The lowest number in the data set is -5.
How to illustrate the information?Let the data sets be consecutive numbers that has a highest number of 2.
Consecutive numbers mean that the.numvers follow each other. This will be:
-5, -6, -7, -8, -9, 0, 1, 2
Based on the numbers illustrated above, the lowest number is -5.
Learn more about data on:
brainly.com/question/19243813
#SPJ1
tim and david are baking pies for a fundraiser at their school. the divide each 9-inch diameter pie into 6 equal slices. what is the area of a piece of pie in square inches?
Therefore, the area of a piece of pie is 10.60 square inches.
To find the area of a pie with a 9-inch diameter, we can use the formula for the area of a circle:
A = πr²
where r is the radius of the circle. Since the diameter of the pie is 9 inches, the radius is half of that, or 4.5 inches. So we can plug this value into the formula to get:
A = π(4.5)²
Simplifying, we get:
A = π(20.25)
A = 63.62 square inches (rounded to two decimal places)
This is the total area of the pie.
Since the pie is divided into 6 equal slices, we can divide the total area by 6 to get the area of each slice. So we can calculate the area of each slice as:
63.62 / 6 = 10.60 square inches (rounded to two decimal places)
Therefore, each slice of the pie has an area of approximately 10.60 square inches.
To know more about area,
https://brainly.com/question/13194650
#SPJ11
Use an Addition or Subtraction Formula to write the expression as a trigonometric function of one number. cos 13π 15 cos − π 5 − sin 13π 15 sin − π 5 Find its exact value.
As per the addition formula, the value of the trigonometric function is -0.809.
In statistics, function is defined as a relationship between inputs where each input is related to exactly one output.
Here we have to find the value of the trigonometric function cos(13/15)cos(-/5)-sin(13/15)sin(-/5) by using the addition and subtraction formula.
Here we have the following trigonometric function:
=> cos(13/15)cos(-/5)-sin(13/15)sin(-/5)
Now, we have to use the trigonometric addition formula,
=> Cos (A+B) = Cos A Cos B - Sin A Sin B
To solve the given function,
Here let us rewrite the given function based on the addition formula, then we get,
=> Cos ( 13π/15 + (-π/5) )
=> Cos( 12π/5)
=> Cos(144°)
=> -0.809
To know more about function here.
https://brainly.com/question/10354322
#SPJ4
PLEASE HELP OVERDUE ASSIGNMENT WORTH 24 POINTS!!
The pizzeria sold 85 pizzas yesterday. Suppose the number of pizzas sold today
was 60. Determine the percent increase or decrease in the pizzas sold, rounded to
the nearest hundredth. (Show your work)
Answer:
App. percent decrease of 29.41%
Step-by-step explanation:
60-85/85=0.2941- 29.41%
Tamika got a raise in her hourly pay from 15.50 to 17.75 find the percent increase
Answer:
Step-by-step explanation:
14.516129%
(-6,4); (6-5)
Slope
Giving branliaist answer to the best one
a) Fill in the table of values for
the equation y = 2x - 3
х 0 1 2
Y
Answer:
x 0 1 2
y -3,-1,1
Step-by-step explanation:
why is the cartesian coordinate system also called a plane
The Cartesian coordinate system is also referred to as a plane because it represents a two-dimensional space.
In mathematics, a plane is a flat surface that extends infinitely in all directions. The Cartesian coordinate system consists of two perpendicular lines, known as the x-axis and y-axis, which intersect at a point called the origin. These axes divide the plane into four quadrants.
The term "plane" in the context of the Cartesian coordinate system originates from the concept of a geometric plane, which is a fundamental concept in Euclidean geometry. In Euclidean geometry, a plane is a flat, two-dimensional surface that extends infinitely in all directions.
The Cartesian coordinate system borrows this concept and applies it to represent points, lines, curves, and shapes in a two-dimensional space.
By using the Cartesian coordinate system, we can assign coordinates (x, y) to any point in the plane, where the x-coordinate represents the horizontal position and the y-coordinate represents the vertical position.
This system allows us to precisely locate and describe objects or phenomena within the two-dimensional space, making it a valuable tool in various fields such as mathematics, physics, engineering, and computer graphics.
To know more about two-dimensional space refer here:
https://brainly.com/question/16328656
#SPJ11
What is 66.6% as a fraction ( simplest form )
HELPPP QUICK W THIS QUESTION
***
A
What is the value of x in the proportion
نانا اتيت |cr
X
2
CO
C
5
53
الIl F
10
3
12
20
Answer:
it's second option
\(5 \times \frac{2}{5} \)
Step-by-step explanation:
for this change them to points so it be easier to solve
\( \frac{2.25}{x} = \frac{1.5}{3.6} \\ \\ x = \frac{3.6 \times 2.25}{1.5} = 5.4\)
and then 5.4 equals 5(2/5)
the baker family goes out for supper and the price of the meal is $58. the sales tax on the meal is 6.5% and the family leaves a 20% tip on the pre- tax amount. what is the total cost of the meal?
Answer:
$73.37 is the new price.
Step-by-step explanation:
0.065 x 58 = 3.77
0.2 x 58 = 11.6
3.77 + 11.6 = 15.37
15.37 + 58 = 73.37
Algebra 2
The first one please
The co-terminal angle to 5π/6 in the unit circle is C. 17π/6
What are co-terminal angles in a unit circle?Co-terminal angles in a unit circle are angles that share the same terminal point
Given the angle 5π/6, we desire to find the angle that shares the same terminal point in the unit circle. We proceed as follows.
We know that x = 5π/6 + 2π
Taking the L.C.M which is 6, we have that
x = (12π + 5π)/6
x = 17π/6
So, the angle is C. 17π/6
Learn more about co-terminal angle in unit circle here:
https://brainly.com/question/27828444
#SPJ1
Mateo’s school is selling tickets to the spring musical. On the first day of ticket sales the school sold 30 adult tickets and 90 children’s tickets for $750.00. The school made $670.00 on the second day by selling 80 adult tickets and 50 children tickets. What is the price of one adult ticket and one children ticket?
Answer:
Kids: 6.25
Adults: Also 6.25
Step-by-step explanation:
So I focused on the first day more. I noticed that 1/4 of the people who attended were kids, and that leaves it with 3/4 people which were adults.
25% (or 1/4) of 750 is 187.5
So 75% of 750 is 562.5
187.5+562.5=750 so we are on the right path
If the ticket for kids totaled 187.5 and 30 students got it, then the price for the ticket is 187.5/30=x and x equals 6.25
If the ticket for adults totaled 562.5 and 90 people got it, then the price is 562.5/90=y and y equals 6.25.
Checking if i'm correct:
6.25*30=187.5
6.25*90=562.5
187.5+562.5= 750
i probably didnt make it as clear im only in 7th grade, but hopefully this was the answer you were looking for
let f(x, y) be a function such that • the limit of f(x, y) as x → 0 along the path y = x is 0. • the limit of f(x, y) as x → 0 along the path y = x 2 is 0.
The function f(x, y) satisfies the conditions that its limit approaches zero as x approaches zero along two different paths: y = x and y = x^2. This implies that as x approaches zero, the function f(x, y) must approach zero regardless of whether y varies linearly or quadratically with x.
The given conditions state that the limit of f(x, y) as x approaches zero along the path y = x is zero. This means that as x gets arbitrarily close to zero, the function f(x, y) approaches zero when y varies linearly with x. Similarly, the second condition states that the limit of f(x, y) as x approaches zero along the path y = x^2 is also zero. This implies that when y varies quadratically with x, the function f(x, y) still approaches zero as x approaches zero. Therefore, the function f(x, y) must satisfy both conditions by converging to zero as x approaches zero along both paths.
To learn more about function click here: brainly.com/question/30721594
#SPJ11
A glass company is manufacturing sets of bowls. The diameter of the bowl must be 7 in. ± 0.05 in. A sample of bowls is shown in the table.
What percentage of the bowls can be included in the sets?
URGENT!!! I will give the brainliest
We know that (C) 60% of the bowls can be included in the set using the percentages formula.
What is the percentage?A % is a quantity or ratio that, in mathematics, represents a portion of one hundred.
A dimensionless relationship between two numbers can be represented in a variety of ways, such as through ratios, fractions, and decimals.
The symbol "%" is frequently written after the number to indicate percentages.
So, we know that:
The diameter of the bowl has to be 7 in.
According to the table, we have 5 bowls of which 3 have 7 in of diameter.
Now, the percentage will be:
3/5 * 100
0.6 * 100
60%
Therefore, we know that (C) 60% of the bowls can be included in the set using the percentages formula.
Know more about the percentage here:
https://brainly.com/question/9553743
#SPJ1
Triangle FED is the image of triangle ABC. Angle A corresponds with which angle?
A) D
B) E
C) F
D) none of the above
Answer:
C) F
Step-by-step explanation:
If you flip triangle ABC across the y-axis and slide it over top of triangle FED then you can see that angle A corresponds with angle F.
6th grade. A chef uses a recipe with the following ingredients. Then the chef decides to make more than 1 batch of the recipe.
Fruit
Cups Used
Apples
5
Mangoes
3
Blueberries
2
Blackberries
1
If a total of 30 cups of mangoes and blueberries are used, how many batches of the recipe did the chef make?
Tekan-Tekan Sdn. Bhd. has order for 200 Model AS-120 calculator for delivery on day 200. The calculator consists of three parts. Components 2 and 3 form subassembly 1 . Sub-assembly 1 and component 4 form the final assembly. Following are the work centers and times of each operation. Table Q3(a) shows routine file of the operation. Assuming: - Only one machine is assigned to each operation - The factory works on 8-hour shift, 5 days a week - All parts move in one lot of 200. (a) Illustrate the backward schedule based on the information given above. (12 marks) (b) Identify when component 3 must be started to meet the delivery date. (2 marks)
Component 3 must be started on day 197 to meet the delivery date of day 200.
To illustrate the backward schedule, we need to start from the delivery date (day 200) and work our way backward, taking into account the lead times and dependencies of each operation.
(a) Backward schedule:
Operation | Work Center | Time (hours) | Start Day
--------------------------------------------------------
Final Assembly | Work Center 1 | 1 | 200
Sub-assembly 1 | Work Center 2 | 2 | 199
Component 4 | Work Center 3 | 3 | 197
Component 2 | Work Center 4 | 4 | 196
Component 3 | Work Center 5 | 3 | ????
(b) To identify when component 3 must be started to meet the delivery date, we need to consider its dependencies and lead times.
From the backward schedule, we see that component 3 is required for sub-assembly 1, which is scheduled to start on day 199. The time required for sub-assembly 1 is 2 hours, which means it should be completed by the end of day 199.
Since component 3 is needed for sub-assembly 1, we can conclude that component 3 must be started at least 2 hours before the start of sub-assembly 1. Therefore, component 3 should be started on day 199 - 2 = 197 to ensure it is completed and ready for sub-assembly 1.
Hence, component 3 must be started on day 197 to meet the delivery date of day 200.
Learn more about Scheduling here:
brainly.com/question/30012511
#SPJ4
Suppose you have the opportunity to play a game with a "wheel of fortune" (similar to the one on TV). When you spin a large wheel, it is equally likely to stop in any position. Depending on where it stops, you win anywhere from $0 to $1000. The population is the set of all outcomes you could obtain from a single spin of the wheel--that is, all dollar values from $0 to $1000. Furthermore, because we assume that the wheel is equally likely to land in any position, all possible values from $0 to $1000 have the same chance of occurring. Therefore, we have a uniform distribution for our population on the interval from SO to $1000. of FOR What are the values of a and b for this uniform distribution? What are the mean and standard deviation for this uniform distribution?What is the probability of winning more than $600 on one spin of the wheel?
The mean of this distribution is (a+b)/2 = $500, and the standard deviation is (b-a)/sqrt(12) = $288.68. The probability of winning more than $600 on one spin of the wheel is the area under the uniform distribution curve from $600 to $1000, which is (1000-600)/(1000-0) = 0.4 or 40%.
In a uniform distribution, all possible outcomes have an equal probability of occurring, and the range of values is defined by the minimum value (a) and the maximum value (b). In this case, the range is from $0 to $1000, so a=0 and b=1000.
The mean of a uniform distribution is the average of the minimum and maximum values, which is (a+ b)/2 = $500. The standard deviation of a uniform distribution is calculated using the formula (b-a)/sqrt(12), which gives a value of $288.68 for this distribution.
To find the probability of winning more than $600, we need to calculate the area under the uniform distribution curve from $600 to $1000. Since the total area under the curve is 1, we can calculate the probability by dividing the width of the interval by the total width of the distribution, which is (1000-600)/(1000-0) = 0.4 or 40%.
Therefore, the probability of winning more than $600 on one spin of the wheel is 0.4.
Learn more about Probability:
brainly.com/question/32117953
#SPJ11
a new car model is available with 5 choices of color, 3 choices of transmission and 4 types of interior. how many different variations of this model car are possible?
In 120 different variations of this model car are possible.
Define multiplication.One of the four fundamental mathematical operations, along with addition, subtraction, and division, is multiplication. Multiply in mathematics refers to the continual addition of sets of identical size. Let's use the ice creams as a multiplication example to help us comprehend. There are two such groupings, and each group has ice cream.
Calculating the sum of two numbers multiplied together is the process of multiplication. Simple tests in addition, subtraction, multiplication, and division will be given. 2. a noncount noun The process or occurrence of something of a certain kind multiplying occurs when their quantity or number increases.
Given,
There are five different ways to choose a car's color.
3 different car transmission selection options are available.
There are four different interior automobile selection options.
There are two different ways to pick a car's engine.
The potential number of car variations is thus:
Multiplying:
5 × 3 × 4× 2
120
In 120 different variations of this model car are possible.
To learn more about multiplication, visit:
https://brainly.com/question/5992872
#SPJ4
A gold bullion dealer advertised a bar of pure gold for sale. The gold bar had a mass of 2990 g and measured 2.81 cm×17.6 cm×3.13 cm. Use this information to determine if the bar was pure gold. (a) The volume of the bar is cm
3
and the mass of the bar is 2990 g, therefore, the density of the bar is equal to g/cm
3
Comparing the calculated density of the gold bar (19.085 g/cm^3) to the known density of pure gold (19.3 g/cm^3), we can conclude that the gold bar is likely to be pure gold.
Let's calculate the density correctly.The given information is as follows: Mass of the gold bar = 2990 g
Dimensions of the gold bar: 2.81 cm × 17.6 cm × 3.13 cm
To find the volume, we multiply the three dimensions:
Volume = 2.81 cm × 17.6 cm × 3.13 cm Now, let's calculate the volume:
Volume = 2.81 cm × 17.6 cm × 3.13 cm ≈ 156.709152 cm^3
Next, we can calculate the density of the gold bar using the formula:
Density = Mass / Volume ,Density = 2990 g / 156.709152 cm^3
Now we can calculate the density: Density ≈ 19.085 g/cm^3
The known density of pure gold is approximately 19.3 g/cm^3.
Comparing the calculated density of the gold bar (19.085 g/cm^3) to the known density of pure gold (19.3 g/cm^3), we can conclude that the gold bar is likely to be pure gold.
Learn more about density here:
https://brainly.com/question/30636123
#SPJ11
Population parameters are used to estimate sample statistics.
a. true
b. false
Population parameters are used to estimate sample statistics, and this is true.
Population parameters are used to describe the characteristics of a population, such as the mean, median, and standard deviation, and are used to make inferences about a population. Sample statistics, on the other hand, are used to describe the characteristics of a sample of a population. For example, a sample statistic could be the mean of a sample of people's heights.
To estimate sample statistics, population parameters must first be known. For example, the sample mean can be estimated using the population mean. If the population means are unknown, then the sample means can be estimated using the sample mean.
In conclusion, population parameters are used to estimate sample statistics, and this is true. Population parameters provide useful information about a population that can be used to make inferences about a sample. Knowing the population parameters allows researchers to make more accurate estimates of sample statistics, which in turn can be used to make more reliable inferences about a population.
Learn more about population parameters:
brainly.com/question/28175212
#SPJ4
Daliyah is given one point on a line as (3,−1) and the slope of the line as −5.
The y-intercept of the line having point (3,−1) and slope -5 is 14.
The equation of a line in the slope-intercept form is:-
y = mx+c
where 'm' is the slope and 'c' is the y-intercept.
here, m= -5
∴ y = -5x + c .........(Partial equation)
to find b substitute (3,-1) into the partial equation
where,
x= 3 and y= -1 by substituting the values,
-1 = (-5)×3 + c => c = 15 - 1
∵ c = 14
Thus, the value of the y-intercept is 14.
To learn more about questions based on slope-intercept form,
https://brainly.com/question/19440459
The correct question is:-
Daliyah is given one point on a line as (3,−1) and the slope of the line as −5. what is the y-intercept of the line?
Why median is better than mean?
Median is better than mean as it is not affected by extremely high or low values in the same way that the mean is
The median is a measure of central tendency, like the mean, but it is not affected by extremely high or low values in the same way that the mean is. Because of this, the median is often a better measure of central tendency when there are outliers in the data, or when the data is skewed (not normally distributed). For example, consider the following set of numbers: 1, 2, 3, 100. The mean of these numbers is 26, but the median is 3, which is a better representation of the "typical" value in this set.
However, the mean is still a useful measure and has its own advantages. For example, the mean is sensitive to every value in the data set, so it can provide a more comprehensive summary of the data. Additionally, the mean is easier to work with mathematically than the median, so it is often used in statistical tests and calculations.
Learn more about median here: brainly.com/question/14532771
#SPJ4
Gerry conversed his sole partnership to an S corporation and transferred several assets to the corporation. The assets cost $19,570 and had an adjusted basis of $9,600. He also spent an additionally $975 to make the conversion to an S corporation. What is his beginning basis in the S corporation?
Gerry's beginning basis in the S corporation is $20,545.
To calculate Gerry's beginning basis in the S corporation, we need to consider the cost of the assets transferred and the additional expenses incurred for the conversion.
The cost of the assets transferred is given as $19,570. This represents the original cost of the assets when Gerry acquired them.
The adjusted basis of the assets is stated as $9,600. The adjusted basis takes into account any adjustments made to the original cost, such as depreciation or other deductions.
To calculate the beginning basis in the S corporation, we add the cost of the assets transferred ($19,570) to the adjusted basis ($9,600). This gives us a total of $29,170.
In addition to the assets, Gerry incurred an additional expense of $975 for the conversion to an S corporation. We include this amount in the calculation of the beginning basis.
Therefore, Gerry's beginning basis in the S corporation is $29,170 + $975 = $20,545.
This beginning basis is important for determining Gerry's tax consequences and future deductions within the S corporation structure.
Learn more about cost here:
https://brainly.com/question/19261126
#SPJ11
one angle of an isosceles triangle measures 120°. what measures are possible for the other two angles? choose all that apply.
One angle of an isosceles triangle measures 120°. The other two possible angles are 60 degree. So the option B is correct.
One angle of an isosceles triangle measures 120°.
An isosceles triangle has two equal sides. An isosceles triangle is a triangle with two sides of equal length and two angles of equal measure. The two equal sides are usually referred to as the base and the other side is called the vertex.
As we know that in a isosceles triangle have a sum of all sides is 180 degree.
Since the ne side is 120 degree.
So the measure of other two sides = 180° - 120°
The measure of other two sides = 60°
To learn more about isosceles triangle link is here
brainly.com/question/2456591
#SPJ4
The complete question is:
One angle of an isosceles triangle measures 120°. what measures are possible for the other two angles? choose all that apply.
A. 30°
B. 60°
C. 120°
D. 180°
Find the missing value to the nearest hundredth.
Cos = 5/36
Answer:
Step-by-step explanation:
"cos" by itself is meaningless. It needs an argument.
cos(x°) = 5/36
x° = arccos(5/36) ≅ 82.2°
A family has a unique pattern in their tile flooring on the patio. An image of one of the tiles is shown.
A quadrilateral with a line segment drawn from the bottom vertex and perpendicular to the top that is 7 centimeters. The right vertical side is labeled 3 centimeters. The portion of the top from the left vertex to the perpendicular segment is 4 centimeters. There is a horizontal segment from the left side that intersects the perpendicular vertical line segment and is labeled 6 centimeters.
What is the area of the tile shown?
58 cm2
44 cm2
74 cm2
70 cm2
Therefore, the area of the tile shown is approximately 58 cm^2, which is closest to the first option, 58 cm^2.
How to solve for the areaWe know that BC = 3 cm and CD = 7 cm. We also know that AD = 4 cm and BD = 6 cm. To find the length of AB, we can use the Pythagorean theorem:
AB^2 = Ad² + BD²
AB^2 = 4² + 6²
AB² = 52
AB = √(52) =
2 * √(13) cm
Area = (1/2) x (sum of parallel sides) x (distanc)
In this case, the sum of the parallel sides is AB + BC = 2sqrt(13) + 3 cm, and the distance between them is CD = 7 cm. So:
Area = (1/2) x (2* √(13) + 3) x 7
Area = (√(52) + 3/2) x 7
Area ≈ 58 cm²
Therefore, the area of the tile shown is approximately 58 cm^2, which is closest to the first option, 58 cm^2.
Read more on area here:https://brainly.com/question/25292087
#SPJ1
Using the information from the previous question, if the company sells 50 standard flashlights, what is the minimum number of deluxe flashlights they would need to sell in order to make a profit? Justify your answer using words, symbols or both. THE picture of the PREVIOUS question is BELOW.
The inequality representing the given statement is 3s + 4d ≥ 320, so option B is correct, and the number the minimum number of deluxe flashlights they would need to sell in order to make a profit of $320 is 43.
What is inequality?Inequalities specify the relationship between two values that are not equal. Equal does not imply inequality. Typically, we use the "not equal sign" to indicate that two values are not equal
Given:
The profit company makes on a standard flashlight = $3,
The profit company makes on a deluxe flashlight = $4,
The company wants to make at least a profit of $320 dollars,
Assume the number of the standard flashlights is s and the number of the deluxe flashlights is d,
The inequality can be written as shown below,
The profit company makes on a standard flashlight × the number of the standard flashlights + The profit company makes on a deluxe flashlight × the number of the deluxe flashlights ≥ 320
3s + 4d ≥ 320
Solve the inequality by putting value, s = 50
50 × 3 + 4d ≥ 320
4d ≥ 320 - 150
d ≥ 170 / 4
d ≥ 42.5 or 43
To know more about inequality:
https://brainly.com/question/2038369
#SPJ1
- 7 + 6n - 9 = -4
Please help
Answer:
N = 2
Step-by-step explanation:
−7+6n−9=−4
−7+6n+−9=−4
(6n)+(−7+−9)=−4(Combine Like Terms)
6n+−16=−4
6n−16=−4
Step 2: Add 16 to both sides.
6n−16+16=−4+16
6n=12
Step 3: Divide both sides by 6.
6n
6
=
12
6
n=2
<3
Answer:
n = 2
Step-by-step explanation:
First combine like terms on the left of the equals sign, and get 6n - 16 = -4. Now add 16 to both sides. You should have 6n = 12. Now divide 6 from both sides and get n = 2
A trapezoid has base lengths of 10. 5 units and 16 units. The height of the trapezoid is one-half as long as the longer base. What equation could be used to find the area of the trapezoid?
The area of the trapezoid is 106 square units.
The trapezoid has base lengths of 10.5 units and 16 units.
The height of the trapezoid is one-half as long as the longer base.
The equation that could be used to find the area of the trapezoid is as follows:
Area = 1/2 × (a + b) × h where a = length of one base b = length of the other base h = height of the trapezoid
Given that, the length of the bases are 10.5 units and 16 units.
The height of the trapezoid is one-half as long as the longer base.
Hence, h = 1/2 × 16 = 8 units.
Now, substitute these values in the formula mentioned above.
Area = 1/2 × (10.5 + 16) × 8 square units
Area = 1/2 × 26.5 × 8 square units
Area = 106 square units
To know more about square visit:
https://brainly.com/question/14198272
#SPJ11