A 2135 ml sample of N₂ has a pressure of 95.4KPa at 135°C. What is the volume of the sample if temperature is
increased to 223°C and the pressure is kept constant?
B. 2595 ml
A. 913 ml
C. .3484 ml
D. 900 ml

Answers

Answer 1

Answer:

The correct answer is C: 3484 ml


Related Questions

Balance the following reaction:
K3PO4 (aq) +
_Ca(OH)2 (aq) →
_Ca3(PO4)2 (s) +
KOH (aq)

Answers

Answer:

3 Ca(OH)2 + 2 K3PO4 ---> Ca3(PO4)2 + 6 KOH

Explanation:

Just balance each atom on both sides.

Consider the reaction
2NO(g) + O2(g) = 2NO2(g)
Suppose that at a particular moment during the reaction nitric oxide
(NO) is reacting at the rate of 0.066 M/s. (a) At what rate is NO2
being formed? (b) At what rate is molecular oxygen reacting?

Answers

Answer:

(a) Rate of formation of NO2 is also 0.066M/s

(b) Rate of reaction of O2 gas is 0.033M/s

Explanation:

(a) in one second, according to the equation,

2 moles of NO combines with 2moles of NO2.

Therefore 0.066M NO will still consume 0.066mole NO2.

(b) According to the equation,

2 moles NO consumes 1 mole O2, 0.0666M will consume 0.0333 mole O2

Question 1 of 10 What is the maximum number of electrons that can occupy one orbital?
A. 6
B. 8
C. 2
D. 1​

Answers

Answer:

C. 2

Explanation:

Is a "wave function that describes properties characteristic of no more than two electrons in the vicinity of an atomic nucleus or of a system of nuclei as in a molecule."

(ASAP) (FOOD SCIENCE) how does the addition of starches provide structure to a food product

Answers

Answer: In addition to building texture, starches are used to contribute stability to food products. This often takes the form of holding water. As previously mentioned, gelatinized starch molecules tend to reassociate with one another.

how can we get propanal from acetone​

Answers

To convert acetone (propanone) to propanal, you can use a two-step process involving reduction and oxidation reactions. Here's a general outline of the process:

1. Reduction of Acetone to Isopropanol:

First, you need to reduce acetone to isopropanol (2-propanol) using a reducing agent. Common reducing agents for this step include sodium borohydride (NaBH₄) or lithium aluminum hydride (LiAlH₄).

Reaction conditions:

- Acetone + NaBH₄ (or LiAlH₄) → Isopropanol

- Solvent: usually an alcohol (e.g., methanol or ethanol) or an ether (e.g., THF)

- Temperature: room temperature or slightly above

2. Oxidation of Isopropanol to Propanal:

Next, oxidize isopropanol to propanal using an appropriate oxidizing agent. A common oxidizing agent for this step is pyridinium chlorochromate (PCC), which selectively oxidizes primary alcohols to aldehydes without over-oxidizing to carboxylic acids.

Reaction conditions:

- Isopropanol + PCC → Propanal

- Solvent: an aprotic polar solvent (e.g., dichloromethane)

- Temperature: room temperature

- Avoid strong oxidizing agents like potassium permanganate (KMnO₄) or chromium trioxide (CrO₃) because they can over-oxidize the isopropanol to propionic acid.

What happens when sodium and sulfur combine?
A) each sodium atom gains one electron
B) each sulfur atom loses one electron
C) each sodium atom loses one electron
D) each sulfur atom gains one electron

Answers

Answer:

BBBBBBBB ITS B

Explanation:

Calculate the energy and wavelength of a photon with a frequency of 11.23 * 10^13 Hz

Answers

The wavelength and the energy would be2.67 × 10⁻⁴ meters and 7.02998 × 10 ⁻²⁰ Joules and respectively if the photon has a frequency of 11.23 × 10¹³ Hz.

What is Wavelength?

It can be understood in terms of the distance between any two similar successive points across any wave.

C = λν

As given in the problem we have to calculate the energy and the wavelength of a photon with a frequency of 11.23 × 10¹³ Hz.

The wavelength of the photon = 3 × 10 ⁸ / 11.23 × 10¹³ Hz.

                                                   = 2.67 × 10⁻⁴  meter

The energy of the photon of light = h × ν

                                                       = 6.26 × 10⁻³⁴ × 11.23 × 10¹³ Hz.

                                                      = 7.02998 × 10 ⁻²⁰ Joules

Thus, the wavelength and the energy would be 2.67 × 10⁻⁴  meter and  7.02998 × 10 ⁻²⁰ Joules and respectively if the photon has a frequency of 1.1 × 10¹⁷ Hz.

To learn more about wavelength, refer to the link given below ;

brainly.com/question/7143261

#SPJ1

What is the problems in contact process (sulphuric acids)

Answers

The problems in contact process are Catalyst Deactivation, Corrosion, Environmental Impact and Safety Concerns.

Explain the problems faced in contact process?

The Contact Process is a widely-used method for producing sulfuric acid, which is one of the most important industrial chemicals. However, there are several problems associated with the Contact Process:

(1) Catalyst Deactivation: The Contact Process requires the use of a catalyst, typically vanadium pentoxide (V₂O₅), to increase the rate of the reaction. However, over time the catalyst can become deactivated due to impurities in the reactants or the formation of a coating on the catalyst surface. This can reduce the efficiency of the process and require expensive catalyst replacement.

(2) Corrosion: The reaction between sulfur dioxide (SO₂) and oxygen (O₂) to form sulfur trioxide (SO₃) is highly exothermic and produces heat, which can cause corrosion of the reaction vessel and associated equipment. This can lead to leaks, failures, and other safety hazards.

(3) Environmental Impact: The Contact Process produces large quantities of sulfur dioxide, which is a major contributor to acid rain and other environmental problems. In addition, the process consumes large amounts of energy and produces greenhouse gases, contributing to climate change.

(4) Safety Concerns: The Contact Process involves the handling of hazardous materials, including sulfur dioxide, sulfur trioxide, and sulfuric acid. These materials can pose significant health and safety risks to workers and the surrounding environment if not handled properly.

Learn more about catalyst here:

https://brainly.com/question/24430084

#SPJ9

24. which is the correct iupac name for the following

24. which is the correct iupac name for the following

Answers

24. The IUPAC name of the compound is 2,4-dimethyl-1-pentanal (Option B)

25. The IUPAC name of the compound is 5-methyl-3-octanone (Option C)

How do I obtain the IUPAC name?

The international union of pure and applied chemistry (IUPAC) standard for naming organic compounds is given below:

Locate the longest continuous carbon chain.Identify the functional group. Identify the substituent groups attached to the compound.Give the substituents groups the lowest count by considering the functional group.Combine the above to get the name of the compound.

24. The name of the compound is given as follow:

The longest continuous carbon chain is 5 i.e pentaneThe functional group is alkanal (aldehyde). Thus, the parent name will be pentanalThe substituent group attached is methylThere are two methyl groups located at carbon 2, and 4

Thus, the IUPAC name of the compound is:

2,4-dimethyl-1-pentanal (Option B)

25. The name of the compound is given as follow:

The longest continuous carbon chain is 8 i.e octaneThe functional group is alkanone (ketone). Thus, the parent name will be octanoneThe substituent group attached is methyl and it is located at carbon 5

Thus, the IUPAC name of the compound is:

5-methyl-3-octanone (Option C)

Learn more about IUPAC naming:

https://brainly.com/question/16180944

#SPJ1

How is the mitochondria organelle much like an engine

Answers

The mitochondrion organelle is much like an engine because it powers the cell just like the engine powers a system.

Functions of the mitochondrion

The mitochondrion is one of the double membrane-bound organelles in the eukaryotic cell. It primarily functions as the cell's powerhouse by generating the energy necessary for metabolic reactions.

Oxidative respiration happens within the mitochondrion and energy in the form of ATP is generated for the use of the cell. This function is comparable to the engine of a vehicle which helps generate the necessary energy to drive the vehicle forward.

More on the mitochondrion can be found here: https://brainly.com/question/17091391

#SPJ1

in an investigation that uses the scientific method which step immediately follows asking a question

Answers

Answer:

Infer and form a hypothesis

Enter the complementary strand of this DNA strand. Give your answer as a string.

Enter the complementary strand of this DNA strand. Give your answer as a string.

Answers

Answer:

atagcca

Explanation:

t goes with a, and c goes with g

atagcca matches with

ta tcggt

Identify the activated complex in the following reaction.

a. CuFeSO
b. FeFe
c. FeCuSO4
d. FeSO4

Identify the activated complex in the following reaction. a. CuFeSOb. FeFec. FeCuSO4d. FeSO4

Answers

The activated complex in the following reaction is: FeCuSO4. The activated complex is a transition state that is an intermediate structure in a chemical reaction. Option C)

An activated complex is a structure that exists temporarily during a chemical reaction and corresponds to the top of the energy barrier that must be overcome for the reaction to proceed to completion.

The activated complex in the following reaction is: FeCuSO4. The activated complex is a transition state that is an intermediate structure in a chemical reaction. It is the structure with the greatest energy within the reaction process and is used to determine the rate at which the reaction occurs. An activated complex exists when the energy required to break the old bonds and form new ones has been absorbed. It has a specific configuration and energy content that is precisely defined.

A chemical reaction is the process by which atoms or groups of atoms in molecules interact to form new molecules. A chemical reaction is caused by the motion of electrons, which are negatively charged particles that surround atomic nuclei. The reaction proceeds through the formation of an intermediate species known as the transition state or activated complex. Reaction mechanisms are the sequence of steps involved in a chemical reaction. These steps describe the intermediate species formed as the reactants are converted to products. Hence option C) is correct.

for more questions on reaction

https://brainly.com/question/25769000

#SPJ8

how do one get this solution
-log10 (2* 10^-2)​

Answers

The result of the computation when you follow the steps is 1.699.

What is logarithm?

A logarithm is a mathematical function that represents the exponent or power to which a specific base must be raised to obtain a given number. In simpler terms, it answers the question: "To what power must we raise a base number to obtain a certain value?"

What you should do is that on your calculator, you could press the logarithm key and then put in the value that has been shown and then the result would be displayed on your calculator.

Learn more about logarithm:https://brainly.com/question/30226560

#SPJ1

How many grams of AuCl3 contain 5.0 x 1023 molecules?

Answers

Answer:

approximately 251.55 grams of AuCl3 would contain 5.0 x 10^23 molecules.

How many amino acids can be coded for with 33 bases on a DNA strand?

Answers

Answer:

660 amino acids.

Explanation:

There is 20 amino acids for one base. So you multiply 33x20 to give you 660.

Answer:

Assuming that the DNA strand is read in sets of three nucleotides (codons), then 33 bases would allow for a maximum of 11 codons to be read.

Each codon codes for one amino acid, so 11 codons would allow for the coding of a maximum of 11 amino acids.

Explanation:

If an object is traveling 400m/s, how long in hours will it take to reach 950.5km?

Answers

Answer:

Let's find out time using musically to we not less X elation times T um Sylvia 120 kilometer are and be known to get 70-kilometer bar are jobless acceleration. Relax. The relation is six housing kilometers where R squared times D and solving 40 t is equal to one divided by 120 hours which is equal to 32nd. Let's find a distance traveled using s is equal to a snot. Let's be not times de lis. How 50 square off 80 Um, A. Sees the exploration of car Times T's were no, that's like in numbers. So a distance is equal to 70 uh, kilometer, but are into one divided by 120 hard is less, one divided by two into x elation of God. It is a 6000-kilometer bar are square, are in duty square will t swear. He's one divided by 120 holes where so t is equal to 0.79 kilometers

Explanation:

Find the SDS for regular bleach

Answers

The Safety Data Sheet (SDS) for regular bleach can be obtained from the manufacturer or supplier of the specific brand or product. It contains important information regarding the hazardous properties, handling, storage, and emergency procedures related to the bleach.

An SDS typically includes details such as the product's chemical composition, physical and chemical properties, potential hazards to health and the environment, precautionary measures for safe handling and storage, first-aid procedures, and information about proper disposal. It also provides guidance on personal protective equipment (PPE) to be used when handling the product and steps to take in case of accidental release or exposure.

The SDS serves as a crucial resource for understanding the potential risks associated with the use of regular bleach and helps ensure that appropriate safety measures are implemented. It is important to review and follow the information provided in the SDS to minimize the risk of accidents, injuries, or adverse health effects associated with the use of the product.

for such more questions on product

https://brainly.com/question/30667391

#SPJ8

Which type of electromagnetic wave has the greatest wavelength?(1 point)

microwaves
microwaves

infrared light
infrared light

X-rays
X-rays

visible light

Answers

x-rays have the greatest wavelength too :)

The type of electromagnetic wave that has the greatest wavelength is Microwaves. Thus, the correct option is A.

What is an Electromagnetic wave?

An electromagnetic wave may be defined as a type of wave that is disseminated by simultaneous periodic variations of electric and magnetic field intensity. It includes radio waves, infrared, visible light, ultraviolet, X-rays, and gamma rays.

In electromagnetic waves, the higher the energy, the lower the wavelength, while the higher the wavelength, the lower the energy.

Among the option given above, microwaves have the greatest wavelength, which means that it has lower energy as well as frequency. The X-rays have shorter wavelengths but higher energy as well as frequency.

Therefore, the type of electromagnetic wave that has the greatest wavelength is X-rays. Thus, the correct option is A.

To learn more about Electromagnetic waves, refer to the link:

https://brainly.com/question/13874687

#SPJ2

What is The fmu (grams/mole) for disulfur hexachloride *the formula for it is S2Cl6*

Answers

Hexasulfur Dichloride

Name: Hexasulfur Dichloride

Formula: S2Cl6

Molar Mass:276.848

Example Reactions:

• S2Cl6 + 4H2O = 2SO2 + 6HCl + H2

Explain how a rainbow is produced

Answers

A rainbow is produced through a proces that includes refraction, reflection, and dispersion of  sunlight.

What more should you know about the production of rainbows?

A rainbow is formed when sulinght is refracted and reflected by rain drops in the atmospher.

The sunlight is split into its component colors, which is why rainbows appear as having an array of colors. This is due to each color being bent by a different amount during refraction.

The colors of a rainbow are always in the same order, with red on the outside and violet on the inside.

Find more exercises on rainbows;

https://brainly.com/question/7965811

#SPJ1

HOW ww STON 4 (November 2015) own gas, Xx(g), is sealed in a container and allowed to form Xaigi at 300 C The action am according to the following balanced equation: 3Xlg) = 2Xg) How will the rate of formation of Xa(g) compare to the rate of formation of Xus)* Write down only HIGHER THAN, LOWER THAN or EQUAL TO eaction mixture is analysed at regular time intervals. The results obtained are shown the below TIME [X₂] [X] of Hubig) produced? Fully explain the 0 2 4 6 8 10 0.22 0.08 0,06 0.06 0.06 0.120 0213 0.228 0.226 0.226 Calculate the equilibrium constant, K., for this reaction at 300 °C. (Answer 236.46) More X:(g) is now added to the container. 4.3.1 How will this change affect the amount of Xzig)? Write down INCREASES, DECREASES or REMAINS THE SAME. 4.3.2 Use Le Chatelier's principle to explain the answer to QUESTION 4.3.1. ​

Answers

According to Le Chatelier's principle, the system will respond by shifting the reaction in the forward direction to counteract the increase in X:(g) concentration

Based on the given data, we can observe that the concentration of Xa(g) remains constant throughout the time intervals, while the concentration of Xus)* decreases. This implies that the rate of formation of Xa(g) is higher than the rate of formation of Xus)*.

To calculate the equilibrium constant (K) for the reaction, we can use the equation: K = ([Xa(g)]^2)/([Xus)*]^3. Using the data at equilibrium, we have K = (0.228^2)/(0.06^3) = 236.46.

When more X:(g) is added to the container, the amount of Xa(g) will increase. Therefore, the amount of Xa(g) will INCREASE.

This can be explained using Le Chatelier's principle. By adding more X:(g), the equilibrium of the reaction is disturbed. . As a result, more Xa(g) will be formed to establish a new equilibrium, leading to an increase in the amount of Xa(g).

For more such questions on principle

https://brainly.com/question/7413269

#SPJ11

The following two organic compounds are structural isomers to each other. Carefully identify and justify the structural isomers type (skeletal, functional, or positional) with their common molecular formula

The following two organic compounds are structural isomers to each other. Carefully identify and justify

Answers

Structural isomers are molecules with the same molecular formula but with different structural formulae. This means that they have the same number and types of atoms, but they are arranged differently. The following two organic compounds are structural isomers of each other.

Carefully identify and justify the structural isomers type (skeletal, functional, or positional) with their common molecular formula.Common molecular formula: C6H14Structural isomers:(i) Hexane: Hexane is a straight-chain alkane with six carbon atoms and no double bonds or rings. The carbon atoms are linked together in a linear or straight-chain configuration in the skeletal isomer. The skeletal isomer differs in terms of the arrangement of atoms in its molecule. This indicates that it is a skeletal isomer.(ii) 2-methylpentane: It is a branched-chain alkane with six carbon atoms and no double bonds or rings. It differs from the first molecule in terms of the location of a methyl group on the second carbon of the five-carbon chain, rather than a straight six-carbon chain. This difference is due to a change in the positioning of the carbon atoms in the molecule. As a result, it is a positional isomer, as it differs by the position of the functional group or substituent. Therefore, the skeletal and positional isomerism types are present between these two compounds.

For such more question on  molecular

https://brainly.com/question/24191825

#SPJ8

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Polyethylene is 86.0% C and 14.0%
H. Determine the empirical formula of the compound.
Percent to Mass: How many grams of C/and Hare present in 100.0 g?

Answers

The empirical formula of polyethylene can be determined by converting the given percentages of carbon (C) and hydrogen (H) into grams. To find the grams of each element, we assume a 100.0 g sample of polyethylene.

For carbon:

Mass of carbon = 86.0% × 100.0 g = 86.0 g

For hydrogen:

Mass of hydrogen = 14.0% × 100.0 g = 14.0 g

Therefore, in a 100.0 g sample of polyethylene, there are 86.0 grams of carbon and 14.0 grams of hydrogen.

The empirical formula of a compound represents the simplest whole-number ratio of atoms present in the compound. To determine the empirical formula, we need to find the ratio of carbon to hydrogen in terms of moles.

First, we convert the masses of carbon and hydrogen into moles using their respective molar masses. The molar mass of carbon is approximately 12.01 g/mol, and the molar mass of hydrogen is approximately 1.008 g/mol.

Number of moles of carbon = 86.0 g / 12.01 g/mol ≈ 7.162 mol

Number of moles of hydrogen = 14.0 g / 1.008 g/mol ≈ 13.89 mol

Next, we divide the number of moles of each element by the smallest number of moles to get a simplified ratio.

Carbon: Hydrogen ≈ 7.162 mol : 13.89 mol ≈ 1 : 1.939

Since we want to express the ratio in whole numbers, we multiply both sides by 2 to get a whole number ratio.

Carbon: Hydrogen ≈ 2 : 3.878

Rounding to the nearest whole number, we find that the empirical formula of polyethylene is CH₂.

for such more questions on hydrogen

https://brainly.com/question/24433860

#SPJ8

. How many moles of oxygen (O) are in 1 mole of calcium carbonate (CaCO3)?

Answers

In 1 mole of calcium carbonate, there are approximately 18.066 x 10^23 moles of oxygen.

To determine the number of moles of oxygen (O) in 1 mole of calcium carbonate (CaCO3), we need to examine the chemical formula of calcium carbonate and identify the number of oxygen atoms present.

The chemical formula of calcium carbonate is CaCO3. In this formula, we have one calcium atom (Ca), one carbon atom (C), and three oxygen atoms (O).

The subscript numbers in the formula indicate the number of atoms for each element. Therefore, we have:

1 calcium atom (Ca)

1 carbon atom (C)

3 oxygen atoms (O)

To calculate the number of moles of oxygen in 1 mole of calcium carbonate, we multiply the number of oxygen atoms (3) by the Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.

Number of moles of oxygen (O) in 1 mole of calcium carbonate (CaCO3) = 3 moles of oxygen x (6.022 x 10^23 molecules/mol)

Calculating this value, we find:

Number of moles of oxygen (O) in 1 mole of calcium carbonate (CaCO3) ≈ 18.066 x 10^23 moles of oxygen

for more such questions on calcium

https://brainly.com/question/12216405

#SPJ8

Part A
How many moles of water are needed to react with 1.7 moles of Li, O?
Given: Li2O + H202LiOH
1.7
0.85
3.4
1.5
none of the above

Answers

Answer:1.7

Explanation:

Starting with 0.3500 mol CO(g) and 0.05500 mol COCl2(g) in a 3.050 L flask at 668 K, how many moles of CI2(g) will be present at equilibrium?
CO(g) + Cl2(g)》COCl2(g)
Kc= 1.2 x 10^3 at 668 K

Answers

At equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.

1: Write the balanced chemical equation:

\(C_O\)(g) + \(Cl_2\)(g) ⟶ \(C_OCl_2\)(g)

2: Set up an ICE table to track the changes in moles of the substances involved in the reaction.

Initial:

\(C_O\)(g) = 0.3500 mol

\(Cl_2\)(g) = 0.05500 mol

\(C_OCl_2\)(g) = 0 mol

Change:

\(C_O\)(g) = -x

\(Cl_2\)(g) = -x

\(C_OCl_2\)(g) = +x

Equilibrium:

\(C_O\)(g) = 0.3500 - x mol

\(Cl_2\)(g) = 0.05500 - x mol

\(C_OCl_2\)(g) = x mol

3: Write the expression for the equilibrium constant (Kc) using the concentrations of the species involved:

Kc = [\(C_OCl_2\)(g)] / [\(C_O\)(g)] * [\(Cl_2\)(g)]

4: Substitute the given equilibrium constant (Kc) value into the expression:

1.2 x \(10^3\) = x / (0.3500 - x) * (0.05500 - x)

5: Solve the equation for x. Rearrange the equation to obtain a quadratic equation:

1.2 x \(10^3\) * (0.3500 - x) * (0.05500 - x) = x

6: Simplify and solve the quadratic equation. This can be done by multiplying out the terms, rearranging the equation to standard quadratic form, and then using the quadratic formula.

7: After solving the quadratic equation, you will find two possible values for x. However, since the number of moles cannot be negative, we discard the negative solution.

8: The positive value of x represents the number of moles of \(Cl_2\)(g) at equilibrium. Substitute the value of x into the expression for \(Cl_2\)(g):

\(Cl_2\)(g) = 0.05500 - x

9: Calculate the value of \(Cl_2\)(g) at equilibrium:

\(Cl_2\)(g) = 0.05500 - x

\(Cl_2\)(g) = 0.05500 - (positive value of x)

10: Calculate the final value of \(Cl_2\) (g) at equilibrium to get the answer.

Therefore, at equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.

For more such questions on equilibrium, click on:

https://brainly.com/question/517289

#SPJ8

superficial zone chondrocytes can get compacted under physiological loading: a multiscale finite element analysis.
a. true
b. false

Answers

The statement "Superficial zone chondrocytes can get compacted under physiological loading: a multiscale finite element analysis" is true.

Superficial zone chondrocytes are the most exposed to mechanical loading and are therefore at risk of being compacted under physiological loading. A multiscale finite element analysis can be used to model and predict the mechanical behavior of cartilage under physiological loading, allowing for a better understanding of the factors that affect its mechanical properties.

This means that chondrocytes in the superficial zone of cartilage are at risk of being compacted under the physiological loading that it experiences in everyday life. A multiscale finite element analysis can be used to model and predict the mechanical behavior of cartilage under physiological loading, allowing for a better understanding of the factors that affect its mechanical properties.

Learn more about chondrocytes

https://brainly.com/question/28231704

#SPJ4

B. A beaker containing 250 cm³ of aqueous solution freezes at -2.21°C. The density of the solution is 1.37 grams/cm³. If the solution is 72.1 % by weight water, what is the molecular weight of the solute in the solution?​

Answers

Explanation:

What is biology definition

Other Questions
What can be enabled to prevent a mobile device from being used until a user enters the correct passcode, such as a pin or password? using jquery, build a simple driving simulator, and to make the vehicle move create four buttons for up, down, left, and right movement. use css to the absolute position of the vehicle which of the following statements is true? a.) in a standard normal distribution, the mean is equal to 1 and the standard deviation is equal to 1. b.) in a standard normal distribution, the mean is equal to 1 and the standard deviation is equal to 2. c.) in a standard normal distribution, the mean is equal to 0 and the standard deviation is equal to 1. d.) in a standard normal distribution, the mean is equal to 0 and the standard deviation is equal to 2. Read the sentence and the question on the picture. The _____ give rise to plasma cells, which produce antibodies (immunoglobulins) that work to inactivate invading antigens. Write a paragraph that evaluates Odysseuss qualifications as an epic hero.????? HELP BRO HELO "We are met," Lincoln says in line three, "on a great battlefield of that war." What is the name of that battlefield? aAntietam bHarpers Ferry cManassas dGettysburg Jimmy is selling left over carpet that he originally paid $0.12 per square foot for. If Jimmy sells 120 square feet of this carpet at $0.15 per square foot, how much profit will he make?$3.20$14.40$2.80$18.00$3.60 the threat of terrorism more often __________ the cost of operating a business. Surface area and volume of a 3d cube Instincts are ________learned over timeconditioned responsesplanned ahead of timeinborn responses Whats your favorite song. Mine is therefore I am Which of the following would be determined using managerial accounting reports? a. Manufacturing cost of each item produced b. Earnings per share c. Return on equity d. Working capital for the period The total amount of charge in coulombs that has entered a wire at time is given by the expression Q = 6 t + 2 t^2, where t is in seconds and t greaterthanorequalto 0. Find an expression for the current in the wire at time t. Compared to historical trends, what is different aboutcontemporary climate change?A. Its occurring fasterB. Its a warning trend C. Its affecting plants and animals D.its caused by atmospheric changes Use a formula to express the function.You pay $900 to rent a special area in a restaurant. In addition, you play $30 for each guest. Write a formula that gives your total cost C, in dollars, as a function of the number n of dinner guestsc= Read and understand the situation below, and make a complete plan to solve Mang Joses problem.Mang Jose wants to paint the exterior of his house. He needs to know how many gallons of paint he would need. So, he asks his friend Juan to help him, according to Juan one (1) gallon of paint can cover an area of 250 square feet. Help Mang Jose prepare a budget for his project if his house exterior is 2700 square feet. Do a research on the different prices of one (1) gallon of paint depending on its brand name and choice of colors. Make a proposal budget for three (3) different colors of paint with its corresponding brand name. melanie has been out with friends and using drugs. despite being obviously uncoordinated and under the influence, she wants to drive her car. her condition is an example of: is throwing a paper bag out of the window of a car by saying it is biodegradable? why As cultures meet and influence one another, one way they change each other is by influencing food habits and diets. How did Pacific Island diets change after colonization?