metalloids are similar because of their conductivity of electricity

Learn more at: https://brainly.com/question/21036799?referrer=searchResults

Na2CO3+Ca(NO3)2⟶CaCO3+2NaNO3 what mass of calcium nitrate in grams is needed to produce 4.93 mol of sodium nitrate?

Answers

Answer:

404.47692 g

Explanation:

Na₂CO₃ + Ca(NO₃)₂ ⇒ CaCO₃ + 2NaNO₃

From the coefficients in the balanced chemical equation, we see that the ratio of Ca(NO₃)₂ and 2NaNO₃ is 1:2, so every 1 mol of Ca(NO₃)₂ produces 2 mols of 2NaNO₃.

(4.93 mol NaNO₃)(\(\frac{Ca(NO3)2}{2NaNO3}\)) = 2.465 mol Ca(NO₃)₂

Then, we need to convert from moles to grams, since we are asked to find the mass of Ca(NO₃)₂. To do this, we need to look up the molar mass of Ca(NO₃)₂, which is 164.088 g/mol.

(2.465 mol Ca(NO₃)₂ ) (  \(\frac{164.088 g}{1 mol}\)) =  404.47692 g

Thus,  404.47692 grams of Ca(NO₃)₂ is needed to produce 4.93 mol of 2NaNO₃.

Predict the changes in the equilibrium position for this reaction when the following changes are made. In each case, state whether the change causes a shift that favors the formation of reactants or of products.
2A(g) +B(g)↔ 4C(g)+heat
a. increase the pressure

b. increase the concentration of A

c. decrease the concentration of C

d. add more heat

Answers

When pressure is increased, the equilibrium position will shift towards the side of reactants, when  concentration of A is increased then the equilibrium position will shift towards the side of products, when, concentration of C is decreased  the equilibrium position will shift towards the side of products, and when we adding more heat than the equilibrium position will shift towards the side of reactants.

If the pressure is increased, according to Le Chatelier's principle, the system will shift towards the side with fewer moles of gas in order to reduce the pressure. In this case, the formation of products (4C) results in an increase in the total number of moles of gas (4 moles of C), compared to the reactants (2 moles of A + 1 mole of B).

If the concentration of A is increased, the system will try to counteract the change by shifting the equilibrium position to the side that would consume the excess of A. In this case, the excess of A will react with B to form more products (C) according to the reaction.

If the concentration of C is decreased, the system will try to counteract the change by shifting the equilibrium position to the side that would replenish the decrease in C. In this case, the decrease in C will result in a decrease in the concentration of products, so the equilibrium position will shift towards the side of products.

Adding heat to the system will increase the temperature, causing the equilibrium position to shift in the direction that absorbs heat in order to reduce the temperature. In this case, heat is a product of the reaction, so the equilibrium position will shift towards the side of reactants.

To know more about Le Chatelier's principle here

https://brainly.com/question/2001993

#SPJ1

write 3 to 5 sentences about predicting the properties of acids and bases​

Answers

Answer:

cause of the properties of their aqueous solutions. Those properties are outlined below:

Aqueous solutions of acids are electrolytes, meaning that they conduct an electrical current. Some acids are strong electrolytes because they ionize completely in water, yielding a great many ions. Other acids are weak electrolytes that exist primarily in a non-ionized form when dissolved in water.

Acids have a sour taste. Lemons, vinegar, and sour candies all contain acids.

Acids change the color of certain acid-base indicators. Two common indicators are litmus and phenolphthalein. Blue litmus turns red in the presence of an acid, while phenolphthalein turns colorless.

Acids react with active metals to yield hydrogen gas. Recall that an activity series is a list of metals in descending order of reactivity. Metals that are above hydrogen in the activity series will replace the hydrogen from an acid in a single-replacement reaction, as shown below:

text{Zn}(s)+text{H}_2text{SO}_4(aq)rightarrow text{ZnSO}_4(aq)+text{H}_2(g)

Acids react with bases to produce a salt compound and water. When equal moles of an acid and a base are combined, the acid is neutralized by the base. The products of this reaction are an ionic compound, which is labeled as a salt, and water.

[10/31, 6:00 PM] Jana Taher: Bases have properties that mostly contrast with those of acids.

Aqueous solutions of bases are also electrolytes. Bases can be either strong or weak, just as acids can.

Bases often have a bitter taste and are found in foods less frequently than acids. Many bases, like soaps, are slippery to the touch.

Bases also change the color of indicators. Litmus turns blue in the presence of a base while phenolphthalein turns pink.

Bases do not react with metals in the way that acids do.

Bases react with acids to produce a salt and water.

Please note that tasting chemicals and touching them are NOT good lab practices and should be avoided in other words, don’t do this at home.

When a cracker dissolves in your mouth, is that physical or chemical change?

Answers

When a cracker dissolves in your mouth, then this is a chemical change. A chemical reactions is an atomic rearrangement-based chemical process.

What is chemical change?

An alteration of one or more compounds as one or maybe more new and distinct substances is referred to as a chemical change or chemical reaction. In other terms, a chemical reactions is an atomic rearrangement-based chemical process.

A chemical change normally cannot be reversed unless through additional chemical processes, although a physical change may frequently be done so. The power of the system changes when a chemical shift takes place. When a cracker dissolves in your mouth, then this is a chemical change.

Therefore, when a cracker dissolves in your mouth, then this is a chemical change.

To learn more about chemical change, here:

https://brainly.com/question/29760166

#SPJ1

A) Which statement best summarizes the way the sun produces energy? (1 point)

Combustion reactions in the sun release large amounts of chemical energy.

Fusion reactions in the sun release large amounts of chemical energy.

Combustion reactions in the sun convert small amounts of matter into large amounts of energy.

Fusion reactions in the sun convert small amounts of matter into large amounts of energy.

Answers

Answer:

1. The combined number of protons and neutrons remains constant.

2. There are two atoms with mass numbers of 2.

3. It is the number of protons plus neutrons.

4. A nucleus with a greater mass than any of the reactants will be produced.

5. Fusion reactions in the sun convert small amounts of matter into large amounts of energy.

Explanation: I couldn't see the comments so I guess some ppl can't either but here you go got them all correct! :)

Th sun produces energy through fusion reaction by converting small amount of matter into larger amounts of energy.

Nuclear fusion in the sun

The sun is able to produce energy because protons of hydrogen atoms present in the sun collide violently in the sun's core and fuse together leading to the formation helium atom.

This process of fussion is referred to as a PP (proton-proton) chain reaction, and it emits an enormous amount of energy

Learn more about Fussion at https://brainly.com/question/638069

ANSWER QUICK!!!! GIVING BRAINIEST!!!

ANSWER QUICK!!!! GIVING BRAINIEST!!!

Answers

Answer:

B.

Explanation:

Can you give me brainliest? i need to rank up

Answer:

2nd One is correct

True or False:
Carbon forms an incredible variety of substances
because it has eight valence electrons making it a
very stable atom that readily bonds.

Answers

Answer:

true i think but dont take my word for it.✌

According to the electronic configuration, carbon has 4 valence electrons that makes it a very stable atom that readily bonds.

What is electronic configuration?

Electronic configuration is defined as the distribution of electrons which are present in an atom or molecule in atomic or molecular orbitals.It describes how each electron moves independently in an orbital.

Knowledge of electronic configuration is necessary for understanding the structure of periodic table.It helps in understanding the chemical properties of elements.

Elements undergo chemical reactions in order to achieve stability. Main group elements obey the octet rule in their electronic configuration while the transition elements follow the 18 electron rule. Noble elements have valence shell complete in ground state and hence are said to be stable.

Learn more about electronic configuration,here:

https://brainly.com/question/29757010

#SPJ2

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Calculate the pH and percent ionization of a HC2H3O2 solution with a concentration of 0.500 M. (Ka = 1.8 x10-5)

Answers

Answer:

I can not see the file

Explanation:

R = 0.821 ( atm Calculate the pressure in a 212 L tank containing 584 moles of Argon gas at 25℃? (Answer = 67.3 atm)

Answers

Answer:

67.3 atm

Explanation:

We'll begin by converting 25 ℃ to Kelvin temperature. This can be obtained as follow:

T(K) = T(℃) + 273

T(℃) = 25 ℃

T(K) = 25 + 273

T(K) = 298 K

Finally, we shall determine the pressure. This can be obtained by using the ideal gas equation as illustrated below:

Gas constant (R) = 0.821 atm.L/Kmol

Volume (V) = 212 L

Number of mole (n) = 584 moles

Temperature (T) = 298 K

Pressure (P) =?

PV = nRT

P × 212 = 584 × 0.0821 × 298

P × 212 = 14288.0272

Divide both side by 212

P = 14288.0272 / 212

P = 67.3 atm

Thus, the pressure is 67.3 atm

Through what basic mechanism is 2-methylcyclohexanol converted to 1-bromo-1-methylcyclohexane when treated with HBr

Answers

Answer:

Sn1 mechanism reaction

Explanation:

In this case, we have to start with the protonation of the "OH" group by the attack of the lone pairs in the alcohol group to the "H" in the HBr producing a positive charge in the oxygen. Then, water is produced and a carbocation is generated. This carbocation can be stabilized by a hydride shift. We can move a hydrogen atom to the positive charge and we will obtain a tertiary carbocation. Finally, the \(Br^- \) will attack to produce the final halide.

See figure 1.

I hope it helps!

Through what basic mechanism is 2-methylcyclohexanol converted to 1-bromo-1-methylcyclohexane when treated

whats the energy in joules of one mole of photons of visible light having a wavelength of 4.11×10^2 nm?​

Answers

The energy in joules of one mole of photons of visible light having a wavelength of 4.11×10^2 nm? can be expressed as 2.9*10^5 J

How can the energy be calculated?

From the question we were told to find the energy and the parameters that is needed to calculate these are;

c=3*10^8

h= 6.626 * 10^-34 J.s

1 mol photons = 6.023x10^23 photon

λ = 4.11×10^2 nm  = 4.11 × 10-7 meters

The parameters can be input  as Energy of one mole photon (E) = ( 6.023x10^23 * 6.626 * 10^-34 * 3*10^8)/ (4.11 × 10^-7)

=291302

=2.9*10^5 J

Learn more about energy at:

https://brainly.com/question/13881533

#SPJ1

Below is a symbol block from the periodic table. What does the number 6 indicate?

Answers

Answer:

Carbon And the number of protons

How many moles are in 33 grams of Boron (B)?

Answers

Answer:

2.77495 moles

Explanation:

Boron= 10.811g (according to periodic table)

\(33g*\frac{1mole}{10.811g B}=2.774951 moles B\)

Nome: Lesson 10.04 Emergency Preparedness Plan Rubric Emergency Preparedness Plan Rubric Emergency Preparedness Plan Rubric Criteria • I can design a family preparedness plan for natural I can define a simple design reflecting a need or a want that includes specified criteria and Can I apply what I learned? * I can generate and compare multiple possible solutions to a problem based on how each meets the criteria and constraints Dote: Almost Always ^ 22 Almost Always 8-10 points Almost Always 8-10 points Sometimes Sometimes 5-7 points Sometimes 5-7 points Still Learning ☆ Still Learning 0-4 points Still Learning 0-4 points​

Answers

A possible rubric for an Emergency Preparedness Plan is given below.

How to illustrate the emergency plan

The Criteria will be:

Identification of potential risks and hazards - the plan should identify the types of emergencies that could happen in the community or area, such as natural disasters (hurricanes, floods, earthquakes), power outages, or human-caused incidents (fires, explosions, terrorism).

Communication plan - the plan should include ways to stay informed and communicate with family members, neighbors, and emergency services during an emergency. This could include designated meeting places, communication methods (cell phones, two-way radios), and contact information for emergency services.

Emergency supplies - the plan should include a list of necessary emergency supplies, such as food, water, first aid kits, flashlights, batteries, and blankets, and how to obtain them.

Evacuation plan - the plan should include routes and methods for evacuation, such as cars, buses, or on foot, as well as a designated meeting place for family members.

Family emergency contacts - the plan should include a list of emergency contacts, such as close relatives, friends, and neighbors, who can help during an emergency.

Learn more about emergency on;

https://brainly.com/question/3238467

#SPJ1

matter can undergo chemical reactions and nuclear reactions. which properly is conserved in nuclear reactions?​

Answers

Answer:change in number of atoms

Explanation:AP3X

The law of partial pressures was developed by ___________.

Answers

Answer:

John Dalton

Explanation:

What is the percent of C in Ca(C2H3O2)2?
(Ca = 40.08 g/mol, C = 12.01 g/mol, H= 1.01 g/mol, O= 16.00 g/mol)
[?]% C

Answers

The percent by mass of the carbon is 30.4%.

What is the percentage of calcium?

The term percentage has to do with the ratio of the mass of a particular atom to the total mass of the compound multiplied by one hundred. Thus the first step is to find the total mass or the molar mass of the compound.

Molar mass = 40 + 2(2(12) + 3(1) + 2(16))

= 40 + 2(24 + 3 + 32)

= 40 + 2(59)

= 40 +118

= 158

Thus the mass of carbon is;

4(12)/158 * 100/1

= 30.4%

Thus carbon is only about 30.4% by mass of the compound.

Learn more about percent by mass:https://brainly.com/question/5394922

#SPJ1

The reaction of 192g of Fe2O3 with 82.5g of CO produces 72.9 of Fe Fe2O3 + 3CO => 2Fe + 3CO2 Calculate the theoretical yield of iron in grams.

Answers

ANSWER

The theoretical yield of Fe is 109.64 grams

EXPLANATION

Given that;

The mass of Fe2O3 is 192 grams

The mass of CO is 82.5 grams

Follow the steps below to find the theoretical yield of Iron

Steps 1; Find the number of moles of Fe2O3 and CO using the below formula

\(\text{ mole = }\frac{\text{ mass}}{\text{ molar mass}}\)

Recall, that the molar mass of Fe2O3 and CO are 159.69 g/mol and 28.01 g/mol

\(\begin{gathered} \text{ For Fe}_2O_3 \\ \text{ mole = }\frac{\text{ 192}}{\text{ 159.69}} \\ \text{ mole = 1.202 moles} \\ \\ \text{ For CO} \\ \text{ mole = }\frac{\text{ 82.5}}{\text{ 28.01}} \\ \text{ mole = 2.945 moles} \end{gathered}\)

Step 2; Determine the limiting raectant of the reaction

To determine the limiting reactant, divide the number of moles by the co-efficient of each reactant

\(\begin{gathered} \text{ For Fe}_2O_3 \\ \text{ mol/wt of Fe}_2O_3\text{ = }\frac{\text{ 1.201 }}{\text{ 1}} \\ \text{ mol/wt of Fe}_2O_3\text{ = 1.202 mol} \\ \\ \text{ for CO} \\ \text{ mol/wt of CO = }\frac{\text{ 2.945}}{\text{ 3}} \\ \text{ mol/wt of CO = 0.982 mol} \end{gathered}\)

From the calculations, the limiting reactant of the reaction is CO

Step 3; Find the number of moles of Fe using a stoichiometry ratio

Let x represents the number of moles of Fe

\(\begin{gathered} \text{ 3 moles CO }\rightarrow\text{ 2 moles Fe} \\ \text{ 2.945 moles CO }\rightarrow\text{ x moles Fe} \\ \text{ cross multiply} \\ \text{ 3 moles CO}\times\text{ x moles Fe = 2 moles Fe }\times\text{ 2.945 moles CO} \\ \text{ x moles Fe = }\frac{\text{ 2 moles Fe}\times2.945mole\cancel{CO}}{3moles\cancel{CO}} \\ \\ \text{ x mole Fe = }\frac{\text{ 2 }\times\text{ 2.945}}{\text{ 3}} \\ \\ \text{ x mole Fe = }\frac{\text{ 5.89}}{\text{ 3}} \\ \text{ x mole Fe = 1.963} \end{gathered}\)

The number of moles of Fe is 1.963 moles

Step 4; Find the theoretical yield of Fe

\(\begin{gathered} \text{ mole = }\frac{\text{ mass}}{\text{ molar mass}} \\ \text{ cross multiply} \\ \text{ mass = mole }\times\text{ molar mass} \end{gathered}\)

Recall, molar mass of Fe is 55.845 g/mol

\(\begin{gathered} \text{ mass = 1.963 }\times\text{ 55.845} \\ \text{ mass = 109.64 grams} \end{gathered}\)

Therefore, the theoretical yield of Fe is 109.64 grams

Other Questions
describe hydrophobic interactions, the conditions under which they occur, and the probable influence they have on protein structure. what pro football hall of famer, known for making the iconic "immaculate reception," died this week at age 72? Bethesda Mining is a midsized coal mining company with 20 mines located in Ohio, Pennsylvania, West Virginia, and Kentucky. The company operates deep mines as well as strip mines. Most of the coal mined is sold under contract, with excess production sold on the spot market.The coal mining industry, especially high-sulfur coal operations such as Bethesda, has been hard-hit by environmental regulations. Recently, however, a combination of increased demand for coal and new pollution reduction technologies has led to an improved market demand for high-sulfur coal. Bethesda has just been approached by Mid-Ohio Electric Company with a request to supply coal for its electric generators for the next four years. Bethesda Mining does not have enough excess capacity at its existing mines to guarantee the contract. The company is considering opening a strip mine in Ohio on 5,000 acres of land purchased 10 years ago for $5.4 million. Based on a recent appraisal, the company feels it could receive $7.3 million on an after-tax basis if it sold the land today.Strip mining is a process where the layers of topsoil above a coal vein are removed and the exposed coal is removed. Some time ago, the company would simply remove the coal and leave the land in an unusable condition. Changes in mining regulations now force a company to reclaim the land; that is, when the mining is completed, the land must be restored to near its original condition. The land can then be used for other purposes. As they are currently operating at full capacity, Bethesda will need to purchase additional equipment, which will cost $43 million. The equipment will be depreciated on a seven-year MACRS schedule. The contract only runs for four years. At that time the coal from the site will be entirely mined. The company feels that the equipment can be sold for 60 percent of its initial purchase price. However, Bethesda plans to open another strip mine at that time and will use the equipment at the new mine.The contract calls for the delivery of 500,000 tons of coal per year at a price of $60 per ton. Bethesda Mining feels that coal production will be 750,000 tons, 810,000 tons, 830,000 tons, and 720,000 tons, respectively, over the next four years. The excess production will be sold in the spot market at an average of $48 per ton, Variable costs amount to $21 per ton and fixed costs are $3.7 million per year. The mine will require a net working capital investment of 5 percent of sales. The net working capital ("NWC") will be built up in the year prior to the sales.Bethesda will be responsible for reclaiming the land at termination of the mining. This will occur in Year 5. The company uses an outside company for reclamation of all the companys strip mines. It is estimated the cost of reclamation will be $3.9 million. After the land is reclaimed, the company plans to donate the land to the state for use as a public park and recreation area as a condition to receive the necessary mining permits. This will occur in Year 5 and result in a charitable expense deduction of $7.3 million. Bethesda faces a 38 percent tax rate and has a 12 percent required return on new strip mine projects. Assume a loss in any year will result in a tax credit.You have been approached by the president of the company with a request to analyze the project. Calculate the payback period, profitability index, net present value, and internal rate of return for the new strip mine. Should Bethesda Mining take the contract and open the mine?Required:To analyze this project, we must calculate the incremental cash flows generated by the project. Since net working capital is built up ahead of sales, the initial cash flow depends in part on this cash outflow. Therefore you need to begin your analysis by calculating your sales forecast. Prepare the sales forecast How does the structure of the news story help inform the reader about the sequence of events? 60-10x = when x= 0 pls answer Use the Terms & Names list to identify each sentence online or on your own paper.A. Thomas JeffersonB. John MarshallC. Meriwether LewisD. John ClarkE. SacagaweaF. Zebulon PikeG. impressmentH. judicial reviewI. Oliver Hazard PerryJ. Judiciary Act of 1801K. Embargo Act of 1807L. Louisiana PurchaseThis forbade U.S. ships from sailing to foreign ports. Which one of the following terms is used to describe a loan wherein each payment is equal in amount and includes both interest and principal 2) What is an atom? Name and give the charges of the three particles inside the atom. given that y varies inversly as x^3 where y= 9 and x=2.A) find the equation relating x and y ?B) find x where y=27 PLEASE HELP ME (STAMP ACT) (Sourcing) Who wrote this, and what is his job? Does he side with England or with the colonists? How do you know? (1 point) Use the ratio test to find the radius of convergence of the power series 4!22 1 + 2x + (2!) 6!23 + + (3!)2 8!4 (4!) + 10!5 (59)2 = R | (If the radius is infinite, enter Inf for R.) Is running when getting chased an instinct? why did inventors and sailors develop better tools for navigation? Is it possible to have an iron-carbon alloy for which the mass fractions of total ferrite and proeutectoid cementite are 0.846 and 0.049, respectively? Why or why not? Four elements are shown as they appear in the periodic table 21 SC 44.956 Scandium 22 24 V Cr 47.867 50.942 51.996 Titanium Vanadium Chromium Which statement makes an accurate comparison of some of these elements? An atom of scandium contains two more protons than an atom of vanadium. B An atom of chromium contains seven more protons than an atom of scandium. An atom of titanium has fewer protons than an atom of vanadium but more protons than an atom of scandium. An atom of chromium contains four more protons than an atom of scandium but only two more prot than an atom of titanium. HELP PLEASE BENCHMARKS PLEASE In order to prevent accidental needle stick injury and potential exposure to infectious agents, what should you do with needles and needle-containing devices? _________________ focuses on whether someone focuses on present facts or future possibilities. The volume of this cone is 36 cubic units. What is the volume of a cylinder that has the same base area and the same height? Water freezes at 32 F and boils at 212 F.How many degrees must the temperature go up from freezing to boiling?OA. 100 FB. 98 FOC 244 FOD. 180 FE 80 F What was the significance of the northwest ordinance of 1787